DE1244174C2 - Verfahren zur Herstellung von Benzolsulfonylharnstoffen - Google Patents
Verfahren zur Herstellung von BenzolsulfonylharnstoffenInfo
- Publication number
- DE1244174C2 DE1244174C2 DE1965F0047142 DEF0047142A DE1244174C2 DE 1244174 C2 DE1244174 C2 DE 1244174C2 DE 1965F0047142 DE1965F0047142 DE 1965F0047142 DE F0047142 A DEF0047142 A DE F0047142A DE 1244174 C2 DE1244174 C2 DE 1244174C2
- Authority
- DE
- Germany
- Prior art keywords
- substituted
- benzenesulfonyl
- och
- ethyl
- radical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 8
- 235000013877 carbamide Nutrition 0.000 claims description 28
- -1 alkenoxy Chemical group 0.000 claims description 26
- 150000003839 salts Chemical class 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 150000003672 ureas Chemical class 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 239000007795 chemical reaction product Substances 0.000 claims description 6
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 125000005083 alkoxyalkoxy group Chemical group 0.000 claims description 5
- 150000001714 carbamic acid halides Chemical class 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 claims description 5
- 150000003560 thiocarbamic acids Chemical class 0.000 claims description 5
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical class NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 4
- 125000004423 acyloxy group Chemical group 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical class O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 claims description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 3
- 150000008331 benzenesulfonamides Chemical class 0.000 claims description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 239000012948 isocyanate Substances 0.000 claims description 3
- 150000002513 isocyanates Chemical class 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 230000010933 acylation Effects 0.000 claims description 2
- 238000005917 acylation reaction Methods 0.000 claims description 2
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 2
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 claims description 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 150000001336 alkenes Chemical class 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- 239000004202 carbamide Substances 0.000 description 25
- 238000002844 melting Methods 0.000 description 15
- 230000008018 melting Effects 0.000 description 15
- 239000008280 blood Substances 0.000 description 10
- 210000004369 blood Anatomy 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- VDTNNGKXZGSZIP-UHFFFAOYSA-N carbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 VDTNNGKXZGSZIP-UHFFFAOYSA-N 0.000 description 8
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 4
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 244000265913 Crataegus laevigata Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical class C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- DKNWSYNQZKUICI-UHFFFAOYSA-N amantadine Chemical compound C1C(C2)CC3CC2CC1(N)C3 DKNWSYNQZKUICI-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- ALZKZGUTVJXYEF-UHFFFAOYSA-N benzenesulfonylcarbamic acid Chemical class OC(=O)NS(=O)(=O)C1=CC=CC=C1 ALZKZGUTVJXYEF-UHFFFAOYSA-N 0.000 description 1
- GHDLZGOOOLEJKI-UHFFFAOYSA-N benzenesulfonylurea Chemical class NC(=O)NS(=O)(=O)C1=CC=CC=C1 GHDLZGOOOLEJKI-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001716 carbazoles Chemical class 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CVJNUXOQCZAWPD-UHFFFAOYSA-N ethyl N-[4-(benzamidomethyl)phenyl]sulfonylcarbamate Chemical compound C(C1=CC=CC=C1)(=O)NCC1=CC=C(C=C1)S(=O)(=O)NC(=O)OCC CVJNUXOQCZAWPD-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910000474 mercury oxide Inorganic materials 0.000 description 1
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- WWECJGLXBSQKRF-UHFFFAOYSA-N n,n-dimethylformamide;methanol Chemical compound OC.CN(C)C=O WWECJGLXBSQKRF-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/64—Sulfonylureas, e.g. glibenclamide, tolbutamide, chlorpropamide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/32—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (23)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1965F0047142 DE1244174C2 (de) | 1965-09-10 | 1965-09-10 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| FI662285A FI45960C (fi) | 1965-09-10 | 1966-08-31 | Menetelmä veren sokeripitoisuutta alentavien bentseenisulfonyylivirtsa -aineiden valmistamiseksi. |
