DE1206306B - Entwickler fuer elektrophotographische Zwecke - Google Patents
Entwickler fuer elektrophotographische ZweckeInfo
- Publication number
- DE1206306B DE1206306B DEK38460A DEK0038460A DE1206306B DE 1206306 B DE1206306 B DE 1206306B DE K38460 A DEK38460 A DE K38460A DE K0038460 A DEK0038460 A DE K0038460A DE 1206306 B DE1206306 B DE 1206306B
- Authority
- DE
- Germany
- Prior art keywords
- toner
- weight
- parts
- developer
- black
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000975 dye Substances 0.000 description 16
- 229910052751 metal Inorganic materials 0.000 description 13
- 239000002184 metal Substances 0.000 description 13
- 239000011347 resin Substances 0.000 description 13
- 229920005989 resin Polymers 0.000 description 13
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 12
- 229920001577 copolymer Polymers 0.000 description 12
- 238000002844 melting Methods 0.000 description 11
- 239000000203 mixture Substances 0.000 description 10
- 230000008018 melting Effects 0.000 description 9
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 8
- 239000002245 particle Substances 0.000 description 8
- 235000002639 sodium chloride Nutrition 0.000 description 8
- 239000011521 glass Substances 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000000986 disperse dye Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000001993 wax Substances 0.000 description 6
- 239000004793 Polystyrene Substances 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 239000003086 colorant Substances 0.000 description 5
- 229910052742 iron Inorganic materials 0.000 description 5
- 239000000049 pigment Substances 0.000 description 5
- 229920002223 polystyrene Polymers 0.000 description 5
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 239000011324 bead Substances 0.000 description 4
- -1 carboxyl- Chemical group 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 238000004043 dyeing Methods 0.000 description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000011787 zinc oxide Substances 0.000 description 4
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- NPDACUSDTOMAMK-UHFFFAOYSA-N 4-Chlorotoluene Chemical compound CC1=CC=C(Cl)C=C1 NPDACUSDTOMAMK-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- SNWKSPIFHCTHRU-UHFFFAOYSA-L disodium;3-[[4-hydroxy-9,10-dioxo-2-(4-sulfonatoanilino)anthracen-1-yl]amino]benzenesulfonate Chemical compound [Na+].[Na+].C=1C=CC(S([O-])(=O)=O)=CC=1NC=1C=2C(=O)C3=CC=CC=C3C(=O)C=2C(O)=CC=1NC1=CC=C(S([O-])(=O)=O)C=C1 SNWKSPIFHCTHRU-UHFFFAOYSA-L 0.000 description 2
- WXDDBYFBIIAYSM-UHFFFAOYSA-N ethyl n-(2-phenylethyl)carbamate Chemical compound CCOC(=O)NCCC1=CC=CC=C1 WXDDBYFBIIAYSM-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000012170 montan wax Substances 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000012860 organic pigment Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- DSEKYWAQQVUQTP-XEWMWGOFSA-N (2r,4r,4as,6as,6as,6br,8ar,12ar,14as,14bs)-2-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-2,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-tetradecahydro-1h-picen-3-one Chemical compound C([C@H]1[C@]2(C)CC[C@@]34C)C(C)(C)CC[C@]1(C)CC[C@]2(C)[C@H]4CC[C@@]1(C)[C@H]3C[C@@H](O)C(=O)[C@@H]1C DSEKYWAQQVUQTP-XEWMWGOFSA-N 0.000 description 1
