DE1111394B - Verfahren zur Herstellung von Pfropfpolymerisaten - Google Patents
Verfahren zur Herstellung von PfropfpolymerisatenInfo
- Publication number
- DE1111394B DE1111394B DEF30229A DEF0030229A DE1111394B DE 1111394 B DE1111394 B DE 1111394B DE F30229 A DEF30229 A DE F30229A DE F0030229 A DEF0030229 A DE F0030229A DE 1111394 B DE1111394 B DE 1111394B
- Authority
- DE
- Germany
- Prior art keywords
- weight
- mixture
- acrylonitrile
- graft
- nitrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000578 graft copolymer Polymers 0.000 title claims description 25
- 238000000034 method Methods 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 239000000178 monomer Substances 0.000 claims description 43
- 229920001515 polyalkylene glycol Polymers 0.000 claims description 32
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 24
- 239000000203 mixture Substances 0.000 claims description 24
- 229920001223 polyethylene glycol Polymers 0.000 claims description 15
- 239000002202 Polyethylene glycol Substances 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- -1 ethylene, propylene Chemical group 0.000 claims description 10
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 10
- 229920001451 polypropylene glycol Polymers 0.000 claims description 8
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 238000007334 copolymerization reaction Methods 0.000 claims description 5
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 claims description 2
- 230000007717 exclusion Effects 0.000 claims description 2
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 229920000642 polymer Polymers 0.000 description 21
- 239000000243 solution Substances 0.000 description 17
- 239000000047 product Substances 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000012190 activator Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 238000010559 graft polymerization reaction Methods 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 6
- 238000006116 polymerization reaction Methods 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 5
- 239000000835 fiber Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 4
- 235000019400 benzoyl peroxide Nutrition 0.000 description 4
- 150000002334 glycols Chemical class 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 229920002239 polyacrylonitrile Polymers 0.000 description 4
- 229920003169 water-soluble polymer Polymers 0.000 description 4
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2,2'-azo-bis-isobutyronitrile Substances N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 3
- 150000001336 alkenes Chemical class 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 201000006747 infectious mononucleosis Diseases 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 2
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229920001748 polybutylene Polymers 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- GELKGHVAFRCJNA-UHFFFAOYSA-N 2,2-Dimethyloxirane Chemical compound CC1(C)CO1 GELKGHVAFRCJNA-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- FCYVWWWTHPPJII-UHFFFAOYSA-N 2-methylidenepropanedinitrile Chemical compound N#CC(=C)C#N FCYVWWWTHPPJII-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- 238000012935 Averaging Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- 229920000265 Polyparaphenylene Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 244000028419 Styrax benzoin Species 0.000 description 1
