DE1793287B2 - Verfahren zur herstellung von n- substituierte n-acylcarbamidsaeurehalogeniden - Google Patents
Verfahren zur herstellung von n- substituierte n-acylcarbamidsaeurehalogenidenInfo
- Publication number
- DE1793287B2 DE1793287B2 DE19681793287 DE1793287A DE1793287B2 DE 1793287 B2 DE1793287 B2 DE 1793287B2 DE 19681793287 DE19681793287 DE 19681793287 DE 1793287 A DE1793287 A DE 1793287A DE 1793287 B2 DE1793287 B2 DE 1793287B2
- Authority
- DE
- Germany
- Prior art keywords
- acid
- chloride
- substituted
- methyl
- acylcarbamic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000002253 acid Substances 0.000 title claims description 8
- 238000000034 method Methods 0.000 title claims description 6
- 150000001805 chlorine compounds Chemical class 0.000 claims description 11
- 239000012948 isocyanate Substances 0.000 claims description 11
- 150000002513 isocyanates Chemical class 0.000 claims description 10
- -1 substituted alkyl radical Chemical class 0.000 claims description 9
- 150000001649 bromium compounds Chemical class 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Chemical group 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- 239000003054 catalyst Substances 0.000 description 10
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 8
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 7
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 5
- 239000012346 acetyl chloride Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 229910008433 SnCU Inorganic materials 0.000 description 4
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 4
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- XHLLMVSEBKZODD-UHFFFAOYSA-N n-acetyl-n-methylcarbamoyl chloride Chemical compound CC(=O)N(C)C(Cl)=O XHLLMVSEBKZODD-UHFFFAOYSA-N 0.000 description 3
- GFLXBRUGMACJLQ-UHFFFAOYSA-N 1-isocyanatohexadecane Chemical compound CCCCCCCCCCCCCCCCN=C=O GFLXBRUGMACJLQ-UHFFFAOYSA-N 0.000 description 2
- JDTUPLBMGDDPJS-UHFFFAOYSA-N 2-methoxy-2-phenylethanol Chemical compound COC(CO)C1=CC=CC=C1 JDTUPLBMGDDPJS-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- GXXXUZIRGXYDFP-UHFFFAOYSA-N 2-(4-methylphenyl)acetic acid Chemical compound CC1=CC=C(CC(O)=O)C=C1 GXXXUZIRGXYDFP-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M 3-Methylbutanoic acid Natural products CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- ANXBDAFDZSXOPQ-UHFFFAOYSA-N 4-methoxy-3-nitrobenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1[N+]([O-])=O ANXBDAFDZSXOPQ-UHFFFAOYSA-N 0.000 description 1
- KZLLSSGOPIGKDO-UHFFFAOYSA-N 4-methyl-2-nitrobenzoic acid Chemical compound CC1=CC=C(C(O)=O)C([N+]([O-])=O)=C1 KZLLSSGOPIGKDO-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 101150050048 SNCB gene Proteins 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- FYXKZNLBZKRYSS-UHFFFAOYSA-N benzene-1,2-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC=C1C(Cl)=O FYXKZNLBZKRYSS-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N beta-methyl-butyric acid Natural products CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- HXMTZADTMCGSBJ-UHFFFAOYSA-N n-butylcarbamoyl chloride Chemical compound CCCCNC(Cl)=O HXMTZADTMCGSBJ-UHFFFAOYSA-N 0.000 description 1
- GKRZNOGGALENQJ-UHFFFAOYSA-N n-carbamoylacetamide Chemical compound CC(=O)NC(N)=O GKRZNOGGALENQJ-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681793287 DE1793287B2 (de) | 1968-08-27 | 1968-08-27 | Verfahren zur herstellung von n- substituierte n-acylcarbamidsaeurehalogeniden |
| CH1149069A CH518909A (de) | 1968-08-27 | 1969-07-28 | Verfahren zur Herstellung von N-substituierten N-Acylcarbamidsäurehalogeniden |
| IL32726A IL32726A0 (en) | 1968-08-27 | 1969-07-29 | N-substituted n-acylcarbamic acid halides and their preparation |
| GB1226450D GB1226450A (enExample) | 1968-08-27 | 1969-08-05 | |
| CS579969A CS153529B2 (enExample) | 1968-08-27 | 1969-08-22 | |
| NL6913031A NL6913031A (enExample) | 1968-08-27 | 1969-08-26 | |
| FR6929359A FR2016469A1 (enExample) | 1968-08-27 | 1969-08-27 | |
| BE738033D BE738033A (enExample) | 1968-08-27 | 1969-08-27 | |
| ES370903A ES370903A1 (es) | 1968-08-27 | 1969-08-27 | Procedimiento para la obtencion de haluros del acido n-acil-carbamidico n-sustituido. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681793287 DE1793287B2 (de) | 1968-08-27 | 1968-08-27 | Verfahren zur herstellung von n- substituierte n-acylcarbamidsaeurehalogeniden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1793287A1 DE1793287A1 (de) | 1972-02-17 |
