DE1229095B - Verfahren zur Herstellung von substituierten 4-Nitro-pyrazol-5-carbonsaeuren - Google Patents
Verfahren zur Herstellung von substituierten 4-Nitro-pyrazol-5-carbonsaeurenInfo
- Publication number
- DE1229095B DE1229095B DEB74873A DEB0074873A DE1229095B DE 1229095 B DE1229095 B DE 1229095B DE B74873 A DEB74873 A DE B74873A DE B0074873 A DEB0074873 A DE B0074873A DE 1229095 B DE1229095 B DE 1229095B
- Authority
- DE
- Germany
- Prior art keywords
- nitro
- parts
- pyrazole
- substituted
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- ZMAXXOYJWZZQBK-UHFFFAOYSA-N 5334-40-7 Chemical class OC(=O)C1=NNC=C1[N+]([O-])=O ZMAXXOYJWZZQBK-UHFFFAOYSA-N 0.000 title claims description 7
- 238000000034 method Methods 0.000 title claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- 230000020477 pH reduction Effects 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- ANLZZGTWBDRRPB-UHFFFAOYSA-N 5-nitro-1h-pyridazin-6-one Chemical compound [O-][N+](=O)C1=CC=NNC1=O ANLZZGTWBDRRPB-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- -1 arylsulfonyl radical Chemical class 0.000 description 10
- 239000002585 base Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- KOPFEFZSAMLEHK-UHFFFAOYSA-N 1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1C=CNN=1 KOPFEFZSAMLEHK-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- WRKFUAPRJKDLDT-UHFFFAOYSA-N 2-(3,4-dichlorophenyl)-4-nitropyrazole-3-carboxylic acid Chemical compound OC(=O)C1=C([N+]([O-])=O)C=NN1C1=CC=C(Cl)C(Cl)=C1 WRKFUAPRJKDLDT-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- SPBXHODOBMVHQL-UHFFFAOYSA-N 4,6-dichloro-2-phenylpyridazin-3-one Chemical compound N1=C(Cl)C=C(Cl)C(=O)N1C1=CC=CC=C1 SPBXHODOBMVHQL-UHFFFAOYSA-N 0.000 description 1
- DXBRCXLIQGEYDP-UHFFFAOYSA-N 4-hydroxy-5-nitro-1H-pyridazin-6-one Chemical class [N+](=O)([O-])C=1C(NN=CC1O)=O DXBRCXLIQGEYDP-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- QGFHVQIPXLIXFD-UHFFFAOYSA-N C1(=CC=CC=C1)N1NC(C(C(=C1)O)[N+](=O)[O-])=O Chemical compound C1(=CC=CC=C1)N1NC(C(C(=C1)O)[N+](=O)[O-])=O QGFHVQIPXLIXFD-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Inorganic materials [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 1
- OHZZTXYKLXZFSZ-UHFFFAOYSA-I manganese(3+) 5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(1-methylpyridin-4-ylidene)porphyrin-22-ide pentachloride Chemical compound [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Mn+3].C1=CN(C)C=CC1=C1C(C=C2)=NC2=C(C=2C=C[N+](C)=CC=2)C([N-]2)=CC=C2C(C=2C=C[N+](C)=CC=2)=C(C=C2)N=C2C(C=2C=C[N+](C)=CC=2)=C2N=C1C=C2 OHZZTXYKLXZFSZ-UHFFFAOYSA-I 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- BJAARRARQJZURR-UHFFFAOYSA-N trimethylazanium;hydroxide Chemical compound O.CN(C)C BJAARRARQJZURR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/16—Halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB74873A DE1229095B (de) | 1964-01-02 | 1964-01-02 | Verfahren zur Herstellung von substituierten 4-Nitro-pyrazol-5-carbonsaeuren |
| CH1637264A CH448105A (de) | 1964-01-02 | 1964-12-18 | Verfahren zur Herstellung von 4-Nitro-pyrazolcarbonsäuren |
| BE657781D BE657781A (enExample) | 1964-01-02 | 1964-12-30 | |
| US422883A US3280141A (en) | 1964-01-02 | 1964-12-30 | 4-nitropyrazole carboxylic acids-(5) |
| NL6415324A NL6415324A (enExample) | 1964-01-02 | 1964-12-31 | |
| FR575A FR1427235A (fr) | 1964-01-02 | 1964-12-31 | Procédé pour la production d'acides nitro-4 pyrazole-carboxyliques |
| GB1/65A GB1084531A (en) | 1964-01-02 | 1965-01-01 | Production of 4-nitropyrazole carboxylic acids-(5) |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB74873A DE1229095B (de) | 1964-01-02 | 1964-01-02 | Verfahren zur Herstellung von substituierten 4-Nitro-pyrazol-5-carbonsaeuren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1229095B true DE1229095B (de) | 1966-11-24 |
Family
ID=6978432
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB74873A Pending DE1229095B (de) | 1964-01-02 | 1964-01-02 | Verfahren zur Herstellung von substituierten 4-Nitro-pyrazol-5-carbonsaeuren |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3280141A (enExample) |
| BE (1) | BE657781A (enExample) |
| CH (1) | CH448105A (enExample) |
| DE (1) | DE1229095B (enExample) |
| FR (1) | FR1427235A (enExample) |
| GB (1) | GB1084531A (enExample) |
| NL (1) | NL6415324A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0224094A3 (de) * | 1985-11-18 | 1988-11-30 | Bayer Ag | 1-Aryl-pyrazole |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2212080A1 (de) * | 1971-03-15 | 1972-10-12 | Eli Lilly and Co., Indianapolis, Ind. (V.StA.) | 3-Nitropyrazolderivate |
-
1964
- 1964-01-02 DE DEB74873A patent/DE1229095B/de active Pending
- 1964-12-18 CH CH1637264A patent/CH448105A/de unknown
- 1964-12-30 US US422883A patent/US3280141A/en not_active Expired - Lifetime
- 1964-12-30 BE BE657781D patent/BE657781A/xx unknown
- 1964-12-31 FR FR575A patent/FR1427235A/fr not_active Expired
- 1964-12-31 NL NL6415324A patent/NL6415324A/xx unknown
-
1965
- 1965-01-01 GB GB1/65A patent/GB1084531A/en not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0224094A3 (de) * | 1985-11-18 | 1988-11-30 | Bayer Ag | 1-Aryl-pyrazole |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1084531A (en) | 1967-09-27 |
| CH448105A (de) | 1967-12-15 |
| US3280141A (en) | 1966-10-18 |
| FR1427235A (fr) | 1966-02-04 |
| BE657781A (enExample) | 1965-06-30 |
| NL6415324A (enExample) | 1965-07-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1620035A1 (de) | 3-Amino-5-X-6-halogenpyrazinonitrile und Verfahren zu deren Herstellung | |
| CH597199A5 (en) | 3-Phenyl pyridaz-6-ones prodn. | |
| DE2414751A1 (de) | Neue 4h-pyrido-eckige klammer auf 1,2a eckige klammer zu-pyrimidin-derivate und verfahren zur herstellung derselben | |
| EP0380712B1 (de) | Verfahren zur Herstellung von 2,6-Dichlordiphenylaminessigsäurederivaten | |
| DE2345068C2 (de) | Verfahren zur Herstellung von Indolo[2,3-a]chinolizinen | |
| DE2347015C2 (de) | Neue Pyrazolyloxyessigsäurederivate, Verfahren zu ihrer Herstellung und diese enthaltende Mittel | |
| DE1229095B (de) | Verfahren zur Herstellung von substituierten 4-Nitro-pyrazol-5-carbonsaeuren | |
| CH500223A (de) | Verfahren zur Herstellung von substituierten Benzoxazepinen und Benzothiazepinen | |
| CH624672A5 (enExample) | ||
| DE2025427A1 (en) | 2,6-dihydroxy-3-oxo-pyridine cpds prodn- from 2,6-dihydroxy cpds, - starting materials for dyes and pesticides | |
| DE1252691B (de) | Verfahren zur Herstellung von 4-Nitro-pyrazolen | |
| EP0001982B1 (de) | Verfahren zur Herstellung aromatischer Aminohydroxyverbindungen | |
| DE3851854T2 (de) | Verfahren zur Herstellung von 1-Alkoxy-3-carboxy-4-cinnolonen. | |
| DE1935671A1 (de) | 2-Aminomethylindole und ihre Salze | |
| DE1770421C3 (de) | Verfahren zur Herstellung von 1,3-Dihydro-2H-1,4-benzodiazepin-2-onderivaten | |
| DE1695188C3 (de) | Verfahren zur Herstellung von l-Alkyl^-chlor^-dihydro-S-phenyl-IH-1,4-benzodiazepinen | |
| DE1213841B (de) | Verfahren zur Herstellung von 3-Aryl-4-halogen-pyridazonen-(6) | |
| DE1275064B (de) | Verfahren zur Herstellung von Pyridazoniminen | |
| DE2445681A1 (de) | Verfahren zur herstellung von 3-phenylpyridazonen | |
| AT297695B (de) | Verfahren zur Herstellung von 1-Cinnamoyl-3-indolylessigsäurederivaten | |
| AT317904B (de) | Verfahren zur Herstellung von neuen Pyridazinverbindungen | |
| AT258916B (de) | Verfahren zur Herstellung von neuen Alkyl-3-amino-5-chlor-6-X-pyrazinoaten | |
| AT246132B (de) | Verfahren zur Herstellung von neuen 4-Nitro-pyrazolcarbonsäuren | |
| AT212470B (de) | Verfahren zur Herstellung von neuen Oxydationsfarbstoffen | |
| DE1543942C (de) | Verfahren zur Herstellung von 1 Oxa 2 methyl 3 carbonylarmno 4 tnia cyclohe xen(2)en |