DE1568908C - - Google Patents
Info
- Publication number
- DE1568908C DE1568908C DE1568908C DE 1568908 C DE1568908 C DE 1568908C DE 1568908 C DE1568908 C DE 1568908C
- Authority
- DE
- Germany
- Prior art keywords
- cyclobutane
- anhydride
- dicarboxylic
- dibromocyclobutane
- dicarboxylic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- NMNZZIMBGSGRPN-UHFFFAOYSA-N 3-oxabicyclo[3.2.0]heptane-2,4-dione Chemical compound O=C1OC(=O)C2CCC12 NMNZZIMBGSGRPN-UHFFFAOYSA-N 0.000 claims description 4
- -1 1,2-dibromocyclobutane - 1,2 - dicarboxylic acid anhydride Chemical compound 0.000 claims description 3
- 238000004508 fractional distillation Methods 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 claims 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- NMNZZIMBGSGRPN-ZXZARUISSA-N (1s,5r)-3-oxabicyclo[3.2.0]heptane-2,4-dione Chemical compound O=C1OC(=O)[C@@H]2CC[C@H]12 NMNZZIMBGSGRPN-ZXZARUISSA-N 0.000 description 1
- KMRBKECRFQFRLQ-UHFFFAOYSA-N 1-bromo-3-oxabicyclo[3.2.0]heptane-2,4-dione Chemical compound BrC12C(CC1)C(=O)OC2=O KMRBKECRFQFRLQ-UHFFFAOYSA-N 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0442087A1 (de) | Verfahren zur Herstellung von gesättigten, fluorhaltigen und chlorfreien Kohlenwasserstoffen | |
| DE1568908C (enExample) | ||
| DE1568908B (de) | Verfahren zur Herstellung von HaIogenierungsprodukten des Cyclobutan-1,2dicarbonsäureanhydrids | |
| EP0037548A2 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethylpiperidon-4 | |
| DE2326414C2 (de) | Verfahren zur Herstellung von m-Chlorbenzolsulfonsäurechlorid und m-Dichlorbenzol | |
| DE1568908A1 (de) | Verfahren zur Herstellung von Halogenierungsprodukten des Cyclobutan-1,2-dicarbonsaeureanhydrids | |
| DE60014347T2 (de) | Verfahren zur herstellung von cyclopropylacetonitril | |
| EP0266544B1 (de) | Verfahren zur Herstellung von Halogenalkoholen | |
| DE281802C (enExample) | ||
| DE1468142C (enExample) | ||
| EP0081666A1 (de) | Verfahren zur Herstellung von Pentafluorbenzylalkohol | |
| DE1252664B (de) | Verfahren zur Herstellung von Sorbinsaure durch Umsetzung von Keten mit Crotonaldehyd | |
| EP0542780B1 (de) | Verfahren zur herstellung von weitgehend fluorierten alkylbromiden | |
| DE1468142B (de) | Verfahren zur Herstellung von 1 Chlor und 1,2 Dichlor bzw 1 Brom und 1,2 Dibrom cyclobutan 1,2 dicarbonsäuren bzw deren Ester oder Nitrile | |
| DE69118595T2 (de) | Verfahren zur Reinigung von 2-Chloropropionsäure | |
| DE2306335C3 (de) | Verfahren zur Herstellung von Dichloracetaldehyd | |
| DE2402457C3 (de) | Verfahren zur Herstellung von m-Phenoxybenzylalkohol | |
| DE1568547A1 (de) | Verfahren zur Herstellung von Dichloracetylchlorid | |
| DE2719021A1 (de) | Verfahren zur herstellung von 1,1,1-trifluor-2-chloraethan | |
| EP0558938B1 (de) | Fluorsubstituierte Dicarbonsäuren sowie ein Verfahren zu ihrer Herstellung und Verwendung | |
| DE873841C (de) | Verfahren zur Herstellung von Hexachlorcyclohexan | |
| AT292660B (de) | Verfahren zur Herstellung von reinem Malonsäuredinitril | |
| DE1241823B (de) | Verfahren zur Herstellung von 1-Chlor-cyclododecadien-(5, 9) | |
| DE1793319C3 (de) | Verfahren zur Herstellung von Allylruthenlumtricarbonylhalogenlden | |
| DE956502C (de) | Verfahren zur Herstellung von trans-trans-Muconsaeure und ihren Estern |