DE1905649A1 - Verfahren zum Polyhalogenieren von Adamantankohlenwasserstoffen - Google Patents
Verfahren zum Polyhalogenieren von AdamantankohlenwasserstoffenInfo
- Publication number
- DE1905649A1 DE1905649A1 DE19691905649 DE1905649A DE1905649A1 DE 1905649 A1 DE1905649 A1 DE 1905649A1 DE 19691905649 DE19691905649 DE 19691905649 DE 1905649 A DE1905649 A DE 1905649A DE 1905649 A1 DE1905649 A1 DE 1905649A1
- Authority
- DE
- Germany
- Prior art keywords
- tertiary
- reaction
- adamantane
- bridgehead
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- ORILYTVJVMAKLC-UHFFFAOYSA-N Adamantane Natural products C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 title claims description 35
- 229930195733 hydrocarbon Natural products 0.000 title claims description 19
- 238000000034 method Methods 0.000 title claims description 15
- -1 adamantane hydrocarbons Chemical class 0.000 title claims description 10
- 150000002430 hydrocarbons Chemical class 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 12
- 239000004215 Carbon black (E152) Substances 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 9
- 229910052782 aluminium Inorganic materials 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 230000002140 halogenating effect Effects 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- UZUCFTVAWGRMTQ-UHFFFAOYSA-N 1-methyladamantane Chemical compound C1C(C2)CC3CC2CC1(C)C3 UZUCFTVAWGRMTQ-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 31
- NBRKLOOSMBRFMH-UHFFFAOYSA-N tert-butyl chloride Chemical compound CC(C)(C)Cl NBRKLOOSMBRFMH-UHFFFAOYSA-N 0.000 description 23
- 239000000203 mixture Substances 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- 239000003054 catalyst Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 11
- 150000005377 tertiary alkyl halides Chemical class 0.000 description 9
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 150000004820 halides Chemical group 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- 230000026030 halogenation Effects 0.000 description 4
- 238000005658 halogenation reaction Methods 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000001805 chlorine compounds Chemical group 0.000 description 3
- 125000003963 dichloro group Chemical group Cl* 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001282 iso-butane Substances 0.000 description 3
- 238000003822 preparative gas chromatography Methods 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- RTPQXHZLCUUIJP-UHFFFAOYSA-N 1,2-dimethyladamantane Chemical compound C1C(C2)CC3CC1C(C)C2(C)C3 RTPQXHZLCUUIJP-UHFFFAOYSA-N 0.000 description 2
- CWNOIUTVJRWADX-UHFFFAOYSA-N 1,3-dimethyladamantane Chemical compound C1C(C2)CC3CC1(C)CC2(C)C3 CWNOIUTVJRWADX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 150000001348 alkyl chlorides Chemical class 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- OZNXTQSXSHODFR-UHFFFAOYSA-N 1-chloroadamantane Chemical compound C1C(C2)CC3CC2CC1(Cl)C3 OZNXTQSXSHODFR-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- SQCZQTSHSZLZIQ-UHFFFAOYSA-N 1-chloropentane Chemical group CCCCCCl SQCZQTSHSZLZIQ-UHFFFAOYSA-N 0.000 description 1
- LOVSGPXFIZDSNE-UHFFFAOYSA-N 1-decyladamantane Chemical class C1C(C2)CC3CC2CC1(CCCCCCCCCC)C3 LOVSGPXFIZDSNE-UHFFFAOYSA-N 0.000 description 1
- LTYUIMGAOGLNCB-UHFFFAOYSA-N 1-ethyl-2,4-dimethyladamantane Chemical compound C1C(C2)CC3CC1(CC)C(C)C2C3C LTYUIMGAOGLNCB-UHFFFAOYSA-N 0.000 description 1
- PMOPIGGDESIABT-UHFFFAOYSA-N 1-ethyl-4-methyladamantane Chemical compound C1C(C2)CC3CC1(CC)CC2C3C PMOPIGGDESIABT-UHFFFAOYSA-N 0.000 description 1
- QDGGAPZDLUDOQU-UHFFFAOYSA-N 1-ethyladamantane Chemical compound C1C(C2)CC3CC2CC1(C[CH2])C3 QDGGAPZDLUDOQU-UHFFFAOYSA-N 0.000 description 1
- DHWIUNJDGPKQKI-UHFFFAOYSA-N 1-hexyladamantane Chemical compound C1C(C2)CC3CC2CC1(CCCCCC)C3 DHWIUNJDGPKQKI-UHFFFAOYSA-N 0.000 description 1
- ZOQLCQXGZZFWAF-UHFFFAOYSA-N 2-butyladamantane Chemical class C1C(C2)CC3CC1C(CCCC)C2C3 ZOQLCQXGZZFWAF-UHFFFAOYSA-N 0.000 description 1
- LIAWCKFOFPPVGF-UHFFFAOYSA-N 2-ethyladamantane Chemical compound C1C(C2)CC3CC1C(CC)C2C3 LIAWCKFOFPPVGF-UHFFFAOYSA-N 0.000 description 1
- 241001436679 Adama Species 0.000 description 1
- 206010067484 Adverse reaction Diseases 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 206010073261 Ovarian theca cell tumour Diseases 0.000 description 1
- IIYWTFLFMVZQET-UHFFFAOYSA-N adamantane Polymers C1C(C2)CC3CC1CC2C3.C1C(C2)CC3CC1CC2C3 IIYWTFLFMVZQET-UHFFFAOYSA-N 0.000 description 1
- 230000006838 adverse reaction Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940052761 dopaminergic adamantane derivative Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- BNIXVQGCZULYKV-UHFFFAOYSA-N pentachloroethane Chemical compound ClC(Cl)C(Cl)(Cl)Cl BNIXVQGCZULYKV-UHFFFAOYSA-N 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- RKSOPLXZQNSWAS-UHFFFAOYSA-N tert-butyl bromide Chemical compound CC(C)(C)Br RKSOPLXZQNSWAS-UHFFFAOYSA-N 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/10—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US70278968A | 1968-02-05 | 1968-02-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1905649A1 true DE1905649A1 (de) | 1969-08-28 |
Family
ID=24822601
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691905649 Pending DE1905649A1 (de) | 1968-02-05 | 1969-02-05 | Verfahren zum Polyhalogenieren von Adamantankohlenwasserstoffen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3485880A (enExample) |
| BE (1) | BE727965A (enExample) |
| CH (1) | CH507177A (enExample) |
| DE (1) | DE1905649A1 (enExample) |
| FR (1) | FR2001326A1 (enExample) |
| GB (1) | GB1195353A (enExample) |
| NL (1) | NL6901486A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3679758A (en) * | 1968-02-05 | 1972-07-25 | Sun Oil Co | Dihalogenation of branched alkanes |
| BE759981A (fr) * | 1969-12-09 | 1971-06-08 | Sun Oil Co | Production d'hydrocarbures halogenes |
| JPS5838411B2 (ja) * | 1976-11-29 | 1983-08-23 | 花王株式会社 | 3−ハロゲン−4−ホモイソツイスタンの製造法 |
| JP4014856B2 (ja) * | 2001-11-14 | 2007-11-28 | 株式会社トクヤマ | ジハロゲン化アダマンタンの製造方法 |
| WO2020075024A1 (en) * | 2018-10-12 | 2020-04-16 | Dr. Reddy’S Laboratories Limited | Process for preparation of memantine |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2447139A (en) * | 1943-08-30 | 1948-08-17 | Universal Oil Prod Co | Production of halocycloalkanes |
| US2742507A (en) * | 1952-02-28 | 1956-04-17 | Sun Oil Co | Separation of hydrocarbons |
| DE1101410B (de) * | 1960-02-29 | 1961-03-09 | Bayer Ag | Verfahren zur Herstellung von Polyhalogenadamantanen |
| US3096372A (en) * | 1961-08-15 | 1963-07-02 | Lilly Co Eli | Novel nu-(substituted)-phenylsulfonyl-n'-1-adamantylureas |
-
1968
- 1968-02-05 US US702789A patent/US3485880A/en not_active Expired - Lifetime
-
1969
- 1969-01-21 CH CH82369A patent/CH507177A/de not_active IP Right Cessation
- 1969-01-29 GB GB4823/69A patent/GB1195353A/en not_active Expired
- 1969-01-30 NL NL6901486A patent/NL6901486A/xx unknown
- 1969-02-04 FR FR6902372A patent/FR2001326A1/fr not_active Withdrawn
- 1969-02-05 DE DE19691905649 patent/DE1905649A1/de active Pending
- 1969-02-05 BE BE727965D patent/BE727965A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3485880A (en) | 1969-12-23 |
| BE727965A (enExample) | 1969-08-05 |
| CH507177A (de) | 1971-05-15 |
| GB1195353A (en) | 1970-06-17 |
| FR2001326A1 (en) | 1969-09-26 |
| NL6901486A (enExample) | 1969-08-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0958052B1 (de) | Amidophosphoniumsalz enthaltender katalysator für halex-reaktionen | |
| DE2337396A1 (de) | Verfahren zur herstellung aromatischer 1,3-diketone | |
| DE1568042A1 (de) | Verfahren zur Herstellung von fluorierten AEthern | |
| DE3816120A1 (de) | Verfahren zur herstellung von unsymmetrischen biarylverbindungen | |
| DE3023437C2 (enExample) | ||
| DE69507253T2 (de) | Verfahren zur Herstellung von 4'-Bromomethyl-2-cyanobiphenyl | |
| EP0291860A1 (de) | Verfahren zur Herstellung von CF3I | |
| EP0523671B1 (de) | Verfahren zur Herstellung von Chlorfluornitrobenzolen | |
| DE1905649A1 (de) | Verfahren zum Polyhalogenieren von Adamantankohlenwasserstoffen | |
| DE2700367A1 (de) | Antibakterielles seifenstueck | |
| DE2130919B2 (de) | Substituierte diphenylaether, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE1695928A1 (de) | Verfahren zur Herstellung von Pyrazolen | |
| DE860198C (de) | Verfahren zur Herstellung von aromatischen Bromkohlenwasserstoffen | |
| EP0635482B1 (de) | Verfahren zur Herstellung von mehrfach fluorierten Nitrobenzolen | |
| DE2548970C3 (de) | Verfahren zur Herstellung von Trichlormethyl-trifluormethyl-benzolen | |
| DE1123663B (de) | Verfahren zur Herstellung von hochchlorierten Arylsulfiden | |
| DE3321855C2 (enExample) | ||
| EP0523668B1 (de) | Verfahren zur Herstellung von Difluorbenzaldehyden | |
| DE2739621C2 (de) | Verfahren zur Herstellung von 1,1,1-Trifluor-2-chlorethan | |
| DE1618190A1 (de) | Verfahren zur Herstellung von Alkenyl- und Cycloalkenylisocyanaten | |
| DE10039717A1 (de) | Verfahren zur Kernchlorierung von meta-Xylol | |
| DE804572C (de) | Verfahren zur Herstellung von Sulfensaeurehalogeniden | |
| DE3102518A1 (de) | Verfahren zur herstellung von p- und o-benzochinonderivaten | |
| DE2027043C3 (de) | Polychlorformyltriphenylphosphate und ihre Verwendung zur Herstellung von flammabweisenden Produkten | |
| CH630593A5 (de) | Verfahren zur herstellung von 4-brom-2-chlorphenol. |