DE1618578C - - Google Patents
Info
- Publication number
- DE1618578C DE1618578C DE1618578C DE 1618578 C DE1618578 C DE 1618578C DE 1618578 C DE1618578 C DE 1618578C
- Authority
- DE
- Germany
- Prior art keywords
- peroxydicarbonates
- tert
- substituted
- decomposition
- peroxydicarbonate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- -1 tert-amyl Chemical group 0.000 claims description 8
- 125000005634 peroxydicarbonate group Chemical group 0.000 claims description 7
- BLCKNMAZFRMCJJ-UHFFFAOYSA-N cyclohexyl cyclohexyloxycarbonyloxy carbonate Chemical class C1CCCCC1OC(=O)OOC(=O)OC1CCCCC1 BLCKNMAZFRMCJJ-UHFFFAOYSA-N 0.000 claims description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 238000000354 decomposition reaction Methods 0.000 description 9
- 239000007858 starting material Substances 0.000 description 4
- BEQKKZICTDFVMG-UHFFFAOYSA-N 1,2,3,4,6-pentaoxepane-5,7-dione Chemical compound O=C1OOOOC(=O)O1 BEQKKZICTDFVMG-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- BGVTUNYGVHSKMD-UHFFFAOYSA-N (4-cyclohexylcyclohexyl) (4-cyclohexylcyclohexyl)oxycarbonyloxy carbonate Chemical compound C(=O)(OC1CCC(CC1)C1CCCCC1)OOC(=O)OC1CCC(CC1)C1CCCCC1 BGVTUNYGVHSKMD-UHFFFAOYSA-N 0.000 description 1
- VNPCSRKMRZPBBO-UHFFFAOYSA-N (4-propan-2-ylcyclohexyl) (4-propan-2-ylcyclohexyl)oxycarbonyloxy carbonate Chemical compound C(=O)(OC1CCC(CC1)C(C)C)OOC(=O)OC1CCC(CC1)C(C)C VNPCSRKMRZPBBO-UHFFFAOYSA-N 0.000 description 1
- QWIQFVKKPYUHAT-UHFFFAOYSA-N (4-propan-2-ylcyclohexyl) carbonochloridate Chemical compound CC(C)C1CCC(OC(Cl)=O)CC1 QWIQFVKKPYUHAT-UHFFFAOYSA-N 0.000 description 1
- YXFSGPPQRCUVRL-UHFFFAOYSA-N (4-tert-butylcyclohexyl) carbonochloridate Chemical compound CC(C)(C)C1CCC(OC(Cl)=O)CC1 YXFSGPPQRCUVRL-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- KIWBRXCOTCXSSZ-UHFFFAOYSA-N hexyl carbonochloridate Chemical compound CCCCCCOC(Cl)=O KIWBRXCOTCXSSZ-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE851496C (de) | Verfahren zur Herstellung symmetrischer oder unsymmetrischer aliphatischer, ditertiaerer Peroxyde | |
| EP0114394B1 (de) | Verfahren zur Herstellung von Polymerisaten der Vinylphosphonsäure in protischen Lösungsmitteln | |
| DE1618578B1 (de) | 4 4 substituierte Dycyclohexylperoxy dikarbonate und deren Herstellung | |
| DE60314848T2 (de) | Polymerisationsverfahren mit diacylperoxiden | |
| DE3884307T2 (de) | Verfahren zur Herstellung von Cyclohexanon-oxim. | |
| DE1618578C (cg-RX-API-DMAC10.html) | ||
| DE1030831B (de) | Verfahren zur Herstellung tertiaerer aromatischer Hydroperoxyde | |
| DE69701591T2 (de) | Stabilisierung von organischen Peroxiden mit Alpha-hydroxyalkylperoxiden | |
| DE861156C (de) | Verfahren zur Herstellung von Polymerisaten oder Mischpolymerisaten ungesaettigter Verbindungen | |
| DE69704836T2 (de) | Verfahren zur Herstellung von Benzoylchloriden | |
| DE69703001T2 (de) | Stabilisierung von organischen Peroxiden mit Beta-dicarbonyl oder Alpha-diketon Verbindungen | |
| DE1232582B (de) | Verfahren zur Herstellung von 3, 3-Bis-(hydro-peroxy-tert.-butyl)-butan-1-carbonsaeureestern | |
| DE871011C (de) | Verfahren zur Herstellung von ª‰-Isopropylnaphthalinhydroperoxyd | |
| DE1815142B2 (de) | Verfahren zur Polymerisation von Vinylchlorid | |
| DE1927761B2 (de) | Verfahren zur polymerisation olefinisch ungesaettigter ver bindungen | |
| DE1280246C2 (de) | Verfahren zur herstellung von 3,3,5-trimethyl-cyclohexanonperoxyden | |
| EP0970048B1 (de) | T-butylperoxy-cyclododecyl-oxalat | |
| DE1131407B (de) | Verfahren zur Polymerisation ungesaettigter Verbindungen | |
| DE968650C (de) | Verwendung von Emulgiermitteln bei der Emulsionspolymerisation | |
| DE2528062A1 (de) | Verfahren zur herstellung von homo- oder mischpolymerisaten von vinylchlorid durch emulsionspolymerisation | |
| DE1170641B (de) | Verfahren zur Polymerisation von olefinisch ungesaettigten Verbindungen | |
| DE1922183C3 (de) | Organische Perester | |
| DE2349314A1 (de) | Verfahren zur herstellung von dibenzothiazolyldisulfid | |
| AT293020B (de) | Verfahren zur Massenpolymerisation von Vinylchlorid | |
| DE1268845B (de) | Verfahren zum Herstellen von Vinylchlorid-Vinylidenchlorid-Mischpolymerisaten |