- QBZIEGUIYWGBMY-FUZXWUMZSA-N (5Z)-5-hydroxyimino-6-oxonaphthalene-2-sulfonic acid iron Chemical compound [Fe].O\N=C1/C(=O)C=Cc2cc(ccc12)S(O)(=O)=O.O\N=C1/C(=O)C=Cc2cc(ccc12)S(O)(=O)=O.O\N=C1/C(=O)C=Cc2cc(ccc12)S(O)(=O)=O QBZIEGUIYWGBMY-FUZXWUMZSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- WQONPSCCEXUXTQ-UHFFFAOYSA-N 1,2-dibromobenzene Chemical class BrC1=CC=CC=C1Br WQONPSCCEXUXTQ-UHFFFAOYSA-N 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- MLKXDPUZXIRXEP-UHFFFAOYSA-N 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]-1-indenyl]acetic acid Chemical class CC1=C(CC(O)=O)C2=CC(F)=CC=C2C1=CC1=CC=C(S(C)=O)C=C1 MLKXDPUZXIRXEP-UHFFFAOYSA-N 0.000 description 1
- JFGQHAHJWJBOPD-UHFFFAOYSA-N 3-hydroxy-n-phenylnaphthalene-2-carboxamide Chemical class OC1=CC2=CC=CC=C2C=C1C(=O)NC1=CC=CC=C1 JFGQHAHJWJBOPD-UHFFFAOYSA-N 0.000 description 1
- 240000000972 Agathis dammara Species 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 241000016649 Copaifera officinalis Species 0.000 description 1
- 229920002871 Dammar gum Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- YCUVUDODLRLVIC-UHFFFAOYSA-N Sudan black B Chemical compound C1=CC(=C23)NC(C)(C)NC2=CC=CC3=C1N=NC(C1=CC=CC=C11)=CC=C1N=NC1=CC=CC=C1 YCUVUDODLRLVIC-UHFFFAOYSA-N 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- DPKHZNPWBDQZCN-UHFFFAOYSA-N acridine orange free base Chemical compound C1=CC(N(C)C)=CC2=NC3=CC(N(C)C)=CC=C3C=C21 DPKHZNPWBDQZCN-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- DZBUGLKDJFMEHC-UHFFFAOYSA-N benzoquinolinylidene Natural products C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- QXJJQWWVWRCVQT-UHFFFAOYSA-K calcium;sodium;phosphate Chemical compound [Na+].[Ca+2].[O-]P([O-])([O-])=O QXJJQWWVWRCVQT-UHFFFAOYSA-K 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 229930002875 chlorophyll Natural products 0.000 description 1
- 235000019804 chlorophyll Nutrition 0.000 description 1
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical compound C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- FPVGTPBMTFTMRT-NSKUCRDLSA-L fast yellow Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C(N)=CC=C1\N=N\C1=CC=C(S([O-])(=O)=O)C=C1 FPVGTPBMTFTMRT-NSKUCRDLSA-L 0.000 description 1
- 235000019233 fast yellow AB Nutrition 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical compound [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 description 1
- 239000011964 heteropoly acid Substances 0.000 description 1
- 235000019239 indanthrene blue RS Nutrition 0.000 description 1
- UHOKSCJSTAHBSO-UHFFFAOYSA-N indanthrone blue Chemical compound C1=CC=C2C(=O)C3=CC=C4NC5=C6C(=O)C7=CC=CC=C7C(=O)C6=CC=C5NC4=C3C(=O)C2=C1 UHOKSCJSTAHBSO-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- YYGBVRCTHASBKD-UHFFFAOYSA-M methylene green Chemical compound [Cl-].C1=CC(N(C)C)=C([N+]([O-])=O)C2=[S+]C3=CC(N(C)C)=CC=C3N=C21 YYGBVRCTHASBKD-UHFFFAOYSA-M 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- AMWVZPDSWLOFKA-UHFFFAOYSA-N phosphanylidynemolybdenum Chemical compound [Mo]#P AMWVZPDSWLOFKA-UHFFFAOYSA-N 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 1
- 229960001755 resorcinol Drugs 0.000 description 1
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 150000004992 toluidines Chemical class 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
- CMPGARWFYBADJI-UHFFFAOYSA-L tungstic acid Chemical compound O[W](O)(=O)=O CMPGARWFYBADJI-UHFFFAOYSA-L 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- MXODCLTZTIFYDV-UHFFFAOYSA-L zinc;1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate Chemical compound [Zn+2].C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C([O-])=O.C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C([O-])=O MXODCLTZTIFYDV-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G13/00—Electrographic processes using a charge pattern
