DE1670971A1 - Chlorpyrimidin-Derivate - Google Patents
Chlorpyrimidin-DerivateInfo
- Publication number
- DE1670971A1 DE1670971A1 DE19681670971 DE1670971A DE1670971A1 DE 1670971 A1 DE1670971 A1 DE 1670971A1 DE 19681670971 DE19681670971 DE 19681670971 DE 1670971 A DE1670971 A DE 1670971A DE 1670971 A1 DE1670971 A1 DE 1670971A1
- Authority
- DE
- Germany
- Prior art keywords
- propionitrile
- methyl
- reaction
- chlorine
- chlorination
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000005698 chloropyrimidines Chemical class 0.000 title claims description 9
- 239000000460 chlorine Substances 0.000 claims description 36
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 229910052801 chlorine Inorganic materials 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 18
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 9
- MPOVCDFGYVNNNK-UHFFFAOYSA-N 3-(dibenzylamino)propanenitrile Chemical compound C=1C=CC=CC=1CN(CCC#N)CC1=CC=CC=C1 MPOVCDFGYVNNNK-UHFFFAOYSA-N 0.000 claims description 3
- PRTAQXYGPJREAD-UHFFFAOYSA-N 3-[benzyl(methyl)amino]propanenitrile Chemical compound N#CCCN(C)CC1=CC=CC=C1 PRTAQXYGPJREAD-UHFFFAOYSA-N 0.000 claims description 3
- XDZSWBPZWOQXCQ-UHFFFAOYSA-N 3-[ethyl(methyl)amino]propanenitrile Chemical compound CCN(C)CCC#N XDZSWBPZWOQXCQ-UHFFFAOYSA-N 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- 239000003701 inert diluent Substances 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 230000005855 radiation Effects 0.000 claims description 2
- TUCHRFCBOJCRSA-UHFFFAOYSA-N 3-[methyl(propyl)amino]propanenitrile Chemical compound CCCN(C)CCC#N TUCHRFCBOJCRSA-UHFFFAOYSA-N 0.000 claims 1
- 125000002837 carbocyclic group Chemical group 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 30
- 238000005660 chlorination reaction Methods 0.000 description 19
- 229910052757 nitrogen Inorganic materials 0.000 description 16
- 238000009835 boiling Methods 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 239000003085 diluting agent Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 238000001816 cooling Methods 0.000 description 8
- 238000009281 ultraviolet germicidal irradiation Methods 0.000 description 8
- -1 4- chloro-3-nitrophenyl Chemical group 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 238000004508 fractional distillation Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UZVRXBTXEACDQE-UHFFFAOYSA-N 4,5,6-trichloro-2-phenylpyrimidine Chemical compound ClC1=C(Cl)C(Cl)=NC(C=2C=CC=CC=2)=N1 UZVRXBTXEACDQE-UHFFFAOYSA-N 0.000 description 3
- AUWPHGWEYHEAIG-UHFFFAOYSA-N 4,5,6-trichloropyrimidine Chemical class ClC1=NC=NC(Cl)=C1Cl AUWPHGWEYHEAIG-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 150000003230 pyrimidines Chemical class 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- PANVCEBTPSTUEL-UHFFFAOYSA-N 1,1,2,3,3-pentachloropropane Chemical compound ClC(Cl)C(Cl)C(Cl)Cl PANVCEBTPSTUEL-UHFFFAOYSA-N 0.000 description 1
- DMZRCHJVWAKCAX-UHFFFAOYSA-N 1,2,3,3,4,4,5,5-octachlorocyclopentene Chemical compound ClC1=C(Cl)C(Cl)(Cl)C(Cl)(Cl)C1(Cl)Cl DMZRCHJVWAKCAX-UHFFFAOYSA-N 0.000 description 1
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- GVBHCMNXRKOJRH-UHFFFAOYSA-N 2,4,5,6-tetrachloropyrimidine Chemical compound ClC1=NC(Cl)=C(Cl)C(Cl)=N1 GVBHCMNXRKOJRH-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- UNIJBMUBHBAUET-UHFFFAOYSA-N 3-(methylamino)propanenitrile Chemical compound CNCCC#N UNIJBMUBHBAUET-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- GKCXISZMRRBNCO-UHFFFAOYSA-N 4,5,6-trichloro-2-(1,1,2,2,2-pentachloroethyl)pyrimidine Chemical compound ClC1=NC(=NC(Cl)=C1Cl)C(Cl)(Cl)C(Cl)(Cl)Cl GKCXISZMRRBNCO-UHFFFAOYSA-N 0.000 description 1
- AXCSYJNKKCROMY-UHFFFAOYSA-N 4,5,6-trichloro-2-(dichloromethyl)pyrimidine Chemical compound ClC(Cl)C1=NC(Cl)=C(Cl)C(Cl)=N1 AXCSYJNKKCROMY-UHFFFAOYSA-N 0.000 description 1
- VCWDXJOLODFQDC-UHFFFAOYSA-N 4,5,6-trichloro-2-(trichloromethyl)pyrimidine Chemical compound ClC1=NC(C(Cl)(Cl)Cl)=NC(Cl)=C1Cl VCWDXJOLODFQDC-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- DPGFZLFJGRGNIK-UHFFFAOYSA-N 5-chloro-4-hydroxy-2-phenyl-1h-pyrimidin-6-one Chemical compound N1C(=O)C(Cl)=C(O)N=C1C1=CC=CC=C1 DPGFZLFJGRGNIK-UHFFFAOYSA-N 0.000 description 1
- JWDRZBJMPROSSB-UHFFFAOYSA-N ClC1=NC(=NC(=C1Cl)Cl)C1=C(C(=C(C2=CC=CC=C12)Cl)Cl)Cl Chemical compound ClC1=NC(=NC(=C1Cl)Cl)C1=C(C(=C(C2=CC=CC=C12)Cl)Cl)Cl JWDRZBJMPROSSB-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000005002 aryl methyl group Chemical group 0.000 description 1
- LZCZIHQBSCVGRD-UHFFFAOYSA-N benzenecarboximidamide;hydron;chloride Chemical compound [Cl-].NC(=[NH2+])C1=CC=CC=C1 LZCZIHQBSCVGRD-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- WLWCQKMQYZFTDR-UHFFFAOYSA-N diethyl 2-chloropropanedioate Chemical compound CCOC(=O)C(Cl)C(=O)OCC WLWCQKMQYZFTDR-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012025 fluorinating agent Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- VUNCWTMEJYMOOR-UHFFFAOYSA-N hexachlorocyclopentadiene Chemical compound ClC1=C(Cl)C(Cl)(Cl)C(Cl)=C1Cl VUNCWTMEJYMOOR-UHFFFAOYSA-N 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- JVGKCYRIXCBMPD-UHFFFAOYSA-N n-methyl-1-[4-(methylaminomethyl)phenyl]methanamine Chemical compound CNCC1=CC=C(CNC)C=C1 JVGKCYRIXCBMPD-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000005441 o-toluyl group Chemical group [H]C1=C([H])C(C(*)=O)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000000985 reactive dye Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000003330 sporicidal effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/30—Halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681670971 DE1670971A1 (de) | 1968-01-12 | 1968-01-12 | Chlorpyrimidin-Derivate |
| CH1861368A CH516564A (de) | 1968-01-12 | 1968-12-13 | Verfahren zur Herstellung von 4,5,6-Tri-chlorpyrimidinen |
| FR1600587D FR1600587A (en:Method) | 1968-01-12 | 1968-12-30 | |
| US788934A US3629261A (en) | 1968-01-12 | 1969-01-03 | Chloropyrimidine derivatives |
| AT17969A AT284849B (de) | 1968-01-12 | 1969-01-09 | Verfahren zur Herstellung von Chlorpyrimidin-Derivaten |
| NL6900450A NL6900450A (en:Method) | 1968-01-12 | 1969-01-10 | |
| BE726729D BE726729A (en:Method) | 1968-01-12 | 1969-01-10 | |
| GB0670/69A GB1247584A (en) | 1968-01-12 | 1969-01-10 | Process for the production of chloropyrimidine derivatives |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0054539 | 1968-01-12 | ||
| DE19681670971 DE1670971A1 (de) | 1968-01-12 | 1968-01-12 | Chlorpyrimidin-Derivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1670971A1 true DE1670971A1 (de) | 1971-03-18 |
Family
ID=25754396
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681670971 Pending DE1670971A1 (de) | 1968-01-12 | 1968-01-12 | Chlorpyrimidin-Derivate |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3629261A (en:Method) |
| BE (1) | BE726729A (en:Method) |
| CH (1) | CH516564A (en:Method) |
| DE (1) | DE1670971A1 (en:Method) |
| FR (1) | FR1600587A (en:Method) |
| GB (1) | GB1247584A (en:Method) |
| NL (1) | NL6900450A (en:Method) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0173191A3 (de) * | 1984-08-29 | 1987-04-01 | Bayer Ag | 5,5-Dichlor-4,5-dihydro-6-hydroxy-2-trichlormethyl-pyrimidin-4-on, ein Verfahren zu seiner Herstellung und seine Verwendung |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2307863A1 (de) * | 1973-02-17 | 1974-08-22 | Bayer Ag | Verfahren zur herstellung von chlorpyrimidinen |