- 235000000126 Styrax benzoin Nutrition 0.000 description 1
- 235000008411 Sumatra benzointree Nutrition 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical class C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 229920006322 acrylamide copolymer Polymers 0.000 description 1
- 150000003926 acrylamides Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 229920005601 base polymer Polymers 0.000 description 1
- 229960002130 benzoin Drugs 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000007380 fibre production Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 235000019382 gum benzoic Nutrition 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- ARQTVSWBVIWYSF-UHFFFAOYSA-N prop-2-enamide;prop-2-enenitrile Chemical compound C=CC#N.NC(=O)C=C ARQTVSWBVIWYSF-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F283/00—Macromolecular compounds obtained by polymerising monomers on to polymers provided for in subclass C08G
- C08F283/06—Macromolecular compounds obtained by polymerising monomers on to polymers provided for in subclass C08G on to polyethers, polyoxymethylenes or polyacetals
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Graft Or Block Polymers (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL259615D NL259615A (en:Method) | 1960-01-05 | ||
| BE598847D BE598847A (en:Method) | 1960-01-05 | ||
| DEF30229A DE1111394B (de) | 1960-01-05 | 1960-01-05 | Verfahren zur Herstellung von Pfropfpolymerisaten |
| CH2461A CH438738A (de) | 1960-01-05 | 1961-01-03 | Verfahren zur Herstellung von stickstoffhaltigen Pfropfpolymerisaten |
| SE8761A SE305323B (en:Method) | 1960-01-05 | 1961-01-04 | |
| GB56761A GB969965A (en) | 1960-01-05 | 1961-01-05 | Process for the manufacture of graft copolymers |
| FR848898A FR1277220A (fr) | 1960-01-05 | 1961-01-05 | Procédé de préparation de polymères greffés |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF30229A DE1111394B (de) | 1960-01-05 | 1960-01-05 | Verfahren zur Herstellung von Pfropfpolymerisaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1111394B true DE1111394B (de) | 1961-07-20 |
Family
ID=37056983
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF30229A Pending DE1111394B (de) | 1960-01-05 | 1960-01-05 | Verfahren zur Herstellung von Pfropfpolymerisaten |
Country Status (7)
| Country | Link |
|---|---|
| BE (1) | BE598847A (en:Method) |
| CH (1) | CH438738A (en:Method) |
| DE (1) | DE1111394B (en:Method) |
| FR (1) | FR1277220A (en:Method) |
| GB (1) | GB969965A (en:Method) |
| NL (1) | NL259615A (en:Method) |
| SE (1) | SE305323B (en:Method) |
Cited By (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3321554A (en) * | 1960-10-04 | 1967-05-23 | Hoechst Ag | Modified polymers of 1, 2-epoxyhydrocarbons and process for their manufacture |
| EP0111454A1 (de) * | 1982-12-14 | 1984-06-20 | Ciba-Geigy Ag | Verfahren zum Klotzfärben von Cellulose-Textilmaterialien |
| EP0755968A2 (de) | 1995-07-25 | 1997-01-29 | Basf Aktiengesellschaft | Verfahren zur Herstellung von Hartschaumstoffen auf Isocyanatbasis |
| EP0757068A1 (de) | 1995-08-03 | 1997-02-05 | BASF Aktiengesellschaft | Flammgeschützte Hartschaumstoffe auf Isocyanatbasis |
| WO2003106522A1 (de) * | 2002-06-13 | 2003-12-24 | Basf Aktiengesellschaft | Polyoxyalkylen-substituierte alkylendiamine und deren verwendung in kosmetischen formulierungen |
| DE102007061883A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Viskoelastischer Polyurethanschaumstoff |
| EP2088166A1 (de) | 2008-02-06 | 2009-08-12 | Evonik Goldschmidt GmbH | Neuartige Kompatibilisierungsmittel zur Verbesserung der Lagerstabilität von Polyolmischungen |
| WO2010079155A1 (de) | 2009-01-12 | 2010-07-15 | Basf Se | Hochelastische polyurethanweichschaumstoffe |
| EP2226344A1 (de) | 2009-03-02 | 2010-09-08 | Basf Se | Abriebbeständiger Polyurethanformkörper mit verbesserten Dauerbiegeeigenschaften |
| WO2011092232A1 (en) | 2010-02-01 | 2011-08-04 | Basf Se | Derivatives of diphosphines as flame retardants for polyurethanes |
| WO2011141266A1 (de) | 2010-04-15 | 2011-11-17 | Basf Se | Verfahren zur herstellung von flammgeschützten polyurethan-schaumstoffen |
| WO2012007418A1 (de) | 2010-07-13 | 2012-01-19 | Bayer Materialscience Ag | Schwach modifizierte präpolymere und ihre anwendungen |
| DE102010027052A1 (de) | 2010-07-13 | 2012-01-19 | Bayer Materialscience Ag | Verfahren zur Herstellung von isocyanatgruppenhaltigen Polyurethan-Präpolymeren |
| US8106121B2 (en) | 2002-03-15 | 2012-01-31 | Basf Aktiengesellschaft | Graft polyols with a bimodal particle size distribution and method for producing graft polyols of this type, in addition to the use thereof for producing polyurethanes |
| WO2012065962A1 (de) | 2010-11-16 | 2012-05-24 | Basf Se | Dimensionsstabile polyurethanformkörper mit geringer dichte |
| EP2465657A1 (de) | 2010-12-16 | 2012-06-20 | Basf Se | Verfahren zur Herstellung niederdichter Polyurethanformkörper |
| EP2492297A1 (de) | 2011-02-23 | 2012-08-29 | Basf Se | Polyesterpolyole auf Basis aromatischer Dicarbonsäuren und daraus hergestellte Polyurethanhartschäume |
| DE102011050220A1 (de) | 2011-05-09 | 2012-11-15 | Bayer Materialscience Aktiengesellschaft | Schwach modifizierte Präpolymere und ihre Anwendungen |
| WO2012160024A1 (de) | 2011-05-26 | 2012-11-29 | Basf Se | Hochelastische polyurethanschaumstoffe, enthaltend ricinusöl |
| EP2602023A1 (de) | 2011-12-07 | 2013-06-12 | Basf Se | Katalysatorkombination zur Herstellung von Polyurethanschaumstoffformkörpern |
| WO2013107717A1 (de) | 2012-01-18 | 2013-07-25 | Basf Se | Niedrigdichte polyurethanschuhsohlen oder sohlenteile mit hohen rückprallelastizitäten und niedrigem druckverformungsrest |
| WO2013127647A1 (de) | 2012-03-01 | 2013-09-06 | Basf Se | Polyetheresterpolyole und ihre verwendung zur herstellung von polyurethan-hartschaumstoffen |
| EP2690118A1 (de) | 2012-07-27 | 2014-01-29 | Basf Se | Polyurethane enthaltend Phosphorverbindungen |
| WO2014040824A1 (de) | 2012-09-13 | 2014-03-20 | Basf Se | Polyurethane enthaltend halogenverbindungen |
| EP2730596A1 (de) | 2012-11-13 | 2014-05-14 | Basf Se | Polyurethanweichschaumstoffe enthaltend Pflanzensamen |
| US8759411B2 (en) | 2010-02-01 | 2014-06-24 | Basf Se | Derivatives of diphosphines as flame retardants for polyurethanes |
| EP2746309A1 (de) | 2012-12-19 | 2014-06-25 | Basf Se | Hydrolysebeständige Polyurethanformkörper aus Polyesterpolyurethan |
| EP2799459A1 (de) | 2013-05-03 | 2014-11-05 | Basf Se | Polyurethane enthaltend Halogenverbindungen |
| EP2818489A1 (de) | 2013-06-28 | 2014-12-31 | Basf Se | Hydrolysebeständige Polyurethanformkörper |
| WO2015067749A1 (en) | 2013-11-08 | 2015-05-14 | Basf Se | Polyurethane sealant |