| CH1078969A CH520661A (de) | 1965-09-10 | 1966-09-07 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| US577619A US3504026A (en) | 1965-09-10 | 1966-09-07 | Benzenesulfonyl-ureas |
| CH1078869A CH512450A (de) | 1965-09-10 | 1966-09-07 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| ES0330971A ES330971A1 (es) | 1965-09-10 | 1966-09-07 | Procedimiento para la obtencion de benzosulfonilureas. |
| CH1293866A CH529116A (de) | 1965-09-10 | 1966-09-07 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| IL26477A IL26477A (en) | 1965-09-10 | 1966-09-07 | Benzene-sulfonyl ureas and process for their preparation |
| CH1079069A CH512451A (de) | 1965-09-10 | 1966-09-07 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| NO164628A NO122920B (enExample) | 1965-09-10 | 1966-09-08 | |
| AT1042867A AT273992B (de) | 1965-09-10 | 1966-09-08 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und deren Salzen |
| BR182693/66A BR6682693D0 (pt) | 1965-09-10 | 1966-09-08 | Processo para a preparacao de benzenossulfonilureias |
| AT848266A AT273988B (de) | 1965-09-10 | 1966-09-08 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und deren Salzen |
| AT1042767A AT273991B (de) | 1965-09-10 | 1966-09-08 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und deren Salzen |
| AT1042967A AT273993B (de) | 1965-09-10 | 1966-09-08 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und deren Salzen |
| NL666612734A NL150781B (nl) | 1965-09-10 | 1966-09-09 | Werkwijze voor het bereiden van geneesmiddelen met bloedsuikerspiegel verlagende activiteit, gevormd geneesmiddel en werkwijze voor het bereiden van daarvoor geschikte geneeskrachtige verbindingen. |
| SE12142/66A SE344587B (enExample) | 1965-09-10 | 1966-09-09 | |
| DK467266AA DK123595B (da) | 1965-09-10 | 1966-09-09 | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller fysiologisk uskadelige salte deraf. |
| GB40409/66A GB1163171A (en) | 1965-09-10 | 1966-09-09 | Benzenesulphonyl-Ureas and process for preparing them |
| JP41059800A JPS5017470B1 (enExample) | 1965-09-10 | 1966-09-10 | |
| FR75948A FR1501005A (fr) | 1965-09-10 | 1966-09-10 | Nouvelles benzène-sulfonyl-urées et leur préparation |
| BE686784D BE686784A (enExample) | 1965-09-10 | 1966-09-12 | |
| FR86809A FR6870M (enExample) | 1965-09-10 | 1966-12-09 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1965F0047142 DE1244174C2 (de) | 1965-09-10 | 1965-09-10 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1244174B DE1244174B (de) | 1967-07-13 |
| DE1244174C2 true DE1244174C2 (de) | 1968-01-18 |
Family
ID=7101444
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1965F0047142 Expired DE1244174C2 (de) | 1965-09-10 | 1965-09-10 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3504026A (enExample) |
| JP (1) | JPS5017470B1 (enExample) |
| AT (4) | AT273992B (enExample) |
| BE (1) | BE686784A (enExample) |
| BR (1) | BR6682693D0 (enExample) |
| CH (4) | CH512450A (enExample) |
| DE (1) | DE1244174C2 (enExample) |
| DK (1) | DK123595B (enExample) |
| ES (1) | ES330971A1 (enExample) |
| FI (1) | FI45960C (enExample) |
| FR (2) | FR1501005A (enExample) |
| GB (1) | GB1163171A (enExample) |
| IL (1) | IL26477A (enExample) |
| NL (1) | NL150781B (enExample) |
| NO (1) | NO122920B (enExample) |
| SE (1) | SE344587B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH499501A (de) * | 1968-06-20 | 1970-11-30 | Ciba Geigy Ag | Verfahren zur Herstellung von neuen Derivaten des p-Aminoalkyl-benzolsulfonamids |
| US3832397A (en) * | 1970-03-19 | 1974-08-27 | Hoffmann La Roche | Process for substituted sulfonylureas |
| US3927220A (en) * | 1971-12-29 | 1975-12-16 | Stauffer Chemical Co | Method of controlling pests with thioureido sulfonanilide compounds |
| US4288454A (en) * | 1978-07-24 | 1981-09-08 | Hoffman-La Roche Inc. | Antiviral 1-adamantyl-3-(phenylsulfonyl)thioureas |
| JPS57154964U (enExample) * | 1981-03-20 | 1982-09-29 | ||
| JPS63124360U (enExample) * | 1987-02-06 | 1988-08-12 | ||
| HRP20090186A2 (hr) | 2009-03-31 | 2010-10-31 | Institut Ruđer Bošković | Adamantanski bisureidni derivati, metoda priprave i primjena u detekciji aniona |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3096372A (en) * | 1961-08-15 | 1963-07-02 | Lilly Co Eli | Novel nu-(substituted)-phenylsulfonyl-n'-1-adamantylureas |
| DE1185180B (de) * | 1963-10-19 | 1965-01-14 | Hoechst Ag | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| FR1440351A (fr) * | 1964-06-30 | 1966-05-27 | Hoechst Ag | Nouvelles benzènesulfonyl-urées et leur préparation |
