DE1173460B - Verfahren zur Herstellung von Carbodiimiden - Google Patents
Verfahren zur Herstellung von CarbodiimidenInfo
- Publication number
- DE1173460B DE1173460B DEF38041A DEF0038041A DE1173460B DE 1173460 B DE1173460 B DE 1173460B DE F38041 A DEF38041 A DE F38041A DE F0038041 A DEF0038041 A DE F0038041A DE 1173460 B DE1173460 B DE 1173460B
- Authority
- DE
- Germany
- Prior art keywords
- isothiourea
- carbodiimides
- case
- nitrogen atom
- aromatic nucleus
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001718 carbodiimides Chemical class 0.000 title claims description 12
- 238000000034 method Methods 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title description 2
- -1 isothiourea ethers Chemical class 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- ZRVIMDQCIXXVBA-UHFFFAOYSA-N [N].NC(N)=S Chemical group [N].NC(N)=S ZRVIMDQCIXXVBA-UHFFFAOYSA-N 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 4
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 238000003776 cleavage reaction Methods 0.000 claims description 3
- 230000007017 scission Effects 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 238000006467 substitution reaction Methods 0.000 claims description 2
- 230000004992 fission Effects 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N isothiourea group Chemical group NC(S)=N UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 230000001588 bifunctional effect Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000001033 ether group Chemical group 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000005979 thermal decomposition reaction Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- KRPRVQWGKLEFKN-UHFFFAOYSA-N 3-(3-aminopropoxy)propan-1-amine Chemical compound NCCCOCCCN KRPRVQWGKLEFKN-UHFFFAOYSA-N 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 238000006434 Ritter amidation reaction Methods 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008164 mustard oil Substances 0.000 description 1
- LSCKDKDKJIZONG-UHFFFAOYSA-N n'-tert-butylmethanediimine Chemical compound CC(C)(C)N=C=N LSCKDKDKJIZONG-UHFFFAOYSA-N 0.000 description 1
- CMESPBFFDMPSIY-UHFFFAOYSA-N n,n'-diphenylmethanediimine Chemical compound C1=CC=CC=C1N=C=NC1=CC=CC=C1 CMESPBFFDMPSIY-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C267/00—Carbodiimides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE638620D BE638620A (enExample) | 1962-10-13 | ||
| DEF38041A DE1173460B (de) | 1962-10-13 | 1962-10-13 | Verfahren zur Herstellung von Carbodiimiden |
| CH1243563A CH427778A (de) | 1962-10-13 | 1963-10-10 | Verfahren zur Herstellung von Carbodiimiden |
| AT816263A AT246114B (de) | 1962-10-13 | 1963-10-11 | Verfahren zur Herstellung von Carbodiimiden |
| GB40496/63A GB1065767A (en) | 1962-10-13 | 1963-10-14 | Process for preparing carbodiimides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF38041A DE1173460B (de) | 1962-10-13 | 1962-10-13 | Verfahren zur Herstellung von Carbodiimiden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1173460B true DE1173460B (de) | 1964-07-09 |
Family
ID=7097191
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF38041A Pending DE1173460B (de) | 1962-10-13 | 1962-10-13 | Verfahren zur Herstellung von Carbodiimiden |
Country Status (5)
| Country | Link |
|---|---|
| AT (1) | AT246114B (enExample) |
| BE (1) | BE638620A (enExample) |
| CH (1) | CH427778A (enExample) |
| DE (1) | DE1173460B (enExample) |
| GB (1) | GB1065767A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR102488760B1 (ko) * | 2016-03-31 | 2023-01-16 | 다우 글로벌 테크놀로지스 엘엘씨 | 비스카보디이미드 및 폴리카보디이미드 및 이의 제조 방법 |
-
0
- BE BE638620D patent/BE638620A/xx unknown
-
1962
- 1962-10-13 DE DEF38041A patent/DE1173460B/de active Pending
-
1963
- 1963-10-10 CH CH1243563A patent/CH427778A/de unknown
- 1963-10-11 AT AT816263A patent/AT246114B/de active
- 1963-10-14 GB GB40496/63A patent/GB1065767A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH427778A (de) | 1967-01-15 |
| BE638620A (enExample) | |
| GB1065767A (en) | 1967-04-19 |
| AT246114B (de) | 1966-04-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2155495A1 (de) | Verfahren zur herstellung von benzylidenverbindungen | |
| DE863055C (de) | Verfahren zur Herstellung von AEthyleniminverbindungen | |
| DE1173460B (de) | Verfahren zur Herstellung von Carbodiimiden | |
| DE2246284C2 (de) | Verfahren zur Herstellung von (2-Cyanäthyl)-Ketonen | |
| DE941909C (de) | Verfahren zur Herstellung von N, N'-Diaethanol-piperazin | |
| DE3128574A1 (de) | Verfahren zur herstellung von n-substituierten acryl- und methacrylamiden | |
| DE575114C (de) | Verfahren zur Darstellung von unsymmetrisch substituierten Methylendiaminabkoemmlingen | |
| DE2336403A1 (de) | Verfahren zur herstellung von isocyanaten | |
| DE960813C (de) | Verfahren zur Herstellung von ungesaettigten ª†- und ª€-Laktonen | |
| EP0388587B1 (de) | Verfahrensverbesserung bei der technisch angewandten Knoevenagelschen Synthese | |
| DE866193C (de) | Verfahren zur Herstellung von in der Amidgruppe substituierten Carbonsaeureamiden | |
| DE235686C (enExample) | ||
| DE1210874B (de) | Verfahren zur Herstellung von Diarylaminoderivaten von Arylaminoalkanen | |
| DE1275050B (de) | Verfahren zur Herstellung von olefinisch ungesaettigten Aldehyden und Ketonen | |
| DE1795299C3 (de) | Verfahren zur Herstellung von Thiazolinen-(3) | |
| DE1240853B (de) | Verfahren zur Herstellung von Sulfurylamiden | |
| DE1118215B (de) | Verfahren zur Herstellung von 2, 5-Dianilino-terephthalsaeureestern | |
| AT210882B (de) | Verfahren zur Herstellung von neuen substituierten Aminoacetophenonen und deren Salzen | |
| DE892448C (de) | Verfahren zur Herstellung von 6-Methyl-8-(2', 6', 6'-trimethylcyclohex-1'-en-1'-yl)-okta-3, 5, 7-trien-2-on | |
| DE1054082B (de) | Verfahren zur Herstellung von 1,8-Octandiolen | |
| DE1272286C2 (de) | Verfahren zur Herstellung von N-substituierten aliphatischen Thiocarbonsaeureamiden | |
| DE1943500A1 (de) | Verfahren zur Herstellung von N-substituierten Morpholinen | |
| DE1008729B (de) | Verfahren zur Herstellung von konjugiert-ungesaettigten Oxocarbonsaeureestern | |
| DE1122937B (de) | Verfahren zur Herstellung von Ketourethanen | |
| DE1050763B (de) | Synthese von Vitamin-A-Säure und ihren Estern |