DE1094830B - Verfahren zur Erzeugung von elektrischem Strom und Zellen zur Durchfuehrung des Verfahrens - Google Patents
Verfahren zur Erzeugung von elektrischem Strom und Zellen zur Durchfuehrung des VerfahrensInfo
- Publication number
- DE1094830B DE1094830B DEM42421A DEM0042421A DE1094830B DE 1094830 B DE1094830 B DE 1094830B DE M42421 A DEM42421 A DE M42421A DE M0042421 A DEM0042421 A DE M0042421A DE 1094830 B DE1094830 B DE 1094830B
- Authority
- DE
- Germany
- Prior art keywords
- cell
- metal
- electrode
- solvent
- hydride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 21
- 230000008569 process Effects 0.000 title description 9
- 239000002904 solvent Substances 0.000 claims description 56
- 229910052751 metal Inorganic materials 0.000 claims description 37
- 239000002184 metal Substances 0.000 claims description 36
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 239000001257 hydrogen Substances 0.000 claims description 24
- 150000004678 hydrides Chemical class 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 16
- 239000007772 electrode material Substances 0.000 claims description 13
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 12
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 11
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 10
- 229910052744 lithium Inorganic materials 0.000 claims description 10
- 239000000374 eutectic mixture Substances 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 239000003513 alkali Substances 0.000 claims description 8
- 150000004820 halides Chemical class 0.000 claims description 8
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 150000002500 ions Chemical class 0.000 claims description 7
- 229920001021 polysulfide Polymers 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- 229910001508 alkali metal halide Inorganic materials 0.000 claims description 6
- 150000004767 nitrides Chemical class 0.000 claims description 6
- 229910001507 metal halide Inorganic materials 0.000 claims description 5
- 150000005309 metal halides Chemical class 0.000 claims description 5
- 239000005077 polysulfide Substances 0.000 claims description 5
- 150000008117 polysulfides Polymers 0.000 claims description 5
- 150000008045 alkali metal halides Chemical class 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- HYHCSLBZRBJJCH-UHFFFAOYSA-N sodium polysulfide Chemical group [Na+].S HYHCSLBZRBJJCH-UHFFFAOYSA-N 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 238000011161 development Methods 0.000 claims description 3
- 229910052976 metal sulfide Inorganic materials 0.000 claims description 3
- XSOKHXFFCGXDJZ-UHFFFAOYSA-N telluride(2-) Chemical compound [Te-2] XSOKHXFFCGXDJZ-UHFFFAOYSA-N 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 150000003346 selenoethers Chemical class 0.000 claims description 2
- 125000000129 anionic group Chemical group 0.000 claims 2
- 229910004261 CaF 2 Inorganic materials 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 239000003792 electrolyte Substances 0.000 description 23
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 21
- 239000007789 gas Substances 0.000 description 16
- 230000008929 regeneration Effects 0.000 description 16
- 238000011069 regeneration method Methods 0.000 description 16
- 238000000354 decomposition reaction Methods 0.000 description 10
- PQXKHYXIUOZZFA-UHFFFAOYSA-M lithium fluoride Chemical compound [Li+].[F-] PQXKHYXIUOZZFA-UHFFFAOYSA-M 0.000 description 10
- 229910052717 sulfur Inorganic materials 0.000 description 10
- 239000011593 sulfur Substances 0.000 description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- -1 hydride Chemical compound 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 150000003839 salts Chemical group 0.000 description 9
- 239000007788 liquid Substances 0.000 description 8
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 8
