DE1248526B - Sprengschnur - Google Patents
SprengschnurInfo
- Publication number
- DE1248526B DE1248526B DED46288A DED0046288A DE1248526B DE 1248526 B DE1248526 B DE 1248526B DE D46288 A DED46288 A DE D46288A DE D0046288 A DED0046288 A DE D0046288A DE 1248526 B DE1248526 B DE 1248526B
- Authority
- DE
- Germany
- Prior art keywords
- explosive
- detonating cord
- explosives
- detonating
- fibers
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000002360 explosive Substances 0.000 claims description 31
- 239000002184 metal Substances 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000000835 fiber Substances 0.000 claims description 4
- 229920001169 thermoplastic Polymers 0.000 claims description 4
- 239000011521 glass Substances 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 239000004416 thermosoftening plastic Substances 0.000 claims description 2
- 238000005474 detonation Methods 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 description 2
- 239000010426 asphalt Substances 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 238000009987 spinning Methods 0.000 description 2
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 description 1
- SPSSULHKWOKEEL-UHFFFAOYSA-N 2,4,6-trinitrotoluene Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O SPSSULHKWOKEEL-UHFFFAOYSA-N 0.000 description 1
- ZKYHWNAIOKHVME-UHFFFAOYSA-N 2-[bis(2-hydroxyethyl)amino]ethanol;perchloric acid Chemical compound [O-]Cl(=O)(=O)=O.OCC[NH+](CCO)CCO ZKYHWNAIOKHVME-UHFFFAOYSA-N 0.000 description 1
- IUKSYUOJRHDWRR-UHFFFAOYSA-N 2-diazonio-4,6-dinitrophenolate Chemical class [O-]C1=C([N+]#N)C=C([N+]([O-])=O)C=C1[N+]([O-])=O IUKSYUOJRHDWRR-UHFFFAOYSA-N 0.000 description 1
- 229910000906 Bronze Inorganic materials 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical class O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000000026 Pentaerythritol tetranitrate Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- RBXVOQPAMPBADW-UHFFFAOYSA-N nitrous acid;phenol Chemical class ON=O.OC1=CC=CC=C1 RBXVOQPAMPBADW-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229960004321 pentaerithrityl tetranitrate Drugs 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000015 trinitrotoluene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06C—DETONATING OR PRIMING DEVICES; FUSES; CHEMICAL LIGHTERS; PYROPHORIC COMPOSITIONS
- C06C5/00—Fuses, e.g. fuse cords
- C06C5/04—Detonating fuses
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Aiming, Guidance, Guns With A Light Source, Armor, Camouflage, And Targets (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED46288A DE1248526B (de) | 1965-01-19 | 1965-01-19 | Sprengschnur |
| FR42242A FR1461014A (fr) | 1965-01-19 | 1965-12-14 | Cordon détonant |
| US519467A US3382802A (en) | 1965-01-19 | 1966-01-10 | Fuse having an improved sheathing |
| BE675185D BE675185A (enExample) | 1965-01-19 | 1966-01-17 | |
| GB2396/66A GB1131027A (en) | 1965-01-19 | 1966-01-18 | Improvements in or relating to safety fuzes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED46288A DE1248526B (de) | 1965-01-19 | 1965-01-19 | Sprengschnur |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1248526B true DE1248526B (de) | 1967-08-24 |
Family
ID=7049618
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DED46288A Pending DE1248526B (de) | 1965-01-19 | 1965-01-19 | Sprengschnur |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3382802A (enExample) |
| BE (1) | BE675185A (enExample) |
| DE (1) | DE1248526B (enExample) |
| FR (1) | FR1461014A (enExample) |
| GB (1) | GB1131027A (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3474730A (en) * | 1967-09-20 | 1969-10-28 | Apache Powder Co | Luminescent coated detonating fuse |
| US4011816A (en) * | 1971-10-06 | 1977-03-15 | The United States Of America As Represented By The Secretary Of The Navy | Continuous line confined detonating fuse to provide a series of work pulses (U) |
| US3792660A (en) * | 1972-03-31 | 1974-02-19 | Gen Motors Corp | Flexible pyrotechnic relay |
| GB1378669A (en) * | 1972-09-06 | 1974-12-27 | Ici Ltd | Explosive fuse-cord |
| GB1396471A (en) * | 1973-02-19 | 1975-06-04 | Ici Ltd | Exposive fuse-cord |
| US3867884A (en) * | 1973-02-19 | 1975-02-25 | Ici Ltd | Explosive fuse-cord |
| US4232606A (en) * | 1977-10-17 | 1980-11-11 | E. I. Du Pont De Nemours And Company | Explosive connecting cord |
| GB2207986A (en) * | 1986-11-28 | 1989-02-15 | Royal Ordnance Plc | Explosive hoses; destroying mines, wire entanglements etc |
| US6247410B1 (en) * | 1998-12-10 | 2001-06-19 | The United States Of America As Represented By The Secretary Of The Navy | High-output insensitive munition detonating cord |
| EP1753706A2 (en) * | 2004-06-01 | 2007-02-21 | Ensign-Bickford Aerospace & Defense Company | Detonating cord with protective jacket |
| CN107345782A (zh) * | 2017-05-19 | 2017-11-14 | 湖北帅力化工有限公司 | 一种棉线与塑料线混合编制的棉塑导爆索 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2380312A (en) * | 1942-11-19 | 1945-07-10 | Du Pont | Detonating fuse |
| US2445032A (en) * | 1946-02-26 | 1948-07-13 | Atlas Powder Co | Detonating fuse |
| US3125024A (en) * | 1964-03-17 | Explosive connecting cord | ||
| US3155038A (en) * | 1962-09-21 | 1964-11-03 | Ensign Bickford Co | Detonating fuse |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2982210A (en) * | 1958-06-25 | 1961-05-02 | Ensign Bickford Co | Connecting cord |
| US2992087A (en) * | 1959-11-03 | 1961-07-11 | Du Pont | New explosive |
| US3260201A (en) * | 1963-11-15 | 1966-07-12 | Ensign Bickford Co | Fuse having cellular plastic sheath |
-
1965
- 1965-01-19 DE DED46288A patent/DE1248526B/de active Pending
- 1965-12-14 FR FR42242A patent/FR1461014A/fr not_active Expired
-
1966
- 1966-01-10 US US519467A patent/US3382802A/en not_active Expired - Lifetime
- 1966-01-17 BE BE675185D patent/BE675185A/xx unknown
- 1966-01-18 GB GB2396/66A patent/GB1131027A/en not_active Expired
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3125024A (en) * | 1964-03-17 | Explosive connecting cord | ||
| US2380312A (en) * | 1942-11-19 | 1945-07-10 | Du Pont | Detonating fuse |
| US2445032A (en) * | 1946-02-26 | 1948-07-13 | Atlas Powder Co | Detonating fuse |
| US3155038A (en) * | 1962-09-21 | 1964-11-03 | Ensign Bickford Co | Detonating fuse |
Also Published As
| Publication number | Publication date |
|---|---|
| BE675185A (enExample) | 1966-05-16 |
| GB1131027A (en) | 1968-10-16 |
| FR1461014A (fr) | 1966-12-02 |
| US3382802A (en) | 1968-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1248526B (de) | Sprengschnur | |
| US3621558A (en) | Manufacture of detonating fuse cord | |
| DE1922374C3 (de) | Verfahren zur Herstellung einer Sprengschnur | |
| DE2803402C3 (de) | Energiearme Sprengschnur sowie Verfahren und Vorrichtung zur Herstellung derselben | |
| DE2057042C3 (de) | Sprengschnur für den Einsatz in Schlagwetter- und kohlenstaubgefährdeten Betrieben | |
| DE1295434C2 (de) | Sprengzuendschnur | |
| DE2749478B2 (de) | Sprengstoff-Zündschnur sowie Verfahren und Vorrichtung zu ihrer Herstellung und ihre Verwendung | |
| DE1916685C3 (de) | Sprengschnur | |
| DE1960570A1 (de) | Sprengschnur | |
| DE1927906A1 (de) | Sprengschnur | |
| DE1194748B (de) | Zuendschnur, insbesondere zur Verwendung fuer das Verzoegerungsschiessen | |
| AT301419B (de) | Sprengschnur, insbesondere zum Schneiden von Felsen, zum geophysikalischen Aufschluß und zum Zünden von Minen | |
| DE2349556C3 (de) | Sprengschnur | |
| DE3020957C2 (de) | Wasserfeste Sprengschnur | |
| DE4322719C1 (de) | Verfahren zur Herstellung einer Sprengschnur mit verminderter, einstellbarer Detonationsgeschwindigkeit | |
| DE940760C (de) | Zuendschnur fuer Sprengstoffladungen sowie Verfahren und Vorrichtung zu ihrer Herstellung | |
| CH325466A (de) | Kabelähnliche Zündvorrichtung für Sprengladungen | |
| DE2344524C3 (de) | Sprengzündschnur und Verfahren zu ihrer Herstellung | |
| DE2349556B2 (de) | Sprengschnur | |
| DE1086609B (de) | Sprengstoff-Ventil- oder Relaisanordnung | |
| AT128612B (de) | Verfahren zur Erzeugung von Sicherheitszündschnüren. | |
| DE1118676B (de) | Schnurartiger Zuender fuer Sicherheitszuendschnuere | |
| DE1571262A1 (de) | Verfahren zur Herstellung von Sprengstoffladungen | |
| DE2520803B2 (de) | Verfahren zur herstellung einer sprengzuendschnur | |
| DE1277728B (de) | Verfahren zur Herstellung einer Sprengschnur |