DE1046707B - Hohlleiter-Transformator - Google Patents
Hohlleiter-TransformatorInfo
- Publication number
- DE1046707B DE1046707B DEW19911A DEW0019911A DE1046707B DE 1046707 B DE1046707 B DE 1046707B DE W19911 A DEW19911 A DE W19911A DE W0019911 A DEW0019911 A DE W0019911A DE 1046707 B DE1046707 B DE 1046707B
- Authority
- DE
- Germany
- Prior art keywords
- waveguide
- transition piece
- dimensions
- dimension
- conductor
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004020 conductor Substances 0.000 claims description 91
- 230000007704 transition Effects 0.000 claims description 34
- 230000005684 electric field Effects 0.000 claims description 4
- 230000001939 inductive effect Effects 0.000 description 5
- 238000005516 engineering process Methods 0.000 description 4
- 230000005540 biological transmission Effects 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 238000000034 method Methods 0.000 description 2
- 241000768714 Anoides Species 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- YTMNONATNXDQJF-QSLGVYCOSA-N cyanidin 3-O-beta-D-galactoside chloride Chemical compound [Cl-].O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1OC1=CC2=C(O)C=C(O)C=C2[O+]=C1C1=CC=C(O)C(O)=C1 YTMNONATNXDQJF-QSLGVYCOSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01P—WAVEGUIDES; RESONATORS, LINES, OR OTHER DEVICES OF THE WAVEGUIDE TYPE
- H01P5/00—Coupling devices of the waveguide type
- H01P5/08—Coupling devices of the waveguide type for linking dissimilar lines or devices
- H01P5/082—Transitions between hollow waveguides of different shape, e.g. between a rectangular and a circular waveguide
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01P—WAVEGUIDES; RESONATORS, LINES, OR OTHER DEVICES OF THE WAVEGUIDE TYPE
- H01P1/00—Auxiliary devices
- H01P1/04—Fixed joints
- H01P1/042—Hollow waveguide joints
Landscapes
- Coils Or Transformers For Communication (AREA)
- Control Of Motors That Do Not Use Commutators (AREA)
- Waveguide Aerials (AREA)
- Waveguides (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US561532A US2960671A (en) | 1956-01-26 | 1956-01-26 | Electromagnetic wave transducer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1046707B true DE1046707B (de) | 1958-12-18 |
Family
ID=24242359
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEW19911A Pending DE1046707B (de) | 1956-01-26 | 1956-10-13 | Hohlleiter-Transformator |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2960671A (enExample) |
| BE (1) | BE552817A (enExample) |
| DE (1) | DE1046707B (enExample) |
| FR (1) | FR1167851A (enExample) |
| GB (1) | GB811807A (enExample) |
| NL (2) | NL113833C (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1271228B (de) * | 1964-12-23 | 1968-06-27 | Spinner G M B H Elektrotechnis | UEbergang zwischen elliptischen oder ovalen Hohlrohrleitern und Rechteckhohlleitern |
| DE4234532A1 (de) * | 1992-10-14 | 1994-04-21 | Ant Nachrichtentech | Hohlleitertransformationsteil und Verfahren zu dessen Herstellung |
| DE19615854C1 (de) * | 1996-04-20 | 1997-11-20 | Alcatel Kabel Ag | Verfahren zur Herstellung einer Kupplung für das Verbinden zweier elektromagnetischer Hohlleiter |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2096684B1 (enExample) * | 1970-06-03 | 1973-12-21 | Behe Roger | |
| US4540959A (en) * | 1983-11-22 | 1985-09-10 | Andrew Corporation | Rectangular to elliptical waveguide connection |
| US4642585A (en) * | 1985-01-30 | 1987-02-10 | Andrew Corporation | Superelliptical waveguide connection |
| FR2607968B1 (fr) * | 1986-12-09 | 1989-02-03 | Alcatel Thomson Faisceaux | Source d'illumination pour antenne de telecommunications |
| DE10032172A1 (de) | 2000-07-01 | 2002-01-17 | Marconi Comm Gmbh | Übergang für orthogonal orientierte Hohlleiter |
| FI122203B (fi) * | 2008-09-11 | 2011-10-14 | Raute Oyj | Aaltojohtoelementti |
| JP5289401B2 (ja) * | 2010-09-09 | 2013-09-11 | 三菱電機株式会社 | 導波管プレート |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB591667A (en) * | 1942-03-31 | 1947-08-25 | Sperry Gyroscope Co Inc | Improvements in or relating to impedance transformers for wave guides |
| US2432094A (en) * | 1942-07-30 | 1947-12-09 | Bell Telephone Labor Inc | Impedance transformer for wave guides |