| DE1793287B2 true DE1793287B2 (de) | 1976-08-26 |
Family
ID=5707649
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681793287 Granted DE1793287B2 (de) | 1968-08-27 | 1968-08-27 | Verfahren zur herstellung von n- substituierte n-acylcarbamidsaeurehalogeniden |
Country Status (9)
| Country | Link |
|---|---|
| BE (1) | BE738033A (enExample) |
| CH (1) | CH518909A (enExample) |
| CS (1) | CS153529B2 (enExample) |
| DE (1) | DE1793287B2 (enExample) |
| ES (1) | ES370903A1 (enExample) |
| FR (1) | FR2016469A1 (enExample) |
| GB (1) | GB1226450A (enExample) |
| IL (1) | IL32726A0 (enExample) |
| NL (1) | NL6913031A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR8404670A (pt) * | 1983-09-19 | 1985-08-06 | Union Carbide Corp | Compostos haleto de carbamoila e processo para sua preparacao |
| US4637901A (en) * | 1983-09-19 | 1987-01-20 | Union Carbide Corporation | N-(alpha-haloacyl)-N-hydrocarbyl carbamoyl halides |
-
1968
- 1968-08-27 DE DE19681793287 patent/DE1793287B2/de active Granted
-
1969
- 1969-07-28 CH CH1149069A patent/CH518909A/de not_active IP Right Cessation
- 1969-07-29 IL IL32726A patent/IL32726A0/xx unknown
- 1969-08-05 GB GB1226450D patent/GB1226450A/en not_active Expired
- 1969-08-22 CS CS579969A patent/CS153529B2/cs unknown
- 1969-08-26 NL NL6913031A patent/NL6913031A/xx not_active Application Discontinuation
- 1969-08-27 BE BE738033D patent/BE738033A/xx unknown
- 1969-08-27 FR FR6929359A patent/FR2016469A1/fr not_active Withdrawn
- 1969-08-27 ES ES370903A patent/ES370903A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL32726A0 (en) | 1969-09-25 |
| NL6913031A (enExample) | 1970-03-03 |
| FR2016469A1 (enExample) | 1970-05-08 |
| GB1226450A (enExample) | 1971-03-31 |
| BE738033A (enExample) | 1970-02-27 |
| CS153529B2 (enExample) | 1974-02-25 |
| ES370903A1 (es) | 1971-07-01 |
| DE1793287A1 (de) | 1972-02-17 |
| CH518909A (de) | 1972-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0132733B1 (de) | Neue Fluorpivalsäurefluoride und Verfahren zu ihrer Herstellung | |
| CH633244A5 (de) | M-brom-benzotrifluoride. | |
| EP0124002A1 (de) | Verfahren zur Herstellung von aromatischen Verbindungen, die über ein Heteroatom gebundene perfluorierte Seitenketten enthalten | |
| DE1793287B2 (de) | Verfahren zur herstellung von n- substituierte n-acylcarbamidsaeurehalogeniden | |
| EP0693466B1 (de) | Verfahren zur Herstellung von aromatischen fluorierten Verbindungen und neue Diamide | |
| DE2008115C3 (de) | Verfahren zur Herstellung von Naralkylsubstituierten N-Acylcarbamidsäurehalogeniden | |
| DE2054342A1 (de) | Neue 1,2,4-Oxdiazole | |
| DE2603508C2 (de) | Verfahren zur Herstellung von " Isothiocyanaten | |
| EP0063740B1 (de) | Verfahren zur Herstellung von tertiären Alkylcyaniden | |
| EP0132734B1 (de) | Neopentylisocyanate und ihre Herstellung | |
| AT214425B (de) | Verfahren zur Herstellung von N-substituierten Malonimiden und deren Polymeren | |
| DE1261855B (de) | Verfahren zur Herstellung von reinem 2-N,N-Dimethylcarbamyl-3-methyl-pyrazolyl-(5)-N,N-dimethylcarbamat | |
| DE1443854C (de) | Verfahren zur Herstellung von in der Seitenkette durch Chlor teilweise oder voll standig substituierten Mono oder Dipropylperchlorbenzolen | |
| EP0173153B1 (de) | Neue benzokondensierte, fluorierte, heterocyclische Verbindungen, ein Verfahren zu ihrer Herstellung und ihre Verwendung | |
| AT228772B (de) | Verfahren zur Herstellung von neuen basisch substituierten Malonsäuredinitrilen | |
| DE1036846B (de) | Verfahren zur Herstellung von Thiophosphorsaeureestern | |
| DE1445733C (de) | Verfahren zur Herstellung von Imidchloriden. Ausscheidung aus: 1179214 | |
| DE2361604C3 (de) | Verfahren zur Herstellung von N1Ndisubstituierten Carbonsäureamiden | |
| DE1927529C3 (de) | Verfahren zur Herstellung von Mono- und Biscarbodiimiden | |
| DE1163803B (de) | Verfahren zur Herstellung von 3-Aryl-1,1,3,3-tetrachlor-2-aza-propenen | |
| AT235306B (de) | Verfahren zur Herstellung von neuen Carbaminsäurederivaten | |
| DE1445659C (de) | Pyndylphosphorverbindungen und Verfahren zu ihrer Herstellung | |
| DE2137649B2 (enExample) | ||
| DE1493826B1 (de) | Verfahren zur Herstellung von halogenierten 4,7-Endomethylen-4,7,8,9-tetrahydrophthalan-5-onen | |
| DE3150981A1 (de) | 3-amino-2-oxo-thiazol-5-carbonsaeure-derivate und ihre herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| EHV | Ceased/renunciation |