DE1119842B - Verfahren zur kontinuierlichen Herstellung von Benzol- oder Pyridincarbonsaeuren - Google Patents
Verfahren zur kontinuierlichen Herstellung von Benzol- oder PyridincarbonsaeurenInfo
- Publication number
- DE1119842B DE1119842B DEB56245A DEB0056245A DE1119842B DE 1119842 B DE1119842 B DE 1119842B DE B56245 A DEB56245 A DE B56245A DE B0056245 A DEB0056245 A DE B0056245A DE 1119842 B DE1119842 B DE 1119842B
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- nitric acid
- temperature
- oxidized
- tube
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 title claims description 12
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 title claims description 4
- 238000010924 continuous production Methods 0.000 title claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 48
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 30
- 229910017604 nitric acid Inorganic materials 0.000 claims description 30
- 239000007789 gas Substances 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 239000007795 chemical reaction product Substances 0.000 claims description 13
- 238000007254 oxidation reaction Methods 0.000 claims description 13
- 230000003647 oxidation Effects 0.000 claims description 12
- 238000010790 dilution Methods 0.000 claims description 9
- 239000012895 dilution Substances 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 150000001555 benzenes Chemical class 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 229910021645 metal ion Inorganic materials 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 150000003222 pyridines Chemical class 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims 2
- 229910001385 heavy metal Inorganic materials 0.000 claims 1
- 210000000003 hoof Anatomy 0.000 claims 1
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 12
- 239000007858 starting material Substances 0.000 description 8
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 150000001491 aromatic compounds Chemical class 0.000 description 4
- GPSDUZXPYCFOSQ-UHFFFAOYSA-N m-toluic acid Chemical compound CC1=CC=CC(C(O)=O)=C1 GPSDUZXPYCFOSQ-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000002360 explosive Substances 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- FKNQCJSGGFJEIZ-UHFFFAOYSA-N 4-methylpyridine Chemical compound CC1=CC=NC=C1 FKNQCJSGGFJEIZ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 2
- SQNZJJAZBFDUTD-UHFFFAOYSA-N durene Chemical compound CC1=CC(C)=C(C)C=C1C SQNZJJAZBFDUTD-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- ZNOKGRXACCSDPY-UHFFFAOYSA-N tungsten trioxide Chemical compound O=[W](=O)=O ZNOKGRXACCSDPY-UHFFFAOYSA-N 0.000 description 2
- OKIRBHVFJGXOIS-UHFFFAOYSA-N 1,2-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC=CC=C1C(C)C OKIRBHVFJGXOIS-UHFFFAOYSA-N 0.000 description 1
- FVHAWXWFPBPFOS-UHFFFAOYSA-N 1,2-dimethyl-3-nitrobenzene Chemical class CC1=CC=CC([N+]([O-])=O)=C1C FVHAWXWFPBPFOS-UHFFFAOYSA-N 0.000 description 1
- SPPWGCYEYAMHDT-UHFFFAOYSA-N 1,4-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC=C(C(C)C)C=C1 SPPWGCYEYAMHDT-UHFFFAOYSA-N 0.000 description 1
- NRGGMCIBEHEAIL-UHFFFAOYSA-N 2-ethylpyridine Chemical class CCC1=CC=CC=N1 NRGGMCIBEHEAIL-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- OTLNPYWUJOZPPA-UHFFFAOYSA-N 4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1 OTLNPYWUJOZPPA-UHFFFAOYSA-N 0.000 description 1
