DE1936026A1 - Gasisolierte Sammelschienenanlage - Google Patents
Gasisolierte SammelschienenanlageInfo
- Publication number
- DE1936026A1 DE1936026A1 DE19691936026 DE1936026A DE1936026A1 DE 1936026 A1 DE1936026 A1 DE 1936026A1 DE 19691936026 DE19691936026 DE 19691936026 DE 1936026 A DE1936026 A DE 1936026A DE 1936026 A1 DE1936026 A1 DE 1936026A1
- Authority
- DE
- Germany
- Prior art keywords
- gas
- pieces
- tight
- conductor
- conductors
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004020 conductor Substances 0.000 claims description 42
- 241000196324 Embryophyta Species 0.000 claims description 7
- 239000011810 insulating material Substances 0.000 claims description 6
- 230000001154 acute effect Effects 0.000 claims description 3
- 238000009434 installation Methods 0.000 claims description 2
- 238000007789 sealing Methods 0.000 claims 2
- 239000007789 gas Substances 0.000 description 19
- 125000006850 spacer group Chemical group 0.000 description 9
- 210000003127 knee Anatomy 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 239000010959 steel Substances 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229910000881 Cu alloy Inorganic materials 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- -1 polyethylene Polymers 0.000 description 2
- 241000486634 Bena Species 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229910018503 SF6 Inorganic materials 0.000 description 1
- 244000000231 Sesamum indicum Species 0.000 description 1
- 235000003434 Sesamum indicum Nutrition 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- PCHPORCSPXIHLZ-UHFFFAOYSA-N diphenhydramine hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C(OCC[NH+](C)C)C1=CC=CC=C1 PCHPORCSPXIHLZ-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000003566 sealing material Substances 0.000 description 1
- 238000005476 soldering Methods 0.000 description 1
- SFZCNBIFKDRMGX-UHFFFAOYSA-N sulfur hexafluoride Chemical compound FS(F)(F)(F)(F)F SFZCNBIFKDRMGX-UHFFFAOYSA-N 0.000 description 1
- 229960000909 sulfur hexafluoride Drugs 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H02—GENERATION; CONVERSION OR DISTRIBUTION OF ELECTRIC POWER
- H02G—INSTALLATION OF ELECTRIC CABLES OR LINES, OR OF COMBINED OPTICAL AND ELECTRIC CABLES OR LINES
- H02G5/00—Installations of bus-bars
- H02G5/06—Totally-enclosed installations, e.g. in metal casings
- H02G5/063—Totally-enclosed installations, e.g. in metal casings filled with oil or gas
Landscapes
- Chemical & Material Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Installation Of Bus-Bars (AREA)
- Gas-Insulated Switchgears (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3400468 | 1968-07-17 | ||
| GB3400568A GB1209657A (en) | 1968-07-17 | 1968-07-17 | Gas insulated busbar installations |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1936026A1 true DE1936026A1 (de) | 1970-10-22 |
Family
ID=26262118
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691936026 Pending DE1936026A1 (de) | 1968-07-17 | 1969-07-16 | Gasisolierte Sammelschienenanlage |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3585271A (https=) |
| DE (1) | DE1936026A1 (https=) |
| FR (1) | FR2013150A1 (https=) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2518178A1 (de) * | 1975-04-24 | 1976-11-04 | Licentia Gmbh | Metallgekapselte, druckgasisolierte hochspannungsleitung |
| DE19613026C1 (de) * | 1996-03-19 | 1997-10-16 | Siemens Ag | Winkelstück zur Verbindung zweier Abschnitte einer gasisolierten Rohrleiteranlage |
