DE1939143C3 - Verfahren zur Herstellung von 3-Acetoxy-2-methylen-propion-saurealkylestern - Google Patents
Verfahren zur Herstellung von 3-Acetoxy-2-methylen-propion-saurealkylesternInfo
- Publication number
- DE1939143C3 DE1939143C3 DE1939143A DE1939143A DE1939143C3 DE 1939143 C3 DE1939143 C3 DE 1939143C3 DE 1939143 A DE1939143 A DE 1939143A DE 1939143 A DE1939143 A DE 1939143A DE 1939143 C3 DE1939143 C3 DE 1939143C3
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- acetoxy
- metal
- acid alkyl
- alkali
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 33
- 239000003054 catalyst Substances 0.000 claims description 27
- 238000006243 chemical reaction Methods 0.000 claims description 23
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 22
- 239000003513 alkali Substances 0.000 claims description 17
- 229910052751 metal Inorganic materials 0.000 claims description 15
- 239000002184 metal Substances 0.000 claims description 15
- 239000007789 gas Substances 0.000 claims description 14
- 229910052763 palladium Inorganic materials 0.000 claims description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 150000002739 metals Chemical class 0.000 claims description 4
- 238000007792 addition Methods 0.000 claims description 3
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052737 gold Inorganic materials 0.000 claims description 3
- 239000010931 gold Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 230000000737 periodic effect Effects 0.000 claims description 2
- 150000002736 metal compounds Chemical class 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000001569 carbon dioxide Substances 0.000 description 7
- 229910002092 carbon dioxide Inorganic materials 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 150000001242 acetic acid derivatives Chemical class 0.000 description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- -1 Alkyl methacrylate Chemical compound 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002506 iron compounds Chemical class 0.000 description 3
- 239000007791 liquid phase Substances 0.000 description 3
- IMOQCGSCOCUDGV-UHFFFAOYSA-N methyl 2-(acetyloxymethyl)prop-2-enoate Chemical compound COC(=O)C(=C)COC(C)=O IMOQCGSCOCUDGV-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 125000005595 acetylacetonate group Chemical group 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 229910021505 gold(III) hydroxide Inorganic materials 0.000 description 1
- WDZVNNYQBQRJRX-UHFFFAOYSA-K gold(iii) hydroxide Chemical compound O[Au](O)O WDZVNNYQBQRJRX-UHFFFAOYSA-K 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 229940060367 inert ingredients Drugs 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 235000014413 iron hydroxide Nutrition 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- NCNCGGDMXMBVIA-UHFFFAOYSA-L iron(ii) hydroxide Chemical compound [OH-].[OH-].[Fe+2] NCNCGGDMXMBVIA-UHFFFAOYSA-L 0.000 description 1
- 150000003903 lactic acid esters Chemical class 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 150000002830 nitrogen compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- HBEQXAKJSGXAIQ-UHFFFAOYSA-N oxopalladium Chemical compound [Pd]=O HBEQXAKJSGXAIQ-UHFFFAOYSA-N 0.000 description 1
- 150000002941 palladium compounds Chemical class 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 1
- ZVSLRJWQDNRUDU-UHFFFAOYSA-L palladium(2+);propanoate Chemical compound [Pd+2].CCC([O-])=O.CCC([O-])=O ZVSLRJWQDNRUDU-UHFFFAOYSA-L 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- JKDRQYIYVJVOPF-FDGPNNRMSA-L palladium(ii) acetylacetonate Chemical compound [Pd+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O JKDRQYIYVJVOPF-FDGPNNRMSA-L 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 235000013580 sausages Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052566 spinel group Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003899 tartaric acid esters Chemical class 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/66—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
- C07C69/73—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of unsaturated acids
- C07C69/732—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of unsaturated acids of unsaturated hydroxy carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/04—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds
- C07C67/05—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation
- C07C67/055—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation in the presence of platinum group metals or their compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/66—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
- C07C69/73—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of unsaturated acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1939143A DE1939143C3 (de) | 1969-08-01 | 1969-08-01 | Verfahren zur Herstellung von 3-Acetoxy-2-methylen-propion-saurealkylestern |
| CH999870A CH542170A (de) | 1969-08-01 | 1970-07-01 | Verfahren zur Herstellung von 3-Acetoxy-2-methylen-propionsäurealkylestern |
| ZA704637A ZA704637B (en) | 1969-08-01 | 1970-07-06 | A process for the production of 3-acetoxy-2-methylene propionic acid alkyl esters |
| RO63941A RO56788A (cg-RX-API-DMAC10.html) | 1969-08-01 | 1970-07-16 | |
| LU61439D LU61439A1 (cg-RX-API-DMAC10.html) | 1969-08-01 | 1970-07-29 | |
| BE754096D BE754096A (fr) | 1969-08-01 | 1970-07-29 | Procede de preparation d'esters alkyliques de l'acide 3-acetoxy-2-methylene-propionique |
| US00059357A US3734950A (en) | 1969-08-01 | 1970-07-29 | Production of 3-acetoxy-2-methylene propionic acid alkyl esters |
| NL7011239A NL7011239A (cg-RX-API-DMAC10.html) | 1969-08-01 | 1970-07-29 | |
| GB36835/70A GB1263417A (en) | 1969-08-01 | 1970-07-30 | A process for the production of 3-acetoxy-2-methylene propionic acid alkyl esters |
| ES382318A ES382318A1 (es) | 1969-08-01 | 1970-07-30 | Procedimiento para la produccion de esteres alquilicos de acido 3-acetoxi-2-metilen-propionico. |
| SE7010562A SE7010562L (cg-RX-API-DMAC10.html) | 1969-08-01 | 1970-07-31 | |
| FR7028468A FR2057921A5 (cg-RX-API-DMAC10.html) | 1969-08-01 | 1970-07-31 | |
| PL1970142413A PL79786B1 (cg-RX-API-DMAC10.html) | 1969-08-01 | 1970-07-31 | |
| AT697970A AT298434B (de) | 1969-08-01 | 1970-07-31 | Verfahren zur Herstellung von neuen 3-Acetoxy-2-methylen-propionsäurealkylestern |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1939143A DE1939143C3 (de) | 1969-08-01 | 1969-08-01 | Verfahren zur Herstellung von 3-Acetoxy-2-methylen-propion-saurealkylestern |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1939143A1 DE1939143A1 (de) | 1971-02-04 |
| DE1939143B2 DE1939143B2 (de) | 1978-01-19 |
| DE1939143C3 true DE1939143C3 (de) | 1978-09-28 |
Family
ID=5741597
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1939143A Expired DE1939143C3 (de) | 1969-08-01 | 1969-08-01 | Verfahren zur Herstellung von 3-Acetoxy-2-methylen-propion-saurealkylestern |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3734950A (cg-RX-API-DMAC10.html) |
| AT (1) | AT298434B (cg-RX-API-DMAC10.html) |
| BE (1) | BE754096A (cg-RX-API-DMAC10.html) |
| CH (1) | CH542170A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1939143C3 (cg-RX-API-DMAC10.html) |
| ES (1) | ES382318A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2057921A5 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1263417A (cg-RX-API-DMAC10.html) |
| LU (1) | LU61439A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL7011239A (cg-RX-API-DMAC10.html) |
| PL (1) | PL79786B1 (cg-RX-API-DMAC10.html) |
| RO (1) | RO56788A (cg-RX-API-DMAC10.html) |
| SE (1) | SE7010562L (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA704637B (cg-RX-API-DMAC10.html) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2148292A1 (en) * | 1994-05-05 | 1995-11-06 | Barrie W. Jackson | Liquid phase prparation of (meth)-acrylate from alpha-olefin |
