DE1269808B - Verfahren zur Herstellung von synthetischen, linearen Polyamiden - Google Patents
Verfahren zur Herstellung von synthetischen, linearen PolyamidenInfo
- Publication number
- DE1269808B DE1269808B DEP1269A DE1269808A DE1269808B DE 1269808 B DE1269808 B DE 1269808B DE P1269 A DEP1269 A DE P1269A DE 1269808 A DE1269808 A DE 1269808A DE 1269808 B DE1269808 B DE 1269808B
- Authority
- DE
- Germany
- Prior art keywords
- polyamides
- acid
- polymer
- synthetic
- pressure
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004952 Polyamide Substances 0.000 title claims description 28
- 229920002647 polyamide Polymers 0.000 title claims description 28
- 238000000034 method Methods 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title claims description 8
- 239000000203 mixture Substances 0.000 claims description 13
- 150000004985 diamines Chemical class 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 238000006068 polycondensation reaction Methods 0.000 claims description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- 229920000642 polymer Polymers 0.000 description 18
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- 239000000981 basic dye Substances 0.000 description 12
- 239000000835 fiber Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 6
- 238000009987 spinning Methods 0.000 description 5
- 229910001220 stainless steel Inorganic materials 0.000 description 5
- 239000010935 stainless steel Substances 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 238000002074 melt spinning Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- UFFRSDWQMJYQNE-UHFFFAOYSA-N 6-azaniumylhexylazanium;hexanedioate Chemical compound [NH3+]CCCCCC[NH3+].[O-]C(=O)CCCCC([O-])=O UFFRSDWQMJYQNE-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 239000001361 adipic acid Substances 0.000 description 3
- 235000011037 adipic acid Nutrition 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- LRQKBLKVPFOOQJ-YFKPBYRVSA-N L-norleucine Chemical compound CCCC[C@H]([NH3+])C([O-])=O LRQKBLKVPFOOQJ-YFKPBYRVSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000012512 characterization method Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 238000010926 purge Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000010186 staining Methods 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- NUDXUJGIZOXHOV-UHFFFAOYSA-N 2,2-diphenylhexanedioic acid Chemical compound C=1C=CC=CC=1C(C(O)=O)(CCCC(=O)O)C1=CC=CC=C1 NUDXUJGIZOXHOV-UHFFFAOYSA-N 0.000 description 1
- YKXQHABPMHMNNY-UHFFFAOYSA-M C(=O)(OC)C=1C=C(C=CC1)S(=O)(=O)[O-].[K+] Chemical compound C(=O)(OC)C=1C=C(C=CC1)S(=O)(=O)[O-].[K+] YKXQHABPMHMNNY-UHFFFAOYSA-M 0.000 description 1
- WIFFVVUCKBYLQD-UHFFFAOYSA-N C(=O)(OC)CCOS(=O)(=O)C1=CC=CC=C1.[Na] Chemical compound C(=O)(OC)CCOS(=O)(=O)C1=CC=CC=C1.[Na] WIFFVVUCKBYLQD-UHFFFAOYSA-N 0.000 description 1
- CHMLNWGTGSLLAQ-UHFFFAOYSA-N NCCOS(=O)(=O)C1=CC=CC=C1.[Na] Chemical compound NCCOS(=O)(=O)C1=CC=CC=C1.[Na] CHMLNWGTGSLLAQ-UHFFFAOYSA-N 0.000 description 1
- 241000124033 Salix Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229960002684 aminocaproic acid Drugs 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000003796 beauty Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000010622 cold drawing Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- UKCQMYVWCIFBOW-UHFFFAOYSA-M potassium;2-propoxycarbonylbenzenesulfonate Chemical compound [K+].CCCOC(=O)C1=CC=CC=C1S([O-])(=O)=O UKCQMYVWCIFBOW-UHFFFAOYSA-M 0.000 description 1
- FJIZBDJKYXYPAE-UHFFFAOYSA-M potassium;3,5-bis(methoxycarbonyl)benzenesulfonate Chemical compound [K+].COC(=O)C1=CC(C(=O)OC)=CC(S([O-])(=O)=O)=C1 FJIZBDJKYXYPAE-UHFFFAOYSA-M 0.000 description 1
- DVBBBJFTGOHNHC-UHFFFAOYSA-M potassium;3,5-dicarboxybenzenesulfonate Chemical compound [K+].OC(=O)C1=CC(C(O)=O)=CC(S([O-])(=O)=O)=C1 DVBBBJFTGOHNHC-UHFFFAOYSA-M 0.000 description 1
- QVHUDHHLHJPCQF-UHFFFAOYSA-M potassium;3-sulfobenzoate Chemical compound [K+].OS(=O)(=O)C1=CC=CC(C([O-])=O)=C1 QVHUDHHLHJPCQF-UHFFFAOYSA-M 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- HFPGULMERUXXDW-UHFFFAOYSA-M sodium;2-carboxybenzenesulfonate Chemical compound [Na+].OS(=O)(=O)C1=CC=CC=C1C([O-])=O HFPGULMERUXXDW-UHFFFAOYSA-M 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/42—Polyamides containing atoms other than carbon, hydrogen, oxygen, and nitrogen
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Artificial Filaments (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US847105A US3142662A (en) | 1959-10-19 | 1959-10-19 | Modified polyamides containing the benzenesulfonate moiety |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1269808B true DE1269808B (de) | 1968-06-06 |
Family
ID=25299768
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP1269A Pending DE1269808B (de) | 1959-10-19 | 1960-10-18 | Verfahren zur Herstellung von synthetischen, linearen Polyamiden |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3142662A (instruction) |
| BE (1) | BE596145A (instruction) |
| CH (1) | CH406644A (instruction) |
| DE (1) | DE1269808B (instruction) |
| FR (1) | FR1270958A (instruction) |
| GB (1) | GB901938A (instruction) |
| NL (2) | NL256973A (instruction) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3296204A (en) * | 1962-02-20 | 1967-01-03 | Eastman Kodak Co | Sulfonated polyamides |
| US3296213A (en) * | 1963-06-19 | 1967-01-03 | Monsanto Co | Aromatic-aliphatic copolyamides |
| DE1260683B (de) * | 1964-02-08 | 1968-02-08 | Bayer Ag | Verfahren zur Herstellung von Faeden und Fasern aus Polyamiden |
| DE1260684B (de) * | 1964-02-08 | 1968-02-08 | Bayer Ag | Verfahren zur Herstellung von Faeden und Fasern aus Polyamiden |
| US3438949A (en) * | 1965-10-21 | 1969-04-15 | Monsanto Co | Polycarbonamides resistant to acid dyes and containing terminal naphthyl disulfonated radicals |
| US3440226A (en) * | 1965-10-21 | 1969-04-22 | Ernestine H Huffman | Polycarbonamides resistant to acid dyes |
| FR1510293A (instruction) * | 1966-01-17 | 1968-04-03 | ||
| US3518233A (en) * | 1967-09-15 | 1970-06-30 | Us Air Force | Arylene sulfimide polymers |
| US3536674A (en) * | 1967-09-15 | 1970-10-27 | Us Air Force | Arylene sulfimide polymers |
| GB1188195A (en) * | 1967-10-05 | 1970-04-15 | Ici Ltd | Disulphonated Modifying Agents for Polyamides |
| US3684775A (en) * | 1970-07-15 | 1972-08-15 | Du Pont | Chain terminated polyhexamethylene adipamide |
| BE788337A (fr) * | 1971-09-02 | 1973-03-05 | Phillips Petroleum Co | Polyamides modifies par des amino-alcanesulfonates |
| US3853823A (en) * | 1971-09-02 | 1974-12-10 | Phillips Petroleum Co | Preparation of aminobenzenesulfonate-modified polyamides |
| US3860560A (en) * | 1972-01-07 | 1975-01-14 | Fiber Industries Inc | Basic dyeable polyamides |
| US3951923A (en) * | 1973-06-14 | 1976-04-20 | Phillips Petroleum Company | Preparation of amino-benzenesulfonate-modified polyamides |
| IT1141254B (it) * | 1980-02-28 | 1986-10-01 | Montedison Spa | Procedimento per produrre poliammidi a modificata tingibilita' |
| EP0421971A3 (en) * | 1989-10-05 | 1991-07-17 | Monsanto Company | Pigmented stain resistant nylon fiber |
| US5085667A (en) * | 1990-05-04 | 1992-02-04 | Burlington Industries, Inc. | Stain resistance of nylon carpet: cationic-dyeable nylon fibers dyed with acid dye |
| US5155178A (en) * | 1990-08-08 | 1992-10-13 | E. I. Du Pont De Nemours And Company | Antistain block copolymer compositions of modified nylon copolymers and high carbon nylons |
| US5164261A (en) * | 1990-08-08 | 1992-11-17 | E. I. Du Pont De Nemours And Company | Dyed antistain nylon with cationic dye modifier |
| US5242733A (en) * | 1990-08-08 | 1993-09-07 | E. I. Du Pont De Nemours And Company | Carpets and fabrics of antistain block copolymer compositions of modified nylon copolymers and high carbon nylons |
| US5545833A (en) * | 1995-05-30 | 1996-08-13 | Monsanto Company | Phosphorus-containing polymers and fibers formed therefrom |
| US6433107B1 (en) | 1995-08-31 | 2002-08-13 | Prisma Fibers, Inc. | Fiber-forming polyamide with concentrate of polyamide and sulfonated aromatic acid |
| US6537475B1 (en) * | 1995-08-31 | 2003-03-25 | Prisma Fibers, Inc. | Melt extrusion spinning polyamide fibers with sulfonated reagent |
| US5852087A (en) * | 1996-02-13 | 1998-12-22 | Teijin Limited | Easily dyeable meta-linkage-containing aromatic polyamide fibers |
| US5889138A (en) * | 1996-11-27 | 1999-03-30 | Solutia Inc. | Process for making stain resistant nylon fibers from highly sulfonated nylon copolymers |
| US6117550A (en) | 1997-10-22 | 2000-09-12 | Prisma Fibers, Inc. | Acid dye stain-resistant fiber-forming polyamide composition containing masterbatch concentrate containing reagent and carrier |
| IL154571A0 (en) * | 2003-02-20 | 2003-09-17 | Nilit Ltd | Process for making polyamide textile articles bearing designs in different colors |
| US11634624B2 (en) * | 2018-03-29 | 2023-04-25 | Mol Magyar Olaj- És Gázipari Nyilvánosan Működő Részvénytársaság | Surfactants for enhanced oil recovery |
| CN108976408A (zh) * | 2018-07-27 | 2018-12-11 | 辽宁银珠化纺集团有限公司 | 一种阳离子易染尼龙66树脂及其制备方法 |
| WO2021167912A1 (en) * | 2020-02-19 | 2021-08-26 | Advansix Resins & Chemicals Llc | Stain-resistant branched polyamides |
| US12146029B1 (en) | 2021-02-08 | 2024-11-19 | Futurefuel Chemical Company | Polymers enhanced with hydrated sodium sulfoisophthalic acid salts |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2880196A (en) * | 1955-06-10 | 1959-03-31 | Nat Distillers Chem Corp | Polyamides from diphenyladipic acid |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2473924A (en) * | 1946-07-19 | 1949-06-21 | Du Pont | Synthetic linear polyamides and process for retarding crystallization of said polyamides |
| GB541072A (en) * | 1940-04-02 | 1941-11-12 | Robert Wighton Monurieff | Improvements in the production and/or treatment of polymeric organic compounds |
| US2317751A (en) * | 1941-09-26 | 1943-04-27 | Standard Oil Dev Co | Lubricating oil |
| US2925397A (en) * | 1955-04-22 | 1960-02-16 | Dehydag Gmbh | Polymer composition comprising a resinous polymer and the salt obtained by reacting a quaternary ammonium compound with an anionic surface active compound and method of making same |
| NL120504C (instruction) * | 1959-10-19 |
-
0
- NL NL120441D patent/NL120441C/xx active
- NL NL256973D patent/NL256973A/xx unknown
-
1959
- 1959-10-19 US US847105A patent/US3142662A/en not_active Expired - Lifetime
-
1960
- 1960-10-11 GB GB34829/60A patent/GB901938A/en not_active Expired
- 1960-10-18 BE BE596145A patent/BE596145A/fr unknown
- 1960-10-18 DE DEP1269A patent/DE1269808B/de active Pending
- 1960-10-18 CH CH1166360A patent/CH406644A/fr unknown
- 1960-10-19 FR FR841629A patent/FR1270958A/fr not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2880196A (en) * | 1955-06-10 | 1959-03-31 | Nat Distillers Chem Corp | Polyamides from diphenyladipic acid |
Also Published As
| Publication number | Publication date |
|---|---|
| BE596145A (fr) | 1961-04-18 |
| NL256973A (instruction) | |
| NL120441C (instruction) | |
| US3142662A (en) | 1964-07-28 |
| FR1270958A (fr) | 1961-09-01 |
| GB901938A (en) | 1962-07-25 |
| CH406644A (fr) | 1966-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1269808B (de) | Verfahren zur Herstellung von synthetischen, linearen Polyamiden | |
| DE69803601T2 (de) | Hochmolekulares polyamid | |
| DE1669511C3 (de) | Elastische Faden und Fasern aus einem segmentierten Polyurethan | |
| DE1266977B (de) | Verfahren zur Herstellung von linearen Polyamiden | |
| DE4027063C2 (de) | Verfahren zur Herstellung von besonders hochmolekularen Polyamidfasern sowie nach diesem Verfahren herstellbare Polyamidfasern | |
| DE1260683B (de) | Verfahren zur Herstellung von Faeden und Fasern aus Polyamiden | |
| DE1260684B (de) | Verfahren zur Herstellung von Faeden und Fasern aus Polyamiden | |
| DE1235499B (de) | Herstellen von Faeden oder Fasern aus Polyurethanen | |
| EP0567998A1 (de) | Verfahren zur Herstellung von Faserbildenden meta-Aramiden | |
| DE19854421A1 (de) | Verfahren zur Herstellung von Polyamid-6 für Spinnzwecke | |
| DE1138935B (de) | Verfahren zur Herstellung von Mischpolyamiden, die wenigstens 50 Gewichtsprozent ªŠ-Caprolactam enthalten | |
| DE1943251A1 (de) | Faserbildende Polyamide mit erhoehtem Aminogruppengehalt | |
| DE1620997A1 (de) | Lineare faserbildende Terpolyamide und Verfahren zu deren Herstellung | |
| DE1795245B2 (de) | Verfahren zur Herstellung von Polyurethanlösungen | |
| DE2339865C2 (de) | Sulfonatgruppenhaltige Polycaprolactame, Verfahren zu ihrer Herstellung und Fäden und Fasern aus Polycaprolactamen, die diese sulfonatgruppenhaltigen Polycaprolactame zugemischt enthalten | |
| DE4010941A1 (de) | Verfahren zur herstellung von aromatischen popyamiden mit hoher hydrolysebestaendigkeit | |
| DE2449664A1 (de) | Verfahren zur herstellung von polyamiden | |
| DE1620996A1 (de) | Lineare faserbildende Terpolyamide und Verfahren zu deren Herstellung | |
| CH435714A (de) | Faserbildendes Polymerisatgemisch und Verfahren zur Herstellung desselben | |
| DE2454119C2 (de) | Verfahren zur Herstellung eines hydrophilen Blockcopolymeren | |
| DE1620991A1 (de) | Lineare faserbildende Terpolyamide und Verfahren zu deren Herstellung | |
| DE1570259A1 (de) | Verfahren zum Herstellen von Polyamiden | |
| DE1961746A1 (de) | Neuartige Terpolyamide | |
| DE1921466C3 (de) | 1,4-Bis-(4'-carbamidostyryl)-benzol, Verfahren zu seiner Herstellung und seine Verwendung zum optischen Aufhellen von synthetischen Polyamiden | |
| DE1570936A1 (de) | Faserbildende synthetische lineare Polycarbonamide und Verfahren zu deren Herstellung |