DE1925697A1 - Halogenierte Thioaether und Verfahren zu deren Herstellung - Google Patents
Halogenierte Thioaether und Verfahren zu deren HerstellungInfo
- Publication number
- DE1925697A1 DE1925697A1 DE19691925697 DE1925697A DE1925697A1 DE 1925697 A1 DE1925697 A1 DE 1925697A1 DE 19691925697 DE19691925697 DE 19691925697 DE 1925697 A DE1925697 A DE 1925697A DE 1925697 A1 DE1925697 A1 DE 1925697A1
- Authority
- DE
- Germany
- Prior art keywords
- radical
- halogen
- reaction
- carbon atoms
- halogenated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 17
- 150000003568 thioethers Chemical class 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 23
- 150000002367 halogens Chemical group 0.000 claims description 22
- 238000006243 chemical reaction Methods 0.000 claims description 21
- 229910052799 carbon Inorganic materials 0.000 claims description 14
- 239000000460 chlorine Substances 0.000 claims description 14
- 229930195733 hydrocarbon Natural products 0.000 claims description 11
- 239000004215 Carbon black (E152) Substances 0.000 claims description 10
- 150000001721 carbon Chemical group 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 239000004593 Epoxy Substances 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 6
- 239000011593 sulfur Substances 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229930195735 unsaturated hydrocarbon Natural products 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 150000002430 hydrocarbons Chemical class 0.000 claims description 4
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 238000006467 substitution reaction Methods 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000004122 cyclic group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 150000002148 esters Chemical group 0.000 claims description 2
- 150000003510 tertiary aliphatic amines Chemical class 0.000 claims description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 claims 2
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims 1
- 239000003637 basic solution Substances 0.000 claims 1
- 150000002118 epoxides Chemical class 0.000 claims 1
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical group [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 claims 1
- 125000000468 ketone group Chemical group 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 20
- 239000000047 product Substances 0.000 description 17
- -1 hydroxy- Chemical class 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- 238000009835 boiling Methods 0.000 description 12
- 238000003756 stirring Methods 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 238000004821 distillation Methods 0.000 description 6
- 238000000921 elemental analysis Methods 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 5
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- DEWLEGDTCGBNGU-UHFFFAOYSA-N 1,3-dichloropropan-2-ol Chemical compound ClCC(O)CCl DEWLEGDTCGBNGU-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229940008075 allyl sulfide Drugs 0.000 description 3
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 3
- 229940073608 benzyl chloride Drugs 0.000 description 3
- 230000008030 elimination Effects 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- ZZHIDJWUJRKHGX-UHFFFAOYSA-N 1,4-bis(chloromethyl)benzene Chemical compound ClCC1=CC=C(CCl)C=C1 ZZHIDJWUJRKHGX-UHFFFAOYSA-N 0.000 description 2
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000004970 halomethyl group Chemical group 0.000 description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- WXOPUPSGODOWFX-UHFFFAOYSA-N 2-(propylsulfanylmethyl)-7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C(CC)SCC1=C2C(=CC=C1)O2 WXOPUPSGODOWFX-UHFFFAOYSA-N 0.000 description 1
- RVBUZBPJAGZHSQ-UHFFFAOYSA-N 2-chlorobutanoic acid Chemical compound CCC(Cl)C(O)=O RVBUZBPJAGZHSQ-UHFFFAOYSA-N 0.000 description 1
- BCEGZWVVDDHJOU-UHFFFAOYSA-N 3-chloropropylsulfanylmethylbenzene Chemical compound ClCCCSCC1=CC=CC=C1 BCEGZWVVDDHJOU-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000269435 Rana <genus> Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- VEUUMBGHMNQHGO-UHFFFAOYSA-N ethyl chloroacetate Chemical compound CCOC(=O)CCl VEUUMBGHMNQHGO-UHFFFAOYSA-N 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000003944 halohydrins Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 150000002497 iodine compounds Chemical class 0.000 description 1
- 150000002576 ketones Chemical group 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- XNCBIABGXFRJQI-UHFFFAOYSA-N thietan-2-ol Chemical compound OC1CCS1 XNCBIABGXFRJQI-UHFFFAOYSA-N 0.000 description 1
