DE1214041B - Total-herbizide Mittel - Google Patents
Total-herbizide MittelInfo
- Publication number
- DE1214041B DE1214041B DEF34006A DEF0034006A DE1214041B DE 1214041 B DE1214041 B DE 1214041B DE F34006 A DEF34006 A DE F34006A DE F0034006 A DEF0034006 A DE F0034006A DE 1214041 B DE1214041 B DE 1214041B
- Authority
- DE
- Germany
- Prior art keywords
- xxx
- xxx xxx
- compound
- herbicidal agents
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004009 herbicide Substances 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 20
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000007788 liquid Substances 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 230000002363 herbicidal effect Effects 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- GJYCVCVHRSWLNY-UHFFFAOYSA-N 2-butylphenol Chemical compound CCCCC1=CC=CC=C1O GJYCVCVHRSWLNY-UHFFFAOYSA-N 0.000 description 2
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 2
- 241000227653 Lycopersicon Species 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- -1 compound Compound Chemical class 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 210000004400 mucous membrane Anatomy 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- QHJIRTVISXHLRI-UHFFFAOYSA-N 6-methyl-4,6-dinitrocyclohexa-1,3-dien-1-ol Chemical compound [O-][N+](=O)C1(C)CC([N+]([O-])=O)=CC=C1O QHJIRTVISXHLRI-UHFFFAOYSA-N 0.000 description 1
- 241000726103 Atta Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 101100109871 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) aro-8 gene Proteins 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920006184 cellulose methylcellulose Polymers 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- GRSBAMVBFWRBBH-UHFFFAOYSA-N o-ethyl chloromethanethioate Chemical compound CCOC(Cl)=S GRSBAMVBFWRBBH-UHFFFAOYSA-N 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000008832 photodamage Effects 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- YPSUCTSXOROPBS-UHFFFAOYSA-N s-methyl chloromethanethioate Chemical compound CSC(Cl)=O YPSUCTSXOROPBS-UHFFFAOYSA-N 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 231100000925 very toxic Toxicity 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C329/00—Thiocarbonic acids; Halides, esters or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1907360A GB944907A (en) | 1960-05-30 | 1960-05-30 | Novel compounds having herbicidal and fungicidal properties and herbicidal and fungicidal compositions containing the said compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1214041B true DE1214041B (de) | 1966-04-07 |
Family
ID=10123316
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF34006A Pending DE1214041B (de) | 1960-05-30 | 1961-05-25 | Total-herbizide Mittel |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE604329A (OSRAM) |
| CH (1) | CH411926A (OSRAM) |
| DE (1) | DE1214041B (OSRAM) |
| ES (1) | ES267762A1 (OSRAM) |
| GB (1) | GB944907A (OSRAM) |
| NL (2) | NL120285C (OSRAM) |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2430332A (en) * | 1945-03-30 | 1947-11-04 | Du Pont | Composition and method |
| US2567987A (en) * | 1948-12-10 | 1951-09-18 | Goodrich Co B F | Herbicidal compositions |
| US2865941A (en) * | 1955-06-20 | 1958-12-23 | Monsanto Chemicals | Chloro-dienyl xanthates |
-
0
- BE BE604329D patent/BE604329A/xx unknown
- NL NL265347D patent/NL265347A/xx unknown
- NL NL120285D patent/NL120285C/xx active
-
1960
- 1960-05-30 GB GB1907360A patent/GB944907A/en not_active Expired
-
1961
- 1961-05-25 DE DEF34006A patent/DE1214041B/de active Pending
- 1961-05-26 CH CH618361A patent/CH411926A/de unknown
- 1961-05-27 ES ES0267762A patent/ES267762A1/es not_active Expired
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2430332A (en) * | 1945-03-30 | 1947-11-04 | Du Pont | Composition and method |
| US2567987A (en) * | 1948-12-10 | 1951-09-18 | Goodrich Co B F | Herbicidal compositions |
| GB660545A (en) * | 1948-12-10 | 1951-11-07 | Goodrich Co B F | Improvements in or relating to herbicidal compositions |
| FR1001021A (fr) * | 1948-12-10 | 1952-02-19 | Goodrich Co B F | Nouvelles compositions herbicides |
| US2865941A (en) * | 1955-06-20 | 1958-12-23 | Monsanto Chemicals | Chloro-dienyl xanthates |
Also Published As
| Publication number | Publication date |
|---|---|
| BE604329A (OSRAM) | |
| NL265347A (OSRAM) | |
| NL120285C (OSRAM) | |
| GB944907A (en) | 1963-12-18 |
| CH411926A (de) | 1966-04-30 |
| ES267762A1 (es) | 1961-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1213665B (de) | Selektive Herbicide | |
| DE1217695B (de) | Insekticide Mittel mit acaricider Wirkung | |
| EP0072426B1 (de) | Mit Wasser verdünnbares Mittel mit bakterizider und fungizider Wirkung | |
| DE2810067C2 (de) | Quartäre Ammoniumsalze und diese enthaltendes fungizides Mittel | |
| AT334134B (de) | Bekampfung von pilzschadlingen | |
| DE69223794T2 (de) | Propylencarbonat und/oder ethylencarbonat als trägerlösung enthaltende antimikrobielle zusammensetzungen | |
| DE1214041B (de) | Total-herbizide Mittel | |
| DE2621102A1 (de) | Propan-1,2-diondioxime, schaedlingsbekaempfungsmittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung | |
| DE1204457B (de) | Kontaktwirksame Totalherbizide | |
| DE1165338B (de) | Insektizide Mittel | |
| DE2354467B2 (de) | Fungizide Dispersionen auf Basis von Benzimidazolmethylcarbamat | |
| DE1188244B (de) | Zubereitung mit biozider Wirkung | |
| DE1299925B (de) | Totalherbizid | |
| DE1181978B (de) | Mittel zur Bekaempfung von Arthropoden, Mollusken und Fischen | |
| DE1642213A1 (de) | Mittel zum Schutz von Menschen oder Tieren gegen eiablegende,stechende und blutsaugende Insekten | |
| AT206402B (de) | Verfahren zum Schützen von organischen Materialien vor Befall und Schädigung durch Mikroorganismen | |
| AT204329B (de) | Mittel zur Bekämpfung von Milben | |
| AT362619B (de) | Insektizides und fungizides mittel | |
| EP0120219A1 (de) | Mittel mit bakterizider und fungizider Wirkung | |
| DE2053356B2 (de) | Zwei-Komponenten-Emulgatorsystem für die Formulierung von Pflanzenschutzmitteln | |
| AT211337B (de) | Phytohormonale Mittel | |
| DE1072814B (de) | Verfahren zur Herstellung höhermolekularer, metallarmer Organo-Ziniiwerbindungen | |
| DE1290129B (de) | 3, 5-Di-tert.-butylphenyl-N-methylcarbamat und seine Verwendung als Insektizid | |
| DE2554532A1 (de) | Selektive herbizide mittel | |
| DE1952744A1 (de) | Pyrimidinderivate,diese enthaltende Mittel,Verfahren zu deren Herstellung und deren Verwendung |