DE1765519A1 - Flachsteckhuelse zur Aufnahme einer Flachsteckzunge - Google Patents
Flachsteckhuelse zur Aufnahme einer FlachsteckzungeInfo
- Publication number
- DE1765519A1 DE1765519A1 DE19681765519 DE1765519A DE1765519A1 DE 1765519 A1 DE1765519 A1 DE 1765519A1 DE 19681765519 DE19681765519 DE 19681765519 DE 1765519 A DE1765519 A DE 1765519A DE 1765519 A1 DE1765519 A1 DE 1765519A1
- Authority
- DE
- Germany
- Prior art keywords
- channel
- flat
- channel bottom
- tongue
- side parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 1
- 210000002105 tongue Anatomy 0.000 description 26
- 239000002184 metal Substances 0.000 description 8
- 238000005452 bending Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 4
- 230000000295 complement effect Effects 0.000 description 3
- 230000037431 insertion Effects 0.000 description 3
- 238000003780 insertion Methods 0.000 description 3
- 239000003351 stiffener Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 2
- 210000003746 feather Anatomy 0.000 description 2
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910000639 Spring steel Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 1
- 230000000254 damaging effect Effects 0.000 description 1
- 230000010181 polygamy Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01R—ELECTRICALLY-CONDUCTIVE CONNECTIONS; STRUCTURAL ASSOCIATIONS OF A PLURALITY OF MUTUALLY-INSULATED ELECTRICAL CONNECTING ELEMENTS; COUPLING DEVICES; CURRENT COLLECTORS
- H01R13/00—Details of coupling devices of the kinds covered by groups H01R12/70 or H01R24/00 - H01R33/00
- H01R13/02—Contact members
- H01R13/10—Sockets for co-operation with pins or blades
- H01R13/11—Resilient sockets
- H01R13/115—U-shaped sockets having inwardly bent legs, e.g. spade type
Landscapes
- Coupling Device And Connection With Printed Circuit (AREA)
- Details Of Connecting Devices For Male And Female Coupling (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2596667 | 1967-06-06 | ||
| GB39801/67A GB1171678A (en) | 1967-06-06 | 1967-08-31 | Electrical connector tab receptacle |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1765519A1 true DE1765519A1 (de) | 1971-07-29 |
Family
ID=26257972
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681765519 Pending DE1765519A1 (de) | 1967-06-06 | 1968-05-31 | Flachsteckhuelse zur Aufnahme einer Flachsteckzunge |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3550069A (enExample) |
| JP (1) | JPS4748706B1 (enExample) |
| BE (1) | BE715745A (enExample) |
| DE (1) | DE1765519A1 (enExample) |
| ES (1) | ES150251Y (enExample) |
| FR (1) | FR1567727A (enExample) |
| GB (1) | GB1171678A (enExample) |
| NL (1) | NL6807567A (enExample) |
| SE (1) | SE352204B (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1079803B (de) * | 1959-03-18 | 1960-04-14 | Quirin Jos Metz & Co | Zeltbahnen- oder Planen-Abschlussrand |
| DE1197594B (de) * | 1964-03-19 | 1965-07-29 | Peter Nawrath | Zeltplanenoese aus Kunststoff |
| DE3116601A1 (de) * | 1980-05-02 | 1982-02-25 | Cinva S.A., Madrid | Verschlusseinrichtung |
