DE1272549B - Verfahren zur Herstellung von Formkoerpern auf der Basis von Epoxyd-Polyaddukten - Google Patents
Verfahren zur Herstellung von Formkoerpern auf der Basis von Epoxyd-PolyadduktenInfo
- Publication number
- DE1272549B DE1272549B DEU4573A DEU0004573A DE1272549B DE 1272549 B DE1272549 B DE 1272549B DE U4573 A DEU4573 A DE U4573A DE U0004573 A DEU0004573 A DE U0004573A DE 1272549 B DE1272549 B DE 1272549B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- anhydride
- epoxy
- temperature
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004593 Epoxy Substances 0.000 title claims description 56
- 238000000034 method Methods 0.000 title claims description 20
- 238000004519 manufacturing process Methods 0.000 title claims description 12
- 229920000728 polyester Polymers 0.000 claims description 53
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 49
- 150000008064 anhydrides Chemical class 0.000 claims description 41
- 150000001875 compounds Chemical class 0.000 claims description 33
- 150000001735 carboxylic acids Chemical class 0.000 claims description 25
- 238000000465 moulding Methods 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 8
- 150000005846 sugar alcohols Polymers 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000000203 mixture Substances 0.000 description 80
- 239000000499 gel Substances 0.000 description 46
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 32
- -1 compounds compounds Chemical class 0.000 description 31
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 24
- 239000002253 acid Substances 0.000 description 23
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 16
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 15
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 15
- 150000002118 epoxides Chemical class 0.000 description 15
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 14
- 229940014800 succinic anhydride Drugs 0.000 description 14
- URRZEEWQOJPKID-UHFFFAOYSA-N 6-(7-oxabicyclo[4.1.0]heptane-4-carbonyloxy)hexyl 7-oxabicyclo[4.1.0]heptane-4-carboxylate Chemical compound C1CC2OC2CC1C(=O)OCCCCCCOC(=O)C1CC2OC2CC1 URRZEEWQOJPKID-UHFFFAOYSA-N 0.000 description 12
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 12
- 239000001361 adipic acid Substances 0.000 description 12
- 235000011037 adipic acid Nutrition 0.000 description 12
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 10
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 9
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 9
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 7
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 7
- 239000000155 melt Substances 0.000 description 7
- 150000008065 acid anhydrides Chemical class 0.000 description 6
- 150000007942 carboxylates Chemical class 0.000 description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 6
- 235000011187 glycerol Nutrition 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 6
- NIYNIOYNNFXGFN-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol;7-oxabicyclo[4.1.0]heptane-4-carboxylic acid Chemical compound OCC1CCC(CO)CC1.C1C(C(=O)O)CCC2OC21.C1C(C(=O)O)CCC2OC21 NIYNIOYNNFXGFN-UHFFFAOYSA-N 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- NZNMSOFKMUBTKW-UHFFFAOYSA-M cyclohexanecarboxylate Chemical compound [O-]C(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-M 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000011976 maleic acid Substances 0.000 description 5