- G03G13/06—Developing
- G03G13/08—Developing using a solid developer, e.g. powder developer
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/10—Developers with toner particles characterised by carrier particles
- G03G9/103—Glass particles
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Developing Agents For Electrophotography (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE594137D BE594137A (cg-RX-API-DMAC10.html) | 1959-08-17 | ||
| NL254973D NL254973A (cg-RX-API-DMAC10.html) | 1959-08-17 | ||
| DEK38460A DE1206306B (de) | 1959-08-17 | 1959-08-17 | Entwickler fuer elektrophotographische Zwecke |
| US43734A US3236776A (en) | 1959-08-17 | 1960-07-19 | Developer composition for electrostatic images and method of utilizing same |
| LU39008D LU39008A1 (cg-RX-API-DMAC10.html) | 1959-08-17 | 1960-07-28 | |
| CH881460A CH381983A (de) | 1959-08-17 | 1960-08-03 | Entwickler für elektrophotographische Zwecke |
| GB27695/60A GB944394A (en) | 1959-08-17 | 1960-08-10 | Developer for electrophotographic purposes |
| SE7855/60A SE306667B (cg-RX-API-DMAC10.html) | 1959-08-17 | 1960-08-16 | |
| FR835986A FR1269854A (fr) | 1959-08-17 | 1960-08-17 | Révélateur pour l'électrophotographie |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK38460A DE1206306B (de) | 1959-08-17 | 1959-08-17 | Entwickler fuer elektrophotographische Zwecke |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1206306B true DE1206306B (de) | 1965-12-02 |
Family
ID=7221388
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK38460A Pending DE1206306B (de) | 1959-08-17 | 1959-08-17 | Entwickler fuer elektrophotographische Zwecke |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3236776A (cg-RX-API-DMAC10.html) |
| BE (1) | BE594137A (cg-RX-API-DMAC10.html) |
| CH (1) | CH381983A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1206306B (cg-RX-API-DMAC10.html) |
| GB (1) | GB944394A (cg-RX-API-DMAC10.html) |
| LU (1) | LU39008A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL254973A (cg-RX-API-DMAC10.html) |
| SE (1) | SE306667B (cg-RX-API-DMAC10.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2638509A1 (de) * | 1975-10-28 | 1977-05-05 | Xerox Corp | Entwicklermaterialien |
| DE3035868A1 (de) * | 1979-10-11 | 1981-04-23 | Minolta Camera K.K., Osaka | Verfahren zum abtrennen von kopierpapier fuer elektrofotografische kopiergeraete |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3417019A (en) * | 1962-12-27 | 1968-12-17 | Eastman Kodak Co | Xerographic development |
| US3965021A (en) * | 1966-01-14 | 1976-06-22 | Xerox Corporation | Electrostatographic toners using block copolymers |
| US3542681A (en) * | 1968-07-10 | 1970-11-24 | Gaf Corp | Negative working electrostatic toners |
| US4018601A (en) * | 1969-06-19 | 1977-04-19 | Xerox Corporation | Electrostatographic magnetic brush imaging process employing carrier beads comprising high purity nickel |
| US3725283A (en) * | 1971-01-06 | 1973-04-03 | Xerox Corp | Electrostatographic developer containing uncoated glass-ceramic carrier particles |
| US3901698A (en) * | 1971-12-10 | 1975-08-26 | Rank Xerox Ltd | Method of reversal development using two electrostatic developers |
| JPS5115992B2 (cg-RX-API-DMAC10.html) * | 1971-12-17 | 1976-05-20 | ||
| BE793098A (fr) * | 1971-12-30 | 1973-06-20 | Xerox Corp | Developpateur electrostatographique |
| US3808026A (en) * | 1972-03-13 | 1974-04-30 | Xerox Corp | Liquid development of electrostatic latent image |
