DE1132903B - Verfahren zur Herstellung von Trifluor- bzw. Difluorkohlen-wasserstoffen - Google Patents
Verfahren zur Herstellung von Trifluor- bzw. Difluorkohlen-wasserstoffenInfo
- Publication number
- DE1132903B DE1132903B DER28591A DER0028591A DE1132903B DE 1132903 B DE1132903 B DE 1132903B DE R28591 A DER28591 A DE R28591A DE R0028591 A DER0028591 A DE R0028591A DE 1132903 B DE1132903 B DE 1132903B
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen fluoride
- ecm
- bromine
- bromine trifluoride
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 10
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 22
- 229910000040 hydrogen fluoride Inorganic materials 0.000 claims description 22
- FQFKTKUFHWNTBN-UHFFFAOYSA-N trifluoro-$l^{3}-bromane Chemical compound FBr(F)F FQFKTKUFHWNTBN-UHFFFAOYSA-N 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 13
- CEBDXRXVGUQZJK-UHFFFAOYSA-N 2-methyl-1-benzofuran-7-carboxylic acid Chemical compound C1=CC(C(O)=O)=C2OC(C)=CC2=C1 CEBDXRXVGUQZJK-UHFFFAOYSA-N 0.000 claims description 12
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 8
- 150000002825 nitriles Chemical class 0.000 claims description 8
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- 239000011737 fluorine Substances 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical group [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 10
- 238000003682 fluorination reaction Methods 0.000 description 9
- 239000007789 gas Substances 0.000 description 7
- 238000001819 mass spectrum Methods 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 238000002329 infrared spectrum Methods 0.000 description 6
- UJPMYEOUBPIPHQ-UHFFFAOYSA-N 1,1,1-trifluoroethane Chemical compound CC(F)(F)F UJPMYEOUBPIPHQ-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical class CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- 239000001307 helium Substances 0.000 description 4
- 229910052734 helium Inorganic materials 0.000 description 4
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 3
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- HUAUNKAZQWMVFY-UHFFFAOYSA-M sodium;oxocalcium;hydroxide Chemical compound [OH-].[Na+].[Ca]=O HUAUNKAZQWMVFY-UHFFFAOYSA-M 0.000 description 3
- -1 y-bromobutyronitrile Chemical compound 0.000 description 3
- LDRPULCXZDDSGE-UHFFFAOYSA-N 1,1,1-trifluorobutane Chemical compound CCCC(F)(F)F LDRPULCXZDDSGE-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- SJNALLRHIVGIBI-UHFFFAOYSA-N allyl cyanide Chemical compound C=CCC#N SJNALLRHIVGIBI-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000012808 vapor phase Substances 0.000 description 2
- QXALUNHYJJONQH-UHFFFAOYSA-N 1,1,1-trifluoro-2-methylpropane Chemical compound CC(C)C(F)(F)F QXALUNHYJJONQH-UHFFFAOYSA-N 0.000 description 1
- KDWQLICBSFIDRM-UHFFFAOYSA-N 1,1,1-trifluoropropane Chemical compound CCC(F)(F)F KDWQLICBSFIDRM-UHFFFAOYSA-N 0.000 description 1
- NPNPZTNLOVBDOC-UHFFFAOYSA-N 1,1-difluoroethane Chemical compound CC(F)F NPNPZTNLOVBDOC-UHFFFAOYSA-N 0.000 description 1
- ZQXCQTAELHSNAT-UHFFFAOYSA-N 1-chloro-3-nitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(C(F)(F)F)=C1 ZQXCQTAELHSNAT-UHFFFAOYSA-N 0.000 description 1
- IRPGOXJVTQTAAN-UHFFFAOYSA-N 2,2,3,3,3-pentafluoropropanal Chemical compound FC(F)(F)C(F)(F)C=O IRPGOXJVTQTAAN-UHFFFAOYSA-N 0.000 description 1
- YZXSQDNPKVBDOG-UHFFFAOYSA-N 2,2-difluoropropane Chemical compound CC(C)(F)F YZXSQDNPKVBDOG-UHFFFAOYSA-N 0.000 description 1