| DE4012959A1 (de) * | 1990-04-24 | 1991-11-07 | Karl Koehler | Flachsteckhuelsen zur herstellung einer loesbaren elektrischen steckverbindung |
| DE20217244U1 (de) * | 2002-11-08 | 2004-03-18 | Ghw Grote & Hartmann Gmbh | Kontaktbuchse mit optimierter Steck- und Ziehkraft |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3789343A (en) * | 1971-06-04 | 1974-01-29 | Shinagawa Automotive Electric | Electrical connector |
| USRE30277E (en) * | 1974-05-03 | 1980-05-20 | Amp Incorporated | Electrical tab receptacle |
| GB1463751A (en) * | 1974-05-03 | 1977-02-09 | Amp Inc | Electrical tab receptacle |
| US4003537A (en) * | 1976-01-19 | 1977-01-18 | Melvin Mutchnik | Mountings for tubular metal legs |
| FR2402949A1 (fr) * | 1977-09-09 | 1979-04-06 | Amp France | Connecteur electrique comportant un contact femelle loge dans un boitier isolant d'une seule piece |
| US4679887A (en) * | 1982-03-24 | 1987-07-14 | Amp Incorporated | Electrical terminal |
| US4423921A (en) | 1982-05-17 | 1984-01-03 | Essex Group, Inc. | Tab receptacle terminal |
| NL8202668A (nl) * | 1982-07-02 | 1984-02-01 | Philips Nv | Elektrisch kontaktorgaan. |
| US4448468A (en) * | 1982-07-09 | 1984-05-15 | Amp Incorporated | Receptacle terminal having latching feature |
| US4713026A (en) * | 1986-10-08 | 1987-12-15 | Interlock Corporation | Tab receptacle terminal having improved electrical and mechanical features |
| FR2618612B1 (fr) * | 1987-07-24 | 1990-01-12 | Cit Alcatel | Connexion electrique pour piece de tolerie |
| US4971566A (en) * | 1988-11-03 | 1990-11-20 | Honeywell Inc. | Printed wiring board connector |
| US5181866A (en) * | 1991-04-03 | 1993-01-26 | Heyco Stamped Products, Inc. | High retention low insertion force electric female disconnect |
| US5437567A (en) * | 1993-08-09 | 1995-08-01 | Molex Incorporated | Female electrical terminal |
| US5525070A (en) * | 1994-04-15 | 1996-06-11 | Panduit Corp. | Positive lock insulated disconnect |
| US5668521A (en) * | 1995-03-22 | 1997-09-16 | Littelfuse, Inc. | Three piece female blade fuse assembly having fuse link terminal with a clip receiving portion |
| GB9507187D0 (en) * | 1995-04-06 | 1995-05-31 | Amp Gmbh | Contact having an independently supported inner contact arm |
| US5581225A (en) * | 1995-04-20 | 1996-12-03 | Littelfuse, Inc. | One-piece female blade fuse with housing |
| US5800220A (en) * | 1995-10-23 | 1998-09-01 | Framatome Connectors Interlock Inc. | Tab receptacle terminal |
| US5574267A (en) * | 1995-11-13 | 1996-11-12 | Palumbo; Nicholas R. | Switch with enhanced heat elimination |
| US5938485A (en) * | 1996-09-30 | 1999-08-17 | The Whitaker Corporation | Electrical terminal |
| US5929740A (en) * | 1997-10-20 | 1999-07-27 | Littelfuse, Inc. | One-piece female blade fuse with housing and improvements thereof |
| US5886612A (en) * | 1997-10-20 | 1999-03-23 | Littelfuse, Inc. | Female fuse housing |
| RU2190287C2 (ru) * | 1997-11-20 | 2002-09-27 | Дроздов Владимир Родионович | Электрический соединитель |
| DE19835020C2 (de) * | 1998-08-03 | 2001-02-08 | Tyco Electronics Logistics Ag | Buchsenkontakt |
| USD516523S1 (en) * | 2004-11-16 | 2006-03-07 | Pent Technologies, Inc. | DC distribution terminal |
