DE1174321B - Verfahren zur Herstellung von Mono-halogenalkyl-1, 3, 5-triazinen - Google Patents
Verfahren zur Herstellung von Mono-halogenalkyl-1, 3, 5-triazinenInfo
- Publication number
- DE1174321B DE1174321B DEA38005A DEA0038005A DE1174321B DE 1174321 B DE1174321 B DE 1174321B DE A38005 A DEA38005 A DE A38005A DE A0038005 A DEA0038005 A DE A0038005A DE 1174321 B DE1174321 B DE 1174321B
- Authority
- DE
- Germany
- Prior art keywords
- triazine
- triazines
- bromine
- preparation
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 claims 1
- 241000251730 Chondrichthyes Species 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 description 8
- 150000002367 halogens Chemical class 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- GIIYEYPYVJAMBU-UHFFFAOYSA-N 2,4,6-triethyl-1,3,5-triazine Chemical compound CCC1=NC(CC)=NC(CC)=N1 GIIYEYPYVJAMBU-UHFFFAOYSA-N 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- -1 2,4,6-triisobutyl-1,3,5-triazine Chemical compound 0.000 description 2
- LASVAZQZFYZNPK-UHFFFAOYSA-N 2,4,6-trimethyl-1,3,5-triazine Chemical compound CC1=NC(C)=NC(C)=N1 LASVAZQZFYZNPK-UHFFFAOYSA-N 0.000 description 2
- ZMCRQQUPQXQQOF-UHFFFAOYSA-N 2-(1-bromoethyl)-4,6-diethyl-1,3,5-triazine Chemical compound CCC1=NC(CC)=NC(C(C)Br)=N1 ZMCRQQUPQXQQOF-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000012454 non-polar solvent Substances 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical class C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- OPFJAODVGSZUDO-UHFFFAOYSA-N 2,4,6-tributyl-1,3,5-triazine Chemical compound CCCCC1=NC(CCCC)=NC(CCCC)=N1 OPFJAODVGSZUDO-UHFFFAOYSA-N 0.000 description 1
- BBZCXXQQRGOUOW-UHFFFAOYSA-N 2,4,6-tripropyl-1,3,5-triazine Chemical compound CCCC1=NC(CCC)=NC(CCC)=N1 BBZCXXQQRGOUOW-UHFFFAOYSA-N 0.000 description 1
- PCJBNHTYTNLVEF-UHFFFAOYSA-N 2-(bromomethyl)-4,6-dimethyl-1,3,5-triazine Chemical compound CC1=NC(C)=NC(CBr)=N1 PCJBNHTYTNLVEF-UHFFFAOYSA-N 0.000 description 1
- ZWOWIAQFWNKRPF-UHFFFAOYSA-N 2-ethenyl-1,3,5-triazine Chemical class C=CC1=NC=NC=N1 ZWOWIAQFWNKRPF-UHFFFAOYSA-N 0.000 description 1
- TYQPJXDSAHTWRO-UHFFFAOYSA-N 2-ethyl-4,6-diphenyl-1,3,5-triazine Chemical compound N=1C(CC)=NC(C=2C=CC=CC=2)=NC=1C1=CC=CC=C1 TYQPJXDSAHTWRO-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000004519 grease Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 238000003822 preparative gas chromatography Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/14—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom
- C07D251/24—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to three ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US68369A US3062818A (en) | 1960-11-10 | 1960-11-10 | Haloalkyl-s-triazines and a new method of preparation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1174321B true DE1174321B (de) | 1964-07-23 |
Family
ID=22082113
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEA38005A Pending DE1174321B (de) | 1960-11-10 | 1961-07-28 | Verfahren zur Herstellung von Mono-halogenalkyl-1, 3, 5-triazinen |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3062818A (https=) |
| DE (1) | DE1174321B (https=) |
| GB (1) | GB917845A (https=) |
| NL (1) | NL268837A (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0130939A1 (de) * | 1983-06-06 | 1985-01-09 | Ciba-Geigy Ag | Verwendung von Triazin-Derivaten zum Schützen von Mais- und Sorghumpflanzen |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3203550A (en) * | 1965-08-31 | Method for the preparation of substi- tuted s-triazine compounds | ||
| US3331838A (en) * | 1964-12-21 | 1967-07-18 | American Cyanamid Co | Selective chlorination of trimethyl-s-triazine |
| US5502028A (en) * | 1991-03-13 | 1996-03-26 | Schering Agrochemicals Limited | Herbicidal pyrimidinyl or triazinyl haloacetic acid derivatives |
| US5758488A (en) * | 1993-05-11 | 1998-06-02 | Roderick Thomson | Core flow expansion chamber device system for reduction of jet turbine engine noise |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2845422A (en) * | 1957-04-22 | 1958-07-29 | American Cyanamid Co | Substituted s-triazines and method of preparation |
-
0
- NL NL268837D patent/NL268837A/xx unknown
-
1960
- 1960-11-10 US US68369A patent/US3062818A/en not_active Expired - Lifetime
-
1961
- 1961-07-26 GB GB27051/61A patent/GB917845A/en not_active Expired
- 1961-07-28 DE DEA38005A patent/DE1174321B/de active Pending
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0130939A1 (de) * | 1983-06-06 | 1985-01-09 | Ciba-Geigy Ag | Verwendung von Triazin-Derivaten zum Schützen von Mais- und Sorghumpflanzen |
Also Published As
| Publication number | Publication date |
|---|---|
| US3062818A (en) | 1962-11-06 |
| NL268837A (https=) | |
| GB917845A (en) | 1963-02-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0041476A2 (de) | Neue Aryl-Phenyl-Acetylen-Verbindungen | |
| DE1174321B (de) | Verfahren zur Herstellung von Mono-halogenalkyl-1, 3, 5-triazinen | |
| DE3135523A1 (de) | N-((4-(3-substituierte pyridyl)piperazino)-alkyl)-azaspirodecandione, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| DE2258243A1 (de) | Heterocyclische verbindungen und deren verwendung | |
| Burger et al. | Heterocyclen-synthesen mit 4, 4-bis (trifluormethyl)-1, 3-diazabuta-1, 3-dienen, I | |
| DE1445950A1 (de) | Verfahren zur Herstellung von Bis-(hydroxymethyl)-pyridindicarbamatderivaten | |
| DE1217963B (de) | Verfahren zur Herstellung von substituierten Imidazolidinen | |
| DE1174788B (de) | Verfahren zur Herstellung von 3-Cyano-1, 2, 4-triazinen | |
| DE2524578A1 (de) | Barbitursaeurederivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE1143802B (de) | Verfahren zur Herstellung von 2-Chlor-6-nitro-benzonitril | |
| DE1302662B (https=) | ||
| AT258955B (de) | Verfahren zur Herstellung neuer Bis(hydroxymethyl)pyridindicarbamat-Derivate | |
| DE2141633C3 (de) | 2-Alkylthio-4,6-diamino-s- triazine, Verfahren zu ihrer Herstellung und diese enthaltende herbizide Mittel | |
| DE1670296A1 (de) | Verfahren zur Herstellung von substituierten Phosphiniminen und entsprechenden Amidophosphoniumhalogeniden | |
| DE1164393B (de) | Verfahren zur Herstellung von 4, 4'-disubstituierten Diphenylsulfonen | |
| CH417572A (de) | Verfahren zur Herstellung von organischen Stickstoffverbindungen | |
| EP0113030A1 (de) | Cycloalkenylderivate, ihre Herstellung und Verwendung | |
| DE3636552A1 (de) | Neue herbizide | |
| DE1036563B (de) | Fungizide Mittel | |
| DE1795842C2 (de) | Antidiabetisch wirksame Sulfonamide sowie Verfahren zu deren Herstellung | |
| DE2625848A1 (de) | Substituierte 1,2,4-oxadiazolidin-3- on-verbindungen, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenschutzmittel | |
| DE1177645B (de) | Verfahren zur Herstellung von kondensierten heterocyclischen Verbindungen | |
| DE2038922A1 (de) | Organische Thiazolopyrimidine | |
| DE2065893C2 (de) | In 5-Stellung halogenphenylsubstituierte 2-(2-Acetylhydrazino-7-Chlor-3H-1,4-benzodiazepine | |
| DE1445656C (de) | Verfahren zur Herstellung von 4 Amino 2,3,5 trichlor 6 (trichlormethyl) pyridin |