DE1944212C - - Google Patents
Info
- Publication number
- DE1944212C DE1944212C DE19691944212 DE1944212A DE1944212C DE 1944212 C DE1944212 C DE 1944212C DE 19691944212 DE19691944212 DE 19691944212 DE 1944212 A DE1944212 A DE 1944212A DE 1944212 C DE1944212 C DE 1944212C
- Authority
- DE
- Germany
- Prior art keywords
- chlorine
- ethylene
- reaction
- addition
- chloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000005977 Ethylene Substances 0.000 claims description 78
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 77
- 239000000460 chlorine Substances 0.000 claims description 74
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 73
- 229910052801 chlorine Inorganic materials 0.000 claims description 73
- 238000006243 chemical reaction Methods 0.000 claims description 54
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 claims description 26
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 19
- 238000006467 substitution reaction Methods 0.000 claims description 18
- 238000007259 addition reaction Methods 0.000 claims description 16
- 239000007810 chemical reaction solvent Substances 0.000 claims description 13
- QVLAWKAXOMEXPM-UHFFFAOYSA-N 1,1,1,2-tetrachloroethane Chemical compound ClCC(Cl)(Cl)Cl QVLAWKAXOMEXPM-UHFFFAOYSA-N 0.000 claims description 11
- 125000001340 2-chloroethyl group Chemical class [H]C([H])(Cl)C([H])([H])* 0.000 claims description 11
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 11
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 claims description 9
- 239000007858 starting material Substances 0.000 claims description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 238000005660 chlorination reaction Methods 0.000 claims description 6
- 229960003750 ethyl chloride Drugs 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical class CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 claims description 5
- VHHHONWQHHHLTI-UHFFFAOYSA-N hexachloroethane Chemical compound ClC(Cl)(Cl)C(Cl)(Cl)Cl VHHHONWQHHHLTI-UHFFFAOYSA-N 0.000 claims description 5
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 5
- 229910001510 metal chloride Inorganic materials 0.000 claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 238000001704 evaporation Methods 0.000 claims description 4
- 238000002474 experimental method Methods 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 3
- 230000008020 evaporation Effects 0.000 claims description 3
- -1 polyethylene Polymers 0.000 claims description 3
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical class CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 claims description 2
- 230000006866 deterioration Effects 0.000 claims description 2
- 238000011835 investigation Methods 0.000 claims description 2
- 230000001737 promoting effect Effects 0.000 claims description 2
- 238000011144 upstream manufacturing Methods 0.000 claims description 2
- 238000004821 distillation Methods 0.000 claims 4
- 239000002994 raw material Substances 0.000 claims 2
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 claims 1
- 239000004698 Polyethylene Substances 0.000 claims 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical group ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims 1
- 239000002253 acid Substances 0.000 claims 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims 1
- 230000008030 elimination Effects 0.000 claims 1
- 238000003379 elimination reaction Methods 0.000 claims 1
- 230000001771 impaired effect Effects 0.000 claims 1
- 238000012423 maintenance Methods 0.000 claims 1
- 229920000573 polyethylene Polymers 0.000 claims 1
- 238000012545 processing Methods 0.000 claims 1
- 239000012429 reaction media Substances 0.000 claims 1
- 239000002904 solvent Substances 0.000 claims 1
- 238000012549 training Methods 0.000 claims 1
- 239000007789 gas Substances 0.000 description 18