- 229910001220 stainless steel Inorganic materials 0.000 description 8
- 239000010935 stainless steel Substances 0.000 description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- MBMLMWLHJBBADN-UHFFFAOYSA-N Ferrous sulfide Chemical group [Fe]=S MBMLMWLHJBBADN-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 230000005611 electricity Effects 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 230000001172 regenerating effect Effects 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 230000005496 eutectics Effects 0.000 description 4
- 229910000103 lithium hydride Inorganic materials 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- NFMAZVUSKIJEIH-UHFFFAOYSA-N bis(sulfanylidene)iron Chemical class S=[Fe]=S NFMAZVUSKIJEIH-UHFFFAOYSA-N 0.000 description 3
- 238000010494 dissociation reaction Methods 0.000 description 3
- 230000005593 dissociations Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 229910001615 alkaline earth metal halide Inorganic materials 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 229910000339 iron disulfide Inorganic materials 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- WHXSMMKQMYFTQS-NJFSPNSNSA-N lithium-9 Chemical compound [9Li] WHXSMMKQMYFTQS-NJFSPNSNSA-N 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 239000011833 salt mixture Substances 0.000 description 2
- 150000004763 sulfides Chemical class 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- GRQJZSJOACLQOV-UHFFFAOYSA-N [Li].[N] Chemical compound [Li].[N] GRQJZSJOACLQOV-UHFFFAOYSA-N 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000001450 anions Chemical group 0.000 description 1
- 239000010405 anode material Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005485 electric heating Methods 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- 150000004673 fluoride salts Chemical class 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- SIAPCJWMELPYOE-UHFFFAOYSA-N lithium hydride Chemical compound [LiH] SIAPCJWMELPYOE-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- DDTIGTPWGISMKL-UHFFFAOYSA-N molybdenum nickel Chemical compound [Ni].[Mo] DDTIGTPWGISMKL-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 150000004772 tellurides Chemical class 0.000 description 1
- 229910052714 tellurium Inorganic materials 0.000 description 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M8/00—Fuel cells; Manufacture thereof
- H01M8/18—Regenerative fuel cells, e.g. redox flow batteries or secondary fuel cells
- H01M8/182—Regeneration by thermal means
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02E—REDUCTION OF GREENHOUSE GAS [GHG] EMISSIONS, RELATED TO ENERGY GENERATION, TRANSMISSION OR DISTRIBUTION
- Y02E60/00—Enabling technologies; Technologies with a potential or indirect contribution to GHG emissions mitigation
- Y02E60/30—Hydrogen technology
- Y02E60/50—Fuel cells
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Sustainable Development (AREA)
- Sustainable Energy (AREA)
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Hybrid Cells (AREA)
- Fuel Cell (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75455558A | 1958-08-12 | 1958-08-12 | |
| US829237A US3031518A (en) | 1958-08-12 | 1959-07-24 | Fuel cells |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1094830B true DE1094830B (de) | 1960-12-15 |
Family
ID=27115936
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEM42421A Pending DE1094830B (de) | 1958-08-12 | 1959-08-12 | Verfahren zur Erzeugung von elektrischem Strom und Zellen zur Durchfuehrung des Verfahrens |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3031518A (enExample) |
| BE (1) | BE581603A (enExample) |
| DE (1) | DE1094830B (enExample) |
| FR (1) | FR1232196A (enExample) |
| GB (1) | GB905334A (enExample) |
| NL (1) | NL268047A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1596259B1 (de) * | 1965-08-24 | 1971-07-01 | Trw Inc | Fuer den betrieb bei ueber 480 grad c bestimmte galvani sche zelle mit geschmolzenem fluoridelektrolyten und gas foermigen depolarisator |