- XSROQCDVUIHRSI-UHFFFAOYSA-N thietane Chemical compound C1CSC1 XSROQCDVUIHRSI-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/14—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/34—Compounds containing oxirane rings with hydrocarbon radicals, substituted by sulphur, selenium or tellurium atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Epoxy Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR152544 | 1968-05-21 | ||
| FR152543 | 1968-05-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1925697A1 true DE1925697A1 (de) | 1969-11-27 |
Family
ID=26182020
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691925697 Pending DE1925697A1 (de) | 1968-05-21 | 1969-05-20 | Halogenierte Thioaether und Verfahren zu deren Herstellung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3673260A (en:Method) |
| BE (1) | BE733292A (en:Method) |
| CH (1) | CH513830A (en:Method) |
| DE (1) | DE1925697A1 (en:Method) |
| GB (1) | GB1276362A (en:Method) |
| LU (1) | LU58674A1 (en:Method) |
| NL (1) | NL6907667A (en:Method) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0193065A1 (de) * | 1985-02-22 | 1986-09-03 | BASF Aktiengesellschaft | Morpholinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TWI574952B (zh) * | 2012-04-16 | 2017-03-21 | Mitsubishi Gas Chemical Co | Preparation of sulfur - containing epoxy compounds |
| CN107207426B (zh) * | 2015-02-13 | 2020-02-14 | 3M创新有限公司 | 耐寒性密封剂及其组分 |
-
1969
- 1969-05-19 GB GB25454/69A patent/GB1276362A/en not_active Expired
- 1969-05-20 US US826291A patent/US3673260A/en not_active Expired - Lifetime
- 1969-05-20 NL NL6907667A patent/NL6907667A/xx unknown
- 1969-05-20 DE DE19691925697 patent/DE1925697A1/de active Pending
- 1969-05-20 LU LU58674D patent/LU58674A1/xx unknown
- 1969-05-20 BE BE733292D patent/BE733292A/xx unknown
- 1969-05-20 CH CH771669A patent/CH513830A/fr not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0193065A1 (de) * | 1985-02-22 | 1986-09-03 | BASF Aktiengesellschaft | Morpholinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide |
Also Published As
| Publication number | Publication date |
|---|---|
| BE733292A (en:Method) | 1969-11-03 |
| LU58674A1 (en:Method) | 1969-08-28 |
| NL6907667A (en:Method) | 1969-11-25 |
| CH513830A (fr) | 1971-10-15 |
| US3673260A (en) | 1972-06-27 |
| GB1276362A (en) | 1972-06-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2425681A1 (de) | Alkylaether von polyglyzerin und deren herstellung | |
| DE3808174C2 (de) | Verfahren zur Herstellung sulfonierter Organosiliciumverbindungen | |
| DE4142129C1 (en:Method) | ||
| EP0003317A1 (de) | Verfahren zum Herstellen von Acyloxysilanen und gegebenenfalls Acyloxysiloxanen | |
| DE2022062B2 (de) | Ortho-Alkylierungsverfahren | |
| DE2411826A1 (de) | Verfahren zur herstellung von merkaptophenolen | |
| DE1593622A1 (de) | Verfahren zur Herstellung von Riechstoffingredienzien und deren Verwendung | |
| DE2454950C2 (de) | Verfahren zur Herstellung von 2-Aminobutan-1-ol und von dessen Säureanlagerungssalzen | |
| DE1276645B (de) | Verfahren zur Herstellung von 4-Alkyl-5-cyan-oxazolen | |
| DE1243677B (de) | Verfahren zur Herstellung von Sulfonsaeureestern | |
| DE1156404B (de) | Verfahren zur Herstellung von Thiophosphorsaeureestern | |
| DE852541C (de) | Verfahren zur Herstellung von AEthern von Alkoholen der Art des Allylalkohols mit halogenhaltigen substituierten Carbinolen | |
| DE1149700B (de) | Verfahren zur Herstellung von Triolen | |
| DE2444389A1 (de) | Verfahren zur herstellung eines hochaktiven polymerisations-initiators | |
| DE972502C (de) | Verfahren zur Herstellung von N-Trichlormethyl-thioimiden | |
| DE1768079C3 (de) | Ungesättigte Polyadditionsverbindungen, sowie Verfahren zu ihrer Herstellung. Ausscheidung aus: 1593216 | |
| DE2436943C3 (de) | o-Hydroxy-omega-(methylsulfinyl)acetonaphthone und Verfahren zu ihrer Herstellung | |
| DE1643341C3 (de) | Verfahren zur Herstellung eines cyclischen Sulfinsäureesters | |
| DE1273529B (de) | Verfahren zur Herstellung von Diorganozinn-S, O-mercapto-acylaten | |
| DE1121607B (de) | Verfahren zur Herstellung von unreinem und reinem Bis-(tetrachloraethyl)-disulfid | |
| DE2323581C3 (de) | Verfahren zur Herstellung von PoIythiodiglycolen | |
| DD261600A5 (de) | Verfahren zur herstellung neuer s-butyl-di-n-alkylphosphane,-phospanoxide und phosphansulfide | |
| DE1668518C3 (de) | Alkoxyalkanpolyolgemische, Verfahren zur Herstellung derselben und diese enthaltende oberflächenaktive Mittel | |
| DE1668165A1 (de) | Verfahren zur Herstellung von Epoxyorganoalkoxysilanen und dadurch hergestellte Produkte | |
| DE1048270B (de) | Verfahren zur Herstellung von Epoxyverbindungen |