DE1939355C3 - - Google Patents
Info
- Publication number
- DE1939355C3 DE1939355C3 DE19691939355 DE1939355A DE1939355C3 DE 1939355 C3 DE1939355 C3 DE 1939355C3 DE 19691939355 DE19691939355 DE 19691939355 DE 1939355 A DE1939355 A DE 1939355A DE 1939355 C3 DE1939355 C3 DE 1939355C3
- Authority
- DE
- Germany
- Prior art keywords
- temperature
- reduction
- water
- yield
- tetrahydroxydiphenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 claims description 14
- 239000007795 chemical reaction product Substances 0.000 claims description 12
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 5
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical class [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 229940079827 sodium hydrogen sulfite Drugs 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 2
- 238000000746 purification Methods 0.000 claims description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Natural products CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 239000003610 charcoal Substances 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 238000007792 addition Methods 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- -1 3,5,5-tribromo-4,6-dioxo-2-cyclohexenylidene Chemical group 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- YHFOGIICKOHRTQ-UHFFFAOYSA-N (2,3,6-tribromo-5-bromooxyphenyl) hypobromite Chemical compound BrOC1=CC(Br)=C(Br)C(OBr)=C1Br YHFOGIICKOHRTQ-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 244000144985 peep Species 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691939355 DE1939355B2 (de) | 1969-08-01 | 1969-08-01 | Verfahren zur herstellung von 3.5.3'.5'-tetrabrom-2.4.2'.4'- tetrahydroxy-diphenyl |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691939355 DE1939355B2 (de) | 1969-08-01 | 1969-08-01 | Verfahren zur herstellung von 3.5.3'.5'-tetrabrom-2.4.2'.4'- tetrahydroxy-diphenyl |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1939355A1 DE1939355A1 (de) | 1971-02-11 |
| DE1939355B2 DE1939355B2 (de) | 1976-02-26 |
| DE1939355C3 true DE1939355C3 (enFirst) | 1976-10-07 |
Family
ID=5741719
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691939355 Granted DE1939355B2 (de) | 1969-08-01 | 1969-08-01 | Verfahren zur herstellung von 3.5.3'.5'-tetrabrom-2.4.2'.4'- tetrahydroxy-diphenyl |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE1939355B2 (enFirst) |
-
1969
- 1969-08-01 DE DE19691939355 patent/DE1939355B2/de active Granted
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1939355C3 (enFirst) | ||
| DE1545930A1 (de) | Verfahren zur Herstellung von Salzen des aminosubstituierten 1.2.4-Dithiazols | |
| DE1939355B2 (de) | Verfahren zur herstellung von 3.5.3'.5'-tetrabrom-2.4.2'.4'- tetrahydroxy-diphenyl | |
| DE2503504C2 (de) | Verfahren zur herstellung von kernjodierten jodverbindungen mit aromatischem charakter | |
| EP0095177B1 (de) | Verfahren zur Herstellung von N-Acetylaminoarylsulfonsäuren | |
| DE1154799B (de) | Verfahren zur Herstellung von 4, 5-Dichlor- und 4, 5-Dibrom-naphthalin-1, 8-dicarbonsaeureanhydrid | |
| CH513789A (de) | Verfahren zur Herstellung von 3,5,3',5'-Tetrabrom-2,4,2',4'-tetrahydroxydiphenyl | |
| DE1804833B2 (de) | Verfahren zur Herstellung von Methallylsulfonsäure und deren Salzen | |
| DE955510C (de) | Verfahren zur Herstellung eines heterocyclischen Chinons | |
| DE3022783A1 (de) | Verfahren zur herstellung von 4-acylamido-2-nitro-1-alkoxybenzol-verbindungen | |
| DE1140193B (de) | Verfahren zur Herstellung von in 3-Stellung substituierten Thiazolidin-2-on-1, 1-dioxyden | |
| DE852693C (de) | Verfahren zur Herstellung von Estern der Alkyliden-bis-thioglykolsaeuren | |
| EP0303733B1 (de) | Verfahren zur Herstellung von Thiophenderivaten und die dabei erhaltenen Zwischenproduke | |
| DE2925359C3 (de) | Verfahren zur Herstellung von Salzen der (-)cis-1,2-Epoxypropylphosphonsäure | |
| DE2316495B2 (de) | Verfahren zur herstellung von 4- hydroxy-3-nitrobenzoesaeure | |
| EP0098445A2 (de) | Verfahren zur Herstellung von 2-Amino-5-nitro-thiazol | |
| DE489571C (de) | Verfahren zur Herstellung von Perinaphthindonen | |
| AT235243B (de) | Verfahren zur Herstellung von festen, Alkali- bzw. Magnesium-bzw.-Ammoniumperoxomonosulfat enthaltenden Produkten | |
| DE1795683C3 (de) | Verfahren zur Herstellung von Dialkalimetallsalzen des Bis-(4-sulfoxyphenyl) - (2-pyridyl) -methane | |
| DE1231691B (de) | Verfahren zur Herstellung von Tetracyclyl-4, 6-epoxyden | |
| DE2542210A1 (de) | Kupfer-ii-salz der 4-chlorphthalsaeure und verfahren zu seiner herstellung | |
| DE1795683A1 (de) | Verfahren zur herstellung von bis(4-sulfoxyphenyl)-(2-phyridyl)-methan bzw. dessen alkalimetallsalzen | |
| CH331516A (de) | Verfahren zur Reinigung von Diphenylolpropan | |
| EP0013395A1 (de) | Verfahren zur Herstellung von 3-Nitro-naphthalin-1,5-disulfonsäure | |
| DE1545690A1 (de) | Neues Verfahren zur Herstellung von Phthalazinen und Phthalazonen |