| DE19709845C1 (de) * | 1997-02-28 | 1998-02-26 | Siemens Ag | Verbindungsstück für den Außenleiter einer gasisolierten Rohrleiteranlage |
| DE29707650U1 (de) * | 1997-04-24 | 1998-08-27 | Siemens AG, 80333 München | Innenleiterverbindung für einen Winkelbaustein einer gasisolierten Rohrleiteranlage |
| DE19722854C1 (de) * | 1997-05-23 | 1999-01-21 | Siemens Ag | Verfahren zur Herstellung von als Gußteil ausgebildeten Winkelstücken für den Außenleiter einer gasisolierten Rohrleiteranlage |
| DE19818193A1 (de) * | 1998-04-23 | 1999-10-28 | Asea Brown Boveri | Direkt forciert gekühlte Generatorableitung |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS515482B1 (https=) * | 1970-05-13 | 1976-02-20 | ||
| CH524907A (de) * | 1970-12-03 | 1972-06-30 | Bbc Brown Boveri & Cie | Dreiphasige Hochspannungsleitungsanordnung mit Rohrkapselung |
| US3767837A (en) * | 1972-08-24 | 1973-10-23 | Ite Imperial Corp | High-voltage pressurized gas-insulated power transmission systems |
| US3767840A (en) * | 1972-09-08 | 1973-10-23 | Ite Imperial Corp | Non-metallic corona shield for gas-insulated electrical equipment and the like |
| CH566656A5 (https=) * | 1973-11-21 | 1975-09-15 | Bbc Brown Boveri & Cie | |
| CH579837A5 (https=) * | 1975-01-10 | 1976-09-15 | Bbc Brown Boveri & Cie | |
| US4017675A (en) * | 1975-06-06 | 1977-04-12 | Westinghouse Electric Corporation | Junction box for high voltage gas insulated conductors |
| DE2556768C2 (de) * | 1975-12-17 | 1983-07-14 | Calor-Emag Elektrizitäts-Aktiengesellschaft, 4030 Ratingen | Hochspannungsschaltanlage |
| DE2632808C3 (de) * | 1976-07-21 | 1980-07-03 | Felten & Guilleaume Carlswerk Ag, 5000 Koeln | Leiterverbindung für ein wassergekühltes Hochspannungs-Energiekabel |
| US4123619A (en) * | 1977-07-01 | 1978-10-31 | Westinghouse Electric Corp. | Gas termination support system |
| FR2455378A1 (fr) * | 1979-04-23 | 1980-11-21 | Alsthom Cgee | Jeu de barres de poste a haute tension |
| SE9500294D0 (sv) | 1995-01-26 | 1995-01-26 | Asea Brown Boveri | Förfarande för att anordna ett strömskenesystem och ett strömskenesystem |
| US8173899B2 (en) * | 2009-04-17 | 2012-05-08 | Schneider Electric USA, Inc. | Busway edgewise elbow drain |
| JP4580036B1 (ja) * | 2009-06-12 | 2010-11-10 | 株式会社神戸製鋼所 | バスバーおよびコネクタ |
| JP4781493B1 (ja) * | 2011-02-28 | 2011-09-28 | 三菱電機株式会社 | ガス絶縁母線 |
| FR2984617B1 (fr) * | 2011-12-14 | 2014-11-28 | Alstom Technology Ltd | Coude a angles d'orientation multiples pour lignes a haute tension |
| FR3117611B1 (fr) | 2020-12-14 | 2023-08-04 | Isorg | Filtre angulaire optique |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3125199A (en) * | 1964-03-17 | Thompson | ||
| US2306850A (en) * | 1940-05-03 | 1942-12-29 | Rca Corp | Transmission line |
| US2678428A (en) * | 1949-09-07 | 1954-05-11 | Rca Corp | Coaxial transmission line termination |
| US2992290A (en) * | 1959-11-09 | 1961-07-11 | Gen Electric | Forced-cooled isolated phase bus |
| CH389742A (de) * | 1961-10-20 | 1965-03-31 | Bbc Brown Boveri & Cie | Druckgasisolierte Sammelschienenanlage |
| US3448202A (en) * | 1965-07-26 | 1969-06-03 | Westinghouse Electric Corp | Enclosed electric power transmission conductors |
| US3391243A (en) * | 1965-07-26 | 1968-07-02 | Westinghouse Electric Corp | Enclosed electric power transmission conductor |
| US3361870A (en) * | 1965-07-26 | 1968-01-02 | Westinghouse Electric Corp | Electric power transmission system including three phase conductors each disposed ina separate return conductor |
-
1969
