DE1593359A1 - Verfahren zur Herstellung von Diamidoadamantanverbindungen - Google Patents
Verfahren zur Herstellung von DiamidoadamantanverbindungenInfo
- Publication number
- DE1593359A1 DE1593359A1 DE19661593359 DE1593359A DE1593359A1 DE 1593359 A1 DE1593359 A1 DE 1593359A1 DE 19661593359 DE19661593359 DE 19661593359 DE 1593359 A DE1593359 A DE 1593359A DE 1593359 A1 DE1593359 A1 DE 1593359A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- adamantane
- sulfuric acid
- carbon atoms
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical class C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 title claims description 43
- 238000000034 method Methods 0.000 title claims description 27
- 238000002360 preparation method Methods 0.000 title claims description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 54
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 34
- -1 Dihydroxyalkyl adamantane Chemical compound 0.000 claims description 30
- 239000000203 mixture Substances 0.000 claims description 30
- 150000001875 compounds Chemical class 0.000 claims description 27
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 229930195733 hydrocarbon Natural products 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- RVIZJROSQMQZCG-UHFFFAOYSA-N adamantane-1,2-diol Chemical compound C1C(C2)CC3CC1C(O)C2(O)C3 RVIZJROSQMQZCG-UHFFFAOYSA-N 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 239000012141 concentrate Substances 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 101001034845 Mus musculus Interferon-induced transmembrane protein 3 Proteins 0.000 claims 1
- 229940125773 compound 10 Drugs 0.000 claims 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- 239000000047 product Substances 0.000 description 29
- 238000006243 chemical reaction Methods 0.000 description 23
- 239000002253 acid Substances 0.000 description 21
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 21
- 150000002009 diols Chemical class 0.000 description 20
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 239000000376 reactant Substances 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 4
- 125000000950 dibromo group Chemical group Br* 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000003368 amide group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- RTPQXHZLCUUIJP-UHFFFAOYSA-N 1,2-dimethyladamantane Chemical compound C1C(C2)CC3CC1C(C)C2(C)C3 RTPQXHZLCUUIJP-UHFFFAOYSA-N 0.000 description 2
- CWNOIUTVJRWADX-UHFFFAOYSA-N 1,3-dimethyladamantane Chemical compound C1C(C2)CC3CC1(C)CC2(C)C3 CWNOIUTVJRWADX-UHFFFAOYSA-N 0.000 description 2
- AZCUIXHZJHFUFI-UHFFFAOYSA-N 1-butyladamantane Chemical compound C1C(C2)CC3CC2CC1(CCCC)C3 AZCUIXHZJHFUFI-UHFFFAOYSA-N 0.000 description 2
- RYSBQFDFWKTQMS-UHFFFAOYSA-N 1-heptyl-3-methyladamantane Chemical compound CC12CC3(CC(CC(C1)C3)C2)CCCCCCC RYSBQFDFWKTQMS-UHFFFAOYSA-N 0.000 description 2
- HLPGROQBOXGCNB-UHFFFAOYSA-N 2,3-dimethyladamantane-1,2-diol Chemical compound C1C(C2)CC3CC1(C)C(O)(C)C2(O)C3 HLPGROQBOXGCNB-UHFFFAOYSA-N 0.000 description 2
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000003963 dichloro group Chemical group Cl* 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 238000003822 preparative gas chromatography Methods 0.000 description 2
- 230000000391 smoking effect Effects 0.000 description 2
- 238000003797 solvolysis reaction Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- MPDDTAJMJCESGV-CTUHWIOQSA-M (3r,5r)-7-[2-(4-fluorophenyl)-5-[methyl-[(1r)-1-phenylethyl]carbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate Chemical compound C1([C@@H](C)N(C)C(=O)C2=NN(C(CC[C@@H](O)C[C@@H](O)CC([O-])=O)=C2C(C)C)C=2C=CC(F)=CC=2)=CC=CC=C1 MPDDTAJMJCESGV-CTUHWIOQSA-M 0.000 description 1
