DE1900785B2 - Verfahren zur herstellung von sprengstoffsensibilisatoren - Google Patents
Verfahren zur herstellung von sprengstoffsensibilisatorenInfo
- Publication number
- DE1900785B2 DE1900785B2 DE19691900785 DE1900785A DE1900785B2 DE 1900785 B2 DE1900785 B2 DE 1900785B2 DE 19691900785 DE19691900785 DE 19691900785 DE 1900785 A DE1900785 A DE 1900785A DE 1900785 B2 DE1900785 B2 DE 1900785B2
- Authority
- DE
- Germany
- Prior art keywords
- polyol
- nitric acid
- percent
- trimethylolethane
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 17
- 239000002360 explosive Substances 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title claims 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 21
- 229920005862 polyol Polymers 0.000 claims description 20
- 150000003077 polyols Chemical class 0.000 claims description 16
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 15
- 229910017604 nitric acid Inorganic materials 0.000 claims description 15
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 claims description 12
- 235000011187 glycerol Nutrition 0.000 claims description 10
- 239000007788 liquid Substances 0.000 claims description 9
- 230000035945 sensitivity Effects 0.000 claims description 9
- IPPYBNCEPZCLNI-UHFFFAOYSA-N trimethylolethane trinitrate Chemical compound [O-][N+](=O)OCC(C)(CO[N+]([O-])=O)CO[N+]([O-])=O IPPYBNCEPZCLNI-UHFFFAOYSA-N 0.000 claims description 9
- 230000001476 alcoholic effect Effects 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 238000005474 detonation Methods 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 16
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- -1 nitric acid ester Chemical class 0.000 description 10
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 9
- 229960003711 glyceryl trinitrate Drugs 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 239000000006 Nitroglycerin Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 230000032050 esterification Effects 0.000 description 7
- 238000005886 esterification reaction Methods 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- 230000035939 shock Effects 0.000 description 6
- 239000007791 liquid phase Substances 0.000 description 5
- 238000006396 nitration reaction Methods 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 229910002651 NO3 Inorganic materials 0.000 description 3
- 238000004880 explosion Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- UQXKXGWGFRWILX-UHFFFAOYSA-N ethylene glycol dinitrate Chemical compound O=N(=O)OCCON(=O)=O UQXKXGWGFRWILX-UHFFFAOYSA-N 0.000 description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B25/00—Compositions containing a nitrated organic compound
- C06B25/10—Compositions containing a nitrated organic compound the compound being nitroglycerine
- C06B25/12—Compositions containing a nitrated organic compound the compound being nitroglycerine with other nitrated organic compounds
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B31/00—Compositions containing an inorganic nitrogen-oxygen salt
- C06B31/28—Compositions containing an inorganic nitrogen-oxygen salt the salt being ammonium nitrate
- C06B31/32—Compositions containing an inorganic nitrogen-oxygen salt the salt being ammonium nitrate with a nitrated organic compound
- C06B31/44—Compositions containing an inorganic nitrogen-oxygen salt the salt being ammonium nitrate with a nitrated organic compound the compound being nitroglycerine
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Emergency Medicine (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US69610668A | 1968-01-08 | 1968-01-08 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1900785A1 DE1900785A1 (de) | 1971-04-22 |
| DE1900785B2 true DE1900785B2 (de) | 1973-05-03 |
| DE1900785C3 DE1900785C3 (cs) | 1973-11-29 |
Family
ID=24795731
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691900785 Granted DE1900785B2 (de) | 1968-01-08 | 1969-01-08 | Verfahren zur herstellung von sprengstoffsensibilisatoren |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3423256A (cs) |
| DE (1) | DE1900785B2 (cs) |
| FR (1) | FR2000065A6 (cs) |
| GB (1) | GB1259634A (cs) |
| IL (1) | IL31366A0 (cs) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3793096A (en) * | 1972-03-01 | 1974-02-19 | Hercules Inc | Aqueous slurry explosive containing a nitratoalkanolamine nitrate sensitizer |
| US4196026A (en) * | 1975-09-04 | 1980-04-01 | Walker Franklin E | Donor free radical explosive composition |
| US4371409A (en) * | 1981-06-01 | 1983-02-01 | Hercules Incorporated | Gelatinized high explosive composition and method of preparation |
| US4352699A (en) * | 1981-06-01 | 1982-10-05 | Hercules Incorporated | Co-nitrating trimetholethane and diethylene glycol |