-
1965
- 1965-09-10 DE DE1965F0047142 patent/DE1244174C2/de not_active Expired
-
1966
- 1966-08-31 FI FI662285A patent/FI45960C/fi active
- 1966-09-07 ES ES0330971A patent/ES330971A1/es not_active Expired
- 1966-09-07 CH CH1078869A patent/CH512450A/de not_active IP Right Cessation
- 1966-09-07 CH CH1079069A patent/CH512451A/de not_active IP Right Cessation
- 1966-09-07 CH CH1293866A patent/CH529116A/de not_active IP Right Cessation
- 1966-09-07 IL IL26477A patent/IL26477A/en unknown
- 1966-09-07 CH CH1078969A patent/CH520661A/de not_active IP Right Cessation
- 1966-09-07 US US577619A patent/US3504026A/en not_active Expired - Lifetime
- 1966-09-08 AT AT1042867A patent/AT273992B/de active
- 1966-09-08 AT AT1042767A patent/AT273991B/de active
- 1966-09-08 NO NO164628A patent/NO122920B/no unknown
- 1966-09-08 AT AT848266A patent/AT273988B/de active
- 1966-09-08 BR BR182693/66A patent/BR6682693D0/pt unknown
- 1966-09-08 AT AT1042967A patent/AT273993B/de active
- 1966-09-09 NL NL666612734A patent/NL150781B/xx unknown
- 1966-09-09 GB GB40409/66A patent/GB1163171A/en not_active Expired
- 1966-09-09 SE SE12142/66A patent/SE344587B/xx unknown
- 1966-09-09 DK DK467266AA patent/DK123595B/da unknown
- 1966-09-10 JP JP41059800A patent/JPS5017470B1/ja active Pending
- 1966-09-10 FR FR75948A patent/FR1501005A/fr not_active Expired
- 1966-09-12 BE BE686784D patent/BE686784A/xx unknown
- 1966-12-09 FR FR86809A patent/FR6870M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE686784A (enExample) | 1967-03-13 |
| FR1501005A (fr) | 1967-11-10 |
| JPS5017470B1 (enExample) | 1975-06-20 |
| NO122920B (enExample) | 1971-09-06 |
| BR6682693D0 (pt) | 1973-12-26 |
| CH512450A (de) | 1971-09-15 |
| AT273991B (de) | 1969-09-10 |
| US3504026A (en) | 1970-03-31 |
| CH529116A (de) | 1972-10-15 |
| FI45960B (enExample) | 1972-07-31 |
| IL26477A (en) | 1971-04-28 |
| GB1163171A (en) | 1969-09-04 |
| SE344587B (enExample) | 1972-04-24 |
| AT273992B (de) | 1969-09-10 |
| NL150781B (nl) | 1976-09-15 |
| ES330971A1 (es) | 1967-09-16 |
| CH520661A (de) | 1972-03-31 |
| CH512451A (de) | 1971-09-15 |
| DK123595B (da) | 1972-07-10 |
| NL6612734A (enExample) | 1967-03-13 |
| AT273988B (de) | 1969-09-10 |
| DE1244174B (de) | 1967-07-13 |
| FR6870M (enExample) | 1969-04-14 |
| FI45960C (fi) | 1972-11-10 |
| AT273993B (de) | 1969-09-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2951135A1 (de) | Sulfonylharnstoffe, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen und ihre verwendung | |
| DE1244174C2 (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1518879C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu Ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1543564C3 (de) | Benzolsulfonylharnstoffe, Verfahren zur ihrer Herstellung und diese enthaltende phyrmazeutische Präparate | |
| DE1443911C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE2238870C3 (de) | Benzolsulfonylharnstoffe | |
| DE2621958A1 (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung | |
| DE1518816C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1443905C3 (de) | benzolsulfonyl] -N'-cyclohexylharnstoff, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE1568648C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1181208B (de) | Verfahren zur Herstellung von N-Benzolsulfonyl-N'-cyclohexyl-harnstoffen | |
| DE1518846C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1670700B2 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und deren Verwendung | |
| DE1518895C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und deren Verwendung | |
| DE2157607C3 (de) | Sulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| EP0031088A1 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen sowie ihre Verwendung | |
| DE1568626B2 (de) | BenzolsuHonyl-harnstoffe, ihre Salze, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1301812B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1443890C (de) | Benzolsulfonyl Harnstoffe und Verfahren zu ihrer Herstellung | |
| DE1443878C (de) | Verfahren zur Herstellung von Benzol= sulfonylharnstoffen | |
| DE1251753B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1034618B (de) | Verfahren zur Herstellung von Sulfonylharnstoffen | |
| DE1793111C3 (de) | Acylaminoäthylbenzolsulfonyl-delta hoch 2-cyclohexenyl-harnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1618402C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1793072C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen |