DE1070540B - - Google Patents
Info
- Publication number
- DE1070540B DE1070540B DENDAT1070540D DE1070540DB DE1070540B DE 1070540 B DE1070540 B DE 1070540B DE NDAT1070540 D DENDAT1070540 D DE NDAT1070540D DE 1070540D B DE1070540D B DE 1070540DB DE 1070540 B DE1070540 B DE 1070540B
- Authority
- DE
- Germany
- Prior art keywords
- cuo
- oersted
- mol percent
- nio
- shows
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000203 mixture Substances 0.000 claims description 51
- 229910000859 α-Fe Inorganic materials 0.000 claims description 23
- 238000005245 sintering Methods 0.000 claims description 16
- 238000004519 manufacturing process Methods 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 150000002739 metals Chemical class 0.000 claims description 6
- 230000005294 ferromagnetic effect Effects 0.000 claims description 5
- 238000003825 pressing Methods 0.000 claims description 5
- 229910052802 copper Inorganic materials 0.000 claims description 4
- 239000003302 ferromagnetic material Substances 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 229910052725 zinc Inorganic materials 0.000 claims description 4
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 229910018072 Al 2 O 3 Inorganic materials 0.000 claims description 2
- 229910018663 Mn O Inorganic materials 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- 229910052793 cadmium Inorganic materials 0.000 claims description 2
- 238000000227 grinding Methods 0.000 claims description 2
- 239000012299 nitrogen atmosphere Substances 0.000 claims description 2
- AMWRITDGCCNYAT-UHFFFAOYSA-L hydroxy(oxo)manganese;manganese Chemical compound [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 53
- 239000000463 material Substances 0.000 description 46
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 44
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 41
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 38
- 239000011787 zinc oxide Substances 0.000 description 19
- 230000005415 magnetization Effects 0.000 description 18
- 230000006698 induction Effects 0.000 description 15
- 229910000431 copper oxide Inorganic materials 0.000 description 13
- 239000005751 Copper oxide Substances 0.000 description 12
- 229910000480 nickel oxide Inorganic materials 0.000 description 11
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 230000005291 magnetic effect Effects 0.000 description 9
- 229910052742 iron Inorganic materials 0.000 description 7
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 5
- 239000010949 copper Substances 0.000 description 5
- 238000010586 diagram Methods 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 239000011572 manganese Substances 0.000 description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 229910007541 Zn O Inorganic materials 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 229910044991 metal oxide Inorganic materials 0.000 description 3
- 150000004706 metal oxides Chemical class 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- IATRAKWUXMZMIY-UHFFFAOYSA-N strontium oxide Chemical compound [O-2].[Sr+2] IATRAKWUXMZMIY-UHFFFAOYSA-N 0.000 description 3
- 238000004804 winding Methods 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000696 magnetic material Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- ZWXOQTHCXRZUJP-UHFFFAOYSA-N manganese(2+);manganese(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[O-2].[Mn+2].[Mn+3].[Mn+3] ZWXOQTHCXRZUJP-UHFFFAOYSA-N 0.000 description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229910000676 Si alloy Inorganic materials 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910001308 Zinc ferrite Inorganic materials 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000013213 extrapolation Methods 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- XWHPIFXRKKHEKR-UHFFFAOYSA-N iron silicon Chemical compound [Si].[Fe] XWHPIFXRKKHEKR-UHFFFAOYSA-N 0.000 description 1
- HTUMBQDCCIXGCV-UHFFFAOYSA-N lead oxide Chemical compound [O-2].[Pb+2] HTUMBQDCCIXGCV-UHFFFAOYSA-N 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 238000010583 slow cooling Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- WGEATSXPYVGFCC-UHFFFAOYSA-N zinc ferrite Chemical compound O=[Zn].O=[Fe]O[Fe]=O WGEATSXPYVGFCC-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B35/00—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/01—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products based on oxide ceramics
- C04B35/26—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products based on oxide ceramics based on ferrites
- C04B35/265—Compositions containing one or more ferrites of the group comprising manganese or zinc and one or more ferrites of the group comprising nickel, copper or cobalt
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Ceramic Engineering (AREA)
- Manufacturing & Machinery (AREA)
- Materials Engineering (AREA)
- Structural Engineering (AREA)
- Organic Chemistry (AREA)
- Soft Magnetic Materials (AREA)
- Magnetic Ceramics (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR694950X | 1955-07-01 | ||
| FR694951X | 1955-07-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1070540B true DE1070540B (enExample) | 1959-12-03 |
Family
ID=26215468
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1070540D Pending DE1070540B (enExample) | 1955-07-01 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2962445A (enExample) |
| BE (1) | BE548112A (enExample) |
| CH (1) | CH343549A (enExample) |
| DE (1) | DE1070540B (enExample) |
| FR (2) | FR1128631A (enExample) |
| GB (1) | GB820959A (enExample) |
| NL (1) | NL112277C (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2987481A (en) * | 1956-10-15 | 1961-06-06 | Ibm | Manganese-zinc ferrite |
| BE562891A (enExample) * | 1956-12-14 | |||
| BE563783A (enExample) * | 1957-01-08 | |||
| US3028336A (en) * | 1957-09-25 | 1962-04-03 | Ibm | Cadmium manganese ferrospinel composition |
| US3055833A (en) * | 1957-10-31 | 1962-09-25 | Rca Corp | Mixed ferrospinels |
| ES246988A1 (es) * | 1958-02-13 | 1959-05-16 | Itt | MÉTODO DE FABRICACION DE UNA MATERIAL CERáMICO FERROMAGNÉTICO |
| NL99145C (enExample) * | 1958-06-03 | |||
| DE1182129B (de) * | 1958-06-04 | 1964-11-19 | Licentia Gmbh | Verfahren zur Herstellung eines magnetischen Kernmaterials mit nahezu rechteckfoermiger Hystereseschleife |
| US3042619A (en) * | 1959-12-31 | 1962-07-03 | Ibm | Ferrite composition for bistable magnetic circuits |
| US3108074A (en) * | 1960-08-12 | 1963-10-22 | Ibm | Technique for processing ferrite cores |
| US3110676A (en) * | 1961-04-18 | 1963-11-12 | Indiana General Corp | Ferrite for memory core |
| US3236777A (en) * | 1963-04-12 | 1966-02-22 | Ampex | Nickel-manganese-ferrous ferrite |
| DE1696446B1 (de) * | 1964-01-20 | 1969-10-23 | Siemens Ag | Ferromagnetischer Ferritkoerper mit einem bei hoher Erregung negativen Temperaturkoeffizienten der Wechselfeldverluste |
| US4001363A (en) * | 1970-03-19 | 1977-01-04 | U.S. Philips Corporation | Method of manufacturing a ceramic ferromagnetic object |
| JP2002198212A (ja) * | 2000-12-27 | 2002-07-12 | Fdk Corp | 低損失酸化物磁性材料 |
| US9797594B1 (en) * | 2013-09-20 | 2017-10-24 | U.S. Department Of Energy | Tri-metallic ferrite oxygen carriers for chemical looping combustion |
| DE202017103569U1 (de) * | 2017-06-14 | 2018-09-17 | Sma Solar Technology Ag | Spule und elektrisches oder elektronisches Gerät mit einer derartigen Spule |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE524097A (enExample) * | ||||
| US2535025A (en) * | 1949-10-06 | 1950-12-26 | Steatite Res Corp | Process of treating ferrites |
| IT492518A (enExample) * | 1951-10-30 | |||
| CA525699A (en) * | 1952-02-07 | 1956-05-29 | Albers-Schoenberg Ernst | Ferromagnetic ceramic materials with hysteresis loops of rectangular shape |
| GB737284A (en) * | 1952-02-15 | 1955-09-21 | Steatite Res Corp | Rectangular loop ferro nagnetic materials |
| US2723238A (en) * | 1952-08-19 | 1955-11-08 | Rca Corp | Manganese zinc ferrospinel compositions, including copper oxide |
| US2715109A (en) * | 1954-06-14 | 1955-08-09 | Steatite Res Corp | Ferromagnetic ceramic materials with hysteresis loops of rectangular shape |
-
0
- DE DENDAT1070540D patent/DE1070540B/de active Pending
- BE BE548112D patent/BE548112A/xx unknown
- NL NL112277D patent/NL112277C/xx active
-
1955
- 1955-07-01 FR FR1128631D patent/FR1128631A/fr not_active Expired
- 1955-07-01 FR FR1128630D patent/FR1128630A/fr not_active Expired
-
1956
- 1956-04-26 CH CH343549D patent/CH343549A/fr unknown
- 1956-06-05 US US589521A patent/US2962445A/en not_active Expired - Lifetime
- 1956-06-28 GB GB20087/56A patent/GB820959A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1128631A (fr) | 1957-01-08 |
| FR1128630A (fr) | 1957-01-08 |
| CH343549A (fr) | 1959-12-31 |
| NL112277C (enExample) | |
| BE548112A (enExample) | |
| US2962445A (en) | 1960-11-29 |
| GB820959A (en) | 1959-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1070540B (enExample) | ||
| DE976406C (de) | Verwendung eines gebrannten Produktes als ferromagnetische Masse | |
| DE1008181B (de) | Ferromagnetische Ferrite | |
| DE973822C (de) | Magnetkern und Verfahren zu seiner Herstellung | |
| DE60105341T2 (de) | Mn-Zn-Ferrit und Verfahren zu seiner Herstellung | |
| DE970458C (de) | Weichmagnetisches Kernmaterial aus Nickel-Zink-Ferrit | |
| DE1073929B (de) | Verfahren zur Herstellung von geformten ferromagnetischen Werkstoffen | |
| DE1109077B (de) | Verfahren zum Herstellen ferromagnetischer Koerper fuer elektrotechnische Zwecke mitpraktisch rechteckiger Hysteresisschleife und niedriger Koerzitivkraft | |
| DE1227820B (de) | Verfahren zur Herstellung von ferromagnetischen oxydischen Koerpern | |
| DE1239606B (de) | Verfahren zur Herstellung von ferromagnetischen Kernen mit weitgehend rechteckfoermiger Hysteresisschleife | |
| AT164420B (de) | Magnetischer Kern aus einem ferromagnetischen Ferrit | |
| DE2735440C3 (de) | Mangan-Zink-Ferrit | |
| CH377268A (de) | Verfahren zur Herstellung eines ferromagnetischen Materials | |
| DE1646686B1 (de) | Verbesserte mangan-zink-ferritkerne | |
| AT216225B (de) | Verfahren zur Herstellung eines gesinterten Magnetkernes | |
| DE1302342C2 (de) | Verfahren zur herstellung eines weichmagnetischen ferrits mit isopermcharakter | |
| DE2143439A1 (de) | Ferrite mit geringem Desakkomodations-Verhalten | |
| AT166177B (de) | Magnetkern für elektromagnetische Vorrichtung | |
| DE958996C (de) | Verfahren zur Herstellung ferromagnetischer, gegebenenfalls geformter Massen | |
| AT214662B (de) | Verfahren zur Herstellung eines gesinterten Magnetkernes | |
| DE1295459B (de) | Magnetkern mit wenigstens annaehernd rechteckiger Hystereseschleife | |
| DE1087507B (de) | Verfahren zur Herstellung ferromagnetischen Materials mit rechteckfoermiger Hystereseschleife | |
| CH337962A (de) | Verfahren zur Herstellung eines Magnetkernes mit einem hohen Rechtwinkligkeitsverhältnis der Hystereseschleife und nach diesem Verfahren hergestellter Magnetkern | |
| DE1696392B1 (de) | Dauermagnetwerkstoff mit Magnetoplumbitstruktur sowie Verfahren zu dessen Herstellung | |
| CH270970A (de) | Magnetisches Material aus ferromagnetischen Mischkristallen von Ferriten und Verfahren zur Herstellung desselben. |