- JZOHAIOLOCXDHH-UHFFFAOYSA-N oxolane-2,5-dione;propane-1,2,3-triol Chemical compound OCC(O)CO.O=C1CCC(=O)O1 JZOHAIOLOCXDHH-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 235000011044 succinic acid Nutrition 0.000 description 5
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 150000001991 dicarboxylic acids Chemical class 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 4
- 239000001384 succinic acid Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 125000003700 epoxy group Chemical group 0.000 description 3
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 3
- 150000002440 hydroxy compounds Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- NQVXJVBTXFCNMS-UHFFFAOYSA-N 2,3-bis(7-oxabicyclo[4.1.0]heptane-4-carbonyloxy)propyl 7-oxabicyclo[4.1.0]heptane-4-carboxylate Chemical compound C1CC2OC2CC1C(=O)OCC(OC(=O)C1CC2OC2CC1)COC(=O)C1CC2OC2CC1 NQVXJVBTXFCNMS-UHFFFAOYSA-N 0.000 description 2
- FQAYEMGMUJSCMN-UHFFFAOYSA-N 2-(2-ethylbut-1-enyl)butanedioic acid Chemical compound C(C)C(=CC(C(=O)O)CC(=O)O)CC FQAYEMGMUJSCMN-UHFFFAOYSA-N 0.000 description 2
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 2
- VDLXXEPUEFHMBP-UHFFFAOYSA-N 2-ethyl-2-(hydroxymethyl)propane-1,3-diol 7-oxabicyclo[4.1.0]heptane-3-carboxylic acid Chemical compound CCC(CO)(CO)CO.C1C(C(=O)O)CCC2OC21.C1C(C(=O)O)CCC2OC21.C1C(C(=O)O)CCC2OC21 VDLXXEPUEFHMBP-UHFFFAOYSA-N 0.000 description 2
- VSKXJRZPVDLHFY-UHFFFAOYSA-N 2-methylcyclohexane-1-carboxylic acid Chemical compound CC1CCCCC1C(O)=O VSKXJRZPVDLHFY-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- ZWAJLVLEBYIOTI-UHFFFAOYSA-N cyclohexene oxide Chemical compound C1CCCC2OC21 ZWAJLVLEBYIOTI-UHFFFAOYSA-N 0.000 description 2
- 238000006735 epoxidation reaction Methods 0.000 description 2
- FLBJFXNAEMSXGL-UHFFFAOYSA-N het anhydride Chemical compound O=C1OC(=O)C2C1C1(Cl)C(Cl)=C(Cl)C2(Cl)C1(Cl)Cl FLBJFXNAEMSXGL-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical compound OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- CYIDZMCFTVVTJO-UHFFFAOYSA-N pyromellitic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=C1C(O)=O CYIDZMCFTVVTJO-UHFFFAOYSA-N 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- KQTIIICEAUMSDG-UHFFFAOYSA-N tricarballylic acid Chemical compound OC(=O)CC(C(O)=O)CC(O)=O KQTIIICEAUMSDG-UHFFFAOYSA-N 0.000 description 2
- 150000003628 tricarboxylic acids Chemical class 0.000 description 2
- 150000004072 triols Chemical class 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- IQVLXQGNLCPZCL-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) 2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate Chemical compound CC(C)(C)OC(=O)NCCCCC(NC(=O)OC(C)(C)C)C(=O)ON1C(=O)CCC1=O IQVLXQGNLCPZCL-UHFFFAOYSA-N 0.000 description 1
- MUTGBJKUEZFXGO-OLQVQODUSA-N (3as,7ar)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione Chemical compound C1CCC[C@@H]2C(=O)OC(=O)[C@@H]21 MUTGBJKUEZFXGO-OLQVQODUSA-N 0.000 description 1
- XVOUMQNXTGKGMA-OWOJBTEDSA-N (E)-glutaconic acid Chemical compound OC(=O)C\C=C\C(O)=O XVOUMQNXTGKGMA-OWOJBTEDSA-N 0.000 description 1
