DE10313681A1 - Verfahren zur Herstellung von Polyamiden - Google Patents
Verfahren zur Herstellung von Polyamiden Download PDFInfo
- Publication number
- DE10313681A1 DE10313681A1 DE10313681A DE10313681A DE10313681A1 DE 10313681 A1 DE10313681 A1 DE 10313681A1 DE 10313681 A DE10313681 A DE 10313681A DE 10313681 A DE10313681 A DE 10313681A DE 10313681 A1 DE10313681 A1 DE 10313681A1
- Authority
- DE
- Germany
- Prior art keywords
- reactor
- liquid
- chamber
- water
- heat exchanger
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims abstract description 70
- 230000008569 process Effects 0.000 title claims abstract description 28
- 239000004952 Polyamide Substances 0.000 title claims abstract description 24
- 229920002647 polyamide Polymers 0.000 title claims abstract description 24
- 238000002360 preparation method Methods 0.000 title claims abstract description 10
- 239000007788 liquid Substances 0.000 claims abstract description 75
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 51
- 239000000203 mixture Substances 0.000 claims abstract description 40
- 125000005219 aminonitrile group Chemical group 0.000 claims abstract description 37
- 150000004985 diamines Chemical class 0.000 claims abstract description 35
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims abstract description 32
- 229910021529 ammonia Inorganic materials 0.000 claims abstract description 16
- 239000000178 monomer Substances 0.000 claims abstract description 13
- 239000007795 chemical reaction product Substances 0.000 claims abstract description 12
- 150000003384 small molecules Chemical class 0.000 claims abstract description 4
- 239000007789 gas Substances 0.000 claims description 79
- 239000000047 product Substances 0.000 claims description 47
- 238000006243 chemical reaction Methods 0.000 claims description 28
- 239000003054 catalyst Substances 0.000 claims description 12
- 239000007787 solid Substances 0.000 claims description 11
- 238000000926 separation method Methods 0.000 claims description 9
- 239000012263 liquid product Substances 0.000 claims description 7
- 239000011261 inert gas Substances 0.000 claims description 5
- 239000012530 fluid Substances 0.000 claims description 4
- 238000012856 packing Methods 0.000 claims description 4
- 238000011144 upstream manufacturing Methods 0.000 claims description 4
- 239000002638 heterogeneous catalyst Substances 0.000 claims description 3
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000003456 ion exchange resin Substances 0.000 claims description 2
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 2
- 239000011949 solid catalyst Substances 0.000 claims description 2
- 239000007848 Bronsted acid Substances 0.000 claims 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 22
- 125000004432 carbon atom Chemical group C* 0.000 description 21
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 15
- 125000002560 nitrile group Chemical group 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 10
- 238000002156 mixing Methods 0.000 description 9
- 150000002825 nitriles Chemical class 0.000 description 9
- 239000012071 phase Substances 0.000 description 9
- BTGRAWJCKBQKAO-UHFFFAOYSA-N adiponitrile Chemical compound N#CCCCCC#N BTGRAWJCKBQKAO-UHFFFAOYSA-N 0.000 description 8
- 238000000066 reactive distillation Methods 0.000 description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- KBMSFJFLSXLIDJ-UHFFFAOYSA-N 6-aminohexanenitrile Chemical compound NCCCCCC#N KBMSFJFLSXLIDJ-UHFFFAOYSA-N 0.000 description 5
- 229920002292 Nylon 6 Polymers 0.000 description 5
- FHKPTEOFUHYQFY-UHFFFAOYSA-N 2-aminohexanenitrile Chemical compound CCCCC(N)C#N FHKPTEOFUHYQFY-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 238000013178 mathematical model Methods 0.000 description 4
- 230000001105 regulatory effect Effects 0.000 description 4
- 238000012546 transfer Methods 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 3
- 229910010413 TiO 2 Inorganic materials 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 238000010924 continuous production Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000007791 liquid phase Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 2
- UFFRSDWQMJYQNE-UHFFFAOYSA-N 6-azaniumylhexylazanium;hexanedioate Chemical compound [NH3+]CCCCCC[NH3+].[O-]C(=O)CCCCC([O-])=O UFFRSDWQMJYQNE-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- -1 alkane dicarboxylic acids Chemical class 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 229960002684 aminocaproic acid Drugs 0.000 description 2
- VHRGRCVQAFMJIZ-UHFFFAOYSA-N cadaverine Chemical compound NCCCCCN VHRGRCVQAFMJIZ-UHFFFAOYSA-N 0.000 description 2
- 238000004364 calculation method Methods 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000007872 degassing Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 1
