DE1772979B1 - Photographisches Aufzeichnungsmaterial fuer das Vesicularverfahren - Google Patents
Photographisches Aufzeichnungsmaterial fuer das VesicularverfahrenInfo
- Publication number
- DE1772979B1 DE1772979B1 DE19681772979 DE1772979A DE1772979B1 DE 1772979 B1 DE1772979 B1 DE 1772979B1 DE 19681772979 DE19681772979 DE 19681772979 DE 1772979 A DE1772979 A DE 1772979A DE 1772979 B1 DE1772979 B1 DE 1772979B1
- Authority
- DE
- Germany
- Prior art keywords
- azido
- recording material
- naphthoquinone
- diazido
- photographic recording
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 title claims description 51
- 238000000034 method Methods 0.000 title claims description 21
- -1 2,3-diazido-5-nitro-1,4-naphthoquinone Chemical compound 0.000 claims description 45
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 12
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 claims description 11
- 229920001577 copolymer Polymers 0.000 claims description 9
- 230000035945 sensitivity Effects 0.000 claims description 9
- 229920001169 thermoplastic Polymers 0.000 claims description 9
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 8
- 239000011248 coating agent Substances 0.000 claims description 8
- 238000000576 coating method Methods 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 8
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 7
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 6
- DUAJIKVIRGATIW-UHFFFAOYSA-N trinitrogen(.) Chemical compound [N]=[N+]=[N-] DUAJIKVIRGATIW-UHFFFAOYSA-N 0.000 claims description 5
- JFINCGOPNUYEGU-UHFFFAOYSA-N 2-azido-3-chloronaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(Cl)=C(N=[N+]=[N-])C(=O)C2=C1 JFINCGOPNUYEGU-UHFFFAOYSA-N 0.000 claims description 4
- 108010010803 Gelatin Proteins 0.000 claims description 3
- KPZYEIVQVXCDPN-UHFFFAOYSA-N [(3-diazonioimino-1,4-dioxonaphthalen-2-ylidene)hydrazinylidene]azanide Chemical compound C1=CC=C2C(=O)C(N=[N+]=[N-])=C(N=[N+]=[N-])C(=O)C2=C1 KPZYEIVQVXCDPN-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229920000159 gelatin Polymers 0.000 claims description 3
- 239000008273 gelatin Substances 0.000 claims description 3
- 235000019322 gelatine Nutrition 0.000 claims description 3
- 235000011852 gelatine desserts Nutrition 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- 238000003756 stirring Methods 0.000 claims description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 3
- 229920002126 Acrylic acid copolymer Polymers 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000005110 aryl thio group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 2
- 239000010410 layer Substances 0.000 claims 6
- AIQITIPMCPMQIG-UHFFFAOYSA-N 5,8-dioxonaphthalene-2-sulfonic acid Chemical compound O=C1C=CC(=O)C2=CC(S(=O)(=O)O)=CC=C21 AIQITIPMCPMQIG-UHFFFAOYSA-N 0.000 claims 1
- 239000004372 Polyvinyl alcohol Substances 0.000 claims 1
- 239000012790 adhesive layer Substances 0.000 claims 1
- 229920002451 polyvinyl alcohol Polymers 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims 1
- 239000007789 gas Substances 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 238000005660 chlorination reaction Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- FRASJONUBLZVQX-UHFFFAOYSA-N 1,4-naphthoquinone Chemical compound C1=CC=C2C(=O)C=CC(=O)C2=C1 FRASJONUBLZVQX-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- WOGWYSWDBYCVDY-UHFFFAOYSA-N 2-chlorocyclohexa-2,5-diene-1,4-dione Chemical compound ClC1=CC(=O)C=CC1=O WOGWYSWDBYCVDY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229910001873 dinitrogen Inorganic materials 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- QIVUCLWGARAQIO-OLIXTKCUSA-N (3s)-n-[(3s,5s,6r)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1h-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide Chemical compound C1([C@H]2[C@H](N(C(=O)[C@@H](NC(=O)C=3C=C4C[C@]5(CC4=NC=3)C3=CC=CN=C3NC5=O)C2)CC(F)(F)F)C)=C(F)C=CC(F)=C1F QIVUCLWGARAQIO-OLIXTKCUSA-N 0.000 description 1
