DE1273252B - Insektizides, akarizides und fungizides Mittel - Google Patents
Insektizides, akarizides und fungizides MittelInfo
- Publication number
- DE1273252B DE1273252B DEN22720A DEN0022720A DE1273252B DE 1273252 B DE1273252 B DE 1273252B DE N22720 A DEN22720 A DE N22720A DE N0022720 A DEN0022720 A DE N0022720A DE 1273252 B DE1273252 B DE 1273252B
- Authority
- DE
- Germany
- Prior art keywords
- group
- insecticidal
- acaricidal
- compound
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000000895 acaricidal effect Effects 0.000 title claims description 7
- 230000000749 insecticidal effect Effects 0.000 title claims description 7
- 239000000417 fungicide Substances 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 29
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- -1 methoxyphenyl group Chemical group 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 239000004480 active ingredient Substances 0.000 claims description 5
- 125000000068 chlorophenyl group Chemical group 0.000 claims 1
- 239000000843 powder Substances 0.000 description 14
- 241000196324 Embryophyta Species 0.000 description 5
- 239000012876 carrier material Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- JSIAIROWMJGMQZ-UHFFFAOYSA-N 2h-triazol-4-amine Chemical class NC1=CNN=N1 JSIAIROWMJGMQZ-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 241000488583 Panonychus ulmi Species 0.000 description 4
- 239000000428 dust Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 241000221785 Erysiphales Species 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 241000607479 Yersinia pestis Species 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 241001124076 Aphididae Species 0.000 description 2
- 241000239290 Araneae Species 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- 241000258916 Leptinotarsa decemlineata Species 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 235000013601 eggs Nutrition 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000000855 fungicidal effect Effects 0.000 description 2
- 239000003906 humectant Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- UAOUIVVJBYDFKD-XKCDOFEDSA-N (1R,9R,10S,11R,12R,15S,18S,21R)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-4-(prop-2-enylamino)-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one Chemical class C([C@@H]1[C@@H](O)[C@@]23C(C1=C)=O)C[C@H]2[C@]12C(N=C(NCC=C)S4)=C4CC(C)(C)[C@H]1[C@H](O)[C@]3(O)OC2 UAOUIVVJBYDFKD-XKCDOFEDSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241001107116 Castanospermum australe Species 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 241000254173 Coleoptera Species 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 241000221787 Erysiphe Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 241000220225 Malus Species 0.000 description 1
- 235000011430 Malus pumila Nutrition 0.000 description 1
- 235000015103 Malus silvestris Nutrition 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 235000021279 black bean Nutrition 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- JKMBMIMLVFMXRW-LYYFRFARSA-N epicocconone Chemical compound C1=C2C[C@@H](CO)OC=C2C(=O)[C@]2(C)C1=C(C(/O)=C/C(=O)/C=C/C=C/C=C/C)C(=O)O2 JKMBMIMLVFMXRW-LYYFRFARSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 239000002641 tar oil Substances 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 239000003021 water soluble solvent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6515—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having three nitrogen atoms as the only ring hetero atoms
- C07F9/6518—Five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL274692 | 1962-02-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1273252B true DE1273252B (de) | 1968-07-18 |
Family
ID=19753602
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN22720A Pending DE1273252B (de) | 1962-02-12 | 1963-02-11 | Insektizides, akarizides und fungizides Mittel |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US3213103A (enExample) |
| AT (2) | AT248177B (enExample) |
| BE (1) | BE628274A (enExample) |
| BR (1) | BR6346802D0 (enExample) |
| CH (1) | CH451174A (enExample) |
| DE (1) | DE1273252B (enExample) |
| DK (1) | DK109763C (enExample) |
| ES (1) | ES284995A1 (enExample) |
| FR (1) | FR1353698A (enExample) |
| GB (1) | GB1032256A (enExample) |
