DE1668472C - - Google Patents
Info
- Publication number
- DE1668472C DE1668472C DE1668472C DE 1668472 C DE1668472 C DE 1668472C DE 1668472 C DE1668472 C DE 1668472C
- Authority
- DE
- Germany
- Prior art keywords
- oxidation
- substituted
- groups
- acid
- benzene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 34
- 238000000034 method Methods 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 17
- 239000003054 catalyst Substances 0.000 claims description 17
- 230000003647 oxidation Effects 0.000 claims description 17
- 238000007254 oxidation reaction Methods 0.000 claims description 17
- 150000001555 benzenes Chemical class 0.000 claims description 14
- 239000007789 gas Substances 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 8
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims description 7
- 239000012495 reaction gas Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 4
- 229910001882 dioxygen Inorganic materials 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- XHCLAFWTIXFWPH-UHFFFAOYSA-N [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] XHCLAFWTIXFWPH-UHFFFAOYSA-N 0.000 claims description 2
- 150000005224 alkoxybenzenes Chemical class 0.000 claims description 2
- 229910001935 vanadium oxide Inorganic materials 0.000 claims description 2
- 239000012808 vapor phase Substances 0.000 claims description 2
- 125000004849 alkoxymethyl group Chemical group 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 230000003197 catalytic effect Effects 0.000 claims 1
- CYIDZMCFTVVTJO-UHFFFAOYSA-N pyromellitic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=C1C(O)=O CYIDZMCFTVVTJO-UHFFFAOYSA-N 0.000 description 28
- 230000000052 comparative effect Effects 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000000047 product Substances 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000002994 raw material Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- -1 K 2 SO 1 Chemical class 0.000 description 4
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical compound OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- JALHTPIEJQBDEN-UHFFFAOYSA-N 1,5-bis(chloromethyl)-2,4-dimethylbenzene Chemical compound CC1=CC(C)=C(CCl)C=C1CCl JALHTPIEJQBDEN-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- FYGHSUNMUKGBRK-UHFFFAOYSA-N 1,2,3-trimethylbenzene Chemical compound CC1=CC=CC(C)=C1C FYGHSUNMUKGBRK-UHFFFAOYSA-N 0.000 description 2
- VGJZYYCREBNVOU-UHFFFAOYSA-N 1-(dichloromethyl)-2,3-dimethylbenzene Chemical group CC1=CC=CC(C(Cl)Cl)=C1C VGJZYYCREBNVOU-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000001354 calcination Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- SQNZJJAZBFDUTD-UHFFFAOYSA-N durene Chemical compound CC1=CC(C)=C(C)C=C1C SQNZJJAZBFDUTD-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- SQFQIHCPTTUZCP-UHFFFAOYSA-N 1,2-bis(chloromethyl)-3,4-dimethylbenzene Chemical class CC1=CC=C(CCl)C(CCl)=C1C SQFQIHCPTTUZCP-UHFFFAOYSA-N 0.000 description 1
- JEHNWRLQWXMLQC-UHFFFAOYSA-N 1,3-bis(chloromethyl)-2,4-dimethylbenzene Chemical compound CC1=CC=C(CCl)C(C)=C1CCl JEHNWRLQWXMLQC-UHFFFAOYSA-N 0.000 description 1
- GRJWOKACBGZOKT-UHFFFAOYSA-N 1,3-bis(chloromethyl)benzene Chemical compound ClCC1=CC=CC(CCl)=C1 GRJWOKACBGZOKT-UHFFFAOYSA-N 0.000 description 1
- UYRPOMMBPQHVMN-UHFFFAOYSA-N 1,4-bis(chloromethyl)-2,5-dimethylbenzene Chemical compound CC1=CC(CCl)=C(C)C=C1CCl UYRPOMMBPQHVMN-UHFFFAOYSA-N 0.000 description 1
- ABGVECYGBJQQQK-UHFFFAOYSA-N 1-(chloromethyl)-2,3,4-trimethylbenzene Chemical compound CC1=CC=C(CCl)C(C)=C1C ABGVECYGBJQQQK-UHFFFAOYSA-N 0.000 description 1
- XFEKIQFBJSDMQB-UHFFFAOYSA-N 2,2,2-trichloroethylbenzene Chemical compound ClC(Cl)(Cl)CC1=CC=CC=C1 XFEKIQFBJSDMQB-UHFFFAOYSA-N 0.000 description 1
- HKCWYAWNOIYUAS-UHFFFAOYSA-N 2,4-bis(chloromethyl)-1-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1CCl HKCWYAWNOIYUAS-UHFFFAOYSA-N 0.000 description 1
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 1
- 241001676573 Minium Species 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- 229910000756 V alloy Inorganic materials 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- HIMLGVIQSDVUJQ-UHFFFAOYSA-N aluminum vanadium Chemical compound [Al].[V] HIMLGVIQSDVUJQ-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69412326T2 (de) | Verfahren zur Herstellung von Essigsäure | |
| DE1962431C3 (OSRAM) | ||
| DE2220799C3 (de) | Verfahren zur Herstellung von Acrylsäure durch Oxydation von Acrolein | |
| DE60018531T2 (de) | Oxydkomplex als Katalysator und Verfahren für die Herstellung von Acrylsäure | |
| DE2125032C3 (de) | Verfahren zur Herstellung von (Meth) Acrolein neben geringen Mengen (Meth) Acrylsäure | |
| DE69722261T2 (de) | Gasphasen-oxidationsverfahren und verfahren zur herstellung von phthalsäureanhydrid | |
| DE2847288C2 (de) | Katalysator und dessen Verwendung zur Herstellung von Methacrylsäure | |
| DE2704991B2 (de) | Verfahren zur Herstellung von Methacrylsäure | |
| DE2139574A1 (de) | Verfahren zur Herstellung von Phenylestern aliphatischer Carbonsäuren | |
| CH619442A5 (en) | Process for the preparation of a mixture of acrolein and acrylic acid, or methacrolein and methacrylic acid. | |
| DE2437154A1 (de) | Verfahren zur herstellung von maleinsaeureanhydrid | |
| DE1811062A1 (de) | Verfahren zur Herstellung von Acrylnitril | |
| DE2941341C2 (de) | Verfahren zur Herstellung von Methacrolein | |
| DE2263009A1 (de) | Modifizierte p-v-fe-katalysatoren zur herstellung von maleinsaeureanhydrid aus gesaettigten aliphatischen kohlenwasserstoffen | |
| DE2931154A1 (de) | Verfahren zur herstellung von carbonsaeuren aus aldehyden | |
| DE2357564C2 (de) | Katalysator und Verfahren zur Herstellung von Methyläthylketon | |
| DE1668472C (OSRAM) | ||
| DD237833A5 (de) | Verfahren zur oxydation ungesaettigter aldehyde und katalysator hierfuer | |
| DE2456113A1 (de) | Verfahren zur herstellung von methylacrylat oder gemischen hiervon mit akrylsaeure | |
| DE2328027C2 (de) | Verfahren zur Herstellung von Dicarbonsäureanhydriden | |
| DE2429095A1 (de) | Verfahren zur herstellung von methacrylsaeure | |
| DE2418281B2 (de) | Katalysator und seine Verwendung zur Herstellung von Maleinsäureanhydrid | |
| DE1668472B1 (de) | Verfahren zur Herstellung von Pyromellithsaeure | |
| DE2554648C3 (de) | Verfahren zur Herstellung von Methacrolein | |
| DE2541571A1 (de) | Verfahren zur herstellung von methacrylsaeure |