- ZPTVNYMJQHSSEA-UHFFFAOYSA-N 4-nitrotoluene Chemical compound CC1=CC=C([N+]([O-])=O)C=C1 ZPTVNYMJQHSSEA-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- -1 alkyl aromatic compound Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- XCJXQCUJXDUNDN-DIVXIXLHSA-N chlorden Chemical compound C12C=CCC2[C@@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)C2(Cl)Cl XCJXQCUJXDUNDN-DIVXIXLHSA-N 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229930007927 cymene Natural products 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910001987 mercury nitrate Inorganic materials 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- JKQOBWVOAYFWKG-UHFFFAOYSA-N molybdenum trioxide Inorganic materials O=[Mo](=O)=O JKQOBWVOAYFWKG-UHFFFAOYSA-N 0.000 description 1
- KBJMLQFLOWQJNF-UHFFFAOYSA-N nickel(ii) nitrate Chemical compound [Ni+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O KBJMLQFLOWQJNF-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- VLZLOWPYUQHHCG-UHFFFAOYSA-N nitromethylbenzene Chemical class [O-][N+](=O)CC1=CC=CC=C1 VLZLOWPYUQHHCG-UHFFFAOYSA-N 0.000 description 1
- DRXYRSRECMWYAV-UHFFFAOYSA-N nitrooxymercury Chemical compound [Hg+].[O-][N+]([O-])=O DRXYRSRECMWYAV-UHFFFAOYSA-N 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
- 125000006839 xylylene group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/803—Processes of preparation
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J14/00—Chemical processes in general for reacting liquids with liquids; Apparatus specially adapted therefor
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J19/00—Chemical, physical or physico-chemical processes in general; Their relevant apparatus
- B01J19/24—Stationary reactors without moving elements inside
- B01J19/2415—Tubular reactors
- B01J19/2435—Loop-type reactors
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/27—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with oxides of nitrogen or nitrogen-containing mineral acids
- C07C51/275—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with oxides of nitrogen or nitrogen-containing mineral acids of hydrocarbyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/50—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL277488D NL277488A (https=) | 1960-01-14 | ||
| NL260004D NL260004A (https=) | 1960-01-14 | ||
| DEB56245A DE1119842B (de) | 1960-01-14 | 1960-01-14 | Verfahren zur kontinuierlichen Herstellung von Benzol- oder Pyridincarbonsaeuren |
| GB1305/61A GB918969A (en) | 1960-01-14 | 1961-01-12 | Continuous process for the oxidation of organic compounds |
| FR849626A FR1277669A (fr) | 1960-01-14 | 1961-01-13 | Procédé en continu pour l'oxydation de composés organiques |
| DEB62224A DE1133714B (de) | 1960-01-14 | 1961-04-21 | Verfahren zur Oxydation von Benzolen oder Pyridinen |
| US188759A US3165548A (en) | 1960-01-14 | 1962-04-19 | Continuous process for the production of aromatic and heterocyclic carboxylic acids |
| FR895244A FR81719E (fr) | 1960-01-14 | 1962-04-20 | Procédé en continu pour l'oxydation de composés organiques |
| GB15470/62A GB951499A (en) | 1960-01-14 | 1962-04-24 | Continuous process for the oxidation of organic compounds |
| DE19621443435 DE1443435A1 (de) | 1960-01-14 | 1962-04-26 | Kontinuierliches Verfahren zu Oxydation aromatischer Verbindungen mit Salpetersaeure |
| US273723A US3271445A (en) | 1960-01-14 | 1963-04-17 | Nitric acid oxidation of benzene compounds containing oxidizable side chains |
| GB15892/63A GB974068A (en) | 1960-01-14 | 1963-04-23 | Continuous oxidation of aromatic compounds with nitric acid |
| FR932814A FR83536E (fr) | 1960-01-14 | 1963-04-26 | Procédé en continu pour l'oxydation de composés organiques |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB56245A DE1119842B (de) | 1960-01-14 | 1960-01-14 | Verfahren zur kontinuierlichen Herstellung von Benzol- oder Pyridincarbonsaeuren |
| DEB62224A DE1133714B (de) | 1960-01-14 | 1961-04-21 | Verfahren zur Oxydation von Benzolen oder Pyridinen |
| DEB0066985 | 1962-04-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1119842B true DE1119842B (de) | 1961-12-21 |
Family
ID=27209103
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB56245A Pending DE1119842B (de) | 1960-01-14 | 1960-01-14 | Verfahren zur kontinuierlichen Herstellung von Benzol- oder Pyridincarbonsaeuren |
| DEB62224A Pending DE1133714B (de) | 1960-01-14 | 1961-04-21 | Verfahren zur Oxydation von Benzolen oder Pyridinen |
| DE19621443435 Pending DE1443435A1 (de) | 1960-01-14 | 1962-04-26 | Kontinuierliches Verfahren zu Oxydation aromatischer Verbindungen mit Salpetersaeure |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB62224A Pending DE1133714B (de) | 1960-01-14 | 1961-04-21 | Verfahren zur Oxydation von Benzolen oder Pyridinen |
| DE19621443435 Pending DE1443435A1 (de) | 1960-01-14 | 1962-04-26 | Kontinuierliches Verfahren zu Oxydation aromatischer Verbindungen mit Salpetersaeure |
Country Status (4)
| Country | Link |
|---|---|
| US (2) | US3165548A (https=) |
| DE (3) | DE1119842B (https=) |
| GB (3) | GB918969A (https=) |
| NL (2) | NL277488A (https=) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL260004A (https=) * | 1960-01-14 | |||
| US3515748A (en) * | 1965-04-29 | 1970-06-02 | Marathon Oil Co | Preparation of aromatic carboxylic acids and nitro - substituted aromatic carboxylic acids |
| DE2966334D1 (en) * | 1979-09-26 | 1983-11-24 | Gulf Research Development Co | Preparation of a mixture of polycylic aromatic polycarboxylic acids soluble in acetone, but insoluble in water |
| DE3202736A1 (de) * | 1982-01-28 | 1983-08-04 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von chinolinmonocarbonsaeuren |
| DE3706792A1 (de) * | 1987-03-03 | 1988-09-15 | Basf Ag | Verfahren zur herstellung von 7-chlor-chinolin-8-carbonsaeure |
| DE3930167A1 (de) * | 1989-09-09 | 1991-03-14 | Basf Ag | Verfahren zur herstellung von 3-methylchinolin-8-carbonsaeure |
| US5939581A (en) * | 1997-08-20 | 1999-08-17 | First Chemical Corporation | Processes for preparing hydrocinnamic acid |
| FR2816615B1 (fr) * | 2000-11-13 | 2003-02-21 | Atofina | Procede de synthese de carboxy-2-anthraquinone par oxydation nitrique d'alkyl-2-anthraquinone |
| EP1795520A1 (de) * | 2005-12-08 | 2007-06-13 | Rütgers Chemicals GmbH | Verfahren zur Herstellung einer aromatischen Carbonsäure |
| US8946472B2 (en) | 2008-12-31 | 2015-02-03 | Sabic Innovative Plastics Ip B.V. | Bio-based terephthalate polyesters |
| GB2471701B (en) | 2009-07-09 | 2011-09-07 | Gary Butler | Golfing accessory time piece |
| USD774926S1 (en) | 2015-07-06 | 2016-12-27 | Gary Butler | Time-measuring instrument |
| EP4412980A4 (en) * | 2021-10-04 | 2025-12-24 | Council Scient Ind Res | CONTINUOUS FLOW REACTOR AND PROCESS FOR THE SYNTHESIS OF SUBSTITUTED BENZOIC ACID |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB405719A (en) * | 1932-08-22 | 1934-02-15 | Ig Farbenindustrie Ag | Improvements in the manufacture and production of acetic acid |
| GB698157A (en) * | 1950-10-12 | 1953-10-07 | Bofors Ab | Method of oxidizing organic compounds by nitric acid |
| GB720384A (en) * | 1951-05-28 | 1954-12-15 | Monsanto Chemicals | Process for the oxidation of xylenes |
| BE521093A (https=) * | 1952-07-01 | |||
| US2800504A (en) * | 1952-10-15 | 1957-07-23 | Distillers Co Yeast Ltd | Production of lower aliphatic acids |
| US2905688A (en) * | 1954-10-04 | 1959-09-22 | Abbott Lab | Continuous process for production of nicotinic acid |
| US3081307A (en) * | 1958-02-10 | 1963-03-12 | Souren Z Avedikian | Production of copper isocinchomeronate and isocinchomeronic acid |
| NL260004A (https=) * | 1960-01-14 |
-
0
- NL NL260004D patent/NL260004A/xx unknown
- NL NL277488D patent/NL277488A/xx unknown
-
1960
- 1960-01-14 DE DEB56245A patent/DE1119842B/de active Pending
-
1961
- 1961-01-12 GB GB1305/61A patent/GB918969A/en not_active Expired
- 1961-04-21 DE DEB62224A patent/DE1133714B/de active Pending
-
1962
- 1962-04-19 US US188759A patent/US3165548A/en not_active Expired - Lifetime
- 1962-04-24 GB GB15470/62A patent/GB951499A/en not_active Expired
- 1962-04-26 DE DE19621443435 patent/DE1443435A1/de active Pending
-
1963
- 1963-04-17 US US273723A patent/US3271445A/en not_active Expired - Lifetime
- 1963-04-23 GB GB15892/63A patent/GB974068A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB974068A (en) | 1964-11-04 |
| DE1443435A1 (de) | 1969-03-13 |
| DE1133714B (de) | 1962-07-26 |
| GB951499A (en) | 1964-03-04 |
| NL260004A (https=) | |
| GB918969A (en) | 1963-02-20 |
| US3271445A (en) | 1966-09-06 |
| US3165548A (en) | 1965-01-12 |
| NL277488A (https=) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69026590T2 (de) | Nitrierungsverfahren | |
| DE1119842B (de) | Verfahren zur kontinuierlichen Herstellung von Benzol- oder Pyridincarbonsaeuren | |
| DE3002829A1 (de) | Zweistufiges verfahren zur herstellung von acrylsaeure | |
| DE2611560A1 (de) | Verfahren zur ammonoxydation | |
| EP0675104B1 (de) | Verfahren zur adiabatischen Herstellung von Mononitrohalogenbenzolen | |
| DE69307555T2 (de) | Verfahren zur Verbesserung einer schonenden Oxidation | |
| DE2331082C3 (de) | Verfahren zur kontinuierlichen Oxydation von substituierten Benzolen oder Benzolderivaten mit Salpetersäure | |
| EP0137548B1 (de) | Verfahren zum Vermischen einer fein zerteilten Flüssigkeit mit einem Gas und Erzeugen einer explosiven Mischung | |
| DE1917279B2 (de) | Verfahren zur Herstellung eines vinylaromatischen Kohlenwasserstoffes durch katalytische Dehydrierung eines alkylierten aromatischen Kohlenwasserstoffes | |
| DE1814707A1 (de) | Verfahren zur Herstellung von Phthalsaeureanhydrid | |
| DE1238000B (de) | Verfahren zur kontinuierlichen Herstellung von gesättigten aliphatischen Dicarbonsäuren | |
| DE1443435B (de) | Verfahren zur kontinuierlichen Herstellung von Benzol- oder Pyridincarbonsäuren | |
| DE1224729B (de) | Verfahren zur kontinuierlichen Herstellung von aromatischen oder aromatisch-heterocyclischen Carbonsaeuren | |
| DE1173441B (de) | Verfahren zur Herstellung von Nitrosylchlorid | |
| DE1468787C3 (https=) | ||
| DE2509738C3 (de) | Verfahren zur kontinuierlichen Herstellung von 13-Dioxa-2,4-dithiacyclohexan-2,4-tetroxid Carbylsulfat | |
| CH649278A5 (de) | Verfahren zur kontinuierlichen bildung eines saeurefluorids aus kohlenmonoxid, wasserfreiem fluorwasserstoff und einem olefin. | |
| DE1793453C2 (de) | Verfahren zur Herstellung eines homogenen Gemisches aus dampfförmigem o-XyIoI und Luft | |
| DE60316968T2 (de) | Verfahren zur herstellung aromatischer dicarbonsäuren unter superkritischen bedingungen | |
| EP1273577B1 (de) | Verfahren zur Erzeugung von o-Xylol-Luft-Gemischen für die Phthalsäureanhydrid-Herstellung | |
| DE1046017B (de) | Verfahren zur Herstellung von aromatischen Carbonsaeuren | |
| AT205471B (de) | Verfahren zur Herstellung von Äthylenoxyd | |
| DE311051C (https=) | ||
| DE1240517B (de) | Verfahren zur Herstellung von ungesaettigten aliphatischen, aromatischen oder ungesaettigten heterocyclischen Aldehyden bzw. Dialdehyden | |
| DE1205966B (de) | Verfahren zur Herstellung von in Wasser schwer-loeslichen oder unloeslichen Cycloalkanonoximen |