| US9107452B2 (en) * | 2003-06-13 | 2015-08-18 | Philip Morris Usa Inc. | Catalyst to reduce carbon monoxide in the mainstream smoke of a cigarette |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2514672A (en) * | 1948-04-21 | 1950-07-11 | Eastman Kodak Co | Alpha-substituted acrylic acid esters and process of preparation |
| US2487849A (en) * | 1948-09-08 | 1949-11-15 | Eastman Kodak Co | Process for preparing enolic esters |
-
1969
- 1969-08-01 DE DE1939143A patent/DE1939143C3/de not_active Expired
-
1970
- 1970-07-01 CH CH999870A patent/CH542170A/de not_active IP Right Cessation
- 1970-07-06 ZA ZA704637A patent/ZA704637B/xx unknown
- 1970-07-16 RO RO63941A patent/RO56788A/ro unknown
- 1970-07-29 BE BE754096D patent/BE754096A/xx unknown
- 1970-07-29 US US00059357A patent/US3734950A/en not_active Expired - Lifetime
- 1970-07-29 NL NL7011239A patent/NL7011239A/xx unknown
- 1970-07-29 LU LU61439D patent/LU61439A1/xx unknown
- 1970-07-30 ES ES382318A patent/ES382318A1/es not_active Expired
- 1970-07-30 GB GB36835/70A patent/GB1263417A/en not_active Expired
- 1970-07-31 PL PL1970142413A patent/PL79786B1/pl unknown
- 1970-07-31 SE SE7010562A patent/SE7010562L/sv unknown
- 1970-07-31 AT AT697970A patent/AT298434B/de not_active IP Right Cessation
- 1970-07-31 FR FR7028468A patent/FR2057921A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH542170A (de) | 1973-09-30 |
| LU61439A1 (cg-RX-API-DMAC10.html) | 1970-10-05 |
| ZA704637B (en) | 1971-04-28 |
| SE7010562L (cg-RX-API-DMAC10.html) | 1971-02-02 |
| RO56788A (cg-RX-API-DMAC10.html) | 1974-08-01 |
| GB1263417A (en) | 1972-02-09 |
| BE754096A (fr) | 1971-01-29 |
| US3734950A (en) | 1973-05-22 |
| DE1939143A1 (de) | 1971-02-04 |
| NL7011239A (cg-RX-API-DMAC10.html) | 1971-02-03 |
| FR2057921A5 (cg-RX-API-DMAC10.html) | 1971-05-21 |
| PL79786B1 (cg-RX-API-DMAC10.html) | 1975-06-30 |
| DE1939143B2 (de) | 1978-01-19 |
| ES382318A1 (es) | 1972-11-16 |
| AT298434B (de) | 1972-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2553761A1 (de) | Verfahren zur katalytischen herstellung von gamma-butyrolacton | |
| DE1911178A1 (de) | Verfahren zur Herstellung von Allylacetat | |
| DE2526381B2 (de) | Verfahren zur Herstellung von Glykolsäure oder deren Gemische mit Diglykolsäure | |
| EP0048946B1 (de) | Verfahren zur Herstellung von ungesättigten Carbonsäureestern | |
| DE1939143C3 (de) | Verfahren zur Herstellung von 3-Acetoxy-2-methylen-propion-saurealkylestern | |
| DE2107913C3 (de) | Verfahren zur Herstellung von Benzylacetat | |
| DE1909964C3 (de) | Verfahren zur Herstellung von 2 Methylen 1,3 diacetoxy propan | |
| DE1904236C3 (de) | Verfahren zur Herstellung von Allyli dendiacetat | |
| JPH01268663A (ja) | モノグリセリドの製造方法 | |
| US2483099A (en) | Esters of polyhydroxy-benzoic acids | |
| DE1901289C3 (de) | Verfahren zur Herstellung vo Allylacetat | |
| DE1793365C3 (de) | Verfahren zur Herstellung von Allylacetat | |
| DE2162826C3 (de) | Verfahren zur Herstellung von Estern der Acryl- bzw. Methacrylsäure ausgehend von Propylen bzw. Isobutylen | |
| DE1942014C3 (de) | Verfahren zur Herstellung von 13-Diacetoxy-2-methylenpropan | |
| DE1905959C3 (de) | Verfahren zur Herstellung von äthylenisch ungesättigten Estern | |
| DE844740C (de) | Verfahren zur Herstellung aliphatischer AEther | |
| DE1668352C3 (de) | Verfahren zur Herstellung ungesättigter Ester von Carbonsäuren | |
| DE1933538B2 (de) | Verfahren zur Herstellung von Allylalkohol | |
| DE1959776C3 (de) | Verfahren zur Herstellung von Propionalde hyd | |
| DE1959780C3 (de) | Verfahren zur Herstellung von Propionaldehyd | |
| DE1933537A1 (de) | Verfahren zur Herstellung von Alkenylacetaten | |
| DE1493375A1 (de) | Verfahren zur Herstellung von Carbonsaeuren | |
| DE2003933A1 (de) | Verfahren zur Herstellung von 1,3-Diacetoxy-2-methylenpropan | |
| DE1793366A1 (de) | Verfahren zur Herstellung von Allylacetat | |
| DE2009742A1 (en) | Allyl alcohol obtained by catalytic - oxidation of propylene |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| EHV | Ceased/renunciation |