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 1
- 229940005561 1,4-benzoquinone Drugs 0.000 description 1
- 150000000191 1,4-naphthoquinones Chemical class 0.000 description 1
- QMOQKCKRUSZXBZ-UHFFFAOYSA-N 2,3-diazido-5-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound N(=[N+]=[N-])C=1C(C=C(C(C=1N=[N+]=[N-])=O)C1=CC=CC=C1)=O QMOQKCKRUSZXBZ-UHFFFAOYSA-N 0.000 description 1
- SVPKNMBRVBMTLB-UHFFFAOYSA-N 2,3-dichloronaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(Cl)=C(Cl)C(=O)C2=C1 SVPKNMBRVBMTLB-UHFFFAOYSA-N 0.000 description 1
- MJFRJVWTRNRXIF-UHFFFAOYSA-N 2,5-diazido-3,6-dichlorocyclohexa-2,5-diene-1,4-dione Chemical compound ClC1=C(N=[N+]=[N-])C(=O)C(Cl)=C(N=[N+]=[N-])C1=O MJFRJVWTRNRXIF-UHFFFAOYSA-N 0.000 description 1
- QNEKLEKUYSMURO-UHFFFAOYSA-N 2-azidocyclohexa-2,5-diene-1,4-dione Chemical compound [N-]=[N+]=NC1=CC(=O)C=CC1=O QNEKLEKUYSMURO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- IEPRKVQEAMIZSS-UHFFFAOYSA-N Di-Et ester-Fumaric acid Natural products CCOC(=O)C=CC(=O)OCC IEPRKVQEAMIZSS-UHFFFAOYSA-N 0.000 description 1
- 238000005698 Diels-Alder reaction Methods 0.000 description 1
- IEPRKVQEAMIZSS-WAYWQWQTSA-N Diethyl maleate Chemical compound CCOC(=O)\C=C/C(=O)OCC IEPRKVQEAMIZSS-WAYWQWQTSA-N 0.000 description 1
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- SKFIYSNSLJSLSW-UHFFFAOYSA-N [(6-diazonioimino-2,5-dioxo-4-sulfocyclohex-3-en-1-ylidene)hydrazinylidene]azanide Chemical compound OS(=O)(=O)C1=CC(=O)C(=NN=[N-])C(=N[N+]#N)C1=O SKFIYSNSLJSLSW-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- 229920001727 cellulose butyrate Polymers 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229920001477 hydrophilic polymer Polymers 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000013517 stratification Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C5/00—Photographic processes or agents therefor; Regeneration of such processing agents
- G03C5/60—Processes for obtaining vesicular images
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65777367A | 1967-08-02 | 1967-08-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1772979B1 true DE1772979B1 (de) | 1970-09-16 |
Family
ID=24638606
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681772979 Pending DE1772979B1 (de) | 1967-08-02 | 1968-07-30 | Photographisches Aufzeichnungsmaterial fuer das Vesicularverfahren |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3519425A (OSRAM) |
| BE (1) | BE718812A (OSRAM) |
| DE (1) | DE1772979B1 (OSRAM) |
| FR (1) | FR1573785A (OSRAM) |
| GB (1) | GB1223472A (OSRAM) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3622335A (en) * | 1970-01-13 | 1971-11-23 | Norman Thomas Notley | Copolymers of an alpha acrylonitrile and a styrene used as vehicles in vesicular materials |
| US3844793A (en) * | 1970-10-19 | 1974-10-29 | American Cyanamid Co | Photosensitive azido material |
| US3779762A (en) * | 1971-05-26 | 1973-12-18 | American Cyanamid Co | N-succinimide additives for azide imaging systems |
| US3716367A (en) * | 1971-05-26 | 1973-02-13 | American Cyanamid Co | N-succinimide additives for azide imaging systems |
| US3933497A (en) * | 1972-12-08 | 1976-01-20 | American Cyanamid Company | Photosensitive azido processes |
| US4931380A (en) * | 1985-07-18 | 1990-06-05 | Microsi, Inc. | Pre-exposure method for increased sensitivity in high contrast resist development of positive working diazo ketone photoresist |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3143418A (en) * | 1961-05-01 | 1964-08-04 | Eastman Kodak Co | Vesicular image-forming coatings comprising a light-sensitive carbazido |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2844595A (en) * | 1954-05-24 | 1958-07-22 | Goodyear Tire & Rubber | Organic azides of the phthalide type |
