DE116089C - - Google Patents
Info
- Publication number
- DE116089C DE116089C DENDAT116089D DE116089DA DE116089C DE 116089 C DE116089 C DE 116089C DE NDAT116089 D DENDAT116089 D DE NDAT116089D DE 116089D A DE116089D A DE 116089DA DE 116089 C DE116089 C DE 116089C
- Authority
- DE
- Germany
- Prior art keywords
- group
- groups
- methylene
- reaction
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000007859 condensation product Substances 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 3
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical group NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 claims description 2
- 125000003172 aldehyde group Chemical group 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 2
- 150000003513 tertiary aromatic amines Chemical class 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 5
- LGDPTPLJZGPOJL-UHFFFAOYSA-N n,n-dimethyl-2-nitrosoaniline Chemical compound CN(C)C1=CC=CC=C1N=O LGDPTPLJZGPOJL-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- -1 aromatic nitrosoamines Chemical group 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- DTUQWGWMVIHBKE-UHFFFAOYSA-N phenylacetaldehyde Chemical compound O=CCC1=CC=CC=C1 DTUQWGWMVIHBKE-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- XKLJHFLUAHKGGU-UHFFFAOYSA-N nitrous amide Chemical class ON=N XKLJHFLUAHKGGU-UHFFFAOYSA-N 0.000 description 2
- 229940100595 phenylacetaldehyde Drugs 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 1
- UMAPFAAAQBMYNJ-UHFFFAOYSA-N 1-n,2-n-dimethylbenzene-1,2-diamine Chemical compound CNC1=CC=CC=C1NC UMAPFAAAQBMYNJ-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- BUNFNRVLMKHKIT-UHFFFAOYSA-N n-(2-nitrophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC=C1[N+]([O-])=O BUNFNRVLMKHKIT-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000004005 nitrosamines Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE116089C true DE116089C (ref) |
Family
ID=385472
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT116089D Active DE116089C (ref) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE116089C (ref) |
-
0
- DE DENDAT116089D patent/DE116089C/de active Active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2209478B2 (de) | Verfahren zur Herstellung von konzentrierten Lösungen anionischer metallfreier sulfonsäuregruppenhaltiger Azofarbstoffe | |
| DE1129153B (de) | Verfahren zur Herstellung von ª-Cyan-ª-Alkyl-ª-phenylacrylsaeureestern | |
| DE116089C (ref) | ||
| DE1795653A1 (de) | Verfahren zur herstellung von 2alkoxy-4.5-azimidobenzamiden | |
| DE1643329B2 (de) | Verfahren zur herstellung von nitroaminodiarylaethern | |
| DE2354959B2 (de) | Neues Verfahren zur Herstellung von 4-Amino-3,5-dihalogen-phenyl-äthanolaminen | |
| DE1206879B (de) | Verfahren zur Herstellung von p-Aminoarylaldehyden | |
| DE1000392C2 (de) | Verfahren zur Herstellung von Diazoamino-Derivaten | |
| DE79385C (de) | Verfahren zur Darstellung von p-Amidoj'-phenylchinolin und p-Amido-7--phenylchh>aldin | |
| DE955591C (de) | Verfahren zur Herstellung von 2-Methyl-4-cyclohexyl-6-dimethylaminomethylphenol | |
| CH396941A (de) | Verfahren zur Herstellung neuer sekundärer Amine | |
| DE109486C (ref) | ||
| DE212205C (ref) | ||
| DE873551C (de) | Verfahren zur Herstellung acylierter Methylendiamine | |
| DE216072C (ref) | ||
| DE1445902C (de) | Verfahren zur Herstellung von 3-Aminoisoxazolen | |
| AT281808B (de) | Verfahren zur Herstellung von neuen 2-Alkoxy- oder 2-Alkenyloxy-4,5-azimidobenzamiden und ihren Salzen | |
| AT203002B (de) | Verfahren zur Herstellung von neuen, heterocyclisch substituierten Pyrazolonderivaten | |
| DE921327C (de) | Verfahren zur Herstellung von alkylschwefelsauren Salzen von Imidoaethern | |
| AT263001B (de) | Verfahren zur Herstellung von neuen Aminodihydroindenooxazolen und ihren Salzen | |
| DE1593742A1 (de) | Verfahren zur Herstellung von 7-Aminocumarinen | |
| DE1004189B (de) | Verfahren zur Herstellung von ª‰-Sulfamido-carbonsaeureamiden | |
| DE709616C (de) | Verfahren zur Herstellung sekundaerer aromatischer Aminoketone | |
| AT240358B (de) | Verfahren zur Herstellung von 1, 5-disubstituierten Tetrazolen | |
| DE1911893A1 (de) | Verfahren zur Herstellung von N-(Halogen-aryl)-2-methyl-5-alkoxy-indol-3-essigsaeuren |