DE1618180A1 - Verfahren zur reduktiven Dimerisierung,alpha,ss-olefinischer Nitrile,Amide oder Ester - Google Patents
Verfahren zur reduktiven Dimerisierung,alpha,ss-olefinischer Nitrile,Amide oder EsterInfo
- Publication number
- DE1618180A1 DE1618180A1 DE19671618180 DE1618180A DE1618180A1 DE 1618180 A1 DE1618180 A1 DE 1618180A1 DE 19671618180 DE19671618180 DE 19671618180 DE 1618180 A DE1618180 A DE 1618180A DE 1618180 A1 DE1618180 A1 DE 1618180A1
- Authority
- DE
- Germany
- Prior art keywords
- olefinic
- esters
- amides
- amalgam
- alpha
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 12
- 150000002825 nitriles Chemical class 0.000 title claims description 4
- 238000006456 reductive dimerization reaction Methods 0.000 title claims description 4
- 150000001408 amides Chemical class 0.000 title description 3
- 150000002148 esters Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 20
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 claims description 16
- 229910000497 Amalgam Inorganic materials 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 239000004312 hexamethylene tetramine Substances 0.000 claims description 8
- 235000010299 hexamethylene tetramine Nutrition 0.000 claims description 8
- 239000003513 alkali Substances 0.000 claims description 6
- 238000006845 Michael addition reaction Methods 0.000 claims description 4
- 150000003857 carboxamides Chemical class 0.000 claims description 3
- 150000001733 carboxylic acid esters Chemical class 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 10
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- -1 acrylic ester Chemical class 0.000 description 5
- 239000001569 carbon dioxide Substances 0.000 description 5
- 229910002092 carbon dioxide Inorganic materials 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910001023 sodium amalgam Inorganic materials 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 150000001342 alkaline earth metals Chemical class 0.000 description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 3
- 229910052753 mercury Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- BTGRAWJCKBQKAO-UHFFFAOYSA-N adiponitrile Chemical compound N#CCCCCC#N BTGRAWJCKBQKAO-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 229960004592 isopropanol Drugs 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 2
- NQQRXZOPZBKCNF-NSCUHMNNSA-N (e)-but-2-enamide Chemical compound C\C=C\C(N)=O NQQRXZOPZBKCNF-NSCUHMNNSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical class CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000007862 dimeric product Substances 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000001139 pH measurement Methods 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 150000007519 polyprotic acids Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US737393A US3557186A (en) | 1967-06-20 | 1968-06-17 | Reductive dimerization of acrylonitrile |
| FR1569389D FR1569389A (cs) | 1967-06-20 | 1968-06-19 | |
| GB29132/68A GB1220957A (en) | 1967-06-20 | 1968-06-19 | REDUCTIVE DIMERIZATION OF alpha,beta-OLEFINIC NITRILES, AMIDES OR ESTERS |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB0093098 | 1967-06-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1618180A1 true DE1618180A1 (de) | 1970-12-10 |
Family
ID=6986764
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671618180 Pending DE1618180A1 (de) | 1967-06-20 | 1967-06-20 | Verfahren zur reduktiven Dimerisierung,alpha,ss-olefinischer Nitrile,Amide oder Ester |
Country Status (3)
| Country | Link |
|---|---|
| BE (1) | BE716833A (cs) |
| DE (1) | DE1618180A1 (cs) |
| NL (1) | NL6808503A (cs) |
-
1967
- 1967-06-20 DE DE19671618180 patent/DE1618180A1/de active Pending
-
1968
- 1968-06-17 NL NL6808503A patent/NL6808503A/xx unknown
- 1968-06-19 BE BE716833D patent/BE716833A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6808503A (cs) | 1968-12-23 |
| BE716833A (cs) | 1968-12-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2040094A1 (de) | Verfahren zur Herstellung von Bismaleinimiden | |
| CH351791A (de) | Fungizides Mittel | |
| DE2130919B2 (de) | Substituierte diphenylaether, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE1618180A1 (de) | Verfahren zur reduktiven Dimerisierung,alpha,ss-olefinischer Nitrile,Amide oder Ester | |
| DE2128985C3 (de) | Stabilisierte Klebstoffe | |
| DE713811C (de) | Verfahren zur Darstellung von Nitrilen | |
| DE1169438B (de) | Verfahren zur Herstellung von Derivaten des ªÏ-Hydroxytiglinaldehyds | |
| DE234912C (cs) | ||
| DE2029561C3 (de) | Verfahren zur Herstellung von a- und ß-Ionon | |
| DE1805989C3 (de) | Verfahren zur Herstellung von NAI kylpyrrolen | |
| DE836039C (de) | Verfahren zur Chlorierung von Essigsaeure | |
| DE2308941C3 (de) | Verfahren zur Herstellung von Oxamid | |
| DE255031C (cs) | ||
| DE1185170B (de) | Verfahren zur Herstellung von alpha,beta-Dichlorpropionsaeuremethylester | |
| DE1917048B2 (de) | 2,5-Di-tert.-butyl-3,4-diäthoxycarbonylpyrrol-1-oxyl und Verfahren zur Herstellung desselben | |
| DE2736258C2 (de) | Verfahren zur Herstellung von Estern der Cyclopropancarbonsäure | |
| DE410471C (de) | Verfahren zur Darstellung substituierter Amide der Cyanthiokohlensaeure | |
| DE1253704B (de) | Verfahren zur Herstellung ungesaettigter Carbonsaeurenitrile | |
| DE1795463A1 (de) | Verfahren zur Herstellung von 3,4-Dihalogen-1,2,5-thiadiazolen | |
| DE2502656A1 (de) | Sulfenamide, deren herstellung und verwendung als vulkanisationsverzoegerer | |
| AT254853B (de) | Verfahren zur Halogenierung der kernständigen Methylgruppe(n) von Methylphenylacetaten | |
| DE886910C (de) | Verfahren zur Herstellung von Dimeren aus Monohalogenolefinen von der Art des Isobutenylchlorids | |
| DE852996C (de) | Verfahren zur Herstellung von Gemischen aus Acetylisoaepfelsaeure-dinitril und ª‡-Acetoxyacrylsaeurenitril | |
| DE637730C (de) | Verfahren zur Herstellung von N-Alkylderivaten des Ammoniaks | |
| DE2316320A1 (de) | Verfahren zur herstellung von 5-amino-2-(beta-cyanoaethyl)-5-cyclohexen-1-on |