- JZUHIOJYCPIVLQ-UHFFFAOYSA-N 2-methylpentane-1,5-diamine Chemical compound NCC(C)CCCN JZUHIOJYCPIVLQ-UHFFFAOYSA-N 0.000 description 1
- FPPLREPCQJZDAQ-UHFFFAOYSA-N 2-methylpentanedinitrile Chemical compound N#CC(C)CCC#N FPPLREPCQJZDAQ-UHFFFAOYSA-N 0.000 description 1
- GFBXDEILUKZCOZ-UHFFFAOYSA-N 2-propylpropanedinitrile Chemical compound CCCC(C#N)C#N GFBXDEILUKZCOZ-UHFFFAOYSA-N 0.000 description 1
- JLLYLQLDYORLBB-UHFFFAOYSA-N 5-bromo-n-methylthiophene-2-sulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(Br)S1 JLLYLQLDYORLBB-UHFFFAOYSA-N 0.000 description 1
- AKVAIQVGWQLMBG-UHFFFAOYSA-N 6-amino-n,n-diethylhexanamide Chemical compound CCN(CC)C(=O)CCCCCN AKVAIQVGWQLMBG-UHFFFAOYSA-N 0.000 description 1
- JYYXVDYYEXMEJU-UHFFFAOYSA-N 6-amino-n,n-dimethylhexanamide Chemical compound CN(C)C(=O)CCCCCN JYYXVDYYEXMEJU-UHFFFAOYSA-N 0.000 description 1
- BUSHYIBZUMHUEU-UHFFFAOYSA-N 6-amino-n-methylhexanamide Chemical compound CNC(=O)CCCCCN BUSHYIBZUMHUEU-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009933 burial Methods 0.000 description 1
- GHWVXCQZPNWFRO-UHFFFAOYSA-N butane-2,3-diamine Chemical compound CC(N)C(C)N GHWVXCQZPNWFRO-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- QYQADNCHXSEGJT-UHFFFAOYSA-N cyclohexane-1,1-dicarboxylate;hydron Chemical compound OC(=O)C1(C(O)=O)CCCCC1 QYQADNCHXSEGJT-UHFFFAOYSA-N 0.000 description 1
- YQLZOAVZWJBZSY-UHFFFAOYSA-N decane-1,10-diamine Chemical compound NCCCCCCCCCCN YQLZOAVZWJBZSY-UHFFFAOYSA-N 0.000 description 1
- DFJYZCUIKPGCSG-UHFFFAOYSA-N decanedinitrile Chemical compound N#CCCCCCCCCC#N DFJYZCUIKPGCSG-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- AVQYXBDAZWIFTO-UHFFFAOYSA-N dodecanedinitrile Chemical compound N#CCCCCCCCCCCC#N AVQYXBDAZWIFTO-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- ZLHYDRXTDZFRDZ-UHFFFAOYSA-N epsilon-aminocaproamide Chemical compound NCCCCCC(N)=O ZLHYDRXTDZFRDZ-UHFFFAOYSA-N 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- NJNQDCIAOXIFTB-UHFFFAOYSA-N ethyl 6-aminohexanoate Chemical compound CCOC(=O)CCCCCN NJNQDCIAOXIFTB-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000007792 gaseous phase Substances 0.000 description 1
- PWSKHLMYTZNYKO-UHFFFAOYSA-N heptane-1,7-diamine Chemical compound NCCCCCCCN PWSKHLMYTZNYKO-UHFFFAOYSA-N 0.000 description 1
- LLEVMYXEJUDBTA-UHFFFAOYSA-N heptanedinitrile Chemical compound N#CCCCCCC#N LLEVMYXEJUDBTA-UHFFFAOYSA-N 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000002706 hydrostatic effect Effects 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- TZJVWRXHKAXSEA-UHFFFAOYSA-N methyl 6-aminohexanoate Chemical compound COC(=O)CCCCCN TZJVWRXHKAXSEA-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- SXJVFQLYZSNZBT-UHFFFAOYSA-N nonane-1,9-diamine Chemical compound NCCCCCCCCCN SXJVFQLYZSNZBT-UHFFFAOYSA-N 0.000 description 1
- QXOYPGTWWXJFDI-UHFFFAOYSA-N nonanedinitrile Chemical compound N#CCCCCCCCC#N QXOYPGTWWXJFDI-UHFFFAOYSA-N 0.000 description 1
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 1
- BTNXBLUGMAMSSH-UHFFFAOYSA-N octanedinitrile Chemical compound N#CCCCCCCC#N BTNXBLUGMAMSSH-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000004886 process control Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005496 tempering Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910001930 tungsten oxide Inorganic materials 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/04—Preparatory processes
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/08—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from amino-carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/08—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from amino-carboxylic acids
- C08G69/14—Lactams
- C08G69/16—Preparatory processes
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/26—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids
- C08G69/28—Preparatory processes
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/36—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from amino acids, polyamines and polycarboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Polyamides (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10313681A DE10313681A1 (de) | 2003-03-26 | 2003-03-26 | Verfahren zur Herstellung von Polyamiden |
| MYPI20040965A MY139354A (en) | 2003-03-26 | 2004-03-18 | Method for producing polyamides |
| PL04721865T PL1611184T3 (pl) | 2003-03-26 | 2004-03-19 | Sposób wytwarzania poliamidów |
| US10/550,491 US20060235191A1 (en) | 2003-03-26 | 2004-03-19 | Method for producing polyamides |
| EP04721865A EP1611184B1 (de) | 2003-03-26 | 2004-03-19 | Verfahren zur herstellung von polyamiden |
| JP2006504741A JP4436360B2 (ja) | 2003-03-26 | 2004-03-19 | ポリアミドの製造方法 |
| CA002519816A CA2519816A1 (en) | 2003-03-26 | 2004-03-19 | Method for producing polyamides |
| CNB200480008122XA CN1329429C (zh) | 2003-03-26 | 2004-03-19 | 聚酰胺的生产方法 |
| KR1020057017851A KR101011062B1 (ko) | 2003-03-26 | 2004-03-19 | 폴리아미드의 제조 방법 |
| MXPA05009187A MXPA05009187A (es) | 2003-03-26 | 2004-03-19 | Procedimiento para la preparacion de poliamidas. |
| DE502004001613T DE502004001613D1 (de) | 2003-03-26 | 2004-03-19 | Verfahren zur herstellung von polyamiden |
| AT04721865T ATE340819T1 (de) | 2003-03-26 | 2004-03-19 | Verfahren zur herstellung von polyamiden |
| ES04721865T ES2273234T3 (es) | 2003-03-26 | 2004-03-19 | Procedimiento para la obtencion de poliamidas. |
| BRPI0408700-3A BRPI0408700B1 (pt) | 2003-03-26 | 2004-03-19 | Processo para a preparação de poliamidas, seus oligômeros ou suas misturas |
| PCT/EP2004/002875 WO2004085512A1 (de) | 2003-03-26 | 2004-03-19 | Verfahren zur herstellung von polyamiden |
| ARP040100994A AR043779A1 (es) | 2003-03-26 | 2004-03-25 | Procedimiento para la preparacion de poliamidas |
| TW093108312A TW200508280A (en) | 2003-03-26 | 2004-03-26 | Preparation of polyamides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10313681A DE10313681A1 (de) | 2003-03-26 | 2003-03-26 | Verfahren zur Herstellung von Polyamiden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE10313681A1 true DE10313681A1 (de) | 2004-10-07 |
Family
ID=32946208
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE10313681A Withdrawn DE10313681A1 (de) | 2003-03-26 | 2003-03-26 | Verfahren zur Herstellung von Polyamiden |
| DE502004001613T Expired - Lifetime DE502004001613D1 (de) | 2003-03-26 | 2004-03-19 | Verfahren zur herstellung von polyamiden |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE502004001613T Expired - Lifetime DE502004001613D1 (de) | 2003-03-26 | 2004-03-19 | Verfahren zur herstellung von polyamiden |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US20060235191A1 (https=) |
| EP (1) | EP1611184B1 (https=) |
| JP (1) | JP4436360B2 (https=) |
| KR (1) | KR101011062B1 (https=) |
| CN (1) | CN1329429C (https=) |
| AR (1) | AR043779A1 (https=) |
| AT (1) | ATE340819T1 (https=) |
| BR (1) | BRPI0408700B1 (https=) |
| CA (1) | CA2519816A1 (https=) |
| DE (2) | DE10313681A1 (https=) |
| ES (1) | ES2273234T3 (https=) |
| MX (1) | MXPA05009187A (https=) |
| MY (1) | MY139354A (https=) |
| PL (1) | PL1611184T3 (https=) |
| TW (1) | TW200508280A (https=) |
| WO (1) | WO2004085512A1 (https=) |
Cited By (86)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102008038411A1 (de) | 2007-09-11 | 2009-03-12 | Basf Se | Flammgeschützte Polyamide |
| DE102009011668A1 (de) | 2008-03-05 | 2009-09-10 | Basf Se | Polyamid und hyperverzweigte Polyesster enthaltende Formmasse |
| DE102008058246A1 (de) | 2008-11-19 | 2010-05-20 | Basf Se | Hochmolekulare Polyamide |
| EP2264093A1 (de) | 2009-06-16 | 2010-12-22 | THOR GmbH | Flammgeschützte Polyamidformmassen |
| WO2011000772A1 (de) | 2009-06-30 | 2011-01-06 | Basf Se | Polyamidfasern mit anfärbbaren partikeln und verfahren zu deren herstellung |
| WO2011000816A1 (de) | 2009-07-03 | 2011-01-06 | Basf Se | Nanokompositblends enthaltend polyamide und polyolefine |
| WO2011009877A1 (de) | 2009-07-24 | 2011-01-27 | Basf Se | Flammgeschützte polyamidformmassen |
| WO2011009798A1 (de) | 2009-07-21 | 2011-01-27 | Basf Se | Nanokompositblends auf basis von polyamiden und polyarylenethersulfonen |
| WO2011051123A1 (de) | 2009-10-27 | 2011-05-05 | Basf Se | Wärmealterungsbeständige polyamide |
| WO2011051121A1 (de) | 2009-10-27 | 2011-05-05 | Basf Se | Wärmealterungsbeständige polyamide mit flammschutz |
| US7960477B2 (en) | 2006-12-13 | 2011-06-14 | Basf Se | Polyamides with acrylate rubbers |
| WO2011069942A1 (de) | 2009-12-08 | 2011-06-16 | Basf Se | Teilaromatische copolyamidformmassen auf der basis von octamethylendiamin |
| WO2011069984A1 (de) | 2009-12-09 | 2011-06-16 | Basf Se | Teilaromatische, teilkristalline copolyamide |
| DE102010062886A1 (de) | 2009-12-16 | 2011-06-22 | Basf Se, 67063 | Polyarylenethersulfone als Schlagzähmodifier |
| WO2011110508A1 (de) | 2010-03-09 | 2011-09-15 | Basf Se | Wärmealterungsbeständige polyamide |
| WO2011134930A1 (de) | 2010-04-30 | 2011-11-03 | Basf Se | Langfaserverstärkte polyamide mit polyolefinen |
| DE102010023770A1 (de) | 2010-06-15 | 2011-12-15 | Basf Se | Glühdrahtbeständige Formmassen |
| WO2011157615A1 (de) | 2010-06-15 | 2011-12-22 | Basf Se | Wärmealterungsbeständige polyamide |
| WO2012013564A1 (de) | 2010-07-30 | 2012-02-02 | Basf Se | Flammgeschützte formmassen |
| EP2415827A1 (de) | 2010-08-04 | 2012-02-08 | Basf Se | Flammgeschützte Polyamide mit Schichtsilikaten |
| US8119718B2 (en) | 2008-06-27 | 2012-02-21 | Basf Se | Thermally conductive polyamides with diatomaceous earth |
| WO2012062594A1 (de) | 2010-11-11 | 2012-05-18 | Basf Se | Wärmealterungsbeständige polyamide |