| FR970556A (fr) * | 1947-08-20 | 1951-01-05 | Emi Ltd | Guide d'ondes électriques |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2576186A (en) * | 1946-10-22 | 1951-11-27 | Rca Corp | Ultrahigh-frequency coupling device |
| US2738468A (en) * | 1950-07-24 | 1956-03-13 | Rca Corp | Wave guide filters |
| US2719274A (en) * | 1951-07-09 | 1955-09-27 | Gen Precision Lab Inc | Microwave switches |
| US2767380A (en) * | 1952-09-30 | 1956-10-16 | Bell Telephone Labor Inc | Impedance transformer |
| US2802183A (en) * | 1954-06-04 | 1957-08-06 | Sanders Associates Inc | Microwave modulator |
-
0
- NL NL212773D patent/NL212773A/xx unknown
- NL NL113833D patent/NL113833C/xx active
- BE BE552817D patent/BE552817A/xx unknown
-
1956
- 1956-01-26 US US561532A patent/US2960671A/en not_active Expired - Lifetime
- 1956-10-13 DE DEW19911A patent/DE1046707B/de active Pending
- 1956-11-28 FR FR1167851D patent/FR1167851A/fr not_active Expired
-
1957
- 1957-01-25 GB GB2784/57A patent/GB811807A/en not_active Expired
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB591667A (en) * | 1942-03-31 | 1947-08-25 | Sperry Gyroscope Co Inc | Improvements in or relating to impedance transformers for wave guides |
| US2432094A (en) * | 1942-07-30 | 1947-12-09 | Bell Telephone Labor Inc | Impedance transformer for wave guides |
| FR970556A (fr) * | 1947-08-20 | 1951-01-05 | Emi Ltd | Guide d'ondes électriques |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1271228B (de) * | 1964-12-23 | 1968-06-27 | Spinner G M B H Elektrotechnis | UEbergang zwischen elliptischen oder ovalen Hohlrohrleitern und Rechteckhohlleitern |
| DE4234532A1 (de) * | 1992-10-14 | 1994-04-21 | Ant Nachrichtentech | Hohlleitertransformationsteil und Verfahren zu dessen Herstellung |
| DE19615854C1 (de) * | 1996-04-20 | 1997-11-20 | Alcatel Kabel Ag | Verfahren zur Herstellung einer Kupplung für das Verbinden zweier elektromagnetischer Hohlleiter |
| US5886588A (en) * | 1996-04-20 | 1999-03-23 | Alcatel Alsthom Compagnie Generale D'electricite | Coupling for two electromagnetic waveguides with different cross-sectional shapes |
Also Published As
| Publication number | Publication date |
|---|---|
| NL212773A (enExample) | |
| US2960671A (en) | 1960-11-15 |
| FR1167851A (fr) | 1958-12-02 |
| BE552817A (enExample) | |
| NL113833C (enExample) | |
| GB811807A (en) | 1959-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2439853C2 (de) | Elektrisches Flachbandkabel | |
| DE2618772C2 (de) | Kabelantenne | |
| DE3486443T2 (de) | Rechteckig-elliptischer Übergangshohlleiter | |
| DE1027274B (de) | Leiter zur UEbertragung elektromagnetischer H-Wellen | |
| DE3428087A1 (de) | Konzentrisches dreileiterkabel | |
| DE2535257B2 (de) | Einstellbarer Laufzeitentzerrer | |
| DE1690288B2 (de) | Trommelbarer Hohlleiter | |
| DE1909092A1 (de) | Hybridkoppler mit 90 deg.-Phasenverschiebung | |
| DE2632772A1 (de) | Mikrowellen-richtantenne | |
| DE1046707B (de) | Hohlleiter-Transformator | |
| DE2161904A1 (de) | Koaxialkabel mit flachem Profil | |
| DE1030904B (de) | Mikrowellen-UEbertragungsleitung nach Art einer gedruckten Schaltung mit einem ersten streifenfoermigen Leiter, der in einem bezueglich der Wellenlaenge sehr geringen Abst and parallel zu einem zweiten durch eine dielektrische Schicht getrennten streifenfoermigen Leiter von gleicher oder groesserer Breite angeordnet ist | |
| DE2710506C3 (de) | Breitband-Richtungsleitung | |
| DE2521956B2 (de) | Polarisationsweiche | |
| DE2708271C2 (de) | Polarisationsweiche | |
| DE1901990B2 (de) | Mehrstufiger Mikrowellenverstärker | |
| DE1201432B (de) | Verjuengtes Hohlleiter-UEbergangsstueck mit dielektrischer Huelse | |
| DE69202048T2 (de) | Anschlussvorrichtung für eine elektrische kabelbeflechtung an einen anschluss. | |
| DE891999C (de) | Bandsperre für Zentimeterwellen | |
| DE964335C (de) | Richtungskoppler fuer sehr hohe Frequenzen | |
| DE2912650C2 (de) | Frequenzweiche | |
| DE2201626C3 (de) | Anwendung des Prinzips der Vorentzerrung bei Wanderfeldröhrenverstärkern | |
| DE9409625U1 (de) | Vorrichtung zur Leistungsteilung bei der leitungsgebundenen Übertragung von Hochfrequenz-Signalen | |
| DE1466325C (de) | Wellentypwandler zur Umwandlung des H tief 10 -Wellentyps des Rechteckhohlleiters in den H tief 01 -Wellentyp des Rundhohlleiters | |
| DE2102554A1 (de) | Richtkopplung |