| US9062158B2 (en) | 2010-12-02 | 2015-06-23 | Basf Se | Polyester polyols based on aromatic dicarboxylic acids |
| WO2016166008A1 (de) | 2015-04-17 | 2016-10-20 | Basf Se | Polyurethane mit reduzierter aldehydemission |
| WO2017194341A1 (de) | 2016-05-12 | 2017-11-16 | Basf Se | Viskoelastische schaumstoffe mit hoher dichte |
| WO2017194340A1 (de) | 2016-05-12 | 2017-11-16 | Basf Se | Klebefreier polyurethanweichschaumstoff |
| WO2017216209A1 (en) | 2016-06-15 | 2017-12-21 | Basf Se | Polyamide dispersion in polyol and preparation thereof |
| DE102005063376B4 (de) | 2005-11-26 | 2018-10-11 | Tougas Oilfield Solutions Gmbh | Pfropfcopolymere und deren Verwendung |
| WO2019007937A1 (de) | 2017-07-05 | 2019-01-10 | Basf Se | Schwefelhaltige polyesterpolyole, deren herstellung und verwendung |
| WO2019053143A1 (en) | 2017-09-13 | 2019-03-21 | Basf Se | POLYURETHANE AND MELAMINE THERAPEUTIC MOUSES BY TRIAXIAL COMPRESSION |
| WO2021122177A1 (en) | 2019-12-17 | 2021-06-24 | Basf Se | A flexible foaming process for producing thermally insulated articles |
| WO2021229044A1 (en) | 2020-05-14 | 2021-11-18 | Basf Se | Electrically dissipative polyurethane foams and use thereof in trench breakers or pipeline pillows |
| WO2021259832A1 (en) | 2020-06-22 | 2021-12-30 | Basf Se | Viscoelastic elastomeric polyurethane foams, process for preparing them and use thereof |
| WO2022018292A1 (en) | 2020-07-24 | 2022-01-27 | Basf Se | Multilayered structure and a process for preparing the same |
| WO2023036801A1 (en) | 2021-09-07 | 2023-03-16 | Basf Se | Ionic monomer- based polyurethane foams and use thereof in trench breakers or pipeline pillows or thermally insulative material |
| WO2026013025A1 (en) | 2024-07-12 | 2026-01-15 | Basf Se | Lignin-based polyols and a process for the preparation thereof |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1077641A (en) * | 1974-08-28 | 1980-05-13 | Donald W. Simroth | Polymer/polyols and process for production thereof |
| EP0364399A3 (de) * | 1988-10-03 | 1992-04-29 | Ciba-Geigy Ag | Wasserlösliche oder in Wasser dispergierbare Mischpolymerisate, deren Herstellung und Verwendung |
| CA1318054C (en) * | 1988-10-03 | 1993-05-18 | Hans-Ulrich Berendt | Graft polymers which are water-soluble or dispersible in water, their preparation and use |
| DE4440212A1 (de) * | 1994-11-10 | 1996-05-15 | Basf Schwarzheide Gmbh | Verfahren zur Herstellung von zelligen Polyurethanen |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1081230A (en) * | 1913-01-07 | 1913-12-09 | Howard Hunt Pen Company C | Pen-making machine. |
-
0
- BE BE598847D patent/BE598847A/xx unknown
- NL NL259615D patent/NL259615A/xx unknown
-
1960
- 1960-01-05 DE DEF30229A patent/DE1111394B/de active Pending
-
1961
- 1961-01-03 CH CH2461A patent/CH438738A/de unknown
- 1961-01-04 SE SE8761A patent/SE305323B/xx unknown
- 1961-01-05 GB GB56761A patent/GB969965A/en not_active Expired
- 1961-01-05 FR FR848898A patent/FR1277220A/fr not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1081230A (en) * | 1913-01-07 | 1913-12-09 | Howard Hunt Pen Company C | Pen-making machine. |
Cited By (57)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3321554A (en) * | 1960-10-04 | 1967-05-23 | Hoechst Ag | Modified polymers of 1, 2-epoxyhydrocarbons and process for their manufacture |
| EP0111454A1 (de) * | 1982-12-14 | 1984-06-20 | Ciba-Geigy Ag | Verfahren zum Klotzfärben von Cellulose-Textilmaterialien |
| EP0755968A2 (de) | 1995-07-25 | 1997-01-29 | Basf Aktiengesellschaft | Verfahren zur Herstellung von Hartschaumstoffen auf Isocyanatbasis |
| EP0757068A1 (de) | 1995-08-03 | 1997-02-05 | BASF Aktiengesellschaft | Flammgeschützte Hartschaumstoffe auf Isocyanatbasis |
| US8106121B2 (en) | 2002-03-15 | 2012-01-31 | Basf Aktiengesellschaft | Graft polyols with a bimodal particle size distribution and method for producing graft polyols of this type, in addition to the use thereof for producing polyurethanes |
| WO2003106522A1 (de) * | 2002-06-13 | 2003-12-24 | Basf Aktiengesellschaft | Polyoxyalkylen-substituierte alkylendiamine und deren verwendung in kosmetischen formulierungen |
| DE102005063376B4 (de) | 2005-11-26 | 2018-10-11 | Tougas Oilfield Solutions Gmbh | Pfropfcopolymere und deren Verwendung |
| DE102007061883A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Viskoelastischer Polyurethanschaumstoff |
| US8318823B2 (en) | 2007-12-20 | 2012-11-27 | Bayer Materialscience Ag | Visco-elastic polyurethane foam |
| DE102008000243A1 (de) | 2008-02-06 | 2009-08-13 | Evonik Goldschmidt Gmbh | Neuartige Kompatibilisierungsmittel zur Verbesserung der Lagerstabilität von Polyolmischungen |
| EP2088166A1 (de) | 2008-02-06 | 2009-08-12 | Evonik Goldschmidt GmbH | Neuartige Kompatibilisierungsmittel zur Verbesserung der Lagerstabilität von Polyolmischungen |
| WO2010079155A1 (de) | 2009-01-12 | 2010-07-15 | Basf Se | Hochelastische polyurethanweichschaumstoffe |
| EP2226344A1 (de) | 2009-03-02 | 2010-09-08 | Basf Se | Abriebbeständiger Polyurethanformkörper mit verbesserten Dauerbiegeeigenschaften |
| WO2011092232A1 (en) | 2010-02-01 | 2011-08-04 | Basf Se | Derivatives of diphosphines as flame retardants for polyurethanes |
| US8759411B2 (en) | 2010-02-01 | 2014-06-24 | Basf Se | Derivatives of diphosphines as flame retardants for polyurethanes |
| WO2011141266A1 (de) | 2010-04-15 | 2011-11-17 | Basf Se | Verfahren zur herstellung von flammgeschützten polyurethan-schaumstoffen |
| WO2012007418A1 (de) | 2010-07-13 | 2012-01-19 | Bayer Materialscience Ag | Schwach modifizierte präpolymere und ihre anwendungen |
| DE102010027052A1 (de) | 2010-07-13 | 2012-01-19 | Bayer Materialscience Ag | Verfahren zur Herstellung von isocyanatgruppenhaltigen Polyurethan-Präpolymeren |
| WO2012007419A1 (de) | 2010-07-13 | 2012-01-19 | Bayer Materialscience Ag | Verfahren zur herstellung von isocyanatgruppenhaltigen polyurethan-präpolymeren |
| US8835591B2 (en) | 2010-07-13 | 2014-09-16 | Bayer Intellectual Property Gmbh | Method for preparing polyurethane prepolymers containing isocyanate groups |
| WO2012065962A1 (de) | 2010-11-16 | 2012-05-24 | Basf Se | Dimensionsstabile polyurethanformkörper mit geringer dichte |
| US9062158B2 (en) | 2010-12-02 | 2015-06-23 | Basf Se | Polyester polyols based on aromatic dicarboxylic acids |
| EP2465657A1 (de) | 2010-12-16 | 2012-06-20 | Basf Se | Verfahren zur Herstellung niederdichter Polyurethanformkörper |
| WO2012113737A1 (de) | 2011-02-23 | 2012-08-30 | Basf Se | Polyesterpolyole auf basis aromatischer dicarbonsäuren und daraus hergestellte polyurethanhartschäume |
| EP2492297A1 (de) | 2011-02-23 | 2012-08-29 | Basf Se | Polyesterpolyole auf Basis aromatischer Dicarbonsäuren und daraus hergestellte Polyurethanhartschäume |
| DE102011050220A1 (de) | 2011-05-09 | 2012-11-15 | Bayer Materialscience Aktiengesellschaft | Schwach modifizierte Präpolymere und ihre Anwendungen |
| WO2012160024A1 (de) | 2011-05-26 | 2012-11-29 | Basf Se | Hochelastische polyurethanschaumstoffe, enthaltend ricinusöl |
| EP2602023A1 (de) | 2011-12-07 | 2013-06-12 | Basf Se | Katalysatorkombination zur Herstellung von Polyurethanschaumstoffformkörpern |
| WO2013107717A1 (de) | 2012-01-18 | 2013-07-25 | Basf Se | Niedrigdichte polyurethanschuhsohlen oder sohlenteile mit hohen rückprallelastizitäten und niedrigem druckverformungsrest |
| WO2013127647A1 (de) | 2012-03-01 | 2013-09-06 | Basf Se | Polyetheresterpolyole und ihre verwendung zur herstellung von polyurethan-hartschaumstoffen |
| EP2690118A1 (de) | 2012-07-27 | 2014-01-29 | Basf Se | Polyurethane enthaltend Phosphorverbindungen |
| WO2014016167A1 (de) | 2012-07-27 | 2014-01-30 | Basf Se | Polyurethanschaumstoffe enthaltend phosphorverbindungen |
| WO2014040824A1 (de) | 2012-09-13 | 2014-03-20 | Basf Se | Polyurethane enthaltend halogenverbindungen |
| WO2014076077A1 (de) | 2012-11-13 | 2014-05-22 | Basf Se | Polyurethanweichschaumstoffe enthaltend pflanzensamen |
| EP2730596A1 (de) | 2012-11-13 | 2014-05-14 | Basf Se | Polyurethanweichschaumstoffe enthaltend Pflanzensamen |
| EP2746309A1 (de) | 2012-12-19 | 2014-06-25 | Basf Se | Hydrolysebeständige Polyurethanformkörper aus Polyesterpolyurethan |
| WO2014095438A1 (de) | 2012-12-19 | 2014-06-26 | Basf Se | Hydrolysebeständige polyurethanformkörper aus polyesterpolyurethan |
| EP2799459A1 (de) | 2013-05-03 | 2014-11-05 | Basf Se | Polyurethane enthaltend Halogenverbindungen |
| EP2818489A1 (de) | 2013-06-28 | 2014-12-31 | Basf Se | Hydrolysebeständige Polyurethanformkörper |
| WO2015067749A1 (en) | 2013-11-08 | 2015-05-14 | Basf Se | Polyurethane sealant |
| WO2016166008A1 (de) | 2015-04-17 | 2016-10-20 | Basf Se | Polyurethane mit reduzierter aldehydemission |
| US10927212B2 (en) | 2016-05-12 | 2021-02-23 | Basf Se | Viscoelastic foams having high density |
| WO2017194341A1 (de) | 2016-05-12 | 2017-11-16 | Basf Se | Viskoelastische schaumstoffe mit hoher dichte |
| WO2017194340A1 (de) | 2016-05-12 | 2017-11-16 | Basf Se | Klebefreier polyurethanweichschaumstoff |
| WO2017216209A1 (en) | 2016-06-15 | 2017-12-21 | Basf Se | Polyamide dispersion in polyol and preparation thereof |
| US11578167B2 (en) | 2017-07-05 | 2023-02-14 | Basf Se | Sulphur-containing polyester polyols, their production and use |
| WO2019007937A1 (de) | 2017-07-05 | 2019-01-10 | Basf Se | Schwefelhaltige polyesterpolyole, deren herstellung und verwendung |
| WO2019053143A1 (en) | 2017-09-13 | 2019-03-21 | Basf Se | POLYURETHANE AND MELAMINE THERAPEUTIC MOUSES BY TRIAXIAL COMPRESSION |
| US11759983B2 (en) | 2017-09-13 | 2023-09-19 | Basf Se | Auxetic polyurethane and melamine foams by triaxial compression |
| WO2021122177A1 (en) | 2019-12-17 | 2021-06-24 | Basf Se | A flexible foaming process for producing thermally insulated articles |
| US11772309B2 (en) | 2019-12-17 | 2023-10-03 | Basf Se | Flexible foaming process for producing thermally insulated articles |
| WO2021229044A1 (en) | 2020-05-14 | 2021-11-18 | Basf Se | Electrically dissipative polyurethane foams and use thereof in trench breakers or pipeline pillows |
| WO2021259832A1 (en) | 2020-06-22 | 2021-12-30 | Basf Se | Viscoelastic elastomeric polyurethane foams, process for preparing them and use thereof |
| US12552894B2 (en) | 2020-06-22 | 2026-02-17 | Basf Se | Viscoelastic elastomeric polyurethane foams, process for preparing them and use thereof |
| WO2022018292A1 (en) | 2020-07-24 | 2022-01-27 | Basf Se | Multilayered structure and a process for preparing the same |
| WO2023036801A1 (en) | 2021-09-07 | 2023-03-16 | Basf Se | Ionic monomer- based polyurethane foams and use thereof in trench breakers or pipeline pillows or thermally insulative material |
| WO2026013025A1 (en) | 2024-07-12 | 2026-01-15 | Basf Se | Lignin-based polyols and a process for the preparation thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| SE305323B (en:Method) | 1968-10-21 |
| FR1277220A (fr) | 1961-11-24 |
| GB969965A (en) | 1964-09-16 |
| CH438738A (de) | 1967-06-30 |
| BE598847A (en:Method) | |
| NL259615A (en:Method) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1111394B (de) | Verfahren zur Herstellung von Pfropfpolymerisaten | |
| DE2552614C3 (de) | Verfahren zur partiellen alkalischen Hydrolyse von vorwiegend Acrylnitril enthaltenden Polymerisaten sowie die Verwendung der Hydrolysate | |
| DE1077430B (de) | Verfahren zur Herstellung von Pfropfpolymerisaten von Polyvinylestern | |
| DE1221018B (de) | Verfahren zur Herstellung von Mischpolymerisaten mit selbstvernetzbaren Eigenschaften in Dispersion | |
| DE1135173B (de) | Verfahren zum Polymerisieren von monomeren Ausgangsstoffen | |
| EP0345552B1 (de) | Perfluoralkylgruppen enthaltende Copolymerisate | |
| DE1520728C3 (de) | Verfahren zur Herstellung wäßriger Polyäthylendispersionen | |
| DE1162567B (de) | Verfahren zur Herstellung von Polymeren und Mischpolymeren von Ureidoalkylvinylaethern | |
| DE1595846B2 (de) | Verfahren zur herstellung von vinylchloridpolymerisaten | |
| DE3049178A1 (de) | "verfahren zum verdicken von waessrigen systemen" | |
| DE2759639C2 (en:Method) | ||
| DE1195050B (de) | Verfahren zur Herstellung von wasserloeslichen Mischpolymerisaten | |
| DE1795498C3 (de) | Verfahren zur Herstellung von Acetaten des Allylalkohol | |
| DE964902C (de) | Verfahren zur Herstellung von wasserloeslichen Mischpolymerisaten aus Acrylsaeure- und Methacrylsaeureamid in waessriger Loesung | |
| DE1182828B (de) | Verfahren zur Herstellung wasserloeslicher Copolymerisate | |
| DE1809742A1 (de) | Verfahren zur Herstellung waessriger Emulsionen eines willkuerlich verteilten Copolymeren aus den Monomeren Vinylacetat und Acrylamid | |
| DE1088717B (de) | Verfahren zur Herstellung modifizierter Polyvinylalkohole | |
| DE1006159B (de) | Verfahren zur Suspensions-Polymerisierung von Vinylmonomeren | |
| DE2214945A1 (de) | Neue, als Verdickungsmittel geeignete, in Pulverform vorliegende vernetzte carboxylische Mischpolymerisate und Verfahren zu deren Herstellung | |
| DE1122256B (de) | Verfahren zur Herstellung von Polymerisaten und Mischpolymerisaten basischer Vinylverbindungen | |
| DE1214404B (de) | Verfahren zur Herstellung modifizierter Polyvinylalkohole | |
| EP0469429A2 (de) | Wässrige Klebstofflösungen ohne organisches Lösungsmittel | |
| DE917812C (de) | Verfahren zur Herstellung von Polyacrylnitrilverbindungen mit basischen Gruppen im Molekuel | |
| DE1720614A1 (de) | Verfahren zur Herstellung von Acrylnitrilpolymerisaten | |
| DE3339068C2 (de) | Verfahren zur Herstellung von Polymerisaten mit seitenständig gebundenen Polyoxyalkylenketten und deren Verwendung zur Herstellung von Polyurethanen |