| WO2012065977A1 (de) | 2010-11-18 | 2012-05-24 | Basf Se | Thermoplastische formmassen auf basis von styrolcopolymeren und polyamiden; verfahren zu deren herstellung und deren verwendung |
| WO2012080403A1 (de) | 2010-12-16 | 2012-06-21 | Basf Se | Glühdrahtbeständige polyamide |
| WO2012084785A1 (de) | 2010-12-20 | 2012-06-28 | Basf Se | Thermoplastische formmassen auf basis von styrol-copolymeren und polyamiden mit verbesserter tieftemperaturzähigkeit |
| WO2012098063A1 (de) | 2011-01-18 | 2012-07-26 | Basf Se | Hydrolysestabile polyamide |
| US8268920B2 (en) | 2008-12-16 | 2012-09-18 | Basf Se | Heat aging resistant polyamides |
| WO2012143316A1 (de) | 2011-04-21 | 2012-10-26 | Basf Se | Vorrichtung zur befestigung von wärmeträgerleitungen an einem behälter |
| WO2012146624A1 (de) | 2011-04-28 | 2012-11-01 | Basf Se | Flammgeschütze formmassen |
| EP2527402A1 (de) | 2011-05-27 | 2012-11-28 | Basf Se | Thermoplastische Formmasse |
| DE102011104303A1 (de) | 2011-06-03 | 2012-12-06 | Basf Se | Photovoltaik-System zur Installation auf Dächern mit Kunststoffträger und Photovoltaik-Modul |
| WO2013037647A1 (de) | 2011-09-15 | 2013-03-21 | Basf Se | Silber-zinkoxid-mischungen als stabilisator für flammgeschützte polyamide enthaltend roten phosphor |
| EP2573138A1 (de) | 2011-09-21 | 2013-03-27 | Basf Se | Polyamid-Formmassen |
| WO2013075982A1 (de) | 2011-11-25 | 2013-05-30 | Basf Se | Blasformbare polyamidformmassen |
| WO2013083508A1 (de) | 2011-12-07 | 2013-06-13 | Basf Se | Flammgeschützte polyamide mit flüssigkristallinen polyestern |
| US8466221B2 (en) | 2010-03-09 | 2013-06-18 | Basf Se | Polyamides that resist heat-aging |
| US8481652B2 (en) | 2007-12-18 | 2013-07-09 | Basf Se | Thermoplastic polyamides having polyether amines |
| WO2013124128A1 (de) | 2012-02-20 | 2013-08-29 | Basf Se | Cuo/zno-mischungen als stabilisatoren für flammgeschützte polyamide |
| EP2641939A1 (de) | 2012-03-21 | 2013-09-25 | Basf Se | Hellgefärbte flammgeschützte Polyamide |
| EP2650331A1 (de) | 2012-04-11 | 2013-10-16 | Basf Se | Polyamide für Trinkwasseranwendungen |
| US8563680B2 (en) | 2010-06-15 | 2013-10-22 | Basf Se | Heat-aging-resistant polyamides |
| US8575295B2 (en) | 2010-12-16 | 2013-11-05 | Basf Se | Glow-wire resistant polyamides |
| WO2013189676A1 (de) | 2012-06-18 | 2013-12-27 | Basf Se | Flammgeschützte polyamide mit polyacrylnitrilhomopolymerisaten |
| US8629206B2 (en) | 2011-01-20 | 2014-01-14 | Basf Se | Flame-retardant thermoplastic molding composition |
| US8629220B2 (en) | 2011-01-18 | 2014-01-14 | Basf Se | Hydrolysis-resistant polyamides |
| US8653168B2 (en) | 2011-05-10 | 2014-02-18 | Basf Se | Flame-retardant thermoplastic molding composition |
| WO2014044471A1 (de) | 2012-09-19 | 2014-03-27 | Basf Se | Flammgeschützte polyamide mit heller farbe |
| US8883904B2 (en) | 2011-09-15 | 2014-11-11 | Basf Se | Mixtures of silver and zinc oxide as stabilizer for flame-retardant polyamides |
| DE102014215370A1 (de) | 2013-09-05 | 2015-03-05 | Basf Se | Langfaserverstärkte flammgeschützte Polyamide |
| US8987357B2 (en) | 2011-05-27 | 2015-03-24 | Basf Se | Thermoplastic molding composition |
| WO2016087324A1 (de) | 2014-12-01 | 2016-06-09 | Basf Se | Flammgeschützte polyamide mit sulfonsäuresalzen |
| WO2016087351A1 (en) | 2014-12-01 | 2016-06-09 | Basf Se | Thermoplastic polyamide particles |
| WO2016166140A1 (de) | 2015-04-16 | 2016-10-20 | Basf Se | Polyamide mit besseren optischen eigenschaften |
| WO2016202577A1 (en) | 2015-06-19 | 2016-12-22 | Basf Se | Polyamide compositions with high melt flow and good mechanical properties |
| EP3118247A1 (de) | 2015-07-15 | 2017-01-18 | Basf Se | Polyamide mit besseren optischen eigenschaften |
| EP3130633A1 (de) | 2015-08-13 | 2017-02-15 | Basf Se | Polyamide mit guter mechanik und schwindung |
| EP3135730A1 (de) | 2015-08-27 | 2017-03-01 | Basf Se | Polyamide mit niedrigem kristallisationspunkt und geringer schwindung |
| WO2017186677A1 (en) | 2016-04-26 | 2017-11-02 | Basf Se | Thermoplastic polyamide particles |
| US9828503B2 (en) | 2013-04-15 | 2017-11-28 | Basf Se | Glow wire resistant polyamides |
| WO2017216023A1 (de) | 2016-06-15 | 2017-12-21 | Basf Se | Schlagzähmodifier basierend auf polyisobuten für polyamide |
| WO2017216209A1 (en) | 2016-06-15 | 2017-12-21 | Basf Se | Polyamide dispersion in polyol and preparation thereof |
| WO2018069055A1 (de) | 2016-10-13 | 2018-04-19 | Basf Se | Flammgeschützte polyamide |
| WO2018141552A1 (en) | 2017-02-01 | 2018-08-09 | Basf Se | Polyarylene ether sulfone comprising naphthalic acid anhydride endgroups |
| WO2018158224A1 (de) | 2017-03-01 | 2018-09-07 | Basf Se | Flammgeschuetzte polyamide mit pvp |
| WO2018234429A1 (de) | 2017-06-22 | 2018-12-27 | Basf Se | Polyamide mit phosphor und al-phosphonaten |