- PNNFEYPWPCDLOC-UPHRSURJSA-N (z)-2,3-dichlorobut-2-enedioic acid Chemical compound OC(=O)C(\Cl)=C(\Cl)C(O)=O PNNFEYPWPCDLOC-UPHRSURJSA-N 0.000 description 1
- ORTVZLZNOYNASJ-UPHRSURJSA-N (z)-but-2-ene-1,4-diol Chemical compound OC\C=C/CO ORTVZLZNOYNASJ-UPHRSURJSA-N 0.000 description 1
- ZWVMLYRJXORSEP-UHFFFAOYSA-N 1,2,6-Hexanetriol Chemical compound OCCCCC(O)CO ZWVMLYRJXORSEP-UHFFFAOYSA-N 0.000 description 1
- PMSFTUYAICWJDV-UHFFFAOYSA-N 1-methylpent-2-ene-1,1,2,3-tetracarboxylic acid Chemical compound CC(C(=C(CC)C(=O)O)C(=O)O)(C(=O)O)C(=O)O PMSFTUYAICWJDV-UHFFFAOYSA-N 0.000 description 1
- DHIGRALKNXRCCE-UHFFFAOYSA-N 2,2-bis(hydroxymethyl)propane-1,3-diol;butanedioic acid Chemical compound OC(=O)CCC(O)=O.OCC(CO)(CO)CO DHIGRALKNXRCCE-UHFFFAOYSA-N 0.000 description 1
- GRVDASGSTFJQFJ-UHFFFAOYSA-N 2-(3-methyl-7-oxabicyclo[4.1.0]heptane-4-carbonyl)oxyethyl 3-methyl-7-oxabicyclo[4.1.0]heptane-4-carboxylate Chemical compound C1C2OC2CC(C)C1C(=O)OCCOC(=O)C1CC2OC2CC1C GRVDASGSTFJQFJ-UHFFFAOYSA-N 0.000 description 1
- AEHGTZPCXSPGKI-UHFFFAOYSA-N 2-(carboxymethyl)-1-methylcyclohexane-1-carboxylic acid Chemical compound OC(=O)C1(C)CCCCC1CC(O)=O AEHGTZPCXSPGKI-UHFFFAOYSA-N 0.000 description 1
- DLLMHEDYJQACRM-UHFFFAOYSA-N 2-(carboxymethyldisulfanyl)acetic acid Chemical compound OC(=O)CSSCC(O)=O DLLMHEDYJQACRM-UHFFFAOYSA-N 0.000 description 1
- SFRDXVJWXWOTEW-UHFFFAOYSA-N 2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)CO SFRDXVJWXWOTEW-UHFFFAOYSA-N 0.000 description 1
- RWLALWYNXFYRGW-UHFFFAOYSA-N 2-Ethyl-1,3-hexanediol Chemical compound CCCC(O)C(CC)CO RWLALWYNXFYRGW-UHFFFAOYSA-N 0.000 description 1
- LCZVSXRMYJUNFX-UHFFFAOYSA-N 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol Chemical class CC(O)COC(C)COC(C)CO LCZVSXRMYJUNFX-UHFFFAOYSA-N 0.000 description 1
- YTLHXFVJMRDAMC-UHFFFAOYSA-N 2-[2-(3-methyl-7-oxabicyclo[4.1.0]heptane-4-carbonyl)oxyethoxy]ethyl 3-methyl-7-oxabicyclo[4.1.0]heptane-4-carboxylate Chemical compound C1C2OC2CC(C)C1C(=O)OCCOCCOC(=O)C1CC2OC2CC1C YTLHXFVJMRDAMC-UHFFFAOYSA-N 0.000 description 1
- TXBCBTDQIULDIA-UHFFFAOYSA-N 2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)(CO)COCC(CO)(CO)CO TXBCBTDQIULDIA-UHFFFAOYSA-N 0.000 description 1
- KAKCFUFVUPINQH-UHFFFAOYSA-N 2-benzofuran-1,3-dione;ethane-1,2-diol Chemical compound OCCO.C1=CC=C2C(=O)OC(=O)C2=C1 KAKCFUFVUPINQH-UHFFFAOYSA-N 0.000 description 1
- ZSPUGXKSCPGBDN-UHFFFAOYSA-N 2-but-1-enyl-2-ethylbutanedioic acid Chemical compound CCC=CC(CC)(C(O)=O)CC(O)=O ZSPUGXKSCPGBDN-UHFFFAOYSA-N 0.000 description 1
- QAGHEHQMRFEQMB-UHFFFAOYSA-N 2-ethylidenepropanedioic acid Chemical compound CC=C(C(O)=O)C(O)=O QAGHEHQMRFEQMB-UHFFFAOYSA-N 0.000 description 1
- FJWCTQCMDWCKEC-UHFFFAOYSA-N 2-propylidenepropanedioic acid Chemical compound CCC=C(C(O)=O)C(O)=O FJWCTQCMDWCKEC-UHFFFAOYSA-N 0.000 description 1
- WZHHYIOUKQNLQM-UHFFFAOYSA-N 3,4,5,6-tetrachlorophthalic acid Chemical compound OC(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C(O)=O WZHHYIOUKQNLQM-UHFFFAOYSA-N 0.000 description 1
- AGULWIQIYWWFBJ-UHFFFAOYSA-N 3,4-dichlorofuran-2,5-dione Chemical compound ClC1=C(Cl)C(=O)OC1=O AGULWIQIYWWFBJ-UHFFFAOYSA-N 0.000 description 1
- ALLUKYCHCQRVNH-UHFFFAOYSA-N 3,4-dichlorofuran-2,5-dione ethane-1,2-diol Chemical compound Cl/C/1=C(/C(=O)OC1=O)Cl.C(CO)O ALLUKYCHCQRVNH-UHFFFAOYSA-N 0.000 description 1
- YHXSMBLTIOJLBX-UHFFFAOYSA-N 3-(7-oxabicyclo[4.1.0]heptane-4-carbonyloxy)propyl 7-oxabicyclo[4.1.0]heptane-4-carboxylate Chemical compound C1CC2OC2CC1C(=O)OCCCOC(=O)C1CC2OC2CC1 YHXSMBLTIOJLBX-UHFFFAOYSA-N 0.000 description 1
- KLWPBEWWHJTYDC-SNAWJCMRSA-N 3-[(e)-2-carboxyethenyl]benzoic acid Chemical compound OC(=O)\C=C\C1=CC=CC(C(O)=O)=C1 KLWPBEWWHJTYDC-SNAWJCMRSA-N 0.000 description 1
- CXJAFLQWMOMYOW-UHFFFAOYSA-N 3-chlorofuran-2,5-dione Chemical compound ClC1=CC(=O)OC1=O CXJAFLQWMOMYOW-UHFFFAOYSA-N 0.000 description 1
- NTUIKGUMDLSOBX-UHFFFAOYSA-N 3-hexyloxolane-2,5-dione Chemical compound CCCCCCC1CC(=O)OC1=O NTUIKGUMDLSOBX-UHFFFAOYSA-N 0.000 description 1
- OFNISBHGPNMTMS-UHFFFAOYSA-N 3-methylideneoxolane-2,5-dione Chemical compound C=C1CC(=O)OC1=O OFNISBHGPNMTMS-UHFFFAOYSA-N 0.000 description 1
- WOHXXIWTEHLCQK-UHFFFAOYSA-N 3-methylpentane-1,4-diol Chemical compound CC(O)C(C)CCO WOHXXIWTEHLCQK-UHFFFAOYSA-N 0.000 description 1
- SXFJDZNJHVPHPH-UHFFFAOYSA-N 3-methylpentane-1,5-diol Chemical compound OCCC(C)CCO SXFJDZNJHVPHPH-UHFFFAOYSA-N 0.000 description 1
- UJWPNMNCNGQIJP-UHFFFAOYSA-N 3-pent-1-enyloxolane-2,5-dione Chemical compound CCCC=CC1CC(=O)OC1=O UJWPNMNCNGQIJP-UHFFFAOYSA-N 0.000 description 1
- UHMARZNHEMRXQH-UHFFFAOYSA-N 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione Chemical class C1=CCCC2C(=O)OC(=O)C21 UHMARZNHEMRXQH-UHFFFAOYSA-N 0.000 description 1
- UHIMKEGZFOQVHV-UHFFFAOYSA-N 4,5,6,7-tetraiodo-2-benzofuran-1,3-dione Chemical compound IC1=C(I)C(I)=C2C(=O)OC(=O)C2=C1I UHIMKEGZFOQVHV-UHFFFAOYSA-N 0.000 description 1
- MMVIDXVHQANYAE-UHFFFAOYSA-N 5-nitro-2-benzofuran-1,3-dione Chemical compound [O-][N+](=O)C1=CC=C2C(=O)OC(=O)C2=C1 MMVIDXVHQANYAE-UHFFFAOYSA-N 0.000 description 1
- MWSKJDNQKGCKPA-UHFFFAOYSA-N 6-methyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione Chemical compound C1CC(C)=CC2C(=O)OC(=O)C12 MWSKJDNQKGCKPA-UHFFFAOYSA-N 0.000 description 1
- ZDZVKPXKLLLOOA-UHFFFAOYSA-N Allylmalonic acid Chemical compound OC(=O)C(C(O)=O)CC=C ZDZVKPXKLLLOOA-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 238000005698 Diels-Alder reaction Methods 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Natural products OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 229920000715 Mucilage Polymers 0.000 description 1
- GRSMWKLPSNHDHA-UHFFFAOYSA-N Naphthalic anhydride Chemical compound C1=CC(C(=O)OC2=O)=C3C2=CC=CC3=C1 GRSMWKLPSNHDHA-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- DUFKCOQISQKSAV-UHFFFAOYSA-N Polypropylene glycol (m w 1,200-3,000) Chemical class CC(O)COC(C)CO DUFKCOQISQKSAV-UHFFFAOYSA-N 0.000 description 1
- UWHCKJMYHZGTIT-UHFFFAOYSA-N Tetraethylene glycol, Natural products OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 1
- TVBIDAAWOMMVRM-UHFFFAOYSA-N [2-ethyl-2-(7-oxabicyclo[4.1.0]heptane-4-carbonyloxymethyl)butyl] 7-oxabicyclo[4.1.0]heptane-4-carboxylate Chemical compound C1CC2OC2CC1C(=O)OCC(CC)(CC)COC(=O)C1CC2OC2CC1 TVBIDAAWOMMVRM-UHFFFAOYSA-N 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- QNSOHXTZPUMONC-UHFFFAOYSA-N benzene pentacarboxylic acid Natural products OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O QNSOHXTZPUMONC-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- BMRWNKZVCUKKSR-UHFFFAOYSA-N butane-1,2-diol Chemical compound CCC(O)CO BMRWNKZVCUKKSR-UHFFFAOYSA-N 0.000 description 1
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 229940018557 citraconic acid Drugs 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- VUSWCWPCANWBFG-UHFFFAOYSA-N cyclohex-3-ene-1-carboxylic acid Chemical class OC(=O)C1CCC=CC1 VUSWCWPCANWBFG-UHFFFAOYSA-N 0.000 description 1
- QSAWQNUELGIYBC-UHFFFAOYSA-N cyclohexane-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCCCC1C(O)=O QSAWQNUELGIYBC-UHFFFAOYSA-N 0.000 description 1
- XBZSBBLNHFMTEB-UHFFFAOYSA-N cyclohexane-1,3-dicarboxylic acid Chemical compound OC(=O)C1CCCC(C(O)=O)C1 XBZSBBLNHFMTEB-UHFFFAOYSA-N 0.000 description 1
- QHYKVJVPIJCRRT-UHFFFAOYSA-N deca-2,4,6,8-tetraenedioic acid Chemical compound OC(=O)C=CC=CC=CC=CC(O)=O QHYKVJVPIJCRRT-UHFFFAOYSA-N 0.000 description 1
- LBVWYGNGGJURHQ-UHFFFAOYSA-N dicarbon Chemical compound [C-]#[C+] LBVWYGNGGJURHQ-UHFFFAOYSA-N 0.000 description 1
- GPLRAVKSCUXZTP-UHFFFAOYSA-N diglycerol Chemical compound OCC(O)COCC(O)CO GPLRAVKSCUXZTP-UHFFFAOYSA-N 0.000 description 1
- FLISWPFVWWWNNP-BQYQJAHWSA-N dihydro-3-(1-octenyl)-2,5-furandione Chemical compound CCCCCC\C=C\C1CC(=O)OC1=O FLISWPFVWWWNNP-BQYQJAHWSA-N 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- AVPRDNCYNYWMNB-UHFFFAOYSA-N ethanamine;hydrate Chemical compound [OH-].CC[NH3+] AVPRDNCYNYWMNB-UHFFFAOYSA-N 0.000 description 1
- KAKYQGDTIHIFJQ-UHFFFAOYSA-N ethane-1,2-diol oxolane-2,5-dione Chemical compound OCCO.O=C1CCC(=O)O1 KAKYQGDTIHIFJQ-UHFFFAOYSA-N 0.000 description 1
- URUGTERYLBWXOS-UHFFFAOYSA-N ethane-1,2-diol;furan-2,5-dione Chemical compound OCCO.O=C1OC(=O)C=C1 URUGTERYLBWXOS-UHFFFAOYSA-N 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- ANSXAPJVJOKRDJ-UHFFFAOYSA-N furo[3,4-f][2]benzofuran-1,3,5,7-tetrone Chemical compound C1=C2C(=O)OC(=O)C2=CC2=C1C(=O)OC2=O ANSXAPJVJOKRDJ-UHFFFAOYSA-N 0.000 description 1
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical compound O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- UMGLBHQOFQXXSI-UHFFFAOYSA-N hepta-2,5-dienedioic acid Chemical compound OC(=O)C=CCC=CC(O)=O UMGLBHQOFQXXSI-UHFFFAOYSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PSTBYXSYWMQNJV-UHFFFAOYSA-N hexa-1,5-diene-2,3-diol Chemical compound OC(=C)C(O)CC=C PSTBYXSYWMQNJV-UHFFFAOYSA-N 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- IERCMVSQYWVLNU-UHFFFAOYSA-N hexane-1,2,4-tricarboxylic acid Chemical compound CCC(C(O)=O)CC(C(O)=O)CC(O)=O IERCMVSQYWVLNU-UHFFFAOYSA-N 0.000 description 1
- OHMBHFSEKCCCBW-UHFFFAOYSA-N hexane-2,5-diol Chemical compound CC(O)CCC(C)O OHMBHFSEKCCCBW-UHFFFAOYSA-N 0.000 description 1
- BQBUMJXDLQOOAJ-UHFFFAOYSA-N hexanedioic acid;propane-1,2,3-triol Chemical compound OCC(O)CO.OC(=O)CCCCC(O)=O BQBUMJXDLQOOAJ-UHFFFAOYSA-N 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000005187 nonenyl group Chemical group C(=CCCCCCCC)* 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- LJAGLQVRUZWQGK-UHFFFAOYSA-N oxecane-2,10-dione Chemical compound O=C1CCCCCCCC(=O)O1 LJAGLQVRUZWQGK-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- LGPJQXNNTQVASQ-UHFFFAOYSA-N pentane-1,2,4-tricarboxylic acid Chemical compound OC(=O)C(C)CC(C(O)=O)CC(O)=O LGPJQXNNTQVASQ-UHFFFAOYSA-N 0.000 description 1
- RUOPINZRYMFPBF-UHFFFAOYSA-N pentane-1,3-diol Chemical compound CCC(O)CCO RUOPINZRYMFPBF-UHFFFAOYSA-N 0.000 description 1
- GLOBUAZSRIOKLN-UHFFFAOYSA-N pentane-1,4-diol Chemical compound CC(O)CCCO GLOBUAZSRIOKLN-UHFFFAOYSA-N 0.000 description 1
- GTCCGKPBSJZVRZ-UHFFFAOYSA-N pentane-2,4-diol Chemical compound CC(O)CC(C)O GTCCGKPBSJZVRZ-UHFFFAOYSA-N 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 150000008442 polyphenolic compounds Chemical class 0.000 description 1
- 235000013824 polyphenols Nutrition 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- CSIGAEASXSGNKS-UHFFFAOYSA-N propane-1,1,3-triol Chemical compound OCCC(O)O CSIGAEASXSGNKS-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
- C08G59/42—Polycarboxylic acids; Anhydrides, halides or low molecular weight esters thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Epoxy Resins (AREA)
- Epoxy Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US588605A US2884408A (en) | 1956-06-01 | 1956-06-01 | Compositions of polyepoxides and polycarboxylic acid anhydrides |
Publications (1)
Publication Number | Publication Date |
---|---|
DE1272549B true DE1272549B (de) | 1968-07-11 |
Family
ID=24354549
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DEU4573A Pending DE1272549B (de) | 1956-06-01 | 1957-05-31 | Verfahren zur Herstellung von Formkoerpern auf der Basis von Epoxyd-Polyaddukten |
Country Status (5)
Families Citing this family (23)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3112294A (en) * | 1956-04-30 | 1963-11-26 | Shell Oil Co | Polyepoxides from epoxy-substituted monocarboxylic acids, their preparation and polymers |
US3083186A (en) * | 1958-07-10 | 1963-03-26 | Union Carbide Corp | Curing spirobi(meta-dioxane) epoxides with polycarboxylic acid anhydrides in combination modifiers containing active hydrogen atoms |
BE592221A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1959-06-24 | |||
US4859758A (en) * | 1987-11-16 | 1989-08-22 | The Sherwin-Williams Company | Acid-functional polymers derived from cellulose ester-unsaturated alcohol copolymers, which are reacted with cyclic anhydrides |
US4912160A (en) * | 1987-11-16 | 1990-03-27 | The Sherwin-Williams Company | Acid-functional polymers from hydroxy polymers and cyclic anhydrides |
US5043220A (en) * | 1987-11-16 | 1991-08-27 | The Sherwin-Williams Company | Substrate coated with a basecoat and/or a clearcoat of an acid-functional compound, an anhydride-functional compound, an epoxy-functional compound and a hydroxy-functional compound |
US5411809A (en) * | 1987-11-16 | 1995-05-02 | The Sherwin-Williams Company | Reactive coatings comprising an acid-functional compound, an anhydride-functional compound and an epoxy-functional compound |
US4871806A (en) * | 1987-11-16 | 1989-10-03 | The Sherwin-Williams Company | Reactive coatings comprising an acid-functional compound, an anhydride-functional compound, an epoxy-functional compound and a hydroxy-functional compound |
US5410078A (en) * | 1994-01-03 | 1995-04-25 | The Sherwin-Williams Company | Styrene-based dicarboxylic acid-functional monomers and polymers prepared from same |
US5633091A (en) * | 1994-01-03 | 1997-05-27 | The Sherwin-Williams Company | Graft copolymers having anhydride functionality |