| DE3727302A1 (de) * | 1986-08-18 | 1988-02-25 | Gen Electric | Verfahren zur elektrizitaetserzeugung und ein thermoelektrisches umwandlungssystem |
| DE3730209A1 (de) * | 1986-09-19 | 1988-03-24 | Gen Electric | Metallhydrid-akkumulator |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3368921A (en) * | 1960-06-17 | 1968-02-13 | North American Rockwell | Conversion of heat to electricity by electrochemical means using uo3 melt |
| US3294585A (en) * | 1961-03-09 | 1966-12-27 | Union Carbide Corp | Thermocell |
| US3357859A (en) * | 1961-05-19 | 1967-12-12 | Westinghouse Electric Corp | Thermally activated electric power supply |
| US3236691A (en) * | 1961-06-20 | 1966-02-22 | Trw Inc | Regenerable fuel cell |
| US3119723A (en) * | 1961-10-30 | 1964-01-28 | Carl E Crouthamel | Apparatus for converting heat into electricity |
| US3370983A (en) * | 1961-12-18 | 1968-02-27 | Gen Motors Corp | Electrothermal transducer and method of operating same |
| US3186872A (en) * | 1962-02-12 | 1965-06-01 | Ewing Bland | Continuous gas concentration cell energy conversion |
| US3294586A (en) * | 1962-03-01 | 1966-12-27 | Pullman Inc | Fuel cell with movable casing and electrodes and method for operating fuel cell withan anode containing an alkaline earth metal |
| US3294587A (en) * | 1962-03-01 | 1966-12-27 | Pullman Inc | Fuel cell |
| US3150998A (en) * | 1962-03-05 | 1964-09-29 | Paul E Reitemeier | Fuel cell systems |
| US3271197A (en) * | 1962-04-24 | 1966-09-06 | Jr Ernest H Lyons | Process for producing electricity and furnace |
| US3401062A (en) * | 1962-05-14 | 1968-09-10 | Ernest H. Lyons Jr. | Process and apparatus for electrolytic production of electric current from photoreducible metal oxides |
| US3508968A (en) * | 1962-05-28 | 1970-04-28 | Energy Conversion Devices Inc | Thermoelectric device |
| CH401178A (de) * | 1962-08-27 | 1965-10-31 | Bbc Brown Boveri & Cie | Elektrochemisches Niedertemperatur-Brennstoffelement |
| US3374120A (en) * | 1962-10-23 | 1968-03-19 | Aerojet General Co | Apparatus and method regarding generation of electrical energy from thermal energy |
| US3507700A (en) * | 1966-01-04 | 1970-04-21 | Philco Ford Corp | Method of operating a thermal fuel cell comprising a metal and a halogen electrode |
| US3455744A (en) * | 1966-04-14 | 1969-07-15 | Gen Motors Corp | Lithium-halogen fuel cell and method of producing electricity |
| US3508969A (en) * | 1966-05-18 | 1970-04-28 | Gen Motors Corp | Galvanic cell with removable barrier between electrolyte and electrode and process for activating cell |
| US3488223A (en) * | 1966-08-17 | 1970-01-06 | Gen Motors Corp | Electrochemical cell having volumetrically variable storage chambers |
| US3488221A (en) * | 1967-08-08 | 1970-01-06 | Atomic Energy Commission | Electrochemical cell |
| DE1929161B2 (de) * | 1969-06-09 | 1974-07-11 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt | Brennstoffelektrode |
| US3877988A (en) * | 1973-03-21 | 1975-04-15 | Mallory & Co Inc P R | Lithium-metal telluride organic electrolyte cell |
| US4090012A (en) * | 1977-05-05 | 1978-05-16 | The United States Of America As Represented By The United States Department Of Energy | Electrochemical heat engine |
| US4818638A (en) * | 1986-08-18 | 1989-04-04 | General Electric Company | System for hydrogen thermal-electrochemical conversion |
| US4833046A (en) * | 1986-09-19 | 1989-05-23 | General Electric Company | Metal-hydrogen secondary battery |
| US5139895A (en) * | 1991-07-19 | 1992-08-18 | General Electric Company | Hydrogen thermal electrochemical converter |
| HU0600774D0 (en) * | 2006-10-11 | 2006-12-28 | Halacsy Attila | Thermally regenerated electrochemical converter and method of electrical energy generation from thermal energy |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US344345A (en) * | 1886-06-29 | Best available cop | ||
| US1323879A (en) * | 1919-12-02 | Process of oxidation oe sulfids | ||
| US567721A (en) * | 1896-09-15 | Method of producing | ||
| GB190607375A (en) * | 1905-03-27 | 1906-06-21 | Lucien-Paul Basset | Thermo-chemical Generator of Electricity. |
| US895715A (en) * | 1906-03-27 | 1908-08-11 | Maurice Bacqua De Labarthe | Thermochemical generation of electricity. |
| BE506139A (enExample) * | 1951-10-17 |
-
0
- NL NL268047D patent/NL268047A/xx unknown
-
1959
- 1959-07-24 US US829237A patent/US3031518A/en not_active Expired - Lifetime
- 1959-08-11 FR FR802580A patent/FR1232196A/fr not_active Expired
- 1959-08-12 BE BE581603A patent/BE581603A/fr unknown
- 1959-08-12 DE DEM42421A patent/DE1094830B/de active Pending
- 1959-08-12 GB GB27560/59A patent/GB905334A/en not_active Expired
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1596259B1 (de) * | 1965-08-24 | 1971-07-01 | Trw Inc | Fuer den betrieb bei ueber 480 grad c bestimmte galvani sche zelle mit geschmolzenem fluoridelektrolyten und gas foermigen depolarisator |
| DE3727302A1 (de) * | 1986-08-18 | 1988-02-25 | Gen Electric | Verfahren zur elektrizitaetserzeugung und ein thermoelektrisches umwandlungssystem |
| DE3730209A1 (de) * | 1986-09-19 | 1988-03-24 | Gen Electric | Metallhydrid-akkumulator |
Also Published As
| Publication number | Publication date |
|---|---|
| GB905334A (en) | 1962-09-05 |
| NL268047A (enExample) | |
| FR1232196A (fr) | 1960-10-06 |
| BE581603A (fr) | 1960-02-12 |
| US3031518A (en) | 1962-04-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1094830B (de) | Verfahren zur Erzeugung von elektrischem Strom und Zellen zur Durchfuehrung des Verfahrens | |
| DE2851225C2 (enExample) | ||
| DE2806984A1 (de) | Verfahren zum herstellen von wasserstoff und sauerstoff sowie eine elektrolysezelle zur durchfuehrung dieses verfahrens | |
| DE2328050C3 (de) | Katalysator für Brennstoffelektroden von Brennstoffelementen | |
| DE69601814T2 (de) | Verfahren zur hydrometallurgischen und elektrochemischen Behandlung der aktiven Masse verbrauchter Bleibatterien zwecks Herstellung von Elektrolyt-Blei und Elementar-Schwefel | |
| DE1696546B2 (de) | Wiederaufladbares galvanisches thermalelement und verfahren zur herstellung einer elektrode dafuer | |
| DE2348258A1 (de) | Sekundaerzelle | |
| DE69207718T2 (de) | Thermisch regenerierte Brennstoffzelle | |
| DE2528889C3 (de) | Verfahren zum Entfernen von Schwefelwasserstoff aus einem Gas | |
| DE1671873A1 (de) | Brennstoffzelle | |
| DE2220258A1 (de) | Aktivierte Aluminium-Anode für elektrochemische Energieumwandlerzelle | |
| DE1671677A1 (de) | Brennstoffzelle und Verfahren zu ihrem Betrieb | |
| CH155911A (de) | Trockengleichrichter. | |
| DE4134109A1 (de) | Verfahren zur herstellung einer elektrolytischen vanadiumloesung | |
| WO1987006493A1 (fr) | Procede et dispositif d'elimination de l'azote contenu dans des gaz de fumee | |
| DE4004220C1 (en) | Electrochemical semi:system for high temp. fuel elements - has carbonate electrolyte melt with added carbon | |
| DE1571985A1 (de) | Verfahren zur anodischen Oxydation von sulfidischen Verbindungen | |
| DE2904923C2 (de) | Hybridprozeß zur Gewinnung von Wasserstoff | |
| DE2512575C3 (de) | Verfahren zur Elektrolyse mit selbstständiger, elektrischer Versorgung | |
| DE69403655T2 (de) | Verfahren zur umwandlung von ammoniak in einem gasstrom zu stickstoff | |
| DE19718923C2 (de) | Elektrolytische Reduktion von Schwefelsäure zu Schwefelwasserstoff und Verwendung der Reduktion | |
| DE2820117A1 (de) | Elektrolytische verfahren unter verwendung graphitischer kohlenstoffkathoden sowie hiermit erzeugte komplexverbindungen | |
| DE1112722B (de) | Verfahren zur elektrolytischen Herstellung von Phosphin | |
| DE2033109C (de) | Verfahren zur Herstellung von Schwefelhexafluorid | |
| DE2033109A1 (de) | Verfahren zur Herstellung von Schwe felhexafluorid |