- KMTFOQPBLCPPTP-UHFFFAOYSA-N 4-bromo-2-methyl-5-propylpyrazole-3-carboxylic acid Chemical compound CCCC1=NN(C)C(C(O)=O)=C1Br KMTFOQPBLCPPTP-UHFFFAOYSA-N 0.000 description 1
- KLZUFWVZNOTSEM-UHFFFAOYSA-K Aluminum fluoride Inorganic materials F[Al](F)F KLZUFWVZNOTSEM-UHFFFAOYSA-K 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 229910021583 Cobalt(III) fluoride Inorganic materials 0.000 description 1
- STZZWJCGRKXEFF-UHFFFAOYSA-N Dichloroacetonitrile Chemical compound ClC(Cl)C#N STZZWJCGRKXEFF-UHFFFAOYSA-N 0.000 description 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 description 1
- PCVBOQNPSAIIDH-UHFFFAOYSA-N F[I](F)(F)(F)(F)F Chemical compound F[I](F)(F)(F)(F)F PCVBOQNPSAIIDH-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical group ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 229940095564 anhydrous calcium sulfate Drugs 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229940095672 calcium sulfate Drugs 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- WZJQNLGQTOCWDS-UHFFFAOYSA-K cobalt(iii) fluoride Chemical compound F[Co](F)F WZJQNLGQTOCWDS-UHFFFAOYSA-K 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- LTVOKYUPTHZZQH-UHFFFAOYSA-N difluoromethane Chemical compound F[C]F LTVOKYUPTHZZQH-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- NBVXSUQYWXRMNV-UHFFFAOYSA-N fluoromethane Chemical class FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- QHMQWEPBXSHHLH-UHFFFAOYSA-N sulfur tetrafluoride Chemical compound FS(F)(F)F QHMQWEPBXSHHLH-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 231100000925 very toxic Toxicity 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/18—Preparation of halogenated hydrocarbons by replacement by halogens of oxygen atoms of carbonyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US835394A US2972639A (en) | 1959-08-24 | 1959-08-24 | Process for the preparation of fluorohydrocarbons |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1132903B true DE1132903B (de) | 1962-07-12 |
Family
ID=25269402
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DER28591A Pending DE1132903B (de) | 1959-08-24 | 1960-08-22 | Verfahren zur Herstellung von Trifluor- bzw. Difluorkohlen-wasserstoffen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2972639A (show.php) |
| BE (1) | BE593279A (show.php) |
| DE (1) | DE1132903B (show.php) |
| FR (1) | FR1262509A (show.php) |
| GB (1) | GB965226A (show.php) |
| NL (1) | NL254901A (show.php) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4143078A (en) * | 1978-05-22 | 1979-03-06 | The Dow Chemical Company | Fluorination of methyl ketones |
| EP0127365A3 (en) * | 1983-05-20 | 1988-03-16 | Imperial Chemical Industries Plc | Heat pumps |
| US5789630A (en) * | 1996-02-27 | 1998-08-04 | University Of Iowa Research Foundation | Process for the synthesis of hexafluoropropanes |
| DE10121101A1 (de) * | 2001-04-27 | 2002-10-31 | Bayer Ag | Triazolopyrimidine |
| FR2864076B1 (fr) * | 2003-12-18 | 2006-02-10 | Rhodia Chimie Sa | Procede de fluorodesazotation |
| CN115490597B (zh) * | 2022-09-19 | 2023-10-20 | 西安近代化学研究所 | 一种氟代甲苯类衍生物的合成方法 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2859245A (en) * | 1956-11-14 | 1958-11-04 | Du Pont | Reaction of sf4 with organic compounds containing a carbonyl radical |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2471831A (en) * | 1947-03-12 | 1949-05-31 | Purdue Research Foundation | Bromine trifluoride treatment of halohydrocarbons |
| US2489970A (en) * | 1947-03-12 | 1949-11-29 | Purdue Research Foundation | Bromine trifluoride treatment of unsaturated organic compounds |
| US2702306A (en) * | 1948-09-10 | 1955-02-15 | Pennsylvania Salt Mfg Co | Production of organic fluorine compounds |
-
0
- NL NL254901D patent/NL254901A/xx unknown
-
1959
- 1959-08-24 US US835394A patent/US2972639A/en not_active Expired - Lifetime
-
1960
- 1960-07-18 FR FR833236A patent/FR1262509A/fr not_active Expired
- 1960-07-22 BE BE593279A patent/BE593279A/fr unknown
- 1960-08-22 DE DER28591A patent/DE1132903B/de active Pending
- 1960-08-24 GB GB29247/60A patent/GB965226A/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2859245A (en) * | 1956-11-14 | 1958-11-04 | Du Pont | Reaction of sf4 with organic compounds containing a carbonyl radical |
Also Published As
| Publication number | Publication date |
|---|---|
| US2972639A (en) | 1961-02-21 |
| FR1262509A (fr) | 1961-05-26 |
| GB965226A (en) | 1964-07-29 |
| BE593279A (fr) | 1961-01-23 |
| NL254901A (show.php) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69202207T2 (de) | Verfahren zur Herstellung von 1-Chlor-1,1,3,3,3-Pentafluorpropan und von 1,1,1,3,3,3-Hexafluorpropan. | |
| DE662450C (de) | Verfahren zur Herstellung von Fluorverbindungen aliphatischer Kohlenwasserstoffe oder deren Arylderivaten | |
| DE69837514T2 (de) | Verfahren zur Abtrennung von Fluorwasserstoff aus seinen Mischungen mit einem Fluorkohlenwasserstoff die 3 bis 6 Kohlenstoffatome enthält | |
| DE69404312T2 (de) | Verfahren zur herstellung von perfluoralkylsulfonylfluoriden | |
| EP0634383B1 (de) | Verfahren zur Addition von HF an halogenierte Alkene | |
| DE1910529B2 (de) | Verfahren zur katalytischen hydrofluorierung von bestimmten gesaettigten und ungesaettigten halogenierten kohlenwasserstoffen | |
| DE1292641C2 (de) | Verfahren zur herstellung von perfluoralkyljodiden | |
| DE1132903B (de) | Verfahren zur Herstellung von Trifluor- bzw. Difluorkohlen-wasserstoffen | |
| DE2453864C3 (de) | Kontinuierliches Verfahren zur Auftrennung von Gemischen aus Zirkoniumtetrachlorid und Hafniumtetrachlorid | |
| DE1917630A1 (de) | Verfahren zur Herstellung von fluorhaltigen Perhalogencarbonsaeurefluoriden oder -chloriden | |
| DE69303682T2 (de) | Verfahren zur Abtrennung von Fluorwasserstoff aus seinen Gemischen mit 1,1,1-Trifluor-2-chlorethan | |
| DE68902658T2 (de) | Verfahren zur herstellung von fluoroaromatischen verbindungen. | |
| DE950282C (de) | Verfahren zur Herstellung von Fluorkohlenstoffverbindungen | |
| DE1237084B (de) | Verfahren zur Herstellung von 1, 2-Dichlor-1, 1, 2, 3, 3, 3,-hexafluorpropan | |
| DE1567504B1 (de) | Verfahren zur Gewinnung bzw.Entfernung von Fluorwasserstoff aus Gasmischungen | |
| DE1117550B (de) | Verfahren zur Herstellung von Schwefelchloridpentafluorid | |
| DE69608327T2 (de) | Verfahren zur Hydrolyse von fluorierten Sulphonylfluorides | |
| JPS5581818A (en) | Method of fluorination | |
| DE969485C (de) | Verfahren zur Herstellung eines zur Acrylnitrilsynthese geeigneten, aus Acetylen undBlausaeure bestehenden Gasgemisches | |
| DE1108676B (de) | Verfahren zur Herstellung von 2-Brom-2-chlor-1, 1, 1-trifluoraethan | |
| DE1940290C (de) | Verfahren zur Abtrennung von Chlorwasserstoff aus einer gasformigen Mischung desselben mit Chlorcyan | |
| DE68906214T2 (de) | Fluorinierte alkoximine, deren n-chlor-und n-brom derivate sowie verfahren zur herstellung davon. | |
| DE1931640A1 (de) | Verfahren zur Herstellung von fluorierten Stickstoffheterozyklen | |
| DE1543925C (de) | Verfahren zur Herstellung von Thia cyclopropanen | |
| DE2313862A1 (de) | Verfahren zur herstellung von fluorierten aethern |