| NL (1) | NL274692A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE628274A (enExample) * | 1962-02-12 | 1900-01-01 | ||
| WO2012040523A2 (en) | 2010-09-24 | 2012-03-29 | The Rockefeller University | Phosphohistidine analogs |
| FR3008161B1 (fr) | 2013-07-03 | 2015-09-04 | Technip France | Embout de connexion d'une conduite flexible avec un organe d'espacement, conduite flexible et procede associes |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1825549A (en) * | 1931-09-29 | G scheuing and bruno walach | ||
| US2476549A (en) * | 1946-10-22 | 1949-07-19 | Gen Aniline & Film Corp | 2-[vinyl-dicarboxylic acid ester]-3-amino-1, 2, 4-triazoles and process of preparing the same |
| NL224965A (enExample) * | 1957-04-27 | 1900-01-01 | ||
| US3220922A (en) * | 1957-04-27 | 1965-11-30 | Philips Corp | Amino-triazol derivatives |
| US2953491A (en) * | 1957-11-21 | 1960-09-20 | American Cyanamid Co | Fungicide |
| US2959519A (en) * | 1958-08-11 | 1960-11-08 | Monsanto Chemicals | Fungicidal composition comprising a 2-halo-4, 6-bis (amino)-s-triazine |
| NL111476C (enExample) * | 1958-10-23 | 1900-01-01 | ||
| DK109974C (da) * | 1959-03-06 | 1968-08-12 | Philips Nv | Middel til bekæmpelse af skadelige organismer. |
| BE628274A (enExample) * | 1962-02-12 | 1900-01-01 |
-
0
- BE BE628274D patent/BE628274A/xx unknown
- NL NL274692D patent/NL274692A/xx unknown
- US US3326751D patent/US3326751A/en not_active Expired - Lifetime
-
1963
- 1963-02-05 US US256246A patent/US3213103A/en not_active Expired - Lifetime
- 1963-02-08 AT AT97064A patent/AT248177B/de active
- 1963-02-08 GB GB5247/63A patent/GB1032256A/en not_active Expired
- 1963-02-08 AT AT99363A patent/AT242165B/de active
- 1963-02-08 CH CH158063A patent/CH451174A/de unknown
- 1963-02-08 BR BR146802/63A patent/BR6346802D0/pt unknown
- 1963-02-09 DK DK62163AA patent/DK109763C/da active
- 1963-02-09 ES ES284995A patent/ES284995A1/es not_active Expired
- 1963-02-11 DE DEN22720A patent/DE1273252B/de active Pending
- 1963-02-12 FR FR924454A patent/FR1353698A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE628274A (enExample) | 1900-01-01 |
| FR1353698A (fr) | 1964-02-28 |
| NL274692A (enExample) | 1900-01-01 |
| US3326751A (en) | 1967-06-20 |
| DK109763C (da) | 1968-06-24 |
| ES284995A1 (es) | 1963-07-16 |
| US3213103A (en) | 1965-10-19 |
| AT248177B (de) | 1966-07-11 |
| BR6346802D0 (pt) | 1973-06-26 |
| AT242165B (de) | 1965-09-10 |
| CH451174A (de) | 1968-05-15 |
| GB1032256A (en) | 1966-06-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2463046C2 (de) | Fungizide Mittel auf Ammoniumphosphonatbasis | |
| DE1803084A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE1011660B (de) | Schaedlingsbekaempfungsmittel | |
| DE1201116B (de) | Fungizides Pflanzenschutzmittel | |
| DE1695906C3 (de) | N'-substituierte 6-Nitroindazole | |
| DE1273252B (de) | Insektizides, akarizides und fungizides Mittel | |
| DE1693192A1 (de) | Schaedlingsbekaempfungsmittel | |
| EP0035972B1 (de) | Cyanoalkyl-Phenylharnstoffe mit selektiver herbizider Wirkung, deren Herstellung und sie enthaltende Mittel | |
| DE1181978B (de) | Mittel zur Bekaempfung von Arthropoden, Mollusken und Fischen | |
| DE2510034C2 (enExample) | ||
| DE2304789C3 (de) | Benzyliden-Semicarbazide, Verfahren zu deren Herstellung und diese enthaltende isektizide Mittel | |
| DE1278427B (de) | Verfahren zur Herstellung von Carbaminsaeureestern | |
| DE2349970A1 (de) | N-benzoyl-n-(3-chlor-4-fluorphenyl)-2amino-propionsaeureester und deren verwendung als herbizide | |
| DE1259331B (de) | Verfahren zur Herstellung von Dithiophosphorsaeureestern | |
| DE1143052B (de) | Schaedlingsbekaempfungsmittel mit insektizider und akarizider Wirkung | |
| DE1542919C (de) | Fungizide zur Bekämpfung von Reisbrand | |
| AT253858B (de) | Insektizide Zusammensetzung | |
| AT257268B (de) | Mischungen zur Schädlingsbekämpfung | |
| DE1642357C2 (de) | Das Pflanzenwachstum beeinflussende Stäubepräparate, wäBrige Lösungen oder Suspensionen | |
| AT231219B (de) | Mittel zur Bekämpfung schädlicher Organismen | |
| AT229632B (de) | Organische Phosphorverbindungen enthaltende Schädlingsbekämpfungsmittel | |
| DE1187848B (de) | Insektizides und akarizides Mittel | |
| DE1181979B (de) | Insektizide Mittel | |
| AT204329B (de) | Mittel zur Bekämpfung von Milben | |
| DE2015854C3 (de) | Phenoxy acethylhydroxamsäurederivate und ihre Verwendung als Fungizide, Algizide und Molluskizide |