DE1201116B - Fungizides Pflanzenschutzmittel - Google Patents
Fungizides PflanzenschutzmittelInfo
- Publication number
- DE1201116B DE1201116B DEN16305A DEN0016305A DE1201116B DE 1201116 B DE1201116 B DE 1201116B DE N16305 A DEN16305 A DE N16305A DE N0016305 A DEN0016305 A DE N0016305A DE 1201116 B DE1201116 B DE 1201116B
- Authority
- DE
- Germany
- Prior art keywords
- compound
- weight
- dimethylamido
- bis
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000000855 fungicidal effect Effects 0.000 title claims description 6
- 239000004476 plant protection product Substances 0.000 title description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 239000004480 active ingredient Substances 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- SGYDKALSBFBIFE-UHFFFAOYSA-N tris(2,3,4,5,6-pentachlorophenyl) phosphate Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1OP(=O)(OC=1C(=C(Cl)C(Cl)=C(Cl)C=1Cl)Cl)OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl SGYDKALSBFBIFE-UHFFFAOYSA-N 0.000 claims description 3
- 229910019142 PO4 Inorganic materials 0.000 claims description 2
- 239000010452 phosphate Substances 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 2
- 239000000575 pesticide Substances 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 38
- 239000000843 powder Substances 0.000 description 16
- 239000000460 chlorine Substances 0.000 description 14
- 241000196324 Embryophyta Species 0.000 description 11
- 241000221785 Erysiphales Species 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000000428 dust Substances 0.000 description 8
- -1 carbethoxyphenyl Chemical group 0.000 description 7
- 240000005979 Hordeum vulgare Species 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 235000007340 Hordeum vulgare Nutrition 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 206010061217 Infestation Diseases 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 241000233866 Fungi Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000010459 dolomite Substances 0.000 description 3
- 229910000514 dolomite Inorganic materials 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 2
- TXSXJLMEOQAASX-QHHAFSJGSA-N phenyl (e)-but-2-enoate Chemical class C\C=C\C(=O)OC1=CC=CC=C1 TXSXJLMEOQAASX-QHHAFSJGSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 230000000885 phytotoxic effect Effects 0.000 description 2
- 229920000136 polysorbate Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 241001480061 Blumeria graminis Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000462639 Epilachna varivestis Species 0.000 description 1
- 241001480059 Erysiphaceae Species 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 244000070406 Malus silvestris Species 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241001454295 Tetranychidae Species 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- 241000219094 Vitaceae Species 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Chemical group 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 235000021021 grapes Nutrition 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000010408 sweeping Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000002641 tar oil Substances 0.000 description 1
- 229940104261 taurate Drugs 0.000 description 1
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/22—Amides of acids of phosphorus
- C07F9/24—Esteramides
- C07F9/2404—Esteramides the ester moiety containing a substituent or a structure which is considered as characteristic
- C07F9/242—Esteramides the ester moiety containing a substituent or a structure which is considered as characteristic of hydroxyaryl compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL225241 | 1958-02-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1201116B true DE1201116B (de) | 1965-09-16 |
Family
ID=19751136
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN16305A Pending DE1201116B (de) | 1958-02-24 | 1959-02-21 | Fungizides Pflanzenschutzmittel |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3038924A (enExample) |
| BE (1) | BE576063A (enExample) |
| CH (1) | CH379193A (enExample) |
| DE (1) | DE1201116B (enExample) |
| ES (1) | ES247459A1 (enExample) |
| FR (1) | FR1247334A (enExample) |
| GB (1) | GB920117A (enExample) |
| NL (2) | NL225241A (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3157568A (en) * | 1959-02-16 | 1964-11-17 | Philips Corp | Bis(dimethylamido)pentachlorophenyl fungicidal compositions |
| NL250581A (enExample) * | 1959-04-16 | |||
| US3089808A (en) * | 1959-08-06 | 1963-05-14 | Philips Corp | Acaricidal diamido phosphate phenol complex |
| US3351682A (en) * | 1959-12-18 | 1967-11-07 | Monsanto Co | Omicron-aryl dialkylphosphinothioates |
| DE1196897B (de) * | 1962-08-23 | 1965-07-15 | Bayer Ag | Rodentizide Mittel |
| US3340331A (en) * | 1964-04-30 | 1967-09-05 | Monsanto Res Corp | Fluorine-containing phosphinates |
| US3346668A (en) * | 1964-04-30 | 1967-10-10 | Monsanto Res Corp | Fluorine-containing phosphinates |
| US3397270A (en) * | 1967-01-25 | 1968-08-13 | Monsanto Co | Method for controlling and eradicating insects with phosphoroamidate sterilants |