| USD516522S1 (en) * | 2004-11-16 | 2006-03-07 | Pent Technologies, Inc. | AC distribution terminal |
| JP2006236657A (ja) * | 2005-02-23 | 2006-09-07 | Nec Corp | コネクタ装置 |
| US7255614B1 (en) * | 2006-06-30 | 2007-08-14 | Illinois Tool Works Inc | Electrical terminal |
| SG149733A1 (en) * | 2007-07-31 | 2009-02-27 | J S T U K Ltd | Receptacle terminal |
| US7595715B2 (en) * | 2007-09-27 | 2009-09-29 | Lear Corporation | High power case fuse |
| US8360812B2 (en) * | 2008-07-28 | 2013-01-29 | Illinois Tool Works Inc. | Tab-form terminal with reduced material and manufacturing cost |
| US8339235B2 (en) | 2008-08-06 | 2012-12-25 | Beckert James J | Housing securing apparatus for electrical components, especially fuses |
| US7892050B2 (en) * | 2009-06-17 | 2011-02-22 | Lear Corporation | High power fuse terminal with scalability |
| US8366497B2 (en) * | 2009-06-17 | 2013-02-05 | Lear Corporation | Power terminal |
| US8951051B2 (en) | 2011-10-10 | 2015-02-10 | Lear Corporation | Connector having optimized tip |
| US9166322B2 (en) | 2013-02-08 | 2015-10-20 | Lear Corporation | Female electric terminal with gap between terminal beams |
| US9548553B2 (en) | 2013-03-15 | 2017-01-17 | Lear Corporation | Terminal with front end protection |
| US9142902B2 (en) | 2013-08-01 | 2015-09-22 | Lear Corporation | Electrical terminal assembly |
| US9190756B2 (en) | 2013-08-01 | 2015-11-17 | Lear Corporation | Electrical terminal assembly |
| US9711926B2 (en) | 2013-11-19 | 2017-07-18 | Lear Corporation | Method of forming an interface for an electrical terminal |
| JP5831611B1 (ja) * | 2014-09-19 | 2015-12-09 | 第一精工株式会社 | コネクタ端子の接続構造 |
| JP6569140B2 (ja) * | 2016-05-18 | 2019-09-04 | 住友電装株式会社 | 雌端子金具 |
| US10027037B2 (en) * | 2016-07-06 | 2018-07-17 | Te Connectivity Corporation | Terminal with reduced normal force |
| US10256561B2 (en) * | 2017-04-05 | 2019-04-09 | Te Connectivity Corporation | Terminal with ribbed contact spring |
| US10103469B1 (en) * | 2017-04-05 | 2018-10-16 | Te Connectivity Corporation | Receptacle terminal with stable contact geometry |
| US10211558B1 (en) * | 2017-12-21 | 2019-02-19 | Te Connectivity Corporation | Low insertion force tab receptacle |
| FR3084970B1 (fr) * | 2018-08-13 | 2021-12-10 | Valeo Siemens Eautomotive France Sas | Equipement electrique |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2552392A (en) * | 1949-09-03 | 1951-05-08 | Hugh W Batcheller | Spade type electric connector |
| US2791755A (en) * | 1955-04-20 | 1957-05-07 | Amp Inc | Electrical connector |
| US2980878A (en) * | 1957-02-11 | 1961-04-18 | Amp Inc | Clip connector for printed circuit board |
| US2992404A (en) * | 1957-03-14 | 1961-07-11 | Berg Quentin | Electrical disconnect |
| US3215975A (en) * | 1961-11-27 | 1965-11-02 | Amp Inc | Connector block assembly |
-
1967
- 1967-08-31 GB GB39801/67A patent/GB1171678A/en not_active Expired
-
1968
- 1968-05-27 BE BE715745D patent/BE715745A/xx unknown
- 1968-05-27 US US732446A patent/US3550069A/en not_active Expired - Lifetime
- 1968-05-29 NL NL6807567A patent/NL6807567A/xx unknown
