DE1542465C - - Google Patents
Info
- Publication number
- DE1542465C DE1542465C DE1542465C DE 1542465 C DE1542465 C DE 1542465C DE 1542465 C DE1542465 C DE 1542465C
- Authority
- DE
- Germany
- Prior art keywords
- benzoyl peroxide
- stearic acid
- dry
- shock
- finely divided
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000004342 Benzoyl peroxide Substances 0.000 claims description 14
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 claims description 14
- 235000019400 benzoyl peroxide Nutrition 0.000 claims description 14
- 235000021355 Stearic acid Nutrition 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 claims description 7
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 claims description 7
- 239000008117 stearic acid Substances 0.000 claims description 7
- 230000035939 shock Effects 0.000 claims description 5
- -1 benzoyl peroxide-stearic acid Chemical compound 0.000 claims description 3
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 150000002978 peroxides Chemical class 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 239000001045 blue dye Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 150000004671 saturated fatty acids Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE972816C (de) | Verfahren zur Herstellung klarer und im wesentlichen farbloser Loesungen von Acrylsaeurenitrilpolymeren | |
| DE2233338C3 (de) | Dispergiertes Präparat zur Verringerung des hydrodynamischen Fließwiderstandes | |
| DE69024127T2 (de) | Wässerige Peroxidzusammensetzungen mit verbessertem Sicherheitsprofil | |
| DE1303065B (enrdf_load_stackoverflow) | ||
| DE3210273C2 (enrdf_load_stackoverflow) | ||
| DE2244462B2 (de) | In Wasser stabile Titanchelate | |
| DE1542465C (enrdf_load_stackoverflow) | ||
| EP0153671B1 (de) | Stabilisierte, Wasser enthaltende, alkalisch eingestellte Natriumdithionitzubereitungen | |
| DE2220804B2 (de) | Feueranzünder | |
| DE1542465B1 (de) | Stossunempfindliches und nicht entflammbares Benzoylperoxid-Stearinsaeure-Gemisch | |
| DE1218884B (de) | Fluessiges Feuerloeschmittel | |
| DE1164591B (de) | Verfahren zur Stabilisierung von Kohlenwasserstoffen | |
| DE1226992B (de) | Gegen Brandgefahr durch Feuchtigkeits-einwirkung stabilisierte, Dithionite enthaltende Mischungen als Bleich- und Faerbehilfsmittel | |
| DE840821C (de) | Zuendsatz fuer brennbare Gase erzeugende Ladungen oder Heizmischungen von Sprengpatronen | |
| DE1183846B (de) | Sprenggemisch | |
| DE2047448A1 (de) | Additiv zur Viskositatserniedrigung in paraffinbasischen Rohölen | |
| DE1645094A1 (de) | Verfahren zum Polymerisieren von Methacrylsaeureestern | |
| DE945091C (de) | Schutzkolloide, Emulgier- bzw. Dispergiermittel | |
| US2144366A (en) | Oxidation inhibitor for insecticides | |
| US4084956A (en) | Barban formulation | |
| DE1294378B (de) | Stabilisierung von Trialkylboranen gegen spontanes Entflammen | |
| DE2156762A1 (de) | Fliessfaehige hektographenmassen | |
| DE2126920A1 (de) | Handhabungssichere Perchloratsprengstoffe | |
| DE2210347A1 (de) | Bakterizide Substanz | |
| DE1049871B (de) | Dispergiermittel mit Schutzkolloideigenschaften |