- 1969-07-11 US US840961A patent/US3585271A/en not_active Expired - Lifetime
- 1969-07-16 DE DE19691936026 patent/DE1936026A1/de active Pending
- 1969-07-17 FR FR6924427A patent/FR2013150A1/fr not_active Withdrawn
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2518178A1 (de) * | 1975-04-24 | 1976-11-04 | Licentia Gmbh | Metallgekapselte, druckgasisolierte hochspannungsleitung |
| DE19613026C1 (de) * | 1996-03-19 | 1997-10-16 | Siemens Ag | Winkelstück zur Verbindung zweier Abschnitte einer gasisolierten Rohrleiteranlage |
| DE19709845C1 (de) * | 1997-02-28 | 1998-02-26 | Siemens Ag | Verbindungsstück für den Außenleiter einer gasisolierten Rohrleiteranlage |
| DE29707650U1 (de) * | 1997-04-24 | 1998-08-27 | Siemens AG, 80333 München | Innenleiterverbindung für einen Winkelbaustein einer gasisolierten Rohrleiteranlage |
| DE19722854C1 (de) * | 1997-05-23 | 1999-01-21 | Siemens Ag | Verfahren zur Herstellung von als Gußteil ausgebildeten Winkelstücken für den Außenleiter einer gasisolierten Rohrleiteranlage |
| DE19818193A1 (de) * | 1998-04-23 | 1999-10-28 | Asea Brown Boveri | Direkt forciert gekühlte Generatorableitung |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2013150A1 (https=) | 1970-03-27 |
| US3585271A (en) | 1971-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1936026A1 (de) | Gasisolierte Sammelschienenanlage | |
| DE19926950A1 (de) | Kabelendgarnitur | |
| DE69627139T2 (de) | Verfahren zum anordnen von einem stromsammelschienensystem und ein stromsammelschienensystem | |
| DE60037237T2 (de) | Verbindungssystem zwischen Mittel- oder Hochspannungszellen | |
| DE2431958A1 (de) | Anordnung der staenderstromanschluesse fuer einen turbogenerator grosser leistung | |
| DE2123549C3 (de) | Vorrichtung zum elektrischen Verbinden eines Stromschienensystems mit einem Anlagenbauteil | |
| CH322444A (de) | Metallgekapselte elektrische Hochspannungs-Schaltanlage | |
| DE19603215A1 (de) | Sammelschienensystem | |
| EP1166308B1 (de) | Selbsterholende strombegrenzungseinrichtung mit flüssigmetall | |
| EP0774816A2 (de) | Gasisolierte Leitung | |
| DE2746566B2 (de) | Hochspannungsdurchffihrung zum Anschluß von mit Isolierflüssigkeit gefüllten Transformatoren an SF6 -isolierte Kabel oder Schaltanlagen | |
| DE1765879B2 (de) | Kabelarmatur für ölgefüllte Starkstromkabel | |
| DE10254385B3 (de) | Rohrförmiges Gehäuse einer druckgasisolierten Baugruppe für eine elektrische Anlage | |
| DE60126411T2 (de) | Im Vakuum operierender Hochspannungsstromverbinder | |
| EP3402000B1 (de) | Vorrichtung zur verbindung supraleitender kabel | |
| DE19623723A1 (de) | Gasisolierte Leitung | |
| DE4135390C1 (en) | Current connecting plug for power supply - has rotatable fixing ring on housing allowing connection to housing of cooperating socket | |
| DE3315588A1 (de) | Starkstromkabel | |
| EP1722441B1 (de) | Anordnung zum elektrisch leitenden Verbinden von Schaltfeldem einer Mittelspannungsanlage | |
| DE2518178A1 (de) | Metallgekapselte, druckgasisolierte hochspannungsleitung | |
| DE2514635A1 (de) | Endverschluss fuer hochspannungskabel mit wassergekuehltem leiter zur einfuehrung in metallgekapselte schaltanlagen | |
| EP2403087A1 (de) | Anordnung zum Verbinden von zwei papierisolierten Hochspannungskabeln | |
| DE635799C (de) | Kapazitiver Spannungsteiler | |
| DE3616243A1 (de) | Durchfuehrung, insbesondere fuer hohe spannungen | |
| EP3109961B1 (de) | Leitungsmodul für eine erdverlegbare hochspannungsleitung, hochspannungsleitung mit leitungsmodulen sowie verfahren zur herstellung der leitungsmodule |