DE1010276B - Verfahren zur Polymerisation von Acrylnitril - Google Patents
Verfahren zur Polymerisation von AcrylnitrilInfo
- Publication number
- DE1010276B DE1010276B DED15085A DED0015085A DE1010276B DE 1010276 B DE1010276 B DE 1010276B DE D15085 A DED15085 A DE D15085A DE D0015085 A DED0015085 A DE D0015085A DE 1010276 B DE1010276 B DE 1010276B
- Authority
- DE
- Germany
- Prior art keywords
- weight
- polymer
- solution
- acrylonitrile
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 title claims description 15
- 238000006116 polymerization reaction Methods 0.000 title claims description 15
- 238000000034 method Methods 0.000 title claims description 8
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 36
- 229920000642 polymer Polymers 0.000 claims description 29
- 239000011592 zinc chloride Substances 0.000 claims description 18
- 235000005074 zinc chloride Nutrition 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 17
- 239000000178 monomer Substances 0.000 claims description 12
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 claims description 10
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 6
- 229910001431 copper ion Inorganic materials 0.000 claims description 5
- 229910001629 magnesium chloride Inorganic materials 0.000 claims description 5
- 239000001110 calcium chloride Substances 0.000 claims description 4
- 229910001628 calcium chloride Inorganic materials 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- 239000002075 main ingredient Substances 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 229920000915 polyvinyl chloride Polymers 0.000 claims 1
- 239000000243 solution Substances 0.000 description 32
- 239000010949 copper Substances 0.000 description 13
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 10
- 229910052802 copper Inorganic materials 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 239000012266 salt solution Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- 238000009987 spinning Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 2
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 2
- 239000012086 standard solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VNDYJBBGRKZCSX-UHFFFAOYSA-L zinc bromide Chemical compound Br[Zn]Br VNDYJBBGRKZCSX-UHFFFAOYSA-L 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229940102001 zinc bromide Drugs 0.000 description 1
- -1 zinc halides Chemical class 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F20/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and only one being terminated by only one carboxyl radical or a salt, anhydride, ester, amide, imide or nitrile thereof
- C08F20/02—Monocarboxylic acids having less than ten carbon atoms, Derivatives thereof
- C08F20/42—Nitriles
- C08F20/44—Acrylonitrile
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/12—Polymerisation in non-solvents
- C08F2/16—Aqueous medium
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US306310A US2763636A (en) | 1952-08-25 | 1952-08-25 | Method of controlling molecular weight of polyacrylonitrile produced in aqueous salt solutions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1010276B true DE1010276B (de) | 1957-06-13 |
Family
ID=23184733
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DED15085A Pending DE1010276B (de) | 1952-08-25 | 1953-05-18 | Verfahren zur Polymerisation von Acrylnitril |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2763636A (enExample) |
| BE (1) | BE520071A (enExample) |
| CH (1) | CH317133A (enExample) |
| DE (1) | DE1010276B (enExample) |
| FR (1) | FR1082731A (enExample) |
| GB (1) | GB725751A (enExample) |
| NL (1) | NL80986C (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1183686B (de) * | 1960-07-09 | 1964-12-17 | Toho Rayon Kabushiki Kaisha | Verfahren zur Herstellung von verspinnbaren Polyacrylnitrilloesungen |
| DE1191965B (de) * | 1958-11-24 | 1965-04-29 | Artur Stoy Dipl Ing | Verfahren zur Herstellung von spinnfaehigen Loesungen von Polymeren bzw. Copolymeren des Acrylnitrils in konzentrierten waessrigen Salzloesungen |
| DE1211162B (de) * | 1959-10-31 | 1966-02-24 | Hans J Zimmer Verfahrenstechni | Verfahren zur Entfernung der in reinem, wasserfreiem Acrylsaeurenitril vorhandenen Spuren Kupfer |
| DE1570959B1 (de) * | 1964-03-23 | 1970-06-25 | Ministerul Ind Petrolului | Verfahren zur Herstellung von Polyacrylnitril |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2837492A (en) * | 1954-02-10 | 1958-06-03 | Dow Chemical Co | Process of making colorless aqueous saline solutions of polyacrylonitrile |
| NL99693C (enExample) * | 1957-01-17 | |||
| US3112295A (en) * | 1959-03-05 | 1963-11-26 | Du Pont | Emulsion polymerization of water-soluble with water-insoluble monomers |
| US3287307A (en) * | 1965-03-29 | 1966-11-22 | Toho Rayon Kk | Method for preparation of the solution of acrylonitrile polymer |
| US3282878A (en) * | 1965-07-26 | 1966-11-01 | Dow Chemical Co | High acrylonitrile polymer solutions containing 2, 4, 6-trichlorophenol |
| US3282877A (en) * | 1965-07-26 | 1966-11-01 | Dow Chemical Co | High acrylonitrile polymer solutions containing brominated salicylanilides |
| US3284395A (en) * | 1965-07-26 | 1966-11-08 | Dow Chemical Co | High acrylonitrile polymer solutions containing a mixture of monochlorinated orthophenylphenols |
| CS148810B1 (enExample) * | 1969-06-13 | 1973-05-24 | ||
| US4123406A (en) * | 1970-03-26 | 1978-10-31 | Ceskoslovenska Akademie Ved | Method of preparing shaped articles from cross-linked hydrogels |
| US4172823A (en) * | 1970-03-26 | 1979-10-30 | Ceskoslovenska Akademie Ved | Method of preparing cross-linked hydrogels |
| US4725364A (en) * | 1982-04-05 | 1988-02-16 | Basf Corporation | Laminar flow filtration process |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR923712A (fr) * | 1945-02-09 | 1947-07-16 | Du Pont | Polymérisation de composés monoéthyléniques |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB555569A (enExample) * | 1940-04-26 | |||
| US2379431A (en) * | 1941-06-27 | 1945-07-03 | Goodrich Co B F | Polymerization of butadienes |
| US2477784A (en) * | 1944-03-06 | 1949-08-02 | Dow Chemical Co | Polymerization of vinyl aromatic compounds |
| GB599472A (en) * | 1945-09-18 | 1948-03-12 | Michael Carr Ashworth | Improved method of polymerisation |
| US2486943A (en) * | 1946-08-31 | 1949-11-01 | Montclair Res Corp | Polymerization process in aqueous thiocyanate solutions |
| US2601293A (en) * | 1950-04-01 | 1952-06-24 | Du Pont | Polymerization initiation systems comprising a hydrazone, a peroxy compound, and cupric ion |
| US2648647A (en) * | 1951-05-28 | 1953-08-11 | Dow Chemical Co | Polymerizing acrylonitrile in aqueous mixed salts |
-
0
- BE BE520071D patent/BE520071A/xx unknown
- NL NL80986D patent/NL80986C/xx active
-
1952
- 1952-08-25 US US306310A patent/US2763636A/en not_active Expired - Lifetime
-
1953
- 1953-05-18 DE DED15085A patent/DE1010276B/de active Pending
- 1953-05-18 FR FR1082731D patent/FR1082731A/fr not_active Expired
- 1953-05-19