- NFGBDPRGBGRGQD-UHFFFAOYSA-N 1,2-dibromo-2,3-dimethyladamantane Chemical compound C1C(C2)CC3CC1(C)C(Br)(C)C2(Br)C3 NFGBDPRGBGRGQD-UHFFFAOYSA-N 0.000 description 1
- QPLRBWJKWVOFOR-UHFFFAOYSA-N 1,2-dibromoadamantane Chemical compound C1C(C2)CC3CC1C(Br)C2(Br)C3 QPLRBWJKWVOFOR-UHFFFAOYSA-N 0.000 description 1
- HLWZKLMEOVIWRK-UHFFFAOYSA-N 1,3-dibromoadamantane Chemical compound C1C(C2)CC3CC1(Br)CC2(Br)C3 HLWZKLMEOVIWRK-UHFFFAOYSA-N 0.000 description 1
- PGBGRFOBTPKZNU-UHFFFAOYSA-N 1,3-dipentyladamantane Chemical compound C1C(C2)CC3CC1(CCCCC)CC2(CCCCC)C3 PGBGRFOBTPKZNU-UHFFFAOYSA-N 0.000 description 1
- LOVSGPXFIZDSNE-UHFFFAOYSA-N 1-decyladamantane Chemical compound C1C(C2)CC3CC2CC1(CCCCCCCCCC)C3 LOVSGPXFIZDSNE-UHFFFAOYSA-N 0.000 description 1
- HUCLCMAVGXHPPK-UHFFFAOYSA-N 1-ethyl-3-methyladamantane Chemical compound C1C(C2)CC3CC2(C)CC1(CC)C3 HUCLCMAVGXHPPK-UHFFFAOYSA-N 0.000 description 1
- QDGGAPZDLUDOQU-UHFFFAOYSA-N 1-ethyladamantane Chemical group C1C(C2)CC3CC2CC1(C[CH2])C3 QDGGAPZDLUDOQU-UHFFFAOYSA-N 0.000 description 1
- UZUCFTVAWGRMTQ-UHFFFAOYSA-N 1-methyladamantane Chemical group C1C(C2)CC3CC2CC1(C)C3 UZUCFTVAWGRMTQ-UHFFFAOYSA-N 0.000 description 1
- CVGQRWVZZMXSHI-UHFFFAOYSA-N 1-pentyladamantane Chemical compound C1C(C2)CC3CC2CC1(CCCCC)C3 CVGQRWVZZMXSHI-UHFFFAOYSA-N 0.000 description 1
- ISDSLPMQFWIUPU-UHFFFAOYSA-N 1-propan-2-yladamantane Chemical compound C1C(C2)CC3CC2CC1(C(C)C)C3 ISDSLPMQFWIUPU-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- CNIIGCLFLJGOGP-UHFFFAOYSA-N 2-(1-naphthalenylmethyl)-4,5-dihydro-1H-imidazole Chemical compound C=1C=CC2=CC=CC=C2C=1CC1=NCCN1 CNIIGCLFLJGOGP-UHFFFAOYSA-N 0.000 description 1
- LIAWCKFOFPPVGF-UHFFFAOYSA-N 2-ethyladamantane Chemical compound C1C(C2)CC3CC1C(CC)C2C3 LIAWCKFOFPPVGF-UHFFFAOYSA-N 0.000 description 1
- UZDXATQPJOOHQJ-UHFFFAOYSA-N 2-ethylbenzonitrile Chemical compound CCC1=CC=CC=C1C#N UZDXATQPJOOHQJ-UHFFFAOYSA-N 0.000 description 1
- VMODAALDMAYACB-UHFFFAOYSA-N 2-methyladamantane Chemical compound C1C(C2)CC3CC1C(C)C2C3 VMODAALDMAYACB-UHFFFAOYSA-N 0.000 description 1
- XBEASOYYZMDTHZ-UHFFFAOYSA-N 2-methylbutanenitrile Chemical compound CCC([CH2])C#N XBEASOYYZMDTHZ-UHFFFAOYSA-N 0.000 description 1
- ACRWYXSKEHUQDB-UHFFFAOYSA-N 3-phenylpropionitrile Chemical compound N#CCCC1=CC=CC=C1 ACRWYXSKEHUQDB-UHFFFAOYSA-N 0.000 description 1
- 241001436679 Adama Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241001070941 Castanea Species 0.000 description 1
- 235000014036 Castanea Nutrition 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 241000662429 Fenerbahce Species 0.000 description 1
- 241000694408 Isomeris Species 0.000 description 1
- 241001274216 Naso Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229940054066 benzamide antipsychotics Drugs 0.000 description 1
- 150000003936 benzamides Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- WVIRSYCDAYUOMJ-UHFFFAOYSA-N n-(3,5-dimethyl-1-adamantyl)acetamide Chemical compound C1C(C2)CC3(C)CC2(C)CC1(NC(=O)C)C3 WVIRSYCDAYUOMJ-UHFFFAOYSA-N 0.000 description 1
- IDKMCHZWZPAIGE-UHFFFAOYSA-N n-(3-acetamido-1-adamantyl)acetamide Chemical compound C1C(C2)CC3CC1(NC(=O)C)CC2(NC(C)=O)C3 IDKMCHZWZPAIGE-UHFFFAOYSA-N 0.000 description 1
- MSQGNHPUFDAVHW-UHFFFAOYSA-N n-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide Chemical compound C1C(C2)(C)CC3(C)CC1(NC(=O)C)CC2(NC(C)=O)C3 MSQGNHPUFDAVHW-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000009304 pastoral farming Methods 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/02—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US45016965A | 1965-04-22 | 1965-04-22 | |
| US45001665A | 1965-04-22 | 1965-04-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1593359A1 true DE1593359A1 (de) | 1970-07-30 |
Family
ID=27035894
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661593359 Pending DE1593359A1 (de) | 1965-04-22 | 1966-04-22 | Verfahren zur Herstellung von Diamidoadamantanverbindungen |
Country Status (3)
| Country | Link |
|---|---|
| BE (1) | BE679961A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1593359A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1108335A (cg-RX-API-DMAC7.html) |
-
1966
- 1966-02-22 GB GB776766A patent/GB1108335A/en not_active Expired
- 1966-04-22 DE DE19661593359 patent/DE1593359A1/de active Pending
- 1966-04-22 BE BE679961D patent/BE679961A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE679961A (cg-RX-API-DMAC7.html) | 1966-10-24 |
| GB1108335A (en) | 1968-04-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2251097C3 (de) | Verfahren zur Gewinnung eines Gemisches von (+)-cis- und (+)-trans-Chrysanthemummonocarbonsäure | |
| DE1593865B2 (de) | Verfahren zur Isolierung von 4,4'-Diaminodiphenylmethan aus Polyphenylmethylenpolyamingemi sehen | |
| DE1593359A1 (de) | Verfahren zur Herstellung von Diamidoadamantanverbindungen | |
| DE2303115C3 (de) | Verfahren zur Chlorierung der Seitenketten von Toluol, Xylol, Trimethylbenzol und substituierten Produkten dieser Verbindungen | |
| DE1818020A1 (de) | Verfahren zur herstellung von 1,2-disubstituiertem hydrazin | |
| DE1518417A1 (de) | Verfahren zur Herstellung von 4,4'-Bis (aminophenyl)methan | |
| DE2527157C2 (de) | Verfahren zur Herstellung von 2-Formylchinoxalin-N↑1↑,N↑4↑-dioxyddimethylacetal | |
| DE3431826A1 (de) | Verfahren zur herstellung aromatischer bromverbindungen | |
| DE1545532A1 (de) | Verfahren zur Herstellung von epsilon-Capro-lactamderivaten | |
| DE2060329C3 (de) | Verfahren zur Herstellung von substituierten Benzamiden | |
| DE1205107B (de) | Verfahren zum Herstellen eines Clathrations-mittels des Werner-Komplex-Verbindungstypes | |
| DE2750951A1 (de) | Verfahren zur herstellung aromatischer substituierter amine | |
| DE2049560C3 (de) | Verfahren zur Herstellung von I,T-Peroxydicyclohexylaniin | |
| DE2130296C3 (de) | Verfahren zur Herstellung von Bromderivaten des Hexamethylbenzols | |
| DE2202720A1 (de) | Verfahren zur Herstellung von 1,2-Di-(o-oder p-nitrophenyl)-aethanol | |
| AT214440B (de) | Verfahren zur Herstellung von 3-Iminoisoindolin-1-onen | |
| AT269369B (de) | Verfahren zur Herstellung von neuen Isoajmalinderivaten | |
| DE932671C (de) | Verfahren zur Herstellung von 1, 2, 4, 5, 6, 7, 8, 8-Octachlor-3a, 4, 7, 7a-tetrahydro-4, 7-endomethylenindan (Chlordan) | |
| AT216511B (de) | Verfahren zur Herstellung von 1,2,4-Benzothiadiazin-1,1-dioxydverbindungen | |
| DE2160673C3 (de) | Verfahren zur Herstellung von 4-Cyanoimidazol-5-carboxyamid bzw. S-Cyanoimidazol-4-carboxyamid | |
| DE2027043C3 (de) | Polychlorformyltriphenylphosphate und ihre Verwendung zur Herstellung von flammabweisenden Produkten | |
| AT225695B (de) | Verfahren zur Herstellung Bromderivaten gegebenenfalls substiuierter aromatischer Kohlenwasserstoffe mit 4 und mehr Bromatomen im Molekül | |
| AT232990B (de) | Verfahren zur Herstellung von neuen Diperoxyden | |
| DE2264638C2 (de) | 5'-Acetyl-2,2'-cyclocytidin-Derivate | |
| DE1919103A1 (de) | 1,2,3-substituierte 4,4,5,5-Tetra-alkyl-delta'-Dehydro- und -imidazolidine |