- 239000000047 product Substances 0.000 description 9
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 8
- BNIXVQGCZULYKV-UHFFFAOYSA-N pentachloroethane Chemical compound ClC(Cl)C(Cl)(Cl)Cl BNIXVQGCZULYKV-UHFFFAOYSA-N 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 3
- 229910052573 porcelain Inorganic materials 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- GZETWZZNDACBTQ-UHFFFAOYSA-N [Cl].C=C Chemical group [Cl].C=C GZETWZZNDACBTQ-UHFFFAOYSA-N 0.000 description 2
- 239000012295 chemical reaction liquid Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000005868 electrolysis reaction Methods 0.000 description 2
- 238000005755 formation reaction Methods 0.000 description 2
- 238000005194 fractionation Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- OYASCNUVPRLTQE-UHFFFAOYSA-N ClC(C(Cl)(Cl)Cl)(Cl)Cl.ClCCCl Chemical compound ClC(C(Cl)(Cl)Cl)(Cl)Cl.ClCCCl OYASCNUVPRLTQE-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229960002089 ferrous chloride Drugs 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691944212 DE1944212A1 (de) | 1969-08-30 | 1969-08-30 | Verfahren zur Herstellung von Polychloraethanen |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691944212 DE1944212A1 (de) | 1969-08-30 | 1969-08-30 | Verfahren zur Herstellung von Polychloraethanen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1944212A1 DE1944212A1 (de) | 1971-11-18 |
| DE1944212C true DE1944212C (enExample) | 1973-03-01 |
Family
ID=5744233
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691944212 Granted DE1944212A1 (de) | 1969-08-30 | 1969-08-30 | Verfahren zur Herstellung von Polychloraethanen |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE1944212A1 (enExample) |
-
1969
- 1969-08-30 DE DE19691944212 patent/DE1944212A1/de active Granted
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2739478C2 (enExample) | ||
| DE69413986T2 (de) | Chlorierungsverfahren | |
| DE69515036T2 (de) | Verfahren zur herstellung von difluormethan | |
| DE2631658C2 (de) | Verfahren zur Herstellung von Vinylidenfluorid | |
| DE2263580C2 (de) | Verfahren zur Herstellung von Chloracetylchlorid | |
| DE1953240A1 (de) | Verfahren zur Herstellung von Vinylchlorid | |
| DE2341743B2 (de) | Verfahren zur Herstellung einer Mischung aus Brenzkatechin und Hydrochinon | |
| DE1944212C (enExample) | ||
| DE2614139A1 (de) | Verfahren zur herstellung von alpha, alpha, alpha, alpha', alpha' alpha'hexachlorxylol | |
| DE3618928A1 (de) | Verfahren zur herstellung von (beta)-chlorpivalinsaeurechlorid | |
| DE3504732A1 (de) | Verfahren zur herstellung eines gemisches von phosphornitridchlorid-oligomeren | |
| DE2645030C2 (de) | Verfahren zur Herstellung von Butandiol oder Butendiol | |
| DE1944212B (enExample) | ||
| DE1944212A1 (de) | Verfahren zur Herstellung von Polychloraethanen | |
| DE3139709A1 (de) | Verfahren zur herstellung von acetalhehyd | |
| DE2000424C3 (de) | Verfahren zur Herstellung von 1,1,1 Tnchlorathan enthaltenden polychlorierten Athanen | |
| DE809812C (de) | Verfahren zur Herstellung chlorierter Kohlenwasserstoffe | |
| DE1960064C3 (de) | Verfahren zur Hypochlorierung von Allylchlorid | |
| DE2058520C3 (de) | Substituierte Trifluoräthylmethyläther, Verfahren zu deren Herstellung sowie diese enthaltende inhalationsanästhetische Zusammensetzungen | |
| DE1468807C3 (de) | Verfahren zur kontinuierlichen Herstellung chlorierter Äthylenderivate | |
| DE2135908C3 (de) | Verfahren zur Herstellung von Vinylidenchlorid | |
| DE2050562A1 (de) | Verfahren zur Herstellung von Dichloracetylchlorid | |
| DE1768492C3 (de) | Verfahren zur gleichzeitigen Herstellung von 1,2-Dichloräthan, 1,1,2-Trichloräthan und 1,1,2,2-Tetrachloräthan durch Oxychlorieren von Äthylen | |
| DE1960063A1 (de) | Verfahren zur Herstellung von Allylchlorid | |
| DE1568582C (de) | Verfahren zur Herstellung von Dichlor athan und Tnchlorathan |