| US3923733A (en) * | 1973-04-13 | 1975-12-02 | American Cyanamid Co | Polyolefin light stabilizers |
| US3984348A (en) * | 1973-11-05 | 1976-10-05 | American Cyanamid Company | Polyolefin light stabilizers |
| US3956486A (en) * | 1974-12-30 | 1976-05-11 | Stauffer Chemical Company | Insecticidal phthalimidothiophosphates activated with certain phosphorothionates |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2552538A (en) * | 1948-10-15 | 1951-05-15 | Dow Chemical Co | Diamidothiophosphates |
| US2615037A (en) * | 1948-10-15 | 1952-10-21 | Dow Chemical Co | O,o-di(4-chlorophenyl) n-alkylamidothiophosphates |
| US2615038A (en) * | 1948-10-15 | 1952-10-21 | Dow Chemical Co | O,o-di(polyhalophenyl) n-substituted amidothiophosphates |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH246915A (de) * | 1944-06-13 | 1947-02-15 | Ag J R Geigy | Schädlingsbekämpfungsmittel. |
| US2642406A (en) * | 1948-04-06 | 1953-06-16 | Eastman Kodak Co | Solutions of polymers of acrylonitrile |
| BE492478A (enExample) * | 1949-02-02 | |||
| US2611729A (en) * | 1949-11-01 | 1952-09-23 | Standard Oil Dev Co | Insecticidal compositions containing hydrocarbon esters of diethyl dithiophosphoric acid |
| US2818406A (en) * | 1954-04-26 | 1957-12-31 | Phillips Petroleum Co | Phosphonic diamides |
| DE1067016B (de) * | 1954-12-04 | 1959-10-15 | Farbenfabriken Bayer Aktiengesellschaft Leverkusen-Bayerwerk | Verfahren zur Her stellung von organischen Phosphorver bmdungen |
| US2855426A (en) * | 1956-04-04 | 1958-10-07 | Dow Chemical Co | O-(cyclohexylphenyl) phosphoroamidothioates |
| US2832745A (en) * | 1956-08-31 | 1958-04-29 | Shea Chemical Corp | Aqueous flameproofing compositions and cellulosic materials treated therewith |
-
0
- NL NL100594D patent/NL100594C/xx active
- NL NL225241D patent/NL225241A/xx unknown
- BE BE576063D patent/BE576063A/xx unknown
-
1959
- 1959-02-16 US US793294A patent/US3038924A/en not_active Expired - Lifetime
- 1959-02-20 GB GB5924/59A patent/GB920117A/en not_active Expired
- 1959-02-21 ES ES0247459A patent/ES247459A1/es not_active Expired
- 1959-02-21 CH CH6987959A patent/CH379193A/de unknown
- 1959-02-21 DE DEN16305A patent/DE1201116B/de active Pending
- 1959-02-23 FR FR787472A patent/FR1247334A/fr not_active Expired
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2552538A (en) * | 1948-10-15 | 1951-05-15 | Dow Chemical Co | Diamidothiophosphates |
| US2615037A (en) * | 1948-10-15 | 1952-10-21 | Dow Chemical Co | O,o-di(4-chlorophenyl) n-alkylamidothiophosphates |
| US2615038A (en) * | 1948-10-15 | 1952-10-21 | Dow Chemical Co | O,o-di(polyhalophenyl) n-substituted amidothiophosphates |
Also Published As
| Publication number | Publication date |
|---|---|
| ES247459A1 (es) | 1959-10-16 |
| NL100594C (enExample) | |
| FR1247334A (fr) | 1960-12-02 |
| GB920117A (en) | 1963-03-06 |
| NL225241A (enExample) | |
| BE576063A (enExample) | |
| CH379193A (de) | 1964-06-30 |
| US3038924A (en) | 1962-06-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1201116B (de) | Fungizides Pflanzenschutzmittel | |
| DE2700258A1 (de) | 1,3,4-substituierte pyrazolinderivate | |
| EP0097126A2 (de) | 2-(3-Pyridyl)-1,3,4-oxadiazole, Verfahren zu ihrer Herstellung und ihre Verwendung in der Schädlingsbekämpfung | |
| DE1812761A1 (de) | Isoxazolylcarbamate,deren Mischungen,Verfahren zu deren Herstellung und deren Verwendung | |
| DE1252962B (de) | Insektizide Zubereitung | |
| DE2422977C2 (de) | Cyclopropan-carbonsäure-α-cyanbenzylester, Verfahren zu deren Herstellung und diese Verbindungen enthaltende pestizide Mittel | |
| DE961670C (de) | Schaedlingsbekaempfungsmittel | |
| CH537147A (de) | Schädlingsbekämpfungsmittel | |
| DE1190246B (de) | Insektizides, acarizides und fungizides Mittel | |
| CH647764A5 (de) | Harnstoffverbindungen mit heterocyclischer aether- oder thioaetherbindung, verfahren zu ihrer herstellung und insektizide, die diese verbindungen enthalten. | |
| DE1181978B (de) | Mittel zur Bekaempfung von Arthropoden, Mollusken und Fischen | |
| DE2941658A1 (de) | Praeparat mit wachstumsregulierender wirkung und anwendung dieses praeparats im acker- und gartenbau, sowie neue hexahydropyrimidine und imidazolidine | |
| CH468153A (de) | Insektenbekämpfungsmittel | |
| DE1278427B (de) | Verfahren zur Herstellung von Carbaminsaeureestern | |
| DE1212777B (de) | Fungitoxische Mittel | |
| AT231219B (de) | Mittel zur Bekämpfung schädlicher Organismen | |
| AT204329B (de) | Mittel zur Bekämpfung von Milben | |
| DE2707709C2 (enExample) | ||
| CH629082A5 (de) | Schaedlingsbekaempfungsmittel enthaltend neue dispirocyclopropancarbonsaeureester als wirkstoffkomponente. | |
| DE1273252B (de) | Insektizides, akarizides und fungizides Mittel | |
| AT261311B (de) | Fungizid | |
| AT223872B (de) | Mehrfunktionelles Schädlingsbekämpfungsmittel | |
| DE1211855B (de) | Fungizide fuer die Landwirtschaft | |
| AT253858B (de) | Insektizide Zusammensetzung | |
| EP0053096A1 (de) | Unsymmetrische Bis-Carbamate, Verfahren zu ihrer Herstellung und ihre Verwendung in der Schädlingsbekämpfung |