| WO2019197511A1 (en) | 2018-04-13 | 2019-10-17 | Basf Se | Flame-retardant thermoplastic molding composition |
| WO2020035455A1 (en) | 2018-08-16 | 2020-02-20 | Basf Se | Thermoplastic molding material |
| WO2020169547A1 (de) | 2019-02-20 | 2020-08-27 | Basf Se | Thermoplastische formmasse |
| WO2020173766A1 (de) | 2019-02-25 | 2020-09-03 | Basf Se | Thermoplastische formmasse |
| US10781404B2 (en) | 2014-12-01 | 2020-09-22 | Xeros Limited | Cleaning method, apparatus and use |
| WO2021043859A1 (en) | 2019-09-05 | 2021-03-11 | Basf Se | Thermoplastic molding compositions that resist heat |
| EP3808810A1 (de) | 2019-10-16 | 2021-04-21 | INEOS Styrolution Group GmbH | Thermoplastische formmassen für rotomolding-verfahren |
| WO2021151850A1 (en) | 2020-01-27 | 2021-08-05 | Basf Se | Thermoplastic polyamide molding compositions that resist heat |
| WO2021170715A1 (en) | 2020-02-26 | 2021-09-02 | Basf Se | Heat-aging resistant polyamide molding compositions |
| WO2021185949A1 (en) | 2020-03-20 | 2021-09-23 | Basf Se | Plasticized polyamide molding compositions |
| WO2021191209A1 (en) | 2020-03-25 | 2021-09-30 | Basf Se | Heat-aging resistant polyamide molding compositions |
| WO2022180221A1 (en) | 2021-02-25 | 2022-09-01 | Basf Se | Polymers having improved thermal conductivity |
| WO2022238213A1 (de) | 2021-05-11 | 2022-11-17 | Basf Se | LASERBESCHRIFTETE UND LASERVERSCHWEIßTE FORMKÖRPER UND DEREN HERSTELLUNG |
| WO2022254022A1 (en) | 2021-06-04 | 2022-12-08 | Basf Se | Thermoplastic moulding composition retaining high gloss |
| WO2023237603A1 (en) | 2022-06-08 | 2023-12-14 | Basf Se | Recycling method for producing a polyamide compound |
| WO2024068508A1 (en) | 2022-09-27 | 2024-04-04 | Basf Se | Thermoplastic moulding compositions having an improved colour stability-3 |
| WO2024068509A1 (en) | 2022-09-27 | 2024-04-04 | Basf Se | Thermoplastic moulding compositions having an improved colour stability-1 |
| WO2024104965A1 (en) | 2022-11-17 | 2024-05-23 | Basf Se | Mixed metal-oxide compositions as stabilizer for flame retardant polyamides |
| WO2025049564A1 (en) | 2023-08-29 | 2025-03-06 | Basf Se | Polyamide molding compositions with improved heat-aging resistance |
| WO2025252781A1 (en) | 2024-06-05 | 2025-12-11 | Basf Se | Flame retardant polyamides for improved lsr compression set |
| EP4722289A1 (en) | 2024-10-02 | 2026-04-08 | Evonik Oxeno GmbH & Co. KG | Polyamide composition |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102004006955A1 (de) * | 2004-02-12 | 2005-09-01 | Basf Ag | Kontinuierliches Verfahren zur Herstellung von Polyamiden |
| DE102005040656A1 (de) * | 2005-08-26 | 2007-03-01 | Basf Ag | Verfahren zur Herstellung von Polyamiden |
| DE102005049297A1 (de) * | 2005-10-12 | 2007-04-19 | Basf Ag | Flammgeschützte Formmassen |
| US8309221B2 (en) * | 2007-10-01 | 2012-11-13 | Jay Plaehn | Reinforced foam panel |
| JP2011526315A (ja) * | 2008-07-02 | 2011-10-06 | ビーエーエスエフ ソシエタス・ヨーロピア | 発泡性ポリアミド |
| GB201320518D0 (en) | 2013-11-20 | 2014-01-01 | Invista Tech Sarl | Continuous polyamidation process - II |
| GB201320520D0 (en) | 2013-11-20 | 2014-01-01 | Invista Tech Sarl | Continuous polyamidation process - I |
| US10995994B2 (en) * | 2014-03-31 | 2021-05-04 | Hamilton Sunstrand Corporation | Outlet header of heat exchanger |
| CN110937982B (zh) * | 2018-09-25 | 2023-01-10 | 中国石油化工股份有限公司 | 一种制备对叔丁基苯酚的方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19808407A1 (de) * | 1998-02-27 | 1999-09-09 | Basf Ag | Herstellung von Polyamiden durch Reaktivdestillation |
| WO2000024808A1 (en) * | 1998-10-26 | 2000-05-04 | E.I. Du Pont De Nemours And Company | Continuous polymerization process for preparing polyamides from omega-aminonitriles |
| DE10120801A1 (de) * | 2001-04-27 | 2002-11-07 | Basf Ag | Reaktor für gas/flüssig oder gas/flüssig/fest-Reaktionen |
| US6472501B1 (en) * | 2001-06-01 | 2002-10-29 | E. I. Du Pont De Nemours And Company | Process for making nylon 6,6 |
| US6437089B1 (en) * | 2001-06-01 | 2002-08-20 | E. I. Du Pont De Nemours And Company | Process for the production of nylon 6 |
| US6479620B1 (en) * | 2001-06-01 | 2002-11-12 | E. I. Du Pont De Nemours And Company | Process for converting caprolactam to nylon 6 |
-
2003
- 2003-03-26 DE DE10313681A patent/DE10313681A1/de not_active Withdrawn
-
2004
- 2004-03-18 MY MYPI20040965A patent/MY139354A/en unknown
- 2004-03-19 MX MXPA05009187A patent/MXPA05009187A/es active IP Right Grant
- 2004-03-19 ES ES04721865T patent/ES2273234T3/es not_active Expired - Lifetime
- 2004-03-19 US US10/550,491 patent/US20060235191A1/en not_active Abandoned
- 2004-03-19 CN CNB200480008122XA patent/CN1329429C/zh not_active Expired - Lifetime
- 2004-03-19 DE DE502004001613T patent/DE502004001613D1/de not_active Expired - Lifetime