| US2865932A (en) * | 1956-05-18 | 1958-12-23 | Olin Mathieson | Azides of di-carboxyaryl compounds |
| US3250731A (en) * | 1962-10-15 | 1966-05-10 | Hercules Powder Co Ltd | Preparation of cellular polypropylene articles by extrusion |
| US3387004A (en) * | 1963-05-02 | 1968-06-04 | American Cyanamid Co | Certain substituted quinones and their preparation |
| US3355295A (en) * | 1964-02-11 | 1967-11-28 | Eastman Kodak Co | Nucleated vesicular film |
-
1967
- 1967-08-02 US US657773A patent/US3519425A/en not_active Expired - Lifetime
-
1968
- 1968-07-30 BE BE718812D patent/BE718812A/xx unknown
- 1968-07-30 DE DE19681772979 patent/DE1772979B1/de active Pending
- 1968-07-31 FR FR1573785D patent/FR1573785A/fr not_active Expired
- 1968-08-01 GB GB36767/68A patent/GB1223472A/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3143418A (en) * | 1961-05-01 | 1964-08-04 | Eastman Kodak Co | Vesicular image-forming coatings comprising a light-sensitive carbazido |
Also Published As
| Publication number | Publication date |
|---|---|
| US3519425A (en) | 1970-07-07 |
| BE718812A (OSRAM) | 1968-12-31 |
| GB1223472A (en) | 1971-02-24 |
| FR1573785A (OSRAM) | 1969-07-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1572203C3 (de) | Verfahren zur Herstellung eines wärmeentwickelbaren Blattmaterials mit einem strahlungsempfindlichen Überzug | |
| DE1175986B (de) | Lichtempfindliche Schicht zur Herstellung photographischer Bilder | |
| DE2244783A1 (de) | Photographisches aufzeichnungs- und reproduktionsverfahren | |
| DE1572136B1 (de) | Fotopolymerisierbares Gemisch | |
| DE1200845B (de) | Waermeempfindliches Kopierblatt | |
| DE2142966A1 (de) | Verbessertes photographisches spiropyranhaltiges Material | |
| DE2460547C2 (de) | Verfahren zur Herstellung einer photothermographischen Beschichtungsmasse sowie photothermographisches Aufzeichnungsmaterial | |
| DE1571819A1 (de) | Thermographisches Verfahren zur Herstellung waermebestaendiger Kopien | |
| DE1199614B (de) | Filmmaterial fuer Farbenphotographie | |
| DE1129510B (de) | Thermographisches Kopiermaterial | |
| DE2049700A1 (de) | Silberfreies photographisches Auf zeichnungsmatenal | |
| DE2152607A1 (de) | Verfahren zur informationsaufzeichnung durch informationsmaessig modulierte, elektromagnetische strahlung | |
| DE1772979B1 (de) | Photographisches Aufzeichnungsmaterial fuer das Vesicularverfahren | |
| DE2241563A1 (de) | Verfahren zum sensibilisieren von auskopiermaterialien | |
| DE2436132A1 (de) | Verfahren und aufzeichnungstraeger fuer die aufzeichnung von abbildungen bzw. nachrichten | |
| DE1770629A1 (de) | Fotoelektrisches Polymerisationsverfahren | |
| DE2245234C3 (de) | Abbildungsblatt und Verfahren zur Herstellung von Bildern | |
| DE1772979C (de) | Photographisches Aufzeichnungsmaterial für das Vesicularverfahren | |
| DE2157542A1 (de) | Verfahren zur Herstellung eines dauer haften Bildes | |
| DE1597564A1 (de) | Thermophotographische,gegebenenfalls sensibilisierte Schicht | |
| DE2332040A1 (de) | Thermographische aufzeichnungsverfahren | |
| DE1284300B (de) | Photographisches Reproduktionsverfahren und Aufzeichnungsmaterial zur Durchfuehrung desselben | |
| DE2237760B2 (de) | Photographisches Aufzeichnungsmaterial mit einer ein Organoazid enthaltenden Schicht sowie Verfahren zur Herstellung photographischer Bilder | |
| DE1237590B (de) | Verfahren zur Herstellung von Kopien durch bildmaessige Erwaermung | |
| AT225527B (de) | Stabiles lichtempfindliches Material |