DE1670835A1 - Verfahren zur Herstellung von Arylsulfonylharnstoffderivaten bicyclischer sekundaerer Amine - Google Patents
Verfahren zur Herstellung von Arylsulfonylharnstoffderivaten bicyclischer sekundaerer AmineInfo
- Publication number
- DE1670835A1 DE1670835A1 DE19671670835 DE1670835A DE1670835A1 DE 1670835 A1 DE1670835 A1 DE 1670835A1 DE 19671670835 DE19671670835 DE 19671670835 DE 1670835 A DE1670835 A DE 1670835A DE 1670835 A1 DE1670835 A1 DE 1670835A1
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- alkoxy
- halogen
- substituted
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 derivatives of bicyclic secondary amines Chemical class 0.000 title claims description 28
- 238000000034 method Methods 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 125000004442 acylamino group Chemical group 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 8
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 229920006395 saturated elastomer Polymers 0.000 claims description 6
- 239000011593 sulfur Substances 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 3
- 150000001805 chlorine compounds Chemical class 0.000 claims description 3
- 239000012948 isocyanate Substances 0.000 claims description 3
- 125000000565 sulfonamide group Chemical group 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 150000001340 alkali metals Chemical group 0.000 claims description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000004202 carbamide Substances 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 238000006400 oxidative hydrolysis reaction Methods 0.000 claims description 2
- 125000004043 oxo group Chemical group O=* 0.000 claims description 2
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 claims description 2
- 229940124530 sulfonamide Drugs 0.000 claims description 2
- 150000003585 thioureas Chemical class 0.000 claims description 2
- 125000004421 aryl sulphonamide group Chemical group 0.000 claims 2
- 125000002252 acyl group Chemical group 0.000 claims 1
- 125000002947 alkylene group Chemical group 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 229910052698 phosphorus Inorganic materials 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000008280 blood Substances 0.000 description 6
- 210000004369 blood Anatomy 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229960005371 tolbutamide Drugs 0.000 description 4
- CHRAJVQLWOMYQI-UHFFFAOYSA-N 5,8,8-trimethyl-3-azabicyclo[3.2.1]octane Chemical compound C1NCC2CCC1(C)C2(C)C CHRAJVQLWOMYQI-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N methyl pentane Natural products CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- CHRAJVQLWOMYQI-SCZZXKLOSA-N (1s,5r)-5,8,8-trimethyl-3-azabicyclo[3.2.1]octane Chemical compound C1NC[C@H]2CC[C@]1(C)C2(C)C CHRAJVQLWOMYQI-SCZZXKLOSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- DRKWSHLYQCUKKG-UHFFFAOYSA-N 2,4,4-trimethyl-3-azabicyclo[3.2.1]octane Chemical compound CC1NC(C)(C)C2CCC1C2 DRKWSHLYQCUKKG-UHFFFAOYSA-N 0.000 description 1
- SIAORVLULRAXDN-UHFFFAOYSA-N 2-methyl-3-azabicyclo[3.2.0]heptane Chemical compound CC1C2CCC2CN1 SIAORVLULRAXDN-UHFFFAOYSA-N 0.000 description 1
- ZUTVRDMZQSHCID-UHFFFAOYSA-N 3-(trifluoromethyl)benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC(C(F)(F)F)=C1 ZUTVRDMZQSHCID-UHFFFAOYSA-N 0.000 description 1
- HGWUUOXXAIISDB-UHFFFAOYSA-N 3-azabicyclo[3.1.0]hexane Chemical compound C1NCC2CC21 HGWUUOXXAIISDB-UHFFFAOYSA-N 0.000 description 1
- CJQNJRRDTPULTL-UHFFFAOYSA-N 3-azabicyclo[3.2.1]octane Chemical compound C1C2CCC1CNC2 CJQNJRRDTPULTL-UHFFFAOYSA-N 0.000 description 1
- LICHZOBEUWVYSY-UHFFFAOYSA-N 3-azabicyclo[3.2.2]nonane Chemical compound C1CC2CCC1CNC2 LICHZOBEUWVYSY-UHFFFAOYSA-N 0.000 description 1
- TVHXQQJDMHKGGK-UHFFFAOYSA-N 4-(trifluoromethyl)benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(C(F)(F)F)C=C1 TVHXQQJDMHKGGK-UHFFFAOYSA-N 0.000 description 1
- SPZGXONNVLTQDE-UHFFFAOYSA-N 4-chloro-3-nitrobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 SPZGXONNVLTQDE-UHFFFAOYSA-N 0.000 description 1
- JGHDVROWMPBQSR-UHFFFAOYSA-N 4-chloro-n-(oxomethylidene)benzenesulfonamide Chemical compound ClC1=CC=C(S(=O)(=O)N=C=O)C=C1 JGHDVROWMPBQSR-UHFFFAOYSA-N 0.000 description 1
- HHHDJHHNEURCNV-UHFFFAOYSA-N 4-chlorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(Cl)C=C1 HHHDJHHNEURCNV-UHFFFAOYSA-N 0.000 description 1
- JESBYSXPKUMFRV-UHFFFAOYSA-N 4-methoxy-3-nitrobenzenesulfonamide Chemical compound COC1=CC=C(S(N)(=O)=O)C=C1[N+]([O-])=O JESBYSXPKUMFRV-UHFFFAOYSA-N 0.000 description 1
- MSFQEZBRFPAFEX-UHFFFAOYSA-N 4-methoxybenzenesulfonamide Chemical compound COC1=CC=C(S(N)(=O)=O)C=C1 MSFQEZBRFPAFEX-UHFFFAOYSA-N 0.000 description 1
- HVCWTENLJRUJPU-UHFFFAOYSA-N 4-methyl-3-nitrobenzenesulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1[N+]([O-])=O HVCWTENLJRUJPU-UHFFFAOYSA-N 0.000 description 1
- VLJQDHDVZJXNQL-UHFFFAOYSA-N 4-methyl-n-(oxomethylidene)benzenesulfonamide Chemical compound CC1=CC=C(S(=O)(=O)N=C=O)C=C1 VLJQDHDVZJXNQL-UHFFFAOYSA-N 0.000 description 1
- QWKKYJLAUWFPDB-UHFFFAOYSA-N 4-nitrobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1 QWKKYJLAUWFPDB-UHFFFAOYSA-N 0.000 description 1
- ZXVJNNSXLBNSJP-UHFFFAOYSA-N 5,8,8-trimethyl-n-(4-methylphenyl)sulfonyl-3-azabicyclo[3.2.1]octane-3-carboxamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)N1CC(C)(C2(C)C)CCC2C1 ZXVJNNSXLBNSJP-UHFFFAOYSA-N 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- MVCZNTSPKMYXNI-UHFFFAOYSA-N C1(=CC=C(C=C1)S(=O)(=O)NC(=O)N1CC2CCC(C1)CC2)C Chemical compound C1(=CC=C(C=C1)S(=O)(=O)NC(=O)N1CC2CCC(C1)CC2)C MVCZNTSPKMYXNI-UHFFFAOYSA-N 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 125000004945 acylaminoalkyl group Chemical group 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- BLNJZMQZYXWQGM-UHFFFAOYSA-N carbamoyl azide Chemical class NC(=O)N=[N+]=[N-] BLNJZMQZYXWQGM-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- CXLBYPJSAWOYSI-UHFFFAOYSA-N ethyl n-methyl-n-(4-methylphenyl)sulfonylcarbamate Chemical compound CCOC(=O)N(C)S(=O)(=O)C1=CC=C(C)C=C1 CXLBYPJSAWOYSI-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- NVNCJNHFYBSIQX-UHFFFAOYSA-N n-(2-methyl-5-sulfamoylphenyl)acetamide Chemical compound CC(=O)NC1=CC(S(N)(=O)=O)=CC=C1C NVNCJNHFYBSIQX-UHFFFAOYSA-N 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- STHHABLIHXTCAK-UHFFFAOYSA-N n-(4-chlorophenyl)sulfonyl-5,8,8-trimethyl-3-azabicyclo[3.2.1]octane-3-carboxamide Chemical compound CC1(C)C(C2)CCC1(C)CN2C(=O)NS(=O)(=O)C1=CC=C(Cl)C=C1 STHHABLIHXTCAK-UHFFFAOYSA-N 0.000 description 1
- JOFJRKZRBGKCTM-UHFFFAOYSA-N n-(4-fluorophenyl)sulfonyl-5,8,8-trimethyl-3-azabicyclo[3.2.1]octane-3-carboxamide Chemical compound CC1(C)C(C2)CCC1(C)CN2C(=O)NS(=O)(=O)C1=CC=C(F)C=C1 JOFJRKZRBGKCTM-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/22—Bridged ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0051949 | 1967-03-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1670835A1 true DE1670835A1 (de) | 1971-03-11 |
Family
ID=7105049
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671670835 Pending DE1670835A1 (de) | 1967-03-25 | 1967-03-25 | Verfahren zur Herstellung von Arylsulfonylharnstoffderivaten bicyclischer sekundaerer Amine |
Country Status (2)
| Country | Link |
|---|---|
| BE (1) | BE712735A (cs) |
| DE (1) | DE1670835A1 (cs) |
-
1967
- 1967-03-25 DE DE19671670835 patent/DE1670835A1/de active Pending
-
1968
- 1968-03-25 BE BE712735D patent/BE712735A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE712735A (cs) | 1968-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0053744A1 (de) | Neue 8-Arylalkyl-3-phenyl-3-nortropanole, deren Säureadditionssalze, diese enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| DE1670835A1 (de) | Verfahren zur Herstellung von Arylsulfonylharnstoffderivaten bicyclischer sekundaerer Amine | |
| EP0007438B1 (de) | Neue substituierte 2-Phenylamino-imidazoline-(2), deren Säureadditionssalze, diese enthaltende Arzneimittel und Verfahren zur Herstellung derselben | |
| DE1443911A1 (de) | Benzolsulfonylharnstoffe und Verfahren zu ihrer Herstellung | |
| DE1921737A1 (de) | Heterocyclische Acylreste enthaltende Sulfonylharnstoffe und Sulfonylsemicarbazide mit antidiabetischer Wirkung | |
| DE1142599B (de) | Verfahren zur Herstellung von Carbaminsaeureestern | |
| DE2344134A1 (de) | Kohlensaeurederivate des 2-mercapto-4,5dichlor-thiazols, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE1174306B (de) | Verfahren zur Herstellung von Sulfonylharnstoffen | |
| CH401948A (de) | Verfahren zur Herstellung N-substituierter Phenylsulfonyl-N'-cycloalkylharnstoffe | |
| DE951719C (de) | Verfahren zur Herstellung von N,N'-Dithio-bis-sulfonsaeureamiden | |
| DE1670834A1 (de) | Verfahren zur Herstellung von arylsulfonylsemicarbaziden bicyclischer N-Aminoverbindungen | |
| DE1003716B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1135891B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| AT263749B (de) | Verfahren zur Herstellung von Dibenzocycloheptaenderivaten und ihren Säureadditionssalzen | |
| AT319960B (de) | Verfahren zur Herstellung von neuen Pyridazinverbindungen | |
| AT374456B (de) | Verfahren zur herstellung von neuen benzolsulfonamidderivaten | |
| DE1126383B (de) | Verfahren zur Herstellung von lokalanaesthetisch wirksamen Aminoaethern | |
| AT236398B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| AT230896B (de) | Verfahren zur Herstellung von neuen Carbaminsäureestern | |
| AT233584B (de) | Verfahren zur Herstellung von neuen Hydrindensulfonylharnstoffen | |
| DE1670770B2 (de) | Arylsulfonylharnstoffe und Arylsulfonylthioharnstoffe | |
| AT339905B (de) | Verfahren zur herstellung von neuen piperidinderivaten und deren salzen | |
| DE913171C (de) | Verfahren zur Herstellung von Aminsalzen des Penicillins | |
| DE1193055B (de) | Verfahren zur Herstellung von Thionophosphon-saeureestern | |
| EP0002806B1 (de) | Verfahren zur Herstellung von in 1-Stellung verätherten 1-Hydroxy-oximino-cycloalkenen-(1) |