DE1644052A1 - Verfahren zur Herstellung von neuen,wasserunloeslichen Azofarbstoffen - Google Patents
Verfahren zur Herstellung von neuen,wasserunloeslichen AzofarbstoffenInfo
- Publication number
- DE1644052A1 DE1644052A1 DE19671644052 DE1644052A DE1644052A1 DE 1644052 A1 DE1644052 A1 DE 1644052A1 DE 19671644052 DE19671644052 DE 19671644052 DE 1644052 A DE1644052 A DE 1644052A DE 1644052 A1 DE1644052 A1 DE 1644052A1
- Authority
- DE
- Germany
- Prior art keywords
- parts
- nitro
- diphenylamine
- phenyl
- chloro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000987 azo dye Substances 0.000 title claims description 5
- 238000000034 method Methods 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 150000008049 diazo compounds Chemical class 0.000 claims description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical class C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 230000008878 coupling Effects 0.000 claims 1
- 238000010168 coupling process Methods 0.000 claims 1
- 238000005859 coupling reaction Methods 0.000 claims 1
- -1 carbomethoxy, carboethoxy Chemical group 0.000 description 41
- 229920000728 polyester Polymers 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 244000172533 Viola sororia Species 0.000 description 9
- 239000000975 dye Substances 0.000 description 9
- 239000010979 ruby Substances 0.000 description 9
- 229910001750 ruby Inorganic materials 0.000 description 9
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 125000005521 carbonamide group Chemical group 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 3
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 2
- 125000001917 2,4-dinitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1*)[N+]([O-])=O)[N+]([O-])=O 0.000 description 2
- MGCGMYPNXAFGFA-UHFFFAOYSA-N 2-amino-5-nitrobenzonitrile Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C#N MGCGMYPNXAFGFA-UHFFFAOYSA-N 0.000 description 2
- LOCWBQIWHWIRGN-UHFFFAOYSA-N 2-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Cl LOCWBQIWHWIRGN-UHFFFAOYSA-N 0.000 description 2
- XTTIQGSLJBWVIV-UHFFFAOYSA-N 2-methyl-4-nitroaniline Chemical compound CC1=CC([N+]([O-])=O)=CC=C1N XTTIQGSLJBWVIV-UHFFFAOYSA-N 0.000 description 2
- SQBCSDZTDXLTLE-UHFFFAOYSA-N 5-nitro-2,1-benzothiazol-3-amine Chemical compound C1=CC([N+]([O-])=O)=CC2=C(N)SN=C21 SQBCSDZTDXLTLE-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- WSOKDJIYZFTESL-UHFFFAOYSA-N (1-nitrocyclohexa-2,4-dien-1-yl)-phenyldiazene Chemical compound C=1C=CC=CC=1N=NC1([N+](=O)[O-])CC=CC=C1 WSOKDJIYZFTESL-UHFFFAOYSA-N 0.000 description 1
- RUSQDYCVIFJQSH-UHFFFAOYSA-N (2-bromophenyl)cyanamide Chemical compound BrC1=CC=CC=C1NC#N RUSQDYCVIFJQSH-UHFFFAOYSA-N 0.000 description 1
- CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical compound C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 description 1
- QUKGLNCXGVWCJX-UHFFFAOYSA-N 1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=CS1 QUKGLNCXGVWCJX-UHFFFAOYSA-N 0.000 description 1
- YDTDKKULPWTHRV-UHFFFAOYSA-N 1H-indazol-3-amine Chemical class C1=CC=C2C(N)=NNC2=C1 YDTDKKULPWTHRV-UHFFFAOYSA-N 0.000 description 1
- LXQOQPGNCGEELI-UHFFFAOYSA-N 2,4-dinitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O LXQOQPGNCGEELI-UHFFFAOYSA-N 0.000 description 1
- YMZIFDLWYUSZCC-UHFFFAOYSA-N 2,6-dibromo-4-nitroaniline Chemical compound NC1=C(Br)C=C([N+]([O-])=O)C=C1Br YMZIFDLWYUSZCC-UHFFFAOYSA-N 0.000 description 1