| US4490196A (en) * | 1984-04-05 | 1984-12-25 | Hercules Incorporated | Low detonation velocity explosive composition |
| US4555279A (en) * | 1984-04-05 | 1985-11-26 | Hercules Incorporated | Low detonation velocity explosive composition |
| US4547232A (en) * | 1984-09-24 | 1985-10-15 | Hercules Incorporated | Sensitization of water-in-oil emulsion explosives |
| US5520757A (en) * | 1988-08-25 | 1996-05-28 | Ici Explosives Usa Inc. | Low vulnerability propellants |
| US5482581A (en) * | 1988-08-25 | 1996-01-09 | Ici Explosives Usa Inc. | Low vulnerability propellant plasticizers |
| US4980000A (en) * | 1990-01-17 | 1990-12-25 | Atlas Powder Company | Nitrostarch emulsion explosives production process |
| US5051142A (en) * | 1990-01-17 | 1991-09-24 | Atlas Powder Company | Emulsion explosive containing nitrostarch |
| US5089652A (en) * | 1990-01-17 | 1992-02-18 | Atlas Powder Company | Nitrate ester preparation |
| US5074938A (en) * | 1990-05-25 | 1991-12-24 | Thiokol Corporation | Low pressure exponent propellants containing boron |
| RU2318789C1 (ru) | 2006-10-16 | 2008-03-10 | Общество с ограниченной ответственностью "ИФОХИМ" | Модификатор взрывчатых веществ |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3306790A (en) * | 1967-02-28 | Slow burning plastisol cellulose ace- tate propellant composition contain- ing resorcinol | ||
| US2709130A (en) * | 1953-06-26 | 1955-05-24 | Trojan Powder Co | Blasting explosives |
| US3140210A (en) * | 1963-01-25 | 1964-07-07 | Henry T Sampson | Binder system for propellants and explosives |
| US3344005A (en) * | 1966-02-23 | 1967-09-26 | Trojan Powder Co | Pentaerythritol tetranitrate-trimethylolethane trinitrate explosives |
-
1968
- 1968-01-08 US US696106A patent/US3423256A/en not_active Expired - Lifetime
-
1969
- 1969-01-05 IL IL31366A patent/IL31366A0/xx unknown
- 1969-01-08 DE DE19691900785 patent/DE1900785B2/de active Granted
- 1969-01-08 FR FR6900128A patent/FR2000065A6/fr not_active Expired
- 1969-01-08 GB GB1259634D patent/GB1259634A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3423256A (en) | 1969-01-21 |
| DE1900785C3 (cs) | 1973-11-29 |
| GB1259634A (cs) | 1972-01-05 |
| DE1900785A1 (de) | 1971-04-22 |
| FR2000065A6 (cs) | 1969-08-29 |
| IL31366A0 (en) | 1969-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1900785B2 (de) | Verfahren zur herstellung von sprengstoffsensibilisatoren | |
| DE2435651C3 (de) | Tetranitroglycoluril, seine Herstellung und Verwendung als Explosivstoff | |
| DE717873C (de) | Verfahren zur Herstellung von detonationsempfindlichem Ammonnitrat | |
| DE1292642B (de) | Verfahren zur Herstellung von Dinitrotoluol | |
| DE2126920C3 (de) | Handhabungssichere Sprengstoffgemische | |
| DE2950481A1 (de) | Neues verfahren zur herstellung der ursodesoxycholsaeure | |
| DE3244444C1 (de) | Zweibasige Propergolblöcke mit erhöhtem Nitramingehalt und Verfahren zu ihrer Herstellung | |
| DE1571222C3 (de) | Verfahren zur Hydrophobierung und Sensibilisierung von pulvrigen Sprengstoffgemischen | |
| DE2349640C2 (de) | Gelatinöse Sprengstoffe mit verbesserter Lagerfähigkeit | |
| DE2139675A1 (de) | Selbstvernichtende sprengladung | |
| DE934694C (de) | Sprengstoffe auf der Grundlage von Nitroform | |
| DE630079C (de) | Verfahren zur Herstellung von Tetraaethanolammoniumpentanitrat | |
| DE922815C (de) | Verfahren zur Herstellung von Sprenggelatine | |
| DE2737699C3 (de) | Verfahren zur Modifizierung des Abbrandverhaltens von Nitrocellulose enthaltenden Festtreibstoffen durch chemische Abwandlung der Nitrocellulose-Komponente und Verwendung der so hergestellten Nitrocellulose | |
| DE548427C (de) | Verfahren zur Herstellung loesemittelfreier, rauchschwacher Pulver | |
| DE1646272C (de) | Sprengstoffsensibilisator und Verfahren zur Herstellung desselben | |
| DE2462330C3 (de) | Explosivstoffe | |
| DE74431C (de) | Verfahren zur Darstellung von a-Nitroalizarin | |
| DE1446934C1 (de) | Verfahren zur Herstellung von Treibmitteln mit verbesserten Brenneigenschaften | |
| DE977653C (de) | Verfahren zur direkten Herstellung gemischter Salpetersaeureester von Polyalkoholen | |
| US1792515A (en) | Nitrated esters of polyhydric alcohols | |
| DE1771848C (de) | Verfahren zum Entfernen von Säure aus rohem, säurehalitgem Pentaerythrittetranitrat | |
| DE936007C (de) | Verfahren zur Herstellung lichtunempfindlicher Hilfsschichten in photographischen Materialien | |
| DE691154C (de) | Verfahren zum Stabilisieren von Nitrostaerke | |
| DE1593557C3 (de) | Verfahren zur Herstellung von Salpetersäureestern mehrwertiger aliphatischer Alkohole durch Umsetzung der Alkohole mit einer Nitriersäure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |