DE1103309B - Verfahren zur Herstellung von Peroxymonosulfaten - Google Patents
Verfahren zur Herstellung von PeroxymonosulfatenInfo
- Publication number
- DE1103309B DE1103309B DEF29594A DEF0029594A DE1103309B DE 1103309 B DE1103309 B DE 1103309B DE F29594 A DEF29594 A DE F29594A DE F0029594 A DEF0029594 A DE F0029594A DE 1103309 B DE1103309 B DE 1103309B
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- acid
- hydrogen peroxide
- peroxydisulfate
- peroxymonosulfate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 21
- 238000004519 manufacturing process Methods 0.000 title description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 50
- 238000006243 chemical reaction Methods 0.000 claims description 40
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 27
- 239000000203 mixture Substances 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 14
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 claims description 12
- FHHJDRFHHWUPDG-UHFFFAOYSA-L peroxysulfate(2-) Chemical compound [O-]OS([O-])(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-L 0.000 claims description 9
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 4
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims 1
- 125000004334 oxygen containing inorganic group Chemical group 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 claims 1
- 239000011734 sodium Substances 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 16
- 239000001301 oxygen Substances 0.000 description 16
- 229910052760 oxygen Inorganic materials 0.000 description 16
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 10
- 235000019394 potassium persulphate Nutrition 0.000 description 9
- FHHJDRFHHWUPDG-UHFFFAOYSA-N peroxysulfuric acid Chemical compound OOS(O)(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-N 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 150000002978 peroxides Chemical class 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- VFNGKCDDZUSWLR-UHFFFAOYSA-L disulfate(2-) Chemical compound [O-]S(=O)(=O)OS([O-])(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-L 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 239000012425 OXONE® Substances 0.000 description 3
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 3
- ROMMGAXYKUBOCB-UHFFFAOYSA-L calcium;sulfonatooxy sulfate Chemical compound [Ca+2].[O-]S(=O)(=O)OOS([O-])(=O)=O ROMMGAXYKUBOCB-UHFFFAOYSA-L 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- SLFDFAKAAIOMLH-UHFFFAOYSA-L magnesium;sulfonatooxy sulfate Chemical compound [Mg+2].[O-]S(=O)(=O)OOS([O-])(=O)=O SLFDFAKAAIOMLH-UHFFFAOYSA-L 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- OKBMCNHOEMXPTM-UHFFFAOYSA-M potassium peroxymonosulfate Chemical compound [K+].OOS([O-])(=O)=O OKBMCNHOEMXPTM-UHFFFAOYSA-M 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PJXJBEGSQLZVRC-UHFFFAOYSA-L S(=O)(=O)([O-])O[O-].[Ca+2] Chemical compound S(=O)(=O)([O-])O[O-].[Ca+2] PJXJBEGSQLZVRC-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- YMGGAHMANIOXGP-UHFFFAOYSA-L disodium;oxido sulfate Chemical compound [Na+].[Na+].[O-]OS([O-])(=O)=O YMGGAHMANIOXGP-UHFFFAOYSA-L 0.000 description 2
- 238000005868 electrolysis reaction Methods 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 2
- 150000004976 peroxydisulfates Chemical class 0.000 description 2
- JRKICGRDRMAZLK-UHFFFAOYSA-N peroxydisulfuric acid Chemical compound OS(=O)(=O)OOS(O)(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-N 0.000 description 2
- -1 peroxymonosulfate salt Cations Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CRUOHKRQFQRBIH-UHFFFAOYSA-L S(=O)(=O)([O-])O[O-].[Mg+2] Chemical compound S(=O)(=O)([O-])O[O-].[Mg+2] CRUOHKRQFQRBIH-UHFFFAOYSA-L 0.000 description 1
- KBTJYNAFUYTSNN-UHFFFAOYSA-N [Na].OO Chemical compound [Na].OO KBTJYNAFUYTSNN-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 239000012491 analyte Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- JZBWUTVDIDNCMW-UHFFFAOYSA-L dipotassium;oxido sulfate Chemical compound [K+].[K+].[O-]OS([O-])(=O)=O JZBWUTVDIDNCMW-UHFFFAOYSA-L 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- VFNGKCDDZUSWLR-UHFFFAOYSA-N disulfuric acid Chemical compound OS(=O)(=O)OS(O)(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- QOSATHPSBFQAML-UHFFFAOYSA-N hydrogen peroxide;hydrate Chemical compound O.OO QOSATHPSBFQAML-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- YPPFWRWCZNXINO-UHFFFAOYSA-N methyl 1-hydroxy-6-phenyl-4-(trifluoromethyl)indole-2-carboxylate Chemical compound C1=C2N(O)C(C(=O)OC)=CC2=C(C(F)(F)F)C=C1C1=CC=CC=C1 YPPFWRWCZNXINO-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- LACHTKPTWJUZBJ-UHFFFAOYSA-N sulfo hydrogen sulfate;hydrate Chemical compound O.OS(=O)(=O)OS(O)(=O)=O LACHTKPTWJUZBJ-UHFFFAOYSA-N 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/055—Peroxyhydrates; Peroxyacids or salts thereof
- C01B15/06—Peroxyhydrates; Peroxyacids or salts thereof containing sulfur
- C01B15/08—Peroxysulfates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US767274A US2955020A (en) | 1958-10-15 | 1958-10-15 | Method of preparing monopersulfates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1103309B true DE1103309B (de) | 1961-03-30 |
Family
ID=25078996
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF29594A Pending DE1103309B (de) | 1958-10-15 | 1959-10-13 | Verfahren zur Herstellung von Peroxymonosulfaten |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2955020A (enExample) |
| CH (1) | CH409892A (enExample) |
| DE (1) | DE1103309B (enExample) |
| FR (1) | FR1238576A (enExample) |
| GB (1) | GB891094A (enExample) |
| NL (2) | NL244297A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1127878B (de) | 1958-11-15 | 1962-04-19 | Degussa | Verfahren zur Herstellung von Kalium- oder Ammoniumsalzen der Caroschen Saeure |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3036885A (en) * | 1958-11-15 | 1962-05-29 | Degussa | Process for the production of caro's acid salts and solutions thereof |
| NL268606A (enExample) * | 1960-09-12 | |||
| US4049786A (en) * | 1976-09-13 | 1977-09-20 | Fmc Corporation | Process of preparing peroxymonosulfate |
| US4756800A (en) * | 1986-09-03 | 1988-07-12 | The United States Of America As Represented By The Secretary Of Agriculture | Method for producing salts of monoperoxysulfuric acid and simultaneously bleaching pulp |
| DE102013010950B4 (de) | 2012-06-28 | 2016-09-01 | Hochschule Anhalt | Elektrolysezelle und Verfahren zur elektrolytischen Erzeugung von Chlordioxid |
| DE102014014188A1 (de) | 2014-09-24 | 2016-03-24 | Hochschule Anhalt (Fh) | Verfahren zur chemischen Erzeugung von Chlordioxid aus Chloritionen und Ozon |
-
0
- NL NL102864D patent/NL102864C/xx active
- NL NL244297D patent/NL244297A/xx unknown
-
1958
- 1958-10-15 US US767274A patent/US2955020A/en not_active Expired - Lifetime
-
1959
- 1959-10-03 FR FR806705A patent/FR1238576A/fr not_active Expired
- 1959-10-07 GB GB33919/59A patent/GB891094A/en not_active Expired
- 1959-10-13 DE DEF29594A patent/DE1103309B/de active Pending
- 1959-10-14 CH CH7939259A patent/CH409892A/de unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1127878B (de) | 1958-11-15 | 1962-04-19 | Degussa | Verfahren zur Herstellung von Kalium- oder Ammoniumsalzen der Caroschen Saeure |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1238576A (fr) | 1960-08-12 |
| GB891094A (en) | 1962-03-07 |
| US2955020A (en) | 1960-10-04 |
| CH409892A (de) | 1966-03-31 |
| NL102864C (enExample) | |
| NL244297A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69409694T2 (de) | Verfahren zur kontinuierlichen Herstellung von Chlordioxid | |
| DE1049832B (de) | Verfahren zur Herstellung von Peroxymonoschwefelsäure | |
| DE1103309B (de) | Verfahren zur Herstellung von Peroxymonosulfaten | |
| DE2529654A1 (de) | Verfahren zur herstellung von dimethylsulfoxid | |
| DE19503900C1 (de) | Verfahren zur Herstellung des Kaliumperoxomonosulfat-Tripelsalzes 2 KHSO¶5¶ . KHSO¶4¶ . K¶2¶SO¶4¶ | |
| DE1097419B (de) | Verfahren zur Herstellung von Alkalipersulfaten | |
| DE1054076B (de) | Verfahren zur Herstellung von Chlordioxyd | |
| DE3427119A1 (de) | Verfahren zur herstellung von kaliumpermonosulfat-tripelsalz | |
| DE1124929B (de) | Verfahren zur Herstellung von Peroxymonosulfaten | |
| DE3425582A1 (de) | Verfahren zur verbesserung der ausbeute an soda bei dem solvay-prozess | |
| DE2145321C3 (de) | Verfahren zur Herstellung von Kaliumperoxydi sulfat | |
| EP0279438B1 (de) | Verfahren zur Herstellung von reinem Bortrifluorid | |
| DE2245892A1 (de) | Verfahren zur herstellung von citronensaeure | |
| AT220589B (de) | Verfahren zur Herstellung von Ammonium-, Alkali- oder Erdalkaliperoxomonosulfaten | |
| SU850583A1 (ru) | Способ получени сульфата аммони | |
| EP0050290A1 (de) | Verfahren zur Herstellung von Alkalisalzen der Imidodisulfonsäure | |
| AT215957B (de) | Verfahren zur Herstellung von Peroxomonosulfaten | |
| DE3223673C2 (enExample) | ||
| DE1912898C (de) | Verfahren zur Herstellung eines aus Ammoniumnatriumnitrat bestehenden Dungemit tels | |
| DE591874C (de) | Herstellung von Alkalisalpeter durch Umsetzung von Salpetersaeure mit Alkalichlorid oder -sulfat | |
| DE1468032A1 (de) | Verfahren zur Gewinnung hellfarbiger Gemische aus Kapillaraktivsubstanzen mit einem Gehalt an Salzen von Sulfofettsaeuren oder deren Estern | |
| DE1667596B2 (de) | Verfahren zur Herstellung von Natriummetaphosphat | |
| DE1912898B (de) | Verfahren zur Herstellung eines aus Ammoniumnatriumnitrat bestehenden Dungemit fels | |
| DE1051256B (de) | Verfahren zur kontinuierlichen Herstellung von Chlordioxyd | |
| DE2806038C2 (de) | Verfahren zur Herstellung von Nitroguanidin |