- 2004-03-19 WO PCT/EP2004/002875 patent/WO2004085512A1/de not_active Ceased
- 2004-03-19 PL PL04721865T patent/PL1611184T3/pl unknown
- 2004-03-19 JP JP2006504741A patent/JP4436360B2/ja not_active Expired - Fee Related
- 2004-03-19 BR BRPI0408700-3A patent/BRPI0408700B1/pt not_active IP Right Cessation
- 2004-03-19 AT AT04721865T patent/ATE340819T1/de not_active IP Right Cessation
- 2004-03-19 CA CA002519816A patent/CA2519816A1/en not_active Abandoned
- 2004-03-19 EP EP04721865A patent/EP1611184B1/de not_active Expired - Lifetime
- 2004-03-19 KR KR1020057017851A patent/KR101011062B1/ko not_active Expired - Fee Related
- 2004-03-25 AR ARP040100994A patent/AR043779A1/es unknown
- 2004-03-26 TW TW093108312A patent/TW200508280A/zh unknown
Cited By (100)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7960477B2 (en) | 2006-12-13 | 2011-06-14 | Basf Se | Polyamides with acrylate rubbers |
| DE102008038411A1 (de) | 2007-09-11 | 2009-03-12 | Basf Se | Flammgeschützte Polyamide |
| US8481652B2 (en) | 2007-12-18 | 2013-07-09 | Basf Se | Thermoplastic polyamides having polyether amines |
| DE102009011668A1 (de) | 2008-03-05 | 2009-09-10 | Basf Se | Polyamid und hyperverzweigte Polyesster enthaltende Formmasse |
| US8119718B2 (en) | 2008-06-27 | 2012-02-21 | Basf Se | Thermally conductive polyamides with diatomaceous earth |
| DE102008058246A1 (de) | 2008-11-19 | 2010-05-20 | Basf Se | Hochmolekulare Polyamide |
| US8268920B2 (en) | 2008-12-16 | 2012-09-18 | Basf Se | Heat aging resistant polyamides |
| EP2264093A1 (de) | 2009-06-16 | 2010-12-22 | THOR GmbH | Flammgeschützte Polyamidformmassen |
| US9080259B2 (en) | 2009-06-30 | 2015-07-14 | Basf Se | Polyamide fibers with dyeable particles and production thereof |
| WO2011000772A1 (de) | 2009-06-30 | 2011-01-06 | Basf Se | Polyamidfasern mit anfärbbaren partikeln und verfahren zu deren herstellung |
| WO2011000816A1 (de) | 2009-07-03 | 2011-01-06 | Basf Se | Nanokompositblends enthaltend polyamide und polyolefine |
| WO2011009798A1 (de) | 2009-07-21 | 2011-01-27 | Basf Se | Nanokompositblends auf basis von polyamiden und polyarylenethersulfonen |
| WO2011009877A1 (de) | 2009-07-24 | 2011-01-27 | Basf Se | Flammgeschützte polyamidformmassen |
| WO2011051123A1 (de) | 2009-10-27 | 2011-05-05 | Basf Se | Wärmealterungsbeständige polyamide |
| WO2011051121A1 (de) | 2009-10-27 | 2011-05-05 | Basf Se | Wärmealterungsbeständige polyamide mit flammschutz |
| WO2011069942A1 (de) | 2009-12-08 | 2011-06-16 | Basf Se | Teilaromatische copolyamidformmassen auf der basis von octamethylendiamin |
| WO2011069984A1 (de) | 2009-12-09 | 2011-06-16 | Basf Se | Teilaromatische, teilkristalline copolyamide |
| US9109085B2 (en) | 2009-12-09 | 2015-08-18 | Basf Se | Semi-aromatic, semi-crystalline copolyamides |
| DE102010062886A1 (de) | 2009-12-16 | 2011-06-22 | Basf Se, 67063 | Polyarylenethersulfone als Schlagzähmodifier |
| US8466221B2 (en) | 2010-03-09 | 2013-06-18 | Basf Se | Polyamides that resist heat-aging |
| WO2011110508A1 (de) | 2010-03-09 | 2011-09-15 | Basf Se | Wärmealterungsbeständige polyamide |
| WO2011134930A1 (de) | 2010-04-30 | 2011-11-03 | Basf Se | Langfaserverstärkte polyamide mit polyolefinen |
| US8563680B2 (en) | 2010-06-15 | 2013-10-22 | Basf Se | Heat-aging-resistant polyamides |
| DE102010023770A1 (de) | 2010-06-15 | 2011-12-15 | Basf Se | Glühdrahtbeständige Formmassen |
| WO2011157615A1 (de) | 2010-06-15 | 2011-12-22 | Basf Se | Wärmealterungsbeständige polyamide |
| WO2012013564A1 (de) | 2010-07-30 | 2012-02-02 | Basf Se | Flammgeschützte formmassen |
| EP2415827A1 (de) | 2010-08-04 | 2012-02-08 | Basf Se | Flammgeschützte Polyamide mit Schichtsilikaten |
| WO2012062594A1 (de) | 2010-11-11 | 2012-05-18 | Basf Se | Wärmealterungsbeständige polyamide |
| WO2012065977A1 (de) | 2010-11-18 | 2012-05-24 | Basf Se | Thermoplastische formmassen auf basis von styrolcopolymeren und polyamiden; verfahren zu deren herstellung und deren verwendung |
| WO2012080403A1 (de) | 2010-12-16 | 2012-06-21 | Basf Se | Glühdrahtbeständige polyamide |
| US8575295B2 (en) | 2010-12-16 | 2013-11-05 | Basf Se | Glow-wire resistant polyamides |
| WO2012084785A1 (de) | 2010-12-20 | 2012-06-28 | Basf Se | Thermoplastische formmassen auf basis von styrol-copolymeren und polyamiden mit verbesserter tieftemperaturzähigkeit |
| US8629220B2 (en) | 2011-01-18 | 2014-01-14 | Basf Se | Hydrolysis-resistant polyamides |
| WO2012098063A1 (de) | 2011-01-18 | 2012-07-26 | Basf Se | Hydrolysestabile polyamide |
| US8629206B2 (en) | 2011-01-20 | 2014-01-14 | Basf Se | Flame-retardant thermoplastic molding composition |
| WO2012143316A1 (de) | 2011-04-21 | 2012-10-26 | Basf Se | Vorrichtung zur befestigung von wärmeträgerleitungen an einem behälter |
| WO2012146624A1 (de) | 2011-04-28 | 2012-11-01 | Basf Se | Flammgeschütze formmassen |
| US8653168B2 (en) | 2011-05-10 | 2014-02-18 | Basf Se | Flame-retardant thermoplastic molding composition |
| US8987357B2 (en) | 2011-05-27 | 2015-03-24 | Basf Se | Thermoplastic molding composition |
| WO2012163680A1 (de) | 2011-05-27 | 2012-12-06 | Basf Se | Thermoplastische formmasse |
| EP2527402A1 (de) | 2011-05-27 | 2012-11-28 | Basf Se | Thermoplastische Formmasse |
| WO2012163457A2 (de) | 2011-06-03 | 2012-12-06 | Basf Se | Photovoltaik-system zur installation auf dächern mit kunststoffträger und photovoltaik-modul |
| DE102011104303A1 (de) | 2011-06-03 | 2012-12-06 | Basf Se | Photovoltaik-System zur Installation auf Dächern mit Kunststoffträger und Photovoltaik-Modul |
| US8883904B2 (en) | 2011-09-15 | 2014-11-11 | Basf Se | Mixtures of silver and zinc oxide as stabilizer for flame-retardant polyamides |
| WO2013037647A1 (de) | 2011-09-15 | 2013-03-21 | Basf Se | Silber-zinkoxid-mischungen als stabilisator für flammgeschützte polyamide enthaltend roten phosphor |
| EP2573138A1 (de) | 2011-09-21 | 2013-03-27 | Basf Se | Polyamid-Formmassen |
| WO2013041422A1 (de) | 2011-09-21 | 2013-03-28 | Basf Se | Polyamid-formmassen |
| WO2013075982A1 (de) | 2011-11-25 | 2013-05-30 | Basf Se | Blasformbare polyamidformmassen |
| US10655013B2 (en) | 2011-11-25 | 2020-05-19 | Basf Se | Blow-moldable polyamide compositions |
| WO2013083508A1 (de) | 2011-12-07 | 2013-06-13 | Basf Se | Flammgeschützte polyamide mit flüssigkristallinen polyestern |
| WO2013124128A1 (de) | 2012-02-20 | 2013-08-29 | Basf Se | Cuo/zno-mischungen als stabilisatoren für flammgeschützte polyamide |
| EP2641939A1 (de) | 2012-03-21 | 2013-09-25 | Basf Se | Hellgefärbte flammgeschützte Polyamide |
| WO2013139827A1 (de) | 2012-03-21 | 2013-09-26 | Basf Se | Hellgefärbte flammgeschützte polyamide |
| EP2650331A1 (de) | 2012-04-11 | 2013-10-16 | Basf Se | Polyamide für Trinkwasseranwendungen |
| WO2013189676A1 (de) | 2012-06-18 | 2013-12-27 | Basf Se | Flammgeschützte polyamide mit polyacrylnitrilhomopolymerisaten |
| WO2014044471A1 (de) | 2012-09-19 | 2014-03-27 | Basf Se | Flammgeschützte polyamide mit heller farbe |
| US9828503B2 (en) | 2013-04-15 | 2017-11-28 | Basf Se | Glow wire resistant polyamides |
| DE102014215370A1 (de) | 2013-09-05 | 2015-03-05 | Basf Se | Langfaserverstärkte flammgeschützte Polyamide |
| WO2016087351A1 (en) | 2014-12-01 | 2016-06-09 | Basf Se | Thermoplastic polyamide particles |
| US10781404B2 (en) | 2014-12-01 | 2020-09-22 | Xeros Limited | Cleaning method, apparatus and use |
| WO2016087324A1 (de) | 2014-12-01 | 2016-06-09 | Basf Se | Flammgeschützte polyamide mit sulfonsäuresalzen |
| WO2016166140A1 (de) | 2015-04-16 | 2016-10-20 | Basf Se | Polyamide mit besseren optischen eigenschaften |
| US11674015B2 (en) | 2015-04-16 | 2023-06-13 | Basf Se | Polyamides with improved optical properties |
| WO2016202577A1 (en) | 2015-06-19 | 2016-12-22 | Basf Se | Polyamide compositions with high melt flow and good mechanical properties |
| US10669394B2 (en) | 2015-06-19 | 2020-06-02 | Basf Se | Polyamide compositions with high melt flow and good mechanical properties |
| EP3118247A1 (de) | 2015-07-15 | 2017-01-18 | Basf Se | Polyamide mit besseren optischen eigenschaften |
| EP3130633A1 (de) | 2015-08-13 | 2017-02-15 | Basf Se | Polyamide mit guter mechanik und schwindung |
| EP3135730A1 (de) | 2015-08-27 | 2017-03-01 | Basf Se | Polyamide mit niedrigem kristallisationspunkt und geringer schwindung |
| WO2017186677A1 (en) | 2016-04-26 | 2017-11-02 | Basf Se | Thermoplastic polyamide particles |
| US11401382B2 (en) | 2016-04-26 | 2022-08-02 | Basf Se | Thermoplastic polyamide particles |
| WO2017216023A1 (de) | 2016-06-15 | 2017-12-21 | Basf Se | Schlagzähmodifier basierend auf polyisobuten für polyamide |
| WO2017216209A1 (en) | 2016-06-15 | 2017-12-21 | Basf Se | Polyamide dispersion in polyol and preparation thereof |
| US10731035B2 (en) | 2016-06-15 | 2020-08-04 | Basf Se | Impact modifier based on polyisobutane for polyamides |
| WO2018069055A1 (de) | 2016-10-13 | 2018-04-19 | Basf Se | Flammgeschützte polyamide |
| US11193020B2 (en) | 2017-02-01 | 2021-12-07 | Basf Se | Polyarylene ether sulfone comprising naphthalic acid anhydride endgroups |
| WO2018141552A1 (en) | 2017-02-01 | 2018-08-09 | Basf Se | Polyarylene ether sulfone comprising naphthalic acid anhydride endgroups |
| WO2018158224A1 (de) | 2017-03-01 | 2018-09-07 | Basf Se | Flammgeschuetzte polyamide mit pvp |
| WO2018234429A1 (de) | 2017-06-22 | 2018-12-27 | Basf Se | Polyamide mit phosphor und al-phosphonaten |
| US11859068B2 (en) | 2017-06-22 | 2024-01-02 | Basf Se | Polyamides with phosphorous and al-phosphonates |
| WO2019197511A1 (en) | 2018-04-13 | 2019-10-17 | Basf Se | Flame-retardant thermoplastic molding composition |
