DE1242618B - Verfahren zur Herstellung von substituierten Nicotinsaeure-phenyl-aethylamiden - Google Patents
Verfahren zur Herstellung von substituierten Nicotinsaeure-phenyl-aethylamidenInfo
- Publication number
- DE1242618B DE1242618B DEF35483A DEF0035483A DE1242618B DE 1242618 B DE1242618 B DE 1242618B DE F35483 A DEF35483 A DE F35483A DE F0035483 A DEF0035483 A DE F0035483A DE 1242618 B DE1242618 B DE 1242618B
- Authority
- DE
- Germany
- Prior art keywords
- nicotinic acid
- ethyl
- ecm
- phenyl
- benzene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 3
- -1 phenyl-nicotinic acid-ethylamides Chemical class 0.000 title description 17
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 claims description 43
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 36
- 239000011664 nicotinic acid Substances 0.000 claims description 21
- 229960003512 nicotinic acid Drugs 0.000 claims description 21
- 235000001968 nicotinic acid Nutrition 0.000 claims description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 239000013078 crystal Substances 0.000 claims description 3
- 238000001704 evaporation Methods 0.000 claims description 3
- 230000008020 evaporation Effects 0.000 claims description 3
- 150000007925 phenylethylamine derivatives Chemical class 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 claims 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims 1
- 229940079593 drug Drugs 0.000 claims 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 claims 1
- JNYWCOMKUGQILI-UHFFFAOYSA-N n-ethyl-n-phenylpyridine-3-carboxamide Chemical class C=1C=CC=CC=1N(CC)C(=O)C1=CC=CN=C1 JNYWCOMKUGQILI-UHFFFAOYSA-N 0.000 claims 1
- 238000003756 stirring Methods 0.000 claims 1
- 239000000725 suspension Substances 0.000 claims 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- 238000006243 chemical reaction Methods 0.000 description 17
- 239000012043 crude product Substances 0.000 description 15
- 238000002844 melting Methods 0.000 description 15
- 230000008018 melting Effects 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- 239000007858 starting material Substances 0.000 description 12
- 238000009835 boiling Methods 0.000 description 11
- 238000005984 hydrogenation reaction Methods 0.000 description 10
- MSYBLBLAMDYKKZ-UHFFFAOYSA-N hydron;pyridine-3-carbonyl chloride;chloride Chemical compound Cl.ClC(=O)C1=CC=CN=C1 MSYBLBLAMDYKKZ-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 9
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- YOMVZWQZGFLTFA-UHFFFAOYSA-N 2-(3-chlorophenyl)-2-methylpropan-1-amine Chemical compound NCC(C)(C)C1=CC=CC(Cl)=C1 YOMVZWQZGFLTFA-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 2
- ZQPBOYASBNAXOZ-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)acetonitrile Chemical compound N#CCC1=CC=C2OCOC2=C1 ZQPBOYASBNAXOZ-UHFFFAOYSA-N 0.000 description 2
- LXKNAUOWEJWGTE-UHFFFAOYSA-N 2-(3-methoxyphenyl)acetonitrile Chemical compound COC1=CC=CC(CC#N)=C1 LXKNAUOWEJWGTE-UHFFFAOYSA-N 0.000 description 2
- PACGLQCRGWFBJH-UHFFFAOYSA-N 2-(4-methoxyphenyl)acetonitrile Chemical compound COC1=CC=C(CC#N)C=C1 PACGLQCRGWFBJH-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- STOZLJYPHYOFCT-UHFFFAOYSA-N 2-ethyl-2-(3-methoxyphenyl)butan-1-amine Chemical compound CCC(CC)(CN)C1=CC=CC(OC)=C1 STOZLJYPHYOFCT-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical class CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- XOUWJGNUVJXYEK-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)-2-propylpentanenitrile Chemical compound CCCC(CCC)(C#N)C1=CC=C2OCOC2=C1 XOUWJGNUVJXYEK-UHFFFAOYSA-N 0.000 description 1
- OUIZGIDKSQXOMA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-2-ethylbutanenitrile Chemical compound CCC(CC)(C#N)C1=CC=C(OC)C(OC)=C1 OUIZGIDKSQXOMA-UHFFFAOYSA-N 0.000 description 1
- ASLSUMISAQDOOB-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)acetonitrile Chemical compound COC1=CC=C(CC#N)C=C1OC ASLSUMISAQDOOB-UHFFFAOYSA-N 0.000 description 1
- JQDJTTSPIBENOW-UHFFFAOYSA-N 2-ethyl-2-(4-methoxyphenyl)butanenitrile Chemical compound CCC(CC)(C#N)C1=CC=C(OC)C=C1 JQDJTTSPIBENOW-UHFFFAOYSA-N 0.000 description 1
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- JDASLUAOHASDPY-UHFFFAOYSA-N CCC(CC)(C#N)C1=CC=C2OCOC2=C1 Chemical compound CCC(CC)(C#N)C1=CC=C2OCOC2=C1 JDASLUAOHASDPY-UHFFFAOYSA-N 0.000 description 1
- 101100356682 Caenorhabditis elegans rho-1 gene Proteins 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 150000007960 acetonitrile Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000007962 benzene acetonitriles Chemical class 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000003947 ethylamines Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ATBIAJXSKNPHEI-UHFFFAOYSA-N pyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=CN=C1 ATBIAJXSKNPHEI-UHFFFAOYSA-N 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 229940125725 tranquilizer Drugs 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/58—Radicals substituted by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL286303D NL286303A (OSRAM) | 1961-12-06 | ||
| NL131190D NL131190C (OSRAM) | 1961-12-06 | ||
| DEF35483A DE1242618B (de) | 1961-12-06 | 1961-12-06 | Verfahren zur Herstellung von substituierten Nicotinsaeure-phenyl-aethylamiden |
| CH1420262A CH429725A (de) | 1961-12-06 | 1962-12-04 | Verfahren zur Herstellung von substituierten Nikotinsäurephenyl-äthylamiden |
| US242104A US3166562A (en) | 1961-12-06 | 1962-12-04 | Novel nicotinic acid phenyl-ethylamides and process for preparing them |
| DK526762AA DK102741C (da) | 1961-12-06 | 1962-12-05 | Fremgangsmåde til fremstilling af substituerede nicotinsyre-phenylethylamider. |
| GB46118/62A GB978288A (en) | 1961-12-06 | 1962-12-06 | New nicotinic acid phenyl-ethylamides and preparations containing them |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF35483A DE1242618B (de) | 1961-12-06 | 1961-12-06 | Verfahren zur Herstellung von substituierten Nicotinsaeure-phenyl-aethylamiden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1242618B true DE1242618B (de) | 1967-06-22 |
Family
ID=7096020
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF35483A Pending DE1242618B (de) | 1961-12-06 | 1961-12-06 | Verfahren zur Herstellung von substituierten Nicotinsaeure-phenyl-aethylamiden |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3166562A (OSRAM) |
| CH (1) | CH429725A (OSRAM) |
| DE (1) | DE1242618B (OSRAM) |
| DK (1) | DK102741C (OSRAM) |
| GB (1) | GB978288A (OSRAM) |
| NL (2) | NL131190C (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3272832A (en) * | 1963-07-03 | 1966-09-13 | Fujisawa Pharmaceutical Co | Nicotinic acid derivatives and process for the preparation thereof |
| US3520930A (en) * | 1964-12-31 | 1970-07-21 | Merck & Co Inc | Lower alkoxy-amino-benzylamines |
| US3541106A (en) * | 1967-12-28 | 1970-11-17 | Velsicol Chemical Corp | Certain substituted n-phenyl-n-hydroxy-nicotinamides,the corresponding isonicotinamines and picolinamides |
| NL7216661A (OSRAM) * | 1972-12-08 | 1974-06-11 | ||
| DE3360926D1 (en) * | 1982-06-16 | 1985-11-07 | Ciba Geigy Ag | Hydroquinone ethers and a process for preparing them |
| IL69392A (en) * | 1982-08-13 | 1987-01-30 | Sanofi Sa | N-oxide nicotinamide derivatives,their preparation and pharmaceutical compositions containing them |
| IL103614A (en) * | 1991-11-22 | 1998-09-24 | Basf Ag | Carboxamides for controlling botrytis and certain novel such compounds |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2483250A (en) * | 1949-09-27 | Tt a it tt | ||
| US2681341A (en) * | 1952-08-19 | 1954-06-15 | S E Massengill Company | Solid acid salts of nu, nu-diethyl pyridine-3-carboxylic acid amide |
| US2721203A (en) * | 1953-07-13 | 1955-10-18 | Fellows Medical Mfg Co Inc | Chloral nicotinamide and method for preparing the same |
| US2976213A (en) * | 1959-11-18 | 1961-03-21 | Robins Co Inc A H | Injectable skeletal muscle relaxant |
| US3053736A (en) * | 1960-03-18 | 1962-09-11 | Abbott Lab | Treatment of mental disturbances by chemotherapeutic means |
-
0
- NL NL286303D patent/NL286303A/xx unknown
- NL NL131190D patent/NL131190C/xx active
-
1961
- 1961-12-06 DE DEF35483A patent/DE1242618B/de active Pending
-
1962
- 1962-12-04 CH CH1420262A patent/CH429725A/de unknown
- 1962-12-04 US US242104A patent/US3166562A/en not_active Expired - Lifetime
- 1962-12-05 DK DK526762AA patent/DK102741C/da active
- 1962-12-06 GB GB46118/62A patent/GB978288A/en not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| None * |
Also Published As
| Publication number | Publication date |
|---|---|
| GB978288A (en) | 1964-12-23 |
| DK102741C (da) | 1965-10-04 |
| US3166562A (en) | 1965-01-19 |
| CH429725A (de) | 1967-02-15 |
| NL131190C (OSRAM) | |
| NL286303A (OSRAM) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1193053B (de) | Verfahren zur Herstellung von Piperazin-derivaten | |
| DE2615406A1 (de) | Beta-adrenergische rezeptoren-blocker | |
| DE1242618B (de) | Verfahren zur Herstellung von substituierten Nicotinsaeure-phenyl-aethylamiden | |
| DE1294391B (de) | Basisch substituierte 1, 4-Benzodioxanderivate und deren pharma-kologisch nicht giftige Salze und Verfahren zu deren Herstellung | |
| DD202542A5 (de) | Verfahren zur herstellung von 1-phenyl-2-aminocarbonylindol-verbindungen | |
| DE3324532A1 (de) | Verfahren zur herstellung von (plus-minus)4oxo-1,2,3,6,7,11b-hexahydro-4h-pyrazino(2,1-a)-isochinolinderivaten | |
| EP0030380A1 (de) | 2,3-Indoldionderivate, Verfahren zu ihrer Herstellung, Zwischenprodukte, Arzneimittel enthaltend solche 2,3-Indoldionderivate und ihre pharmazeutische Verwendung | |
| CH636856A5 (en) | 4-(3-Aminopropoxy)indole derivatives, their preparation and medicines containing them | |
| AT237616B (de) | Verfahren zur Herstellung von neuen substituierten Nikotinsäure-phenyläthylamiden | |
| DE1215142B (de) | Verfahren zur Herstellung von araliphatischen Isonitrilen | |
| DE2065365C3 (de) | 1,3-disubstituierte Azetidine sowie Verfahren zu deren Herstellung und ihre Anwendung | |
| CH441291A (de) | Verfahren zur Herstellung von organischen Aminen | |
| CH484070A (de) | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile | |
| DE1238920B (de) | Verfahren zur Herstellung von substituierten Isonicotinsaeurephenyl-propylamiden | |
| AT371445B (de) | Verfahren zur herstellung von neuen cis-4a-phenyl-isochinolinderivaten und ihren saeureadditionssalzen | |
| AT339276B (de) | Verfahren zur herstellung von basischen cycloalkanonoximathern und deren saureadditionssalzen | |
| AT235836B (de) | Verfahren zur Herstellung von neuen basisch substituierten Polymethylentetrahydrochinolinen | |
| DE1242241B (de) | Verfahren zur Herstellung von substituierten Phenyl-alpha-aminoketonen und deren Saeureadditionssalzen bzw. deren optischen Antipoden | |
| DE953803C (de) | Verfahren zur Herstellung von Alkaminestern von 4-Amino-2-oxybenzoesaeure, die am N-und O-Atom alkyliert sind | |
| DE957573C (de) | Verfahren zur Herstellung von Abkoemmlingen von 10-(Aminoalkyl)-acridanen | |
| DE1166782B (de) | Verfahren zur Herstellung von substituierten aromatischen Dicarbonsaeureimiden und deren Salzen | |
| DE1795793C3 (de) | Verfahren zur Herstellung von Chinoxalin-di-N-oxiden | |
| DE1189552B (de) | Verfahren zur Herstellung von 2-Oxo-1, 2-dihydrochinoxalinen und von deren Salzen und quaternaeren Ammoniumverbindungen | |
| CH613452A5 (en) | Process for the preparation of novel tetrahydropyridine derivatives | |
| AT332864B (de) | Verfahren zur herstellung von neuen diphenylmethoxyathylaminen und deren additionssalzen |