DE1216318B - Verfahren zur Herstellung von Diphenylalkylaminen - Google Patents
Verfahren zur Herstellung von DiphenylalkylaminenInfo
- Publication number
- DE1216318B DE1216318B DEK48245A DEK0048245A DE1216318B DE 1216318 B DE1216318 B DE 1216318B DE K48245 A DEK48245 A DE K48245A DE K0048245 A DEK0048245 A DE K0048245A DE 1216318 B DE1216318 B DE 1216318B
- Authority
- DE
- Germany
- Prior art keywords
- phenyl
- general formula
- hydrogen
- hydroxy
- german
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 16
- 238000002360 preparation method Methods 0.000 title claims description 4
- -1 alkyl radical Chemical group 0.000 claims description 10
- 239000002841 Lewis acid Substances 0.000 claims description 7
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 7
- 150000007517 lewis acids Chemical class 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 150000002366 halogen compounds Chemical class 0.000 claims description 3
- 230000002140 halogenating effect Effects 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- 238000005684 Liebig rearrangement reaction Methods 0.000 claims 1
- OXNGKCPRVRBHPO-XLMUYGLTSA-N alpha-L-Fucp-(1->2)-beta-D-Galp-(1->3)-[alpha-L-Fucp-(1->4)]-beta-D-GlcpNAc Chemical compound O[C@H]1[C@H](O)[C@H](O)[C@H](C)O[C@H]1O[C@H]1[C@H](O[C@H]2[C@@H]([C@@H](CO)O[C@@H](O)[C@@H]2NC(C)=O)O[C@H]2[C@H]([C@H](O)[C@H](O)[C@H](C)O2)O)O[C@H](CO)[C@H](O)[C@@H]1O OXNGKCPRVRBHPO-XLMUYGLTSA-N 0.000 claims 1
- 244000309464 bull Species 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 44
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- 150000001805 chlorine compounds Chemical class 0.000 description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000011976 maleic acid Substances 0.000 description 3
- QCCDLTOVEPVEJK-UHFFFAOYSA-N phenylacetone Chemical compound CC(=O)CC1=CC=CC=C1 QCCDLTOVEPVEJK-UHFFFAOYSA-N 0.000 description 3
- PWMWNFMRSKOCEY-UHFFFAOYSA-N 1-Phenyl-1,2-ethanediol Chemical compound OCC(O)C1=CC=CC=C1 PWMWNFMRSKOCEY-UHFFFAOYSA-N 0.000 description 2
- RRHGBEAONBPBMW-UHFFFAOYSA-N 1-amino-1-phenylpropan-1-ol Chemical compound CCC(N)(O)C1=CC=CC=C1 RRHGBEAONBPBMW-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000003138 primary alcohols Chemical class 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 150000003333 secondary alcohols Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- BFAQNLRAFSBFGU-UHFFFAOYSA-N 1-amino-1-phenylethanol Chemical compound CC(N)(O)C1=CC=CC=C1 BFAQNLRAFSBFGU-UHFFFAOYSA-N 0.000 description 1
- VOMKAVVAIOMLBA-UHFFFAOYSA-N 1-chloro-1-phenylpropan-1-amine Chemical compound C1(=CC=CC=C1)C(CC)(N)Cl VOMKAVVAIOMLBA-UHFFFAOYSA-N 0.000 description 1
- GFCBSUWRIBEWBM-UHFFFAOYSA-N 1-propylpiperidine;hydrochloride Chemical compound Cl.CCCN1CCCCC1 GFCBSUWRIBEWBM-UHFFFAOYSA-N 0.000 description 1
- XAOCLQUZOIZSHV-UHFFFAOYSA-N 2-(benzylamino)-1-phenylethanol Chemical compound C=1C=CC=CC=1C(O)CNCC1=CC=CC=C1 XAOCLQUZOIZSHV-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- YDKKFDJXOUDVQM-UHFFFAOYSA-N C(C)(C)N(CC(O)C1=CC=CC=C1)C1=CC=CC=C1 Chemical compound C(C)(C)N(CC(O)C1=CC=CC=C1)C1=CC=CC=C1 YDKKFDJXOUDVQM-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- 238000006683 Mannich reaction Methods 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000004792 aryl magnesium halides Chemical class 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000002327 cardiovascular agent Substances 0.000 description 1
- 229940125692 cardiovascular agent Drugs 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N dimethylmethane Natural products CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 1
- PCHPORCSPXIHLZ-UHFFFAOYSA-N diphenhydramine hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C(OCC[NH+](C)C)C1=CC=CC=C1 PCHPORCSPXIHLZ-UHFFFAOYSA-N 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- 125000006840 diphenylmethane group Chemical group 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- UPWPDUACHOATKO-UHFFFAOYSA-K gallium trichloride Chemical compound Cl[Ga](Cl)Cl UPWPDUACHOATKO-UHFFFAOYSA-K 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- FRCFWPVMFJMNDP-UHFFFAOYSA-N n-propan-2-ylaniline Chemical compound CC(C)NC1=CC=CC=C1 FRCFWPVMFJMNDP-UHFFFAOYSA-N 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- ULSIYEODSMZIPX-UHFFFAOYSA-N phenylethanolamine Chemical compound NCC(O)C1=CC=CC=C1 ULSIYEODSMZIPX-UHFFFAOYSA-N 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- PYNUOAIJIQGACY-UHFFFAOYSA-N propylazanium;chloride Chemical compound Cl.CCCN PYNUOAIJIQGACY-UHFFFAOYSA-N 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- IMCGHZIGRANKHV-AJNGGQMLSA-N tert-butyl (3s,5s)-2-oxo-5-[(2s,4s)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidine-1-carboxylate Chemical compound O1C(=O)[C@H](C(C)C)C[C@H]1[C@H]1N(C(=O)OC(C)(C)C)C(=O)[C@H](C(C)C)C1 IMCGHZIGRANKHV-AJNGGQMLSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/02—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reactions involving the formation of amino groups from compounds containing hydroxy groups or etherified or esterified hydroxy groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK111894D DK111894A (OSRAM) | 1962-11-15 | ||
| DEK48245A DE1216318B (de) | 1962-11-15 | 1962-11-15 | Verfahren zur Herstellung von Diphenylalkylaminen |
| CH1384063A CH438352A (de) | 1962-11-15 | 1963-11-12 | Verfahren zur Herstellung von Diphenylalkylaminen |
| DK530863AA DK111894B (da) | 1962-11-15 | 1963-11-12 | Fremgangsmåde til fremstilling af diphenylalkylaminer eller syreadditionssalte deraf. |
| SE12571/63A SE300822B (OSRAM) | 1962-11-15 | 1963-11-14 | |
| FI2228/63A FI41961B (OSRAM) | 1962-11-15 | 1963-11-14 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK48245A DE1216318B (de) | 1962-11-15 | 1962-11-15 | Verfahren zur Herstellung von Diphenylalkylaminen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1216318B true DE1216318B (de) | 1966-05-12 |
Family
ID=7224866
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK48245A Pending DE1216318B (de) | 1962-11-15 | 1962-11-15 | Verfahren zur Herstellung von Diphenylalkylaminen |
Country Status (5)
| Country | Link |
|---|---|
| CH (1) | CH438352A (OSRAM) |
| DE (1) | DE1216318B (OSRAM) |
| DK (2) | DK111894B (OSRAM) |
| FI (1) | FI41961B (OSRAM) |
| SE (1) | SE300822B (OSRAM) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1994011337A1 (en) * | 1992-11-06 | 1994-05-26 | Pharmacia Ab | Novel 3,3-diphenylpropylamines, their use and preparation |
| WO1998043942A1 (en) * | 1997-03-27 | 1998-10-08 | Pharmacia & Upjohn Ab | Novel compounds, their use and preparation |
| US7230030B2 (en) | 1998-05-12 | 2007-06-12 | Schwarz Pharma Ag | Derivatives of 3,3-diphenylpropylamines |
| US7989654B2 (en) * | 2003-04-08 | 2011-08-02 | Ucb Pharma Gmbh | High purity bases of 3,3-diphenylpropylamino monoesters |
| CN110372571A (zh) * | 2018-04-12 | 2019-10-25 | 中国科学院大连化学物理研究所 | 一种2-(2,2-二芳基乙基)-环胺衍生物或盐及合成和应用与组合物 |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE8800207D0 (sv) * | 1988-01-22 | 1988-01-22 | Kabivitrum Ab | Nya aminer, deras anvendning och framstellning |
| US5382600A (en) * | 1988-01-22 | 1995-01-17 | Pharmacia Aktiebolag | 3,3-diphenylpropylamines and pharmaceutical compositions thereof |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE925468C (de) * | 1941-08-13 | 1955-03-21 | Hoechst Ag | Verfahren zur Herstellung von ª†, ª†-Diaryl-propyl-aminen |
| DE1056618B (de) * | 1955-11-15 | 1959-05-06 | Lab Pharmaceutica Dr C Janssen | Verfahren zur Herstellung eines neuen spasmolytisch wirksamen 1, 1-Diphenyl-3-dialkylaminopropans, seiner quaternaeren und seiner Saeureadditionssalze |
| DE1100031B (de) | 1958-05-07 | 1961-02-23 | Hoechst Ag | Verfahren zur Herstellung von basisch substituierten Diphenylmethanderivaten |
| DE1111642B (de) | 1958-05-07 | 1961-07-27 | Hoechst Ag | Verfahren zur Herstellung von basisch substituierten Diphenylmethan-Derivaten mit Herz- und Kreislaufwirksamkeit |
-
0
- DK DK111894D patent/DK111894A/da unknown
-
1962
- 1962-11-15 DE DEK48245A patent/DE1216318B/de active Pending
-
1963
- 1963-11-12 DK DK530863AA patent/DK111894B/da unknown
- 1963-11-12 CH CH1384063A patent/CH438352A/de unknown
- 1963-11-14 FI FI2228/63A patent/FI41961B/fi active
- 1963-11-14 SE SE12571/63A patent/SE300822B/xx unknown
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE925468C (de) * | 1941-08-13 | 1955-03-21 | Hoechst Ag | Verfahren zur Herstellung von ª†, ª†-Diaryl-propyl-aminen |
| DE1056618B (de) * | 1955-11-15 | 1959-05-06 | Lab Pharmaceutica Dr C Janssen | Verfahren zur Herstellung eines neuen spasmolytisch wirksamen 1, 1-Diphenyl-3-dialkylaminopropans, seiner quaternaeren und seiner Saeureadditionssalze |
| DE1100031B (de) | 1958-05-07 | 1961-02-23 | Hoechst Ag | Verfahren zur Herstellung von basisch substituierten Diphenylmethanderivaten |
| DE1111642B (de) | 1958-05-07 | 1961-07-27 | Hoechst Ag | Verfahren zur Herstellung von basisch substituierten Diphenylmethan-Derivaten mit Herz- und Kreislaufwirksamkeit |
Cited By (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1994011337A1 (en) * | 1992-11-06 | 1994-05-26 | Pharmacia Ab | Novel 3,3-diphenylpropylamines, their use and preparation |
| US5559269A (en) * | 1992-11-06 | 1996-09-24 | Pharmacia Ab | 3,3-diphenylpropylamines, their use and preparation |
| AU672458B2 (en) * | 1992-11-06 | 1996-10-03 | Pharmacia Ab | Novel 3,3-diphenylpropylamines, their use and preparation |
| US5686464A (en) * | 1992-11-06 | 1997-11-11 | Pharmacia Ab | 3,3-diphenylpropylamines, their use and preparation |
| USRE39667E1 (en) | 1992-11-06 | 2007-05-29 | Pfizer Health Ab | 3,3-Diphenylpropylamines, their use and preparation |
| USRE40851E1 (en) | 1992-11-06 | 2009-07-14 | Pfizer Health Ab | 3,3-diphenylpropylamines, their use and preparation |
| WO1998043942A1 (en) * | 1997-03-27 | 1998-10-08 | Pharmacia & Upjohn Ab | Novel compounds, their use and preparation |
| US6313132B1 (en) | 1997-03-27 | 2001-11-06 | Pharmacia Ab | Therapeutically active diarylpropylamines; their pharmaceutically acceptable salts; a method for their preparation and method for their use |
| US7384980B2 (en) | 1998-05-12 | 2008-06-10 | Schwarz Pharma Ag | Derivatives of 3,3-diphenylpropylamines |
| US7230030B2 (en) | 1998-05-12 | 2007-06-12 | Schwarz Pharma Ag | Derivatives of 3,3-diphenylpropylamines |
| US7855230B2 (en) | 1998-05-12 | 2010-12-21 | Ucb Pharma Gmbh | Derivatives of 3,3-diphenylpropylamines |
| US7985772B2 (en) | 1998-05-12 | 2011-07-26 | Ucb Pharma Gmbh | Derivatives of 3,3-diphenylpropylamines |
| US8338478B2 (en) | 1998-05-12 | 2012-12-25 | Ucb Pharma Gmbh | Derivatives of 3,3-diphenylpropylamines |
| US7989654B2 (en) * | 2003-04-08 | 2011-08-02 | Ucb Pharma Gmbh | High purity bases of 3,3-diphenylpropylamino monoesters |
| CN110372571A (zh) * | 2018-04-12 | 2019-10-25 | 中国科学院大连化学物理研究所 | 一种2-(2,2-二芳基乙基)-环胺衍生物或盐及合成和应用与组合物 |
| US11274079B2 (en) | 2018-04-12 | 2022-03-15 | Dalian Institute Of Chemical Physics, Chinese Academy Of Sciences | 2-(2,2-diarylethyl)-cyclic amine derivative or salt, synthesis method, application and composition thereof |
| CN110372571B (zh) * | 2018-04-12 | 2022-11-15 | 中国科学院大连化学物理研究所 | 一种2-(2,2-二芳基乙基)-环胺衍生物或盐及合成和应用与组合物 |
Also Published As
| Publication number | Publication date |
|---|---|
| DK111894A (OSRAM) | |
| DK111894B (da) | 1968-10-21 |
| CH438352A (de) | 1967-06-30 |
| FI41961B (OSRAM) | 1969-12-31 |
| SE300822B (OSRAM) | 1968-05-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2503002A1 (de) | Substituierte piperidinderivate, ein verfahren zu ihrer herstellung sowie arzneimittel | |
| DE1216318B (de) | Verfahren zur Herstellung von Diphenylalkylaminen | |
| DE1194418B (de) | Verfahren zur Herstellung von neuen Dihalogen-amino-benzylaminen oder deren Saeureadditionssalzen mit physiologisch vertraeglichen Saeuren | |
| DE916168C (de) | Verfahren zur Herstellung von Pyrrolidinoalkylphenothiazinen | |
| EP0023584B1 (de) | Verfahren zur Herstellung von Trifluormethyl-Naphthalinen | |
| DE1104965B (de) | Verfahren zur Herstellung von Derivaten des Urazols | |
| DE1141996B (de) | Verfahren zur Herstellung von heterocyclischen sekundaeren Aminen | |
| DE2354327C3 (de) | 2-Amino-l,23>4-tetrahydronaphthalin-Derivate, Verfahren zu deren Herstellung und Verfahren zur Herstellung von 6,7-Benzomorphanen ausgehend von jenen | |
| DE2704690A1 (de) | Triphenylalkenderivate, solche enthaltende arzneimittel und verfahren zur herstellung derselben | |
| DE908138C (de) | Verfahren zur Herstellung von 1-Benzyl-2-alkyl-1,2,3,4,5,6,7,8,-octa-hydroisochinolinen und ihren Salzen | |
| DE1468772B1 (de) | 11-[3-(4-beta-Hydroxyaethyl-piperazino)-propyliden]-2-chlor-6,11-dihydro-dibenz[b,e]oxepin,dessen Salze und Verfahren zur Herstellun dieser Verbindungen | |
| AT244327B (de) | Verfahren zur Herstellung von Diphenylalkylaminen und ihren physiologisch verträglichen Salzen | |
| AT245737B (de) | Verfahren zur Herstellung einer neuen, therapeutisch wirksamen Dibenzocycloheptanverbindung und nicht-toxischer Salze derselben | |
| DE1468772C (de) | 11- eckige Klammer auf 3-(4-beta-Hydroxyäthyl-piperazino)-propyliden eckige Klammer zu -i-chlor-ö,! 1-dihydro-dibenz eckige Klammer auf b,e eckige Klammer zu oxepin, dessen Salze und Verfahren zur Herstellung dieser Verbindungen | |
| DE950550C (de) | Verfahren zur Herstellung von basisch substituierten Phenylcycloalkenylpropanolen | |
| AT203495B (de) | Verfahren zur Herstellung von neuen tertiären Aminen | |
| CH633786A5 (en) | Process for the preparation of dl-6a,10a-cis-1-hydroxy-3-substituted-6,6-dimethyl-6,6a,7,8,10,10a-hex ahydro-9H-dibenzo[b,d]pyran-9-ones | |
| DE2921139A1 (de) | Ethylether des isocamphyl-guajakols, verfahren zu ihrer herstellung und ihre verwendung zur herstellung von 3- eckige klammer auf isocamphyl-(5) eckige klammer zu -cyclohexanol | |
| DE1620536C (de) | Verfahren zur Herstellung von alpha Pyrrolidinoketonen und ihren Salzen | |
| DE1518652A1 (de) | Verfahren zur Herstellung von pharmazeutisch wirksamen Derivaten des 2-Aminoindans | |
| AT215429B (de) | Verfahren zur Herstellung von neuen Ferrocenderivaten | |
| AT347423B (de) | Verfahren zur herstellung von neuen 7- aminobenzocycloheptenen und von deren salzen | |
| DE1212550B (de) | Verfahren zur Herstellung von Diphenylisopropylaminen | |
| DE1906832A1 (de) | Verfahren zur Herstellung von Indoleninen | |
| DE1200293B (de) | Verfahren zur Herstellung von Dimercapto-chinonmethiden |