DE1468142C - - Google Patents
Info
- Publication number
- DE1468142C DE1468142C DE1468142C DE 1468142 C DE1468142 C DE 1468142C DE 1468142 C DE1468142 C DE 1468142C
- Authority
- DE
- Germany
- Prior art keywords
- cyclobutane
- chlorine
- reaction mixture
- chloro
- ester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 9
- 239000011541 reaction mixture Substances 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 150000002148 esters Chemical class 0.000 claims description 7
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 3
- 238000005658 halogenation reaction Methods 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 238000003756 stirring Methods 0.000 claims description 3
- 238000005660 chlorination reaction Methods 0.000 claims description 2
- CZPLUOCTUPJSIZ-UHFFFAOYSA-N cyclobutane-1,2-dicarbonitrile Chemical compound N#CC1CCC1C#N CZPLUOCTUPJSIZ-UHFFFAOYSA-N 0.000 claims description 2
- 230000026030 halogenation Effects 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims 3
- DPECEOKIDKPBCX-UHFFFAOYSA-N 1-chlorocyclobutane-1-carboxylic acid Chemical compound OC(=O)C1(Cl)CCC1 DPECEOKIDKPBCX-UHFFFAOYSA-N 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- JFWMYCVMQSLLOO-UHFFFAOYSA-N cyclobutanecarbonyl chloride Chemical compound ClC(=O)C1CCC1 JFWMYCVMQSLLOO-UHFFFAOYSA-N 0.000 claims 1
- 238000004508 fractional distillation Methods 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 230000007062 hydrolysis Effects 0.000 claims 1
- 238000006460 hydrolysis reaction Methods 0.000 claims 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- CCQPAEQGAVNNIA-UHFFFAOYSA-N cyclobutane-1,1-dicarboxylic acid Chemical compound OC(=O)C1(C(O)=O)CCC1 CCQPAEQGAVNNIA-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- LGAGUISFTUGUHO-UHFFFAOYSA-N 1,2-dibromocyclobutane Chemical class BrC1CCC1Br LGAGUISFTUGUHO-UHFFFAOYSA-N 0.000 description 1
- -1 1,2-dichloro-cyclobutane ester Chemical class 0.000 description 1
- RVHOBHMAPRVOLO-UHFFFAOYSA-N 2-ethylbutanedioic acid Chemical compound CCC(C(O)=O)CC(O)=O RVHOBHMAPRVOLO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- SUSAGCZZQKACKE-UHFFFAOYSA-N cyclobutane-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCC1C(O)=O SUSAGCZZQKACKE-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000010915 one-step procedure Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- OBSZRRSYVTXPNB-UHFFFAOYSA-N tetraphosphorus Chemical compound P12P3P1P32 OBSZRRSYVTXPNB-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2341572C2 (de) | Verfahren zur Herstellung einer äthylenisch ungesättigten Carbonsäure | |
| EP0706987B1 (de) | Verfahren zur Herstellung von alkylierten aromatischen Carbonsäuren und Carbonsäurehalogeniden | |
| DE2708182C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE1468142C (enExample) | ||
| DE2614240B2 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE1468142B (de) | Verfahren zur Herstellung von 1 Chlor und 1,2 Dichlor bzw 1 Brom und 1,2 Dibrom cyclobutan 1,2 dicarbonsäuren bzw deren Ester oder Nitrile | |
| DE3120969A1 (de) | Verfahren zur herstellung von 2,2-dihalogenvinylsubstituierten cyclopropancarbonsaeure-estern | |
| EP0048370A1 (de) | Verfahren zur Herstellung von trans-3-(Z-2-Chlor-2-aryl-vinyl)-2,2-dimethyl-cyclopropan-1-carbon-säure-derivaten, neue Zwischenprodukte hierfür, Verfahren zu deren Herstellung und Verwendung von Zwischenprodukten in Schädlingsbekämpfungsmitteln | |
| DE2423316C2 (de) | Verfahren zur Herstellung von 4-Chlor-5-oxo-hexansäurenitril und 6-Chlor-5-oxo-hexansäure-nitril | |
| CH634811A5 (en) | Process for the oxidation of alkaryl compounds | |
| DE1618401C3 (de) | Verfahren zur Herstellung von 2-Chlor-alkyl-isocyaniddichloriden neben Dichloralkanen | |
| DE1568908C (enExample) | ||
| DE2460821A1 (de) | Verfahren zur herstellung von carbonsaeurefluoriden | |
| DE3021728A1 (de) | Verfahren zur bromierung von 4-tert.butyltoluol | |
| DE3633886A1 (de) | Verfahren zur herstellung von halogenalkoholen | |
| DE1468142A1 (de) | Verfahren zur Herstellung von Halogenierungsprodukten der Cyclobutan-1,2-dicarbonsaeure bzw. deren Derivate | |
| DE2937696C2 (enExample) | ||
| DE1768250C3 (de) | Verfahren zur Herstellung von Diacetylselenid | |
| DE2802967A1 (de) | Verfahren zur herstellung von cyclopropanderivaten | |
| AT292660B (de) | Verfahren zur Herstellung von reinem Malonsäuredinitril | |
| EP0045429A2 (de) | Verfahren zur Herstellung von 4-tert.-Butylbenzaldehyden | |
| DE1245362B (de) | Verfahren zur Herstellung von Sorbinsaeurechlorid oder -bromid | |
| DE1568908B (de) | Verfahren zur Herstellung von HaIogenierungsprodukten des Cyclobutan-1,2dicarbonsäureanhydrids | |
| CH620188A5 (en) | Process for the preparation of 3-bromobenzaldehyde | |
| EP0050777A2 (de) | Verfahren zur Herstellung von chlorfluoralkyl-substituierten Cyclopropancarbonsäuren und deren Derivaten und Zwischenprodukte dafür |