US5480951A (en) * | 1994-01-03 | 1996-01-02 | The Sherwin-Williams Company | Curable compositions incorporating anhydride-functional polymers derived from alkenyl succinic anhydride |
US5679742A (en) * | 1994-01-03 | 1997-10-21 | The Sherwin-Williams Company | Hydrogenated polymers having anhydride functionality |
US5391818A (en) * | 1994-01-03 | 1995-02-21 | The Sherwin-Williams Company | Tricarboxylic acid-functional monomers and polymers prepared from same |
US5863998A (en) * | 1994-01-03 | 1999-01-26 | The Sherwin-Williams Company | Dicarboxylic acid-functional monomers and polymers prepared from same |
US5418306A (en) * | 1994-01-03 | 1995-05-23 | The Sherwin-Williams Company | Acid-functional polymers derived from anhydride-functional polymers comprising ene reaction products of unsaturated anhydrides and polyolefins and curable compositions prepared from same |
US5492976A (en) * | 1994-01-03 | 1996-02-20 | The Sherwin-Williams Company | Anhydride-functional polymers comprising ene reaction products of unsaturated anhydrides and polyolefins |
US5364945A (en) * | 1994-01-03 | 1994-11-15 | The Sherwin-Williams Company | Anhydride-functional monomers and polymers and reactive compositions prepared from same |
US5444139A (en) * | 1994-01-03 | 1995-08-22 | The Sherwin-Williams Company | Anhydride-functional polymers derived from alkenyl succinic anhydride |
US5418307A (en) * | 1994-01-03 | 1995-05-23 | The Sherwin-Williams Company | Hydrogenated polymers having acid functionality |
US5405973A (en) * | 1994-01-03 | 1995-04-11 | The Sherwin-Williams Company | Vinylbenzyl group-containing succinic anhydride |
JP2010254628A (ja) * | 2009-04-27 | 2010-11-11 | Nippon Kayaku Co Ltd | ジオレフィン化合物、エポキシ化合物、硬化性樹脂組成物及びその硬化物 |
CA2784792C (en) | 2010-01-05 | 2015-06-23 | The Sherwin-Williams Company | Primers comprising cerium molybdate |
WO2011084880A2 (en) | 2010-01-05 | 2011-07-14 | The Sherwin-Williams Company | Primers comprising cerium phosphate |
Citations (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
BE497540A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1949-08-12 | |||
FR1088704A (fr) * | 1952-11-03 | 1955-03-09 | Henkel & Cie Gmbh | Procédé de préparation de résines synthétiques |
FR1109935A (fr) * | 1953-08-13 | 1956-02-03 | Union Carbide & Carbon Corp | Dérivés époxydes et procédé de fabrication |
US2745847A (en) * | 1953-10-08 | 1956-05-15 | Union Carbide & Carbon Corp | Diepoxides |
Family Cites Families (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2527806A (en) * | 1948-02-10 | 1950-10-31 | Du Pont | Dicarboxylic acid anhydride-4-vinylcyclohexene diepoxide reaction products |
US2607761A (en) * | 1948-04-10 | 1952-08-19 | Ind Res Inst Of The University | Reaction products of alkylene oxides and synthetic polymeric carboxylic acids |
US2623023A (en) * | 1951-07-28 | 1952-12-23 | Rohm & Haas | Expanded, cellular, resinous products containing polyepoxides and aconitic acid |
US2764575A (en) * | 1951-10-08 | 1956-09-25 | Henkel & Cie Gmbh | Synthetic resins from oxacyclobutane compounds and dicarboxylic acids |
US2720500A (en) * | 1952-10-17 | 1955-10-11 | Alkydol Lab Inc | Polyesters from polycarboxylic acids, polyhydric alcohols, and glycidyl ethers of monoh ydrocarbon substituted monohydric phenol |
NL204817A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1955-02-24 |
-
0
- BE BE557991D patent/BE557991A/xx unknown
-
1956
- 1956-06-01 US US588605A patent/US2884408A/en not_active Expired - Lifetime
-
1957
- 1957-05-31 DE DEU4573A patent/DE1272549B/de active Pending
- 1957-05-31 GB GB17287/57A patent/GB845121A/en not_active Expired
- 1957-05-31 FR FR1179370D patent/FR1179370A/fr not_active Expired
Patent Citations (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
BE497540A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1949-08-12 | |||
FR1088704A (fr) * | 1952-11-03 | 1955-03-09 | Henkel & Cie Gmbh | Procédé de préparation de résines synthétiques |
FR1109935A (fr) * | 1953-08-13 | 1956-02-03 | Union Carbide & Carbon Corp | Dérivés époxydes et procédé de fabrication |
US2745847A (en) * | 1953-10-08 | 1956-05-15 | Union Carbide & Carbon Corp | Diepoxides |
Also Published As
Publication number | Publication date |
---|---|
BE557991A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
GB845121A (en) | 1960-08-17 |
FR1179370A (fr) | 1959-05-22 |
US2884408A (en) | 1959-04-28 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE1272549B (de) | Verfahren zur Herstellung von Formkoerpern auf der Basis von Epoxyd-Polyaddukten | |
DE1420781C3 (de) | Verfahren zur Herstellung von Epoxyd Polyaddukten | |
EP0028687B1 (de) | Verfahren zur Herstellung von hochmolekularen, linearen Polyestern | |
DE69611269T2 (de) | Verfahren zum Polymerisieren von macrozyklischen Polyester-Oligomeren | |
DE1420782C3 (de) | Verfahren zur Herstellung von Epoxyd Polyaddukten | |
CH621564A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
DE1082403B (de) | Verfahren zum Haerten eines Glycidylpolyaethers | |
DE1420797B2 (de) | Verfahren zur ueberfuehrung von polyglycidylpolyaethern mehrwertiger phenole in hochmolekulare vernetzte produkte | |
DE1156555B (de) | Verfahren zum Herstellen von Formteilen durch Hitzehaerten von Polyesterformmassen | |
DE1214882B (de) | Verfahren zur Herstellung von haertbaren, hochmolekularen, Epoxydgruppen enthaltenden Verbindungen | |
DE1228423B (de) | Verfahren zur Herstellung von Formteilen | |
DE1096037B (de) | Verfahren zur Herstellung von Formkoerpern und UEberzuegen aus Diepoxydverbindungen | |
DE1520725A1 (de) | Verfahren zur Herstellung von Alkydharzen | |
DE60320122T2 (de) | Mit zwei endgruppen versehene polyester enthaltende polyesterlaminierharze mit verringerten voc-emissionsniveaus | |
US3006936A (en) | Polyesters from epoxy-containing oleaginous materials and process of making same | |
DE1228424B (de) | Verfahren zur Herstellung von Formteilen | |
DE1150202B (de) | Herstellen von Formteilen oder UEberzuegen aus Polyepoxyd-Formmassen | |
DE1192827B (de) | Verfahren zur Herstellung von Formteilen auf der Basis von Diepoxyden | |
DE1057783B (de) | Verfahren zum Haerten von Glycidpolyaethern | |
DE1294665B (de) | Verfahren zur Herstellung eines Polyesters | |
DE2439480A1 (de) | Polyamin-kompositionen zur haertung von epoxid-harzen | |
DE1570422A1 (de) | Verfahren zur Herstellung flammwidriger Form- und UEberzugsmassen | |
DE1233607B (de) | Verfahren zur Herstellung von Formteilen, UEberzuegen und Verklebungen | |
AT204783B (de) | Verfahren zur Herstellung eines synthetischen Harzes | |
DE1273825B (de) | Verfahren zur Herstellung von Formkoerpern auf der Basis von Polyaddukten |