| DE3319957A1 (de) * | 1983-06-01 | 1984-12-06 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von chlorpyrimidinen |
-
1968
- 1968-01-12 DE DE19681670971 patent/DE1670971A1/de active Pending
- 1968-12-13 CH CH1861368A patent/CH516564A/de not_active IP Right Cessation
- 1968-12-30 FR FR1600587D patent/FR1600587A/fr not_active Expired
-
1969
- 1969-01-03 US US788934A patent/US3629261A/en not_active Expired - Lifetime
- 1969-01-10 BE BE726729D patent/BE726729A/xx unknown
- 1969-01-10 NL NL6900450A patent/NL6900450A/xx unknown
- 1969-01-10 GB GB0670/69A patent/GB1247584A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0173191A3 (de) * | 1984-08-29 | 1987-04-01 | Bayer Ag | 5,5-Dichlor-4,5-dihydro-6-hydroxy-2-trichlormethyl-pyrimidin-4-on, ein Verfahren zu seiner Herstellung und seine Verwendung |
Also Published As
| Publication number | Publication date |
|---|---|
| CH516564A (de) | 1971-12-15 |
| US3629261A (en) | 1971-12-21 |
| BE726729A (en:Method) | 1969-06-16 |
| NL6900450A (en:Method) | 1969-07-15 |
| FR1600587A (en:Method) | 1970-07-27 |
| GB1247584A (en) | 1971-09-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1695940A1 (de) | Verfahren zur Herstellung von 1,2-Dihydro-1-hydroxy-pyrimidinen | |
| DE3634975A1 (de) | Verfahren zur herstellung von substituierten und disubstituierten pyridin-2,3-dicarboxylatestern | |
| CH630356A5 (en) | Process for the preparation of 3-phenyl-5-(substituted)-4(1H)-pyridones, and their use | |
| DE2130919C3 (de) | Substituierte Diphenylether, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE69215266T2 (de) | Verfahren zur Herstellung von 1H-Benzimidazolen | |
| DE1670971A1 (de) | Chlorpyrimidin-Derivate | |
| DE2725992A1 (de) | Benzylcyanoacetale, verfahren zu ihrer herstellung und ihre verwendung | |
| AT284849B (de) | Verfahren zur Herstellung von Chlorpyrimidin-Derivaten | |
| DE2627223A1 (de) | Verfahren zur herstellung von 4-benzoylpyrazol-derivaten | |
| DE2814330A1 (de) | Verfahren zur herstellung eines 2,6-dichlorpyridin-derivats | |
| DE2503736A1 (de) | Verfahren zur herstellung von 2-oxo- 1,2-dihydro-chinazolinen | |
| CH503035A (de) | Verfahren zur Herstellung von Chlorpyrimidinen | |
| DE2809798B2 (de) | Verfahren zur Herstellung von 5-substituierten Tetrazolen | |
| DE1770922A1 (de) | Neue Triazinderivate und Verfahren zu deren Herstellung | |
| DE1793467C (de) | Verfahren zur Herstellung von 4-Hydroxybenzonitrilen | |
| AT258921B (de) | Verfahren zur Herstellung von Chinazolinderivaten | |
| DE2063384A1 (de) | l-(l,2-Diphenyl-2-formylvinyl)-4methylpiperazin und seine physiologisch verträglichen Salze und Verfahren zu seiner Herstellung | |
| EP0445644B1 (de) | Trifluor- bzw. Chlordifluormethoxypyrimidine und Verfahren zu ihrer Herstellung | |
| DE1921340C3 (de) | In 4-Stellung substituierte 2-Phenyl-5-haIogen-pyrimidine | |
| DE1445982A1 (de) | Verfahren fuer die Herstellung von 4-Amin-5-Arylazopyrimidin-Derivaten | |
| AT162937B (de) | Verfahren zur Herstellung eines neuen substituierten 2,4-Diamino-1,3,5-triazins | |
| DE1768531C3 (de) | Verfahren zur Herstellung fluorierter organischer Verbindungen | |
| DE931828C (de) | Verfahren zur Herstellung von AEthylendiaminderivaten | |
| AT258916B (de) | Verfahren zur Herstellung von neuen Alkyl-3-amino-5-chlor-6-X-pyrazinoaten | |
| DE2631520A1 (de) | Chinoxalin-di-n-oxide, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |