DE1173906B - Verfahren zur Herstellung von 3-Aminopropan-sulfonsaeure-(1) - Google Patents
Verfahren zur Herstellung von 3-Aminopropan-sulfonsaeure-(1)Info
- Publication number
- DE1173906B DE1173906B DEH42904A DEH0042904A DE1173906B DE 1173906 B DE1173906 B DE 1173906B DE H42904 A DEH42904 A DE H42904A DE H0042904 A DEH0042904 A DE H0042904A DE 1173906 B DE1173906 B DE 1173906B
- Authority
- DE
- Germany
- Prior art keywords
- solution
- water
- reaction
- duration
- minutes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 21
- SNKZJIOFVMKAOJ-UHFFFAOYSA-N 3-Aminopropanesulfonate Chemical compound NCCCS(O)(=O)=O SNKZJIOFVMKAOJ-UHFFFAOYSA-N 0.000 title description 17
- 238000002360 preparation method Methods 0.000 title description 3
- 239000000243 solution Substances 0.000 claims description 97
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 claims description 50
- 238000006243 chemical reaction Methods 0.000 claims description 43
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 40
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 33
- 239000007789 gas Substances 0.000 claims description 28
- 150000003839 salts Chemical class 0.000 claims description 26
- 239000007864 aqueous solution Substances 0.000 claims description 24
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 24
- 239000001301 oxygen Substances 0.000 claims description 24
- 229910052760 oxygen Inorganic materials 0.000 claims description 24
- 238000003756 stirring Methods 0.000 claims description 18
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 13
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims description 9
- 229940082150 encore Drugs 0.000 claims description 9
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 claims description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 8
- 229960003237 betaine Drugs 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- WQDSRJBTLILEEK-UHFFFAOYSA-N sulfurous acid Chemical compound OS(O)=O.OS(O)=O WQDSRJBTLILEEK-UHFFFAOYSA-N 0.000 claims description 7
- 238000001556 precipitation Methods 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 239000011780 sodium chloride Substances 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- AOSFMYBATFLTAQ-UHFFFAOYSA-N 1-amino-3-(benzimidazol-1-yl)propan-2-ol Chemical compound C1=CC=C2N(CC(O)CN)C=NC2=C1 AOSFMYBATFLTAQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 235000019270 ammonium chloride Nutrition 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 3
- 235000014113 dietary fatty acids Nutrition 0.000 claims 3
- 239000000194 fatty acid Substances 0.000 claims 3
- 229930195729 fatty acid Natural products 0.000 claims 3
- 235000019864 coconut oil Nutrition 0.000 claims 2
- 239000003240 coconut oil Substances 0.000 claims 2
- 150000004665 fatty acids Chemical class 0.000 claims 2
- MLGWTHRHHANFCC-UHFFFAOYSA-N prop-2-en-1-amine;hydrochloride Chemical compound Cl.NCC=C MLGWTHRHHANFCC-UHFFFAOYSA-N 0.000 claims 2
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical compound CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 claims 2
- 239000007787 solid Substances 0.000 claims 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 1
- 210000000056 organ Anatomy 0.000 claims 1
- 239000003760 tallow Substances 0.000 claims 1
- 239000011734 sodium Substances 0.000 description 59
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229910052708 sodium Inorganic materials 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- -1 oxy compound Chemical class 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- SNAUETXKUXDMFB-UHFFFAOYSA-N n-prop-2-enylbutan-1-amine Chemical compound CCCCNCC=C SNAUETXKUXDMFB-UHFFFAOYSA-N 0.000 description 2
- SHLPFDHXCIUODM-UHFFFAOYSA-N n-prop-2-enyloctan-1-amine Chemical compound CCCCCCCCNCC=C SHLPFDHXCIUODM-UHFFFAOYSA-N 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- QIVUCLWGARAQIO-OLIXTKCUSA-N (3s)-n-[(3s,5s,6r)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1h-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide Chemical compound C1([C@H]2[C@H](N(C(=O)[C@@H](NC(=O)C=3C=C4C[C@]5(CC4=NC=3)C3=CC=CN=C3NC5=O)C2)CC(F)(F)F)C)=C(F)C=CC(F)=C1F QIVUCLWGARAQIO-OLIXTKCUSA-N 0.000 description 1
- ZIRURAJAJIQZFG-UHFFFAOYSA-N 1-aminopropane-1-sulfonic acid Chemical compound CCC(N)S(O)(=O)=O ZIRURAJAJIQZFG-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052920 inorganic sulfate Inorganic materials 0.000 description 1
- GBCKRQRXNXQQPW-UHFFFAOYSA-N n,n-dimethylprop-2-en-1-amine Chemical compound CN(C)CC=C GBCKRQRXNXQQPW-UHFFFAOYSA-N 0.000 description 1
- PUUULGNNRPBVBA-UHFFFAOYSA-N n-ethylprop-2-en-1-amine Chemical compound CCNCC=C PUUULGNNRPBVBA-UHFFFAOYSA-N 0.000 description 1
- IOXXVNYDGIXMIP-UHFFFAOYSA-N n-methylprop-2-en-1-amine Chemical compound CNCC=C IOXXVNYDGIXMIP-UHFFFAOYSA-N 0.000 description 1
- DYUWTXWIYMHBQS-UHFFFAOYSA-N n-prop-2-enylprop-2-en-1-amine Chemical compound C=CCNCC=C DYUWTXWIYMHBQS-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 150000003139 primary aliphatic amines Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- TZYULTYGSBAILI-UHFFFAOYSA-M trimethyl(prop-2-enyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC=C TZYULTYGSBAILI-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/02—Sulfonic acids having sulfo groups bound to acyclic carbon atoms
- C07C309/03—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C309/13—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton
- C07C309/14—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton containing amino groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL279927D NL279927A (cg-RX-API-DMAC7.html) | 1961-06-20 | ||
| DEH42904A DE1173906B (de) | 1961-06-20 | 1961-06-20 | Verfahren zur Herstellung von 3-Aminopropan-sulfonsaeure-(1) |
| CH655262A CH413854A (de) | 1961-06-20 | 1962-05-29 | Verfahren zur Herstellung von Aminoalkansulfonsäuren |
| GB23041/62A GB986071A (en) | 1961-06-20 | 1962-06-15 | Improvements in or relating to n-alkane sulphonic acids |
| FR901309A FR1336719A (fr) | 1961-06-20 | 1962-06-20 | Nouveau procédé de préparation d'acides nu-alcane-sulfoniques |
| US456802A US3255239A (en) | 1961-06-20 | 1965-05-18 | Novel process for the preparation of inner salts of n-alkane sulfonic acids |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEH42904A DE1173906B (de) | 1961-06-20 | 1961-06-20 | Verfahren zur Herstellung von 3-Aminopropan-sulfonsaeure-(1) |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1173906B true DE1173906B (de) | 1964-07-16 |
Family
ID=7155022
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEH42904A Pending DE1173906B (de) | 1961-06-20 | 1961-06-20 | Verfahren zur Herstellung von 3-Aminopropan-sulfonsaeure-(1) |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3255239A (cg-RX-API-DMAC7.html) |
| CH (1) | CH413854A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1173906B (cg-RX-API-DMAC7.html) |
| GB (1) | GB986071A (cg-RX-API-DMAC7.html) |
| NL (1) | NL279927A (cg-RX-API-DMAC7.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0031991B1 (en) * | 1979-11-23 | 1983-07-20 | Mobil Oil Corporation | Method of preparing propane sulfonates |
| US4877885A (en) * | 1985-04-26 | 1989-10-31 | Akademie Der Wissenschaften Der Ddr | Novel 3-sulfinatomethyl-or 3-sulfonatomethyl-4-sulfomethyl pyrrolidinium betaines and their salts as well as process for making the same |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1096911A (en) * | 1963-06-07 | 1967-12-29 | Unilever Ltd | Sulphonic acid derivatives |
| US3625999A (en) * | 1968-02-19 | 1971-12-07 | Lever Brothers Ltd | Process for the preparation of phosphonium sulfonate salts |
| DE2410862C3 (de) * | 1974-03-07 | 1980-12-11 | Bayer Ag, 5090 Leverkusen | Ätherstrukturen enthaltende Dihydroxysulfonate und Verfahren zu deren Herstellung |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2323714A (en) * | 1941-06-25 | 1943-07-06 | Du Pont | Chemical process |
| US2600287A (en) * | 1948-12-31 | 1952-06-10 | Phillips Petroleum Co | Preparation of haloalkane sulfonates and toluidine derivatives thereof |
| US2653970A (en) * | 1950-01-12 | 1953-09-29 | Allied Chem & Dye Corp | Olefin sulfitation process |
| FR1094797A (cg-RX-API-DMAC7.html) * | 1955-05-24 | |||
| FR1102301A (fr) * | 1953-07-03 | 1955-10-19 | Bohme Fettchemie Gmbh | Procédé de fabrication d'acides oxyalcanesulfoniques ou de leurs sels |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3170951A (en) * | 1963-05-23 | 1965-02-23 | American Cyanamid Co | Process for the preparation of sulfo-n-alkylpropionamides |
-
0
- NL NL279927D patent/NL279927A/xx unknown
-
1961
- 1961-06-20 DE DEH42904A patent/DE1173906B/de active Pending
-
1962
- 1962-05-29 CH CH655262A patent/CH413854A/de unknown
- 1962-06-15 GB GB23041/62A patent/GB986071A/en not_active Expired
-
1965
- 1965-05-18 US US456802A patent/US3255239A/en not_active Expired - Lifetime
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1094797A (cg-RX-API-DMAC7.html) * | 1955-05-24 | |||
| US2323714A (en) * | 1941-06-25 | 1943-07-06 | Du Pont | Chemical process |
| US2600287A (en) * | 1948-12-31 | 1952-06-10 | Phillips Petroleum Co | Preparation of haloalkane sulfonates and toluidine derivatives thereof |
| US2653970A (en) * | 1950-01-12 | 1953-09-29 | Allied Chem & Dye Corp | Olefin sulfitation process |
| FR1102301A (fr) * | 1953-07-03 | 1955-10-19 | Bohme Fettchemie Gmbh | Procédé de fabrication d'acides oxyalcanesulfoniques ou de leurs sels |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0031991B1 (en) * | 1979-11-23 | 1983-07-20 | Mobil Oil Corporation | Method of preparing propane sulfonates |
| US4877885A (en) * | 1985-04-26 | 1989-10-31 | Akademie Der Wissenschaften Der Ddr | Novel 3-sulfinatomethyl-or 3-sulfonatomethyl-4-sulfomethyl pyrrolidinium betaines and their salts as well as process for making the same |
Also Published As
| Publication number | Publication date |
|---|---|
| GB986071A (en) | 1965-03-17 |
| US3255239A (en) | 1966-06-07 |
| CH413854A (de) | 1966-05-31 |
| NL279927A (cg-RX-API-DMAC7.html) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE19733681A1 (de) | Verfahren zur Herstellung einer wäßrigen Lösung von freiem Hydroxylamin | |
| CH631956A5 (de) | Verfahren zur herstellung von 2,5-dichlorphenol. | |
| DD219023A3 (de) | Verfahren zur herstellung von natriumtaurinat | |
| DE2529654A1 (de) | Verfahren zur herstellung von dimethylsulfoxid | |
| DE1173906B (de) | Verfahren zur Herstellung von 3-Aminopropan-sulfonsaeure-(1) | |
| EP0163318B1 (de) | Neue 2-substituierte 3-Sulfopropyl-ammoniumbetaine und Verfahren zu ihrer Herstellung | |
| DE2105473C3 (cg-RX-API-DMAC7.html) | ||
| DE2245892B2 (de) | Verfahren zur Herstellung von Citronensäure | |
| DE2645544C2 (cg-RX-API-DMAC7.html) | ||
| EP0000495A1 (de) | Verfahren zur Herstellung von 1-Amino-8-naphthol-3,6-disulfonsäure (H-Säure). | |
| EP0127783B1 (de) | Verfahren zum Phlegmatisieren von wasserunlöslichen Peroxycarbonsäuren | |
| DE1229542B (de) | Verfahren zur Herstellung von Aminoalkansulfonsaeuren | |
| EP0050290A1 (de) | Verfahren zur Herstellung von Alkalisalzen der Imidodisulfonsäure | |
| AT222101B (de) | Verfahren zur Herstellung von neuen α-Nitro-ω-Lactamen | |
| DE1064952B (de) | Verfahren und Vorrichtung zur Herstellung von Amino-carbonsaeurenitrilen | |
| DE819092C (de) | Verfahren zur Herstellung von Isopropylbenzolhydroperoxyd | |
| DE2119119C3 (de) | Verfahren zum Entfernen von Cyanidionen aus Abwässern | |
| DE1468656C3 (de) | Verfahren zur Gewinnung von Acrylnitril | |
| DE2012509C (de) | Verfahren zur Herstellung von Dicyan | |
| DE854359C (de) | Verfahren zur fortlaufenden Herstellung von Lactamen | |
| DE1259868B (de) | Verfahren zur Herstellung von Milchsaeure | |
| DE854507C (de) | Verfahren zur Herstellung von Alkyladipinsaeuren | |
| DE2713345A1 (de) | Verfahren zur herstellung von reinem brom | |
| AT227246B (de) | Verfahren zur Herstellung von Caprolactam | |
| DE1468667C3 (de) | Verfahren zur Oxydation von tert,-Butylalkohol zu alpha-Hydroxyisobuttersäure |