| DE2352604B2 (de) * | 1972-10-21 | 1980-09-11 | Konishiroku Photo Industry Co., Ltd., Tokio | Toner für elektrostatographische Trockenentwickler |
| US3925219A (en) * | 1973-06-29 | 1975-12-09 | Minnesota Mining & Mfg | Pressure-fixable developing powder containing a thermoplastic resin and wax |
| US4122024A (en) * | 1974-05-30 | 1978-10-24 | Xerox Corporation | Classified toner materials |
| US3969251A (en) * | 1974-05-30 | 1976-07-13 | Xerox Corporation | Developer mixture |
| US3977871A (en) * | 1975-08-15 | 1976-08-31 | International Business Machines Corporation | Electrophotographic developer with fibers of polytetrafluoroethylene |
| US4065305A (en) * | 1976-03-01 | 1977-12-27 | Xerox Corporation | Xerographic developer |
| DE2724776A1 (de) * | 1976-06-02 | 1977-12-15 | Canon Kk | Verfahren und entwickler zum entwickeln elektrischer ladungsbilder |
| JPS5560960A (en) * | 1978-10-31 | 1980-05-08 | Agfa Gevaert Nv | Composition for developing electrostatic image and method of development |
| US4304843A (en) * | 1978-11-22 | 1981-12-08 | E. I. Du Pont De Nemours And Company | Dry toner with improved toning uniformity |
| US4299904A (en) * | 1978-11-28 | 1981-11-10 | Sri International | Photographic image enhancement method employing photoluminescence |
| JPS5950061B2 (ja) * | 1979-04-09 | 1984-12-06 | 富士ゼロックス株式会社 | 静電潜像現像用トナ− |
| AU532173B2 (en) * | 1979-06-13 | 1983-09-22 | Mitsui Toatsu Chemicals Inc. | Electrophotographic toner |
| JPS6050511A (ja) * | 1983-08-31 | 1985-03-20 | Hitachi Ltd | 液晶表示素子 |
| KR890004563B1 (ko) * | 1984-04-03 | 1989-11-15 | 미따코오교오가부시기가이샤 | 부극성 대전성 청색 토너 |
| US4947201A (en) * | 1988-06-06 | 1990-08-07 | Spectrum Sciences | Imaging system |
| US4966824A (en) * | 1988-06-06 | 1990-10-30 | Spectrum Sciences | Liquid toner composition containing two different charge directors |
| US4877699A (en) * | 1988-08-25 | 1989-10-31 | Eastman Kodak Company | Electrophotographic luminescent amplification process |
| US5080995A (en) * | 1990-06-29 | 1992-01-14 | Xerox Corporation | Processes for toner pigment dispersion |
| US5087538A (en) * | 1990-07-02 | 1992-02-11 | Xerox Corporation | Toner and imaging processes |
| US5142337A (en) * | 1990-10-09 | 1992-08-25 | International Business Machines, Corp. | Printing grey scale images |
| DE69415952T2 (de) * | 1993-11-30 | 1999-06-10 | Konica Corp., Tokio/Tokyo | Entwickler vom Zwei-Komponententyp und Bildherstellungsverfahren |
| US6162573A (en) * | 1994-11-30 | 2000-12-19 | Xerox Corporation | Blended custom color toners and developers |
| US6083654A (en) * | 1998-12-21 | 2000-07-04 | Xerox Corporation | Toner compositions and processes thereof |
| US10705442B2 (en) | 2016-08-03 | 2020-07-07 | Xerox Corporation | Toner compositions with white colorants and processes of making thereof |
| CN115285968A (zh) * | 2022-07-29 | 2022-11-04 | 东北林业大学 | 一种采用邻苯二胺制备纤维素纳米碳球的方法及应用 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2618551A (en) * | 1948-10-20 | 1952-11-18 | Haloid Co | Developer for electrostatic images |
| US2735785A (en) * | 1953-07-30 | 1956-02-21 | Process of electrostatic printing | |
| US2817767A (en) * | 1953-11-23 | 1957-12-24 | Haloid Co | Xerographic development |
| CA565006A (en) * | 1954-12-23 | 1958-10-21 | The Battelle Development Corporation | Tripartite developer for electrostatic images |
| US2917460A (en) * | 1955-06-17 | 1959-12-15 | Ibm | Powder compositions useful as electroscopic toners |
| US3010842A (en) * | 1955-08-29 | 1961-11-28 | Xerox Corp | Development of electrostatic images |