- 1968-05-30 ES ES1968150251U patent/ES150251Y/es not_active Expired
- 1968-05-31 DE DE19681765519 patent/DE1765519A1/de active Pending
- 1968-06-05 FR FR1567727D patent/FR1567727A/fr not_active Expired
- 1968-06-06 SE SE07641/68A patent/SE352204B/xx unknown
- 1968-06-06 JP JP3857668A patent/JPS4748706B1/ja active Pending
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1079803B (de) * | 1959-03-18 | 1960-04-14 | Quirin Jos Metz & Co | Zeltbahnen- oder Planen-Abschlussrand |
| DE1197594B (de) * | 1964-03-19 | 1965-07-29 | Peter Nawrath | Zeltplanenoese aus Kunststoff |
| DE3116601A1 (de) * | 1980-05-02 | 1982-02-25 | Cinva S.A., Madrid | Verschlusseinrichtung |
| DE4012959A1 (de) * | 1990-04-24 | 1991-11-07 | Karl Koehler | Flachsteckhuelsen zur herstellung einer loesbaren elektrischen steckverbindung |
| DE20217244U1 (de) * | 2002-11-08 | 2004-03-18 | Ghw Grote & Hartmann Gmbh | Kontaktbuchse mit optimierter Steck- und Ziehkraft |
| DE10352478B4 (de) * | 2002-11-08 | 2013-09-26 | Lear Corp. | Kontaktbuchse mit optimierter Steck- und Ziehkraft |
Also Published As
| Publication number | Publication date |
|---|---|
| US3550069A (en) | 1970-12-22 |
| ES150251U (es) | 1969-11-16 |
| NL6807567A (enExample) | 1968-12-09 |
| JPS4748706B1 (enExample) | 1972-12-07 |
| FR1567727A (enExample) | 1969-05-16 |
| ES150251Y (es) | 1970-07-16 |
| BE715745A (enExample) | 1968-10-16 |
| SE352204B (enExample) | 1972-12-18 |
| GB1171678A (en) | 1969-11-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1765519A1 (de) | Flachsteckhuelse zur Aufnahme einer Flachsteckzunge | |
| DE69509599T2 (de) | Buchse mit metallischem Halteteil | |
| DE2145881A1 (de) | Elektrische Flachsteckbuchse | |
| DE1806564U (de) | Loesbares elektrisches verbindungsteil. | |
| DE69738308T2 (de) | Kontaktstift mit in entgegen gesetzter Richtung orientierte Verankerungsflügel und Steckerelement | |
| DE2816039A1 (de) | Elektrische anschlussklemme | |
| DE60100283T2 (de) | Kontaktfeder | |
| DE69512526T2 (de) | Elektrisches kontaktelement | |
| DE1590047A1 (de) | Elektrische Flachsteckhuelse | |
| DE2719820C2 (enExample) | ||
| DE10038632B4 (de) | Vorrichtung zur schwenkbaren Lagerung von Informationsträgern | |
| DE102011100432A1 (de) | Anschlußpaßstück und Verfahren zum Herstellen desselben | |
| DE1096998B (de) | Stromanschluss fuer gedruckte Stromkreise | |
| DE19710515C1 (de) | Steckkarte für elektronische Geräte | |
| DE69803424T2 (de) | Elektrische Kontaktbuchse | |
| DE10006848C1 (de) | Steckkarte für elektronische Geräte | |
| DE8913569U1 (de) | Elektrisches Kontaktelement mit Kontaktfederarmen | |
| DE69408523T2 (de) | Buchsenklemme | |
| DE69808878T2 (de) | Druckkontakt-Steckerelement und seinem Gehäuse | |
| DE3786438T2 (de) | Elektrischer Steckverbinder. | |
| DE10027094B4 (de) | Befestigte Struktur einer steckerseitigen Abdeckung | |
| DE4306795C2 (de) | Kontaktelement | |
| DE2710235A1 (de) | Gehaeuse aus elektrisch isolierendem werkstoff fuer eine elektrische anschlussklemme | |
| DE2019221A1 (de) | Flachsteckbuchse | |
| DE1765338A1 (de) | Flachsteckhuelse zur Aufnahme einer Flachsteckzunge |