DE1165010B - Verfahren zur Herstellung aromatischer Carbonsaeuren - Google Patents
Verfahren zur Herstellung aromatischer CarbonsaeurenInfo
- Publication number
- DE1165010B DE1165010B DEJ22571A DEJ0022571A DE1165010B DE 1165010 B DE1165010 B DE 1165010B DE J22571 A DEJ22571 A DE J22571A DE J0022571 A DEJ0022571 A DE J0022571A DE 1165010 B DE1165010 B DE 1165010B
- Authority
- DE
- Germany
- Prior art keywords
- oxidation
- aromatic
- catalyst
- carboxylic acids
- hydrogen bromide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 7
- -1 aromatic carboxylic acids Chemical class 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 33
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 18
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 16
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 16
- 239000003054 catalyst Substances 0.000 claims description 14
- 238000007254 oxidation reaction Methods 0.000 claims description 11
- GWHJZXXIDMPWGX-UHFFFAOYSA-N 1,2,4-trimethylbenzene Chemical compound CC1=CC=C(C)C(C)=C1 GWHJZXXIDMPWGX-UHFFFAOYSA-N 0.000 claims description 10
- 230000003647 oxidation Effects 0.000 claims description 10
- SQNZJJAZBFDUTD-UHFFFAOYSA-N durene Chemical compound CC1=CC(C)=C(C)C=C1C SQNZJJAZBFDUTD-UHFFFAOYSA-N 0.000 claims description 5
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 claims description 4
- 239000008096 xylene Substances 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 3
- 229910000043 hydrogen iodide Inorganic materials 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229950005228 bromoform Drugs 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims 2
- 150000004694 iodide salts Chemical class 0.000 claims 2
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical class C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 claims 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical class [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims 1
- 150000001347 alkyl bromides Chemical class 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- 229910001503 inorganic bromide Inorganic materials 0.000 claims 1
- 229910001505 inorganic iodide Inorganic materials 0.000 claims 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 8
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 4
- CYIDZMCFTVVTJO-UHFFFAOYSA-N pyromellitic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=C1C(O)=O CYIDZMCFTVVTJO-UHFFFAOYSA-N 0.000 description 4
- ARCGXLSVLAOJQL-UHFFFAOYSA-N trimellitic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- 150000001491 aromatic compounds Chemical class 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical class C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 3
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 3
- 238000007086 side reaction Methods 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 150000003738 xylenes Chemical class 0.000 description 3
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical class C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 2
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 239000003245 coal Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 2
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Inorganic materials [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 2
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical group C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 1
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical class C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- UJMDYLWCYJJYMO-UHFFFAOYSA-N benzene-1,2,3-tricarboxylic acid Chemical class OC(=O)C1=CC=CC(C(O)=O)=C1C(O)=O UJMDYLWCYJJYMO-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- BZRRQSJJPUGBAA-UHFFFAOYSA-L cobalt(ii) bromide Chemical class Br[Co]Br BZRRQSJJPUGBAA-UHFFFAOYSA-L 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 125000005590 trimellitic acid group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/305—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with sulfur or sulfur-containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB39088/61A GB952524A (en) | 1961-11-01 | 1961-11-01 | Oxidation of substituted aromatic compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1165010B true DE1165010B (de) | 1964-03-12 |
Family
ID=10407564
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEJ22571A Pending DE1165010B (de) | 1961-11-01 | 1962-10-29 | Verfahren zur Herstellung aromatischer Carbonsaeuren |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3193577A (en:Method) |
| BE (1) | BE624291A (en:Method) |
| DE (1) | DE1165010B (en:Method) |
| GB (1) | GB952524A (en:Method) |
| NL (1) | NL284892A (en:Method) |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3124611A (en) * | 1964-03-10 | Oxidation of aromatic compounds | ||
| US2444924A (en) * | 1944-10-01 | 1948-07-13 | Farkas Ladislaus Guillaume | Process of oxidizing primary or secondary alcoholic hydroxyl groups or aldehyde groups |
| US2415800A (en) * | 1945-03-12 | 1947-02-11 | Shell Dev | Controlled oxidation of alkylated aromatic hydrocarbons |
| US2662923A (en) * | 1951-01-08 | 1953-12-15 | Dresser Operations Inc | Oxidation of aromatic hydrocarbons to phenols |
| US2821552A (en) * | 1956-06-12 | 1958-01-28 | Eastman Kodak Co | Oxidation of hydrocarbons with sulfur dioxides |
| US2900412A (en) * | 1958-08-07 | 1959-08-18 | California Research Corp | Oxidation process employing sulfur dioxide |
-
0
- NL NL284892D patent/NL284892A/xx unknown
- BE BE624291D patent/BE624291A/xx unknown
-
1961
- 1961-11-01 GB GB39088/61A patent/GB952524A/en not_active Expired
-
1962
- 1962-10-19 US US231851A patent/US3193577A/en not_active Expired - Lifetime
- 1962-10-29 DE DEJ22571A patent/DE1165010B/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| BE624291A (en:Method) | |
| GB952524A (en) | 1964-03-18 |
| US3193577A (en) | 1965-07-06 |
| NL284892A (en:Method) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3703517A1 (de) | Toluoldisproportionierungsverfahren | |
| EP0044480B1 (de) | Verfahren zur Herstellung von Wasserstoffperoxid | |
| DE1165010B (de) | Verfahren zur Herstellung aromatischer Carbonsaeuren | |
| DE1543703A1 (de) | Verfahren zur Oxydation von aromatischen Kohlenwasserstoffen | |
| DE1114179B (de) | Verfahren zur Herstellung von Benzoldicarbonsaeuren | |
| DE2162495C2 (de) | Verfahren zur Herstellung von Biphenyl und dessen Derivaten durch oxidatives Kuppeln aromatischer Verbindungen | |
| DE2100036A1 (de) | Verfahren zur Herstellung von Hydroxy !ammoniumnitrat | |
| DE1493191C3 (de) | Verfahren zur Herstellung von Benzoldicarbonsäuren | |
| DE1925102C3 (de) | Verfahren zum Disprogportionieren von alkylaromatischen Kohlenwasserstoffen | |
| DE1081445B (de) | Verfahren zur Herstellung von aromatischen Di- oder Polycarbon-saeuren | |
| DE2531065C3 (de) | Verfahren zum Disproportionieren von Benzol und Methylbenzolen | |
| DE3028199C2 (de) | Verfahren zur Isomerisierung von 1-Methylnaphthalin | |
| DE2158279A1 (de) | Verfahren zur Herstellung von Terephthalsäure oder Isophthalsäure | |
| DE1147571B (de) | Verfahren zur Herstellung von Benzoldicarbonsaeuren | |
| DE2103142C3 (de) | Katalysator zur Oxidation von Alkylbenzolen mit Sauerstoff zu Carbonsäuren | |
| DE2039904C (de) | Verfahren zur Herstellung von Diphenylen | |
| DE2227260C3 (de) | Verfahren zum Isomerisieren von Dimethylnaphthalin | |
| AT229885B (de) | Verfahren zur Rückgewinnung von aktivem, wasserfreien Aluminiumchlorid aus Friedel-Crafts-Reaktionslösungen | |
| DE1280864B (de) | Verfahren zur Herstellung von unsubstituierten oder durch oxydationsbestaendige Gruppen substituierten Phenolen | |
| DE2146940C3 (de) | Verfahren zum Isomerisieren von Abströmen einer p-Xylot-Kristallisationseinrichtung | |
| DE2001570A1 (de) | Verfahren zur Herstellung aromatischer Dinitrohalogenverbindungen | |
| DE1768691A1 (de) | Verfahren zur Herstellung von aromatischen Carbonsaeuren | |
| DE1153356B (de) | Verfahren zur Herstellung von Terephthalsaeure | |
| DE976759C (de) | Verfahren zur kontinuierlichen Herstellung von Trinitrotoluol durch Nitrieren von Dinitrotoluol im Gegenstrom | |
| DE1122052B (de) | Verfahren zur Oxydation von Alkylbenzolen |