| NL95463C (cg-RX-API-DMAC10.html) * | 1955-12-29 | |||
| US2986521A (en) * | 1958-03-28 | 1961-05-30 | Rca Corp | Reversal type electroscopic developer powder |
| US3013890A (en) * | 1958-07-08 | 1961-12-19 | Xerox Corp | Process of developing electrostatic images and composition therefor |
-
0
- BE BE594137D patent/BE594137A/xx unknown
- NL NL254973D patent/NL254973A/xx unknown
-
1959
- 1959-08-17 DE DEK38460A patent/DE1206306B/de active Pending
-
1960
- 1960-07-19 US US43734A patent/US3236776A/en not_active Expired - Lifetime
- 1960-07-28 LU LU39008D patent/LU39008A1/xx unknown
- 1960-08-03 CH CH881460A patent/CH381983A/de unknown
- 1960-08-10 GB GB27695/60A patent/GB944394A/en not_active Expired
- 1960-08-16 SE SE7855/60A patent/SE306667B/xx unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2638509A1 (de) * | 1975-10-28 | 1977-05-05 | Xerox Corp | Entwicklermaterialien |
| DE3035868A1 (de) * | 1979-10-11 | 1981-04-23 | Minolta Camera K.K., Osaka | Verfahren zum abtrennen von kopierpapier fuer elektrofotografische kopiergeraete |
Also Published As
| Publication number | Publication date |
|---|---|
| BE594137A (cg-RX-API-DMAC10.html) | |
| SE306667B (cg-RX-API-DMAC10.html) | 1968-12-02 |
| LU39008A1 (cg-RX-API-DMAC10.html) | 1960-09-28 |
| US3236776A (en) | 1966-02-22 |
| NL254973A (cg-RX-API-DMAC10.html) | |
| GB944394A (en) | 1963-12-11 |
| CH381983A (de) | 1964-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1206306B (de) | Entwickler fuer elektrophotographische Zwecke | |
| DE69018293T2 (de) | Toner für die Entwicklung elektrostatischer latenter Bilder. | |
| US3165420A (en) | Developer for electrophotographic purposes and process for developing an electrostatic image | |
| DE1089265B (de) | Entwicklerpulver fuer elektrostatische Kopierverfahren | |
| DE2447083C2 (de) | Toner für Elektrostatographie | |
| DE3918084C2 (cg-RX-API-DMAC10.html) | ||
| DE68924246T2 (de) | Tonerzusammensetzung. | |
| DE1188440B (de) | Entwickler fuer elektrostatische latente Bilder | |
| NO137035B (no) | Ultralydapparat til medisinsk diagnose. | |
| EP0647885B1 (de) | Dekorierte Keramik- und Glaserzeugnisse, Verfahren zu deren Herstellung und keramische Farbzusammensetzungen zur Durchführung des Verfahrens | |
| DE1299527B (de) | Elektrophotographischer Entwickler fuer eine Magnetbuersten-entwicklung | |
| DE69220619T2 (de) | Ladungskontrollmittel und Toner zur Entwicklung elektrostatischer Bilder | |
| DE2333850A1 (de) | Fluessige tonerzusammensetzung zur entwicklung von elektrostatischen ladungsmodellen | |
| DE3643604C2 (cg-RX-API-DMAC10.html) | ||
| DE2450203C3 (de) | Toner für elektrostatographische Trockenentwickler | |
| DE1215524B (de) | Verfahren zur Herstellung eines fluessigen Entwicklers fuer Ladungsbilder | |
| US4526852A (en) | Liquid developer for developing electrostatic charge images and process for its preparation | |
| DE2334353C2 (de) | Positiv arbeitender elektrostatographischer Suspensionsentwickler | |
| DE69029567T2 (de) | Tonerzusammensetzung und deren Verwendung in einem Bildherstellungsverfahren | |
| DE3636989A1 (de) | Fluessigentwickler fuer latente elektrostatische bilder | |
| AT232378B (de) | Entwickler für elektrophotographische Zwecke | |
| DE69418290T2 (de) | Negatives Ladungssteuermittel und Toner zur Entwicklung elektrostatischer Bilder | |
| DE68925670T2 (de) | Trockener elektrophotographischer Entwickler | |
| DE3018692A1 (de) | Toner fuer die elektrostatische photographie | |
| DE1175548B (de) | Toner fuer elektrophotographische Zwecke |