- XVYNBLCPQVDRCH-UHFFFAOYSA-N 2-amino-3-chloro-5-nitrobenzonitrile Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1C#N XVYNBLCPQVDRCH-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- KWMDHCLJYMVBNS-UHFFFAOYSA-N 2-bromo-4,6-dinitroaniline Chemical compound NC1=C(Br)C=C([N+]([O-])=O)C=C1[N+]([O-])=O KWMDHCLJYMVBNS-UHFFFAOYSA-N 0.000 description 1
- CGPPWNTVTNCHDO-UHFFFAOYSA-N 2-bromo-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Br CGPPWNTVTNCHDO-UHFFFAOYSA-N 0.000 description 1
- LHRIICYSGQGXSX-UHFFFAOYSA-N 2-chloro-4,6-dinitroaniline Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1[N+]([O-])=O LHRIICYSGQGXSX-UHFFFAOYSA-N 0.000 description 1
- GVBHRNIWBGTNQA-UHFFFAOYSA-N 2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC=C1N GVBHRNIWBGTNQA-UHFFFAOYSA-N 0.000 description 1
- JSIAIROWMJGMQZ-UHFFFAOYSA-N 2h-triazol-4-amine Chemical class NC1=CNN=N1 JSIAIROWMJGMQZ-UHFFFAOYSA-N 0.000 description 1
- SVHJZUGMXGVZOE-UHFFFAOYSA-N 4-[(2,4-dinitrophenyl)diazenyl]-3-methylaniline Chemical compound CC1=CC(N)=CC=C1N=NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O SVHJZUGMXGVZOE-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- QPQKUYVSJWQSDY-UHFFFAOYSA-N 4-phenyldiazenylaniline Chemical compound C1=CC(N)=CC=C1N=NC1=CC=CC=C1 QPQKUYVSJWQSDY-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- KZHGPDSVHSDCMX-UHFFFAOYSA-N 6-methoxy-1,3-benzothiazol-2-amine Chemical compound COC1=CC=C2N=C(N)SC2=C1 KZHGPDSVHSDCMX-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- ABDMQSFNJPYOLA-UHFFFAOYSA-N NS(=O)(=O)[N+]([O-])=O Chemical compound NS(=O)(=O)[N+]([O-])=O ABDMQSFNJPYOLA-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 241001123003 Viola palustris Species 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- POJOORKDYOPQLS-UHFFFAOYSA-L barium(2+) 5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate Chemical compound [Ba+2].C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O.C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O POJOORKDYOPQLS-UHFFFAOYSA-L 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- BIXZHMJUSMUDOQ-UHFFFAOYSA-N dichloran Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1Cl BIXZHMJUSMUDOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ILGQIWVECKRNLJ-UHFFFAOYSA-N nitroso hydrogen sulfate;sulfuric acid Chemical compound OS(O)(=O)=O.OS(=O)(=O)ON=O ILGQIWVECKRNLJ-UHFFFAOYSA-N 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 208000027765 speech disease Diseases 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 1
- 239000010981 turquoise Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/0025—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB0090909 | 1967-01-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1644052A1 true DE1644052A1 (de) | 1971-03-25 |
Family
ID=6985549
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671644052 Pending DE1644052A1 (de) | 1967-01-26 | 1967-01-26 | Verfahren zur Herstellung von neuen,wasserunloeslichen Azofarbstoffen |
Country Status (4)
| Country | Link |
|---|---|
| CH (1) | CH488784A (enExample) |
| DE (1) | DE1644052A1 (enExample) |
| FR (1) | FR1551802A (enExample) |
| GB (1) | GB1202984A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4179435A (en) * | 1971-05-03 | 1979-12-18 | Ciba-Geigy Corporation | Azo dyestuffs having a carboxyl group and a substituted sulfonylimino group in the coupling component |
| CH561251A5 (enExample) * | 1971-05-03 | 1975-04-30 | Ciba Geigy Ag | |
| JPS6027695B2 (ja) * | 1977-03-15 | 1985-07-01 | バイエル・アクチエンゲゼルシヤフト | アゾ化合物 |
| GB2031927A (en) * | 1978-09-08 | 1980-04-30 | Ici Ltd | Dyestuffs |
| DE3164291D1 (en) * | 1980-04-30 | 1984-07-26 | Ciba Geigy Ag | Azo dyestuffs, methods for their preparation and their use as colouring agents in photographic materials in the silver dyestuff bleaching process, and the said photographic materials containing these azo dyestuffs |
| EP0093926B1 (de) * | 1982-05-06 | 1985-08-07 | Bayer Ag | Azofarbstoffe |
| DE4021960A1 (de) * | 1990-07-10 | 1992-01-16 | Basf Ag | Thiophenazofarbstoffe |
| CN103525121B (zh) * | 2013-09-10 | 2015-12-23 | 江苏亚邦染料股份有限公司 | 一类偶氮二苯胺型分散染料及其应用 |
-
1967
- 1967-01-26 DE DE19671644052 patent/DE1644052A1/de active Pending
-
1968
- 1968-01-22 CH CH90668A patent/CH488784A/de not_active IP Right Cessation
- 1968-01-25 GB GB392568A patent/GB1202984A/en not_active Expired
- 1968-01-25 FR FR1551802D patent/FR1551802A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH488784A (de) | 1970-04-15 |
| GB1202984A (en) | 1970-08-26 |
| FR1551802A (enExample) | 1968-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1644052A1 (de) | Verfahren zur Herstellung von neuen,wasserunloeslichen Azofarbstoffen | |
| DE4335261C2 (de) | Dispersionsfarbstoffe | |
| DE2050657C3 (de) | Azofarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung | |
| CH689353A5 (de) | Dispersionsfarbstoffe. | |
| DE1644150A1 (de) | Wasserunloesliche Azofarbstoffe und Verfahren zu deren Herstellung und Verwendung | |
| DE2801951A1 (de) | Azofarbstoffe | |
| DE1644175C3 (de) | Sulfonsäure- und carbonsäurefreie Azofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung | |
| DE1444655A1 (de) | Verfahren zur Herstellung von Chrommischkomplex-Azofarbstoffen | |
| DE3016301A1 (de) | Wasserunloesliche azofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2205062C3 (de) | Wasserunlösliche Azofarbstoffe, Verfahren zu ihrer Herstellung und Verwendung | |
| DE1644129B2 (de) | Wasserunlösliche Monoazofarbstoffe und Verfahren zum Färben von Polyesterfasern | |
| DE1153840B (de) | Verfahren zur Herstellung wasserunloeslicher Azofarbstoffe | |
| DE1922901C3 (de) | Azofarbstoffe, enthaltend einen Sulfolanylpyrazolrest | |
| DE19624505A1 (de) | Dispersionsfarbstoffe | |
| DE1644122B2 (de) | Sulfonsaeure- und carbonsaeuregruppenfreie wasserunloesliche monoazofarbstoffe und verfahren zu ihrer herstellung | |
| DE1644093A1 (de) | Verfahren zur Herstellung von wasserloeslichen basischen Azofarbstoffen | |
| DE1644094C3 (de) | Wasserunlösliche Azofarbstoffe | |
| DE1544600C (de) | Monoazofarbstoffe sowie Ver fahren zu ihrer Herstellung und Verwendung | |
| DE1135588B (de) | Verfahren zur Herstellung von wasserunloeslichen p-Aminoazofarbstoffen | |
| DE1644221C3 (de) | Wasserunlösliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung | |
| DE1644122C3 (de) | Sulfonsäure- und carbonsäuregruppenfreie wasserunlösliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung | |
| CH352070A (de) | Verfahren zur Herstellung von wasserunlöslichen Monoazofarbstoffen | |
| DE2051023A1 (en) | Mono and dis-azo dyes - of the benzimidazole series contg sulphonic acid gps | |
| DE2437274A1 (de) | Neue, wasserunloesliche azofarbstoffe und verfahren zu ihrer herstellung | |
| DE1644234A1 (de) | Neue wasserunloesliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung |