DE1142872B - Verfahren zur Herstellung von gegebenenfalls im Benzoylrest substituierten Mono-(ª‰-benzoylhydrazino)-naphthalinen - Google Patents
Verfahren zur Herstellung von gegebenenfalls im Benzoylrest substituierten Mono-(ª‰-benzoylhydrazino)-naphthalinenInfo
- Publication number
- DE1142872B DE1142872B DEF32657A DEF0032657A DE1142872B DE 1142872 B DE1142872 B DE 1142872B DE F32657 A DEF32657 A DE F32657A DE F0032657 A DEF0032657 A DE F0032657A DE 1142872 B DE1142872 B DE 1142872B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- sulfonic acid
- benzoylhydrazino
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 12
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title description 2
- WARCRYXKINZHGQ-UHFFFAOYSA-N benzohydrazide Chemical class NNC(=O)C1=CC=CC=C1 WARCRYXKINZHGQ-UHFFFAOYSA-N 0.000 claims description 9
- 150000002790 naphthalenes Chemical class 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims description 5
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 claims description 4
- 239000003085 diluting agent Chemical class 0.000 claims description 4
- 150000003458 sulfonic acid derivatives Chemical class 0.000 claims description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical class C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- JZJAJRLLYXEWGP-UHFFFAOYSA-N n-[4-(hydrazinecarbonyl)phenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(C(=O)NN)C=C1 JZJAJRLLYXEWGP-UHFFFAOYSA-N 0.000 description 4
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 4
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- XBCIOBSQHJYVBQ-UHFFFAOYSA-N naphthalen-1-ylhydrazine Chemical class C1=CC=C2C(NN)=CC=CC2=C1 XBCIOBSQHJYVBQ-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- XSXYESVZDBAKKT-UHFFFAOYSA-N 2-hydroxybenzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1O XSXYESVZDBAKKT-UHFFFAOYSA-N 0.000 description 2
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 2
- FBYMBFPXCCVIRA-UHFFFAOYSA-N 4,6-dihydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(O)=CC=C21 FBYMBFPXCCVIRA-UHFFFAOYSA-N 0.000 description 2
- REKQLYUAUXYJSZ-UHFFFAOYSA-N 4-methoxybenzohydrazide Chemical compound COC1=CC=C(C(=O)NN)C=C1 REKQLYUAUXYJSZ-UHFFFAOYSA-N 0.000 description 2
- HBZVNWNSRNTWPS-UHFFFAOYSA-N 6-amino-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(N)=CC=C21 HBZVNWNSRNTWPS-UHFFFAOYSA-N 0.000 description 2
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 150000001716 carbazoles Chemical class 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- GRWMSCBKWMQPON-UHFFFAOYSA-N 2-aminobenzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1N GRWMSCBKWMQPON-UHFFFAOYSA-N 0.000 description 1
- JSIVTKBYJLGBPY-UHFFFAOYSA-N 3-aminobenzohydrazide Chemical compound NNC(=O)C1=CC=CC(N)=C1 JSIVTKBYJLGBPY-UHFFFAOYSA-N 0.000 description 1
- DMYHTSZRAULBDW-UHFFFAOYSA-N 4,7-dihydroxynaphthalene-2-sulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(O)=CC=C21 DMYHTSZRAULBDW-UHFFFAOYSA-N 0.000 description 1
- XRZGDRWOTXCILS-UHFFFAOYSA-N 4,8-dihydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(O)=CC=CC2=C1O XRZGDRWOTXCILS-UHFFFAOYSA-N 0.000 description 1
- WPBZMCGPFHZRHJ-UHFFFAOYSA-N 4-aminobenzohydrazide Chemical compound NNC(=O)C1=CC=C(N)C=C1 WPBZMCGPFHZRHJ-UHFFFAOYSA-N 0.000 description 1
- PKBGHORNUFQAAW-UHFFFAOYSA-N 4-chlorobenzohydrazide Chemical compound NNC(=O)C1=CC=C(Cl)C=C1 PKBGHORNUFQAAW-UHFFFAOYSA-N 0.000 description 1
- ZMZGIVVRBMFZSG-UHFFFAOYSA-N 4-hydroxybenzohydrazide Chemical compound NNC(=O)C1=CC=C(O)C=C1 ZMZGIVVRBMFZSG-UHFFFAOYSA-N 0.000 description 1
- WSUYONLKFXZZRV-UHFFFAOYSA-N 7-aminonaphthalen-2-ol Chemical compound C1=CC(O)=CC2=CC(N)=CC=C21 WSUYONLKFXZZRV-UHFFFAOYSA-N 0.000 description 1
- GGZZISOUXJHYOY-UHFFFAOYSA-N 8-amino-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(N)=CC=CC2=C1O GGZZISOUXJHYOY-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- -1 alkali metal salts Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- AOBNSCYTCGBVQR-UHFFFAOYSA-N ethyl 4-(methanesulfonamido)benzoate Chemical compound CCOC(=O)C1=CC=C(NS(C)(=O)=O)C=C1 AOBNSCYTCGBVQR-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- GJWCINCFUVWDJZ-UHFFFAOYSA-N n'-naphthalen-2-ylbenzohydrazide Chemical compound C=1C=C2C=CC=CC2=CC=1NNC(=O)C1=CC=CC=C1 GJWCINCFUVWDJZ-UHFFFAOYSA-N 0.000 description 1
- XTBLDMQMUSHDEN-UHFFFAOYSA-N naphthalene-2,3-diamine Chemical compound C1=CC=C2C=C(N)C(N)=CC2=C1 XTBLDMQMUSHDEN-UHFFFAOYSA-N 0.000 description 1
- JRNGUTKWMSBIBF-UHFFFAOYSA-N naphthalene-2,3-diol Chemical compound C1=CC=C2C=C(O)C(O)=CC2=C1 JRNGUTKWMSBIBF-UHFFFAOYSA-N 0.000 description 1
- HBJPJUGOYJOSLR-UHFFFAOYSA-N naphthalene-2,7-diamine Chemical compound C1=CC(N)=CC2=CC(N)=CC=C21 HBJPJUGOYJOSLR-UHFFFAOYSA-N 0.000 description 1
- DFQICHCWIIJABH-UHFFFAOYSA-N naphthalene-2,7-diol Chemical compound C1=CC(O)=CC2=CC(O)=CC=C21 DFQICHCWIIJABH-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- BHZRJJOHZFYXTO-UHFFFAOYSA-L potassium sulfite Chemical compound [K+].[K+].[O-]S([O-])=O BHZRJJOHZFYXTO-UHFFFAOYSA-L 0.000 description 1
- 235000019252 potassium sulphite Nutrition 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
- C07C243/24—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids
- C07C243/38—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids with acylating carboxyl groups bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF32657A DE1142872B (de) | 1960-11-30 | 1960-11-30 | Verfahren zur Herstellung von gegebenenfalls im Benzoylrest substituierten Mono-(ª‰-benzoylhydrazino)-naphthalinen |
| CH1182861A CH396936A (de) | 1960-11-30 | 1961-10-12 | Verfahren zur Herstellung von Acylhydrazinonaphthalinen |
| GB3752161A GB934428A (cg-RX-API-DMAC7.html) | 1960-11-30 | 1961-10-19 | |
| BE610867A BE610867A (fr) | 1960-11-30 | 1961-11-28 | Procédé de fabrication d'acylhydrazinonaphtalènes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF32657A DE1142872B (de) | 1960-11-30 | 1960-11-30 | Verfahren zur Herstellung von gegebenenfalls im Benzoylrest substituierten Mono-(ª‰-benzoylhydrazino)-naphthalinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1142872B true DE1142872B (de) | 1963-01-31 |
Family
ID=7094725
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF32657A Pending DE1142872B (de) | 1960-11-30 | 1960-11-30 | Verfahren zur Herstellung von gegebenenfalls im Benzoylrest substituierten Mono-(ª‰-benzoylhydrazino)-naphthalinen |
Country Status (4)
| Country | Link |
|---|---|
| BE (1) | BE610867A (cg-RX-API-DMAC7.html) |
| CH (1) | CH396936A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1142872B (cg-RX-API-DMAC7.html) |
| GB (1) | GB934428A (cg-RX-API-DMAC7.html) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH09227485A (ja) * | 1996-02-16 | 1997-09-02 | Fuji Photo Film Co Ltd | 2−ヒドラジノナフタレン化合物の製造方法 |
-
1960
- 1960-11-30 DE DEF32657A patent/DE1142872B/de active Pending
-
1961
- 1961-10-12 CH CH1182861A patent/CH396936A/de unknown
- 1961-10-19 GB GB3752161A patent/GB934428A/en not_active Expired
- 1961-11-28 BE BE610867A patent/BE610867A/fr unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH396936A (de) | 1965-08-15 |
| BE610867A (fr) | 1962-03-16 |
| GB934428A (cg-RX-API-DMAC7.html) | 1963-08-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1142872B (de) | Verfahren zur Herstellung von gegebenenfalls im Benzoylrest substituierten Mono-(ª‰-benzoylhydrazino)-naphthalinen | |
| DE1443325A1 (de) | Verfahren zur Herstellung von 2,5-Diarylaminoterephthalsaeuren oder deren Estern | |
| DE1078582B (de) | Verfahren zur Herstellung substituierter Thyropropionsaeuren | |
| DE1005062B (de) | Verfahren zur Herstellung von Cyclohepten-(1)-carbonsaeure-(1) bzw. deren Estern | |
| DE1121052B (de) | Verfahren zur Herstellung von 4, 5-substituierten 2-Amino-oxazolen | |
| DE1153029B (de) | Verfahren zur Herstellung von o-Aminophenol-ª‰-hydroxyaethylsulfon-schwefelsaeureestern | |
| DE681685C (de) | Verfahren zur Herstellung von p-Aminobenzolsulfonarylidabkoemmlingen | |
| AT227696B (de) | Verfahren zur Herstellung von 2-Amino-oxazolen | |
| DE928286C (de) | Verfahren zur Herstellung eines neuen, analgetisch wirksamen 1-Phenyl-pyrazolderivates | |
| AT205026B (de) | Verfahren zur Herstellung von neuen α-Aroyl-α-(o-carboxybenzoylamino)-essigsäureestern | |
| EP0036143B1 (de) | Verfahren zur Herstellung von 1-Amino-2-ethoxy-naphthalin-6-sulfonsäure | |
| AT203489B (de) | Verfahren zur Herstellung von 4-Nitrostyryl-2-sulfonsäure-Verbindungen | |
| DE1072998B (de) | Verfahren zur Herstellung von substituierten Diphenyläthern | |
| DE3022783A1 (de) | Verfahren zur herstellung von 4-acylamido-2-nitro-1-alkoxybenzol-verbindungen | |
| EP0179217A2 (de) | Verfahren zur Herstellung von 2-Hydroxy-5,6,7,8-tetrahydrocarbazol, die Alkali- und Erdalkalisalze des 2-Hydroxy-5,6,7,8-tetrahydrocarbazols und deren Verwendung | |
| CH227069A (de) | Verfahren zur Herstellung einer Cyclopentano-dimethyl-polyhydrophenanthren-carbonsäure. | |
| DE2238761C3 (de) | Verfahren zur Herstellung 2substituierter 5-Benzothiazol-essigsäure-Verbindungen | |
| DE755395C (de) | Verfahren zur Herstellung von Sulfanilamidabkoemmlingen | |
| AT200154B (de) | Verfahren zur Herstellung von Citrullin | |
| AT278787B (de) | Verfahren zur herstellung von neuen carbonsaeuren und von deren salzen | |
| DE1543941C (de) | Verfahren zur Herstellung von 1-Oxa-2-methyl-3-aminocarbonyl-4-thia-cyclohex-2-en-4-oxiden oder 4,4-dioxiden | |
| EP0084329B1 (de) | Verfahren zur Herstellung von 1,4-Bis-(dicyanomethylen)-cyclohexan | |
| CH389626A (de) | Verfahren zur Herstellung von a,B-Di-(imidazyl-(2))-äthylenen | |
| DE2213602A1 (de) | Neues Verfahren zur Herstellung von Arylsulfonylha"rnstoffen | |
| CH358438A (de) | Verfahren zur Herstellung von Diphenyläthern |