DE1911228C - - Google Patents
Info
- Publication number
- DE1911228C DE1911228C DE1911228C DE 1911228 C DE1911228 C DE 1911228C DE 1911228 C DE1911228 C DE 1911228C
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- amalgam
- reaction liquid
- liquid
- adipic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000006243 chemical reaction Methods 0.000 claims description 78
- BTGRAWJCKBQKAO-UHFFFAOYSA-N adiponitrile Chemical compound N#CCCCCC#N BTGRAWJCKBQKAO-UHFFFAOYSA-N 0.000 claims description 62
- 229910000497 Amalgam Inorganic materials 0.000 claims description 34
- 238000000034 method Methods 0.000 claims description 29
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 24
- 230000008569 process Effects 0.000 claims description 20
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 11
- 238000004519 manufacturing process Methods 0.000 claims description 8
- 239000003513 alkali Substances 0.000 claims description 4
- 238000006456 reductive dimerization reaction Methods 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 3
- 239000012295 chemical reaction liquid Substances 0.000 description 71
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 36
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 26
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 19
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 19
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 17
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 16
- 239000007795 chemical reaction product Substances 0.000 description 15
- 150000001875 compounds Chemical class 0.000 description 15
- 239000007788 liquid Substances 0.000 description 15
- 238000006116 polymerization reaction Methods 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 239000001569 carbon dioxide Substances 0.000 description 13
- 229910002092 carbon dioxide Inorganic materials 0.000 description 13
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 13
- 239000011734 sodium Substances 0.000 description 13
- 229910001023 sodium amalgam Inorganic materials 0.000 description 13
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 12
- 230000000052 comparative effect Effects 0.000 description 12
- 238000002474 experimental method Methods 0.000 description 12
- 229910052708 sodium Inorganic materials 0.000 description 12
- NTFJXDRAVMOYBG-UHFFFAOYSA-N 2-(2,2-dicyanoethoxymethyl)propanedinitrile Chemical compound N#CC(C#N)COCC(C#N)C#N NTFJXDRAVMOYBG-UHFFFAOYSA-N 0.000 description 10
- 238000005755 formation reaction Methods 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 7
- 239000006227 byproduct Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 7
- 229910052753 mercury Inorganic materials 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 238000007278 cyanoethylation reaction Methods 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 238000001914 filtration Methods 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 210000003739 neck Anatomy 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 238000007086 side reaction Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- YHRUOJUYPBUZOS-UHFFFAOYSA-N 1,3-dichloropropane Chemical compound ClCCCCl YHRUOJUYPBUZOS-UHFFFAOYSA-N 0.000 description 2
- 229940057054 1,3-dimethylurea Drugs 0.000 description 2
- 229910000567 Amalgam (chemistry) Inorganic materials 0.000 description 2
- -1 Isobutyl halides Chemical class 0.000 description 2
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical compound CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000003929 acidic solution Substances 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 230000036632 reaction speed Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000003021 water soluble solvent Substances 0.000 description 2
- SEQRDAAUNCRFIT-UHFFFAOYSA-N 1,1-dichlorobutane Chemical compound CCCC(Cl)Cl SEQRDAAUNCRFIT-UHFFFAOYSA-N 0.000 description 1
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- FJBKGZOGZWULLY-UHFFFAOYSA-N OO.[He] Chemical compound OO.[He] FJBKGZOGZWULLY-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 238000009739 binding Methods 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000008676 import Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3050670C2 (enExample) | ||
| DE1643255A1 (de) | Verfahren zur Herstellung von p-Aminophenol | |
| DE3819830A1 (de) | Verfahren zur herstellung von 1,2,5,6,9,10-hexabromcyclododecan | |
| DE1911228C (enExample) | ||
| DE1593968A1 (de) | Verfahren zur Herstellung von Polyphenolen | |
| DE3103713C2 (de) | Verfahren zur Reinigung der bei der Herstellung von 2,3-Epoxypropyltrialkylammoniumchloriden entstehenden Umsetzungsgemische | |
| DE3687207T2 (de) | Verfahren zur reinigung eines oxidationsreaktionsgemisches. | |
| DE3336199A1 (de) | Veresterung phenolgruppenhaltiger carbonsaeuren | |
| DE2831994A1 (de) | Verfahren zur herstellung von tobias- saeure | |
| DE2651901C3 (de) | Verfahren zur Herabsetzung des Monochloracetylengehaltes von Roh-1, 1-Dichloräthylen | |
| DE1959343C3 (de) | Verfahren zur Herstellung von Vinylidenfluorid | |
| DE1911228B (de) | Verfahren zur Herstellung von Adipin sauredinitnl | |
| DE2535658C2 (de) | Verfahren zur Herstellung von Calciumfluorid | |
| DE69810061T2 (de) | Verfahren zur Reinigung einer Bromverbindung | |
| DE896196C (de) | Verfahren zur Herstellung von Melamin | |
| DE2428081C3 (de) | Kontinuierliches Verfahren zum Reinigen von Glyoxal | |
| DE2150599B2 (enExample) | ||
| DE69711229T2 (de) | Verfahren zur herstellung von fluorierten alkylthiocyanat | |
| DE69028766T2 (de) | Verfahren zur Herstellung einer Kupferphthalocyaninverbindung | |
| CH643216A5 (de) | Verfahren zur rueckgewinnung von brom aus abfallfluessigkeit. | |
| DE2831995A1 (de) | Verfahren zur herstellung einer waessrigen loesung eines alkalisalzes von 2-hydroxy-1-naphthalinsulfonsaeure | |
| DE2831956A1 (de) | Verfahren zur herstellung einer waessrigen loesung eines alkalimetallsalzes von 2-hydroxy-1-naphthalinsulfonsaeure | |
| DE3686793T2 (de) | Behandlung der reaktionsmischung bei der herstellung von natriumdithionit. | |
| DE2364093A1 (de) | Verfahren zur umwandlung von trichloraethylen, das in 1,2-dichloraethan enthalten ist | |
| DE2952902C2 (de) | Verfahren zur Reinigung von Naphtochinon |