| WO2020035455A1 (en) | 2018-08-16 | 2020-02-20 | Basf Se | Thermoplastic molding material |
| WO2020169547A1 (de) | 2019-02-20 | 2020-08-27 | Basf Se | Thermoplastische formmasse |
| WO2020173766A1 (de) | 2019-02-25 | 2020-09-03 | Basf Se | Thermoplastische formmasse |
| WO2021043859A1 (en) | 2019-09-05 | 2021-03-11 | Basf Se | Thermoplastic molding compositions that resist heat |
| EP3808810A1 (de) | 2019-10-16 | 2021-04-21 | INEOS Styrolution Group GmbH | Thermoplastische formmassen für rotomolding-verfahren |
| WO2021151850A1 (en) | 2020-01-27 | 2021-08-05 | Basf Se | Thermoplastic polyamide molding compositions that resist heat |
| WO2021170715A1 (en) | 2020-02-26 | 2021-09-02 | Basf Se | Heat-aging resistant polyamide molding compositions |
| WO2021185949A1 (en) | 2020-03-20 | 2021-09-23 | Basf Se | Plasticized polyamide molding compositions |
| WO2021191209A1 (en) | 2020-03-25 | 2021-09-30 | Basf Se | Heat-aging resistant polyamide molding compositions |
| WO2022180221A1 (en) | 2021-02-25 | 2022-09-01 | Basf Se | Polymers having improved thermal conductivity |
| WO2022238213A1 (de) | 2021-05-11 | 2022-11-17 | Basf Se | LASERBESCHRIFTETE UND LASERVERSCHWEIßTE FORMKÖRPER UND DEREN HERSTELLUNG |
| WO2022254022A1 (en) | 2021-06-04 | 2022-12-08 | Basf Se | Thermoplastic moulding composition retaining high gloss |
| WO2023237603A1 (en) | 2022-06-08 | 2023-12-14 | Basf Se | Recycling method for producing a polyamide compound |
| WO2024068508A1 (en) | 2022-09-27 | 2024-04-04 | Basf Se | Thermoplastic moulding compositions having an improved colour stability-3 |
| WO2024068509A1 (en) | 2022-09-27 | 2024-04-04 | Basf Se | Thermoplastic moulding compositions having an improved colour stability-1 |
| WO2024104965A1 (en) | 2022-11-17 | 2024-05-23 | Basf Se | Mixed metal-oxide compositions as stabilizer for flame retardant polyamides |
| WO2025049564A1 (en) | 2023-08-29 | 2025-03-06 | Basf Se | Polyamide molding compositions with improved heat-aging resistance |
| WO2025252781A1 (en) | 2024-06-05 | 2025-12-11 | Basf Se | Flame retardant polyamides for improved lsr compression set |
| EP4722289A1 (en) | 2024-10-02 | 2026-04-08 | Evonik Oxeno GmbH & Co. KG | Polyamide composition |
| WO2026073751A1 (en) | 2024-10-02 | 2026-04-09 | Evonik Oxeno Gmbh & Co. Kg | Polyamide composition |
Also Published As
| Publication number | Publication date |
|---|---|
| ATE340819T1 (de) | 2006-10-15 |
| DE502004001613D1 (de) | 2006-11-09 |
| EP1611184B1 (de) | 2006-09-27 |
| KR20050118203A (ko) | 2005-12-15 |
| CN1764683A (zh) | 2006-04-26 |
| US20060235191A1 (en) | 2006-10-19 |
| CA2519816A1 (en) | 2004-10-07 |
| EP1611184A1 (de) | 2006-01-04 |
| BRPI0408700B1 (pt) | 2014-01-14 |
| MY139354A (en) | 2009-09-30 |
| KR101011062B1 (ko) | 2011-01-25 |
| JP2006521432A (ja) | 2006-09-21 |
| TW200508280A (en) | 2005-03-01 |
| AR043779A1 (es) | 2005-08-10 |
| PL1611184T3 (pl) | 2007-02-28 |
| CN1329429C (zh) | 2007-08-01 |
| MXPA05009187A (es) | 2005-10-18 |
| ES2273234T3 (es) | 2007-05-01 |
| BRPI0408700A (pt) | 2006-03-07 |
| JP4436360B2 (ja) | 2010-03-24 |
| WO2004085512A1 (de) | 2004-10-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1611184B1 (de) | Verfahren zur herstellung von polyamiden | |
| EP0922065B1 (de) | Verfahren zur herstellung von polyamiden aus aminonitrilen | |
| KR102396141B1 (ko) | 연속적인 폴리아미드화 방법-ii | |
| EP0866826A2 (de) | Verfahren und vorrichtung zur vereinheitlichten, kontinuierlichen herstellung von polyamiden | |
| KR102298409B1 (ko) | 연속적인 폴리아미드화 방법-i | |
| EP1058704B1 (de) | Herstellung von polyamiden durch reaktivdestillation | |
| DE2410474A1 (de) | Herstellung von polyamiden durch kontinuierliche polymerisation | |
| DE69925013T2 (de) | Kontinuierliches polymerisationsverfahren zur herstellung von polyamiden aus omega-aminonitrilen | |
| DE69921120T2 (de) | Kontinuierliches verfahren zur polyamidherstellung | |
| DE60209499T2 (de) | Verfahren zur herstellung von nylon 6,6 | |
| DE102005040656A1 (de) | Verfahren zur Herstellung von Polyamiden | |
| EP1053275B1 (de) | Kontinuierliches verfahren zur herstellung von polyamiden aus aminonitrilen | |
| EP1723192B1 (de) | Kontinuierliches verfahren zur herstellung von polyamiden | |
| EP1181324B1 (de) | Verfahren zur herstellung von polyamiden | |
| DE10313682A1 (de) | Verfahren zur Herstellung von Polyamiden | |
| EP1242506A1 (de) | Verfahren zur herstellung von polyamiden | |
| DE19709390A1 (de) | Verfahren zur Herstellung von Polyamiden aus Aminonitrilen | |
| EP1756208A1 (de) | Verfahren zur abtrennung von ammoniak und wasser aus gemischen, die bei der herstellung von polyamiden entstehen | |
| EP1658321A1 (de) | Verfahren zur herstellung von polyamiden | |
| MXPA00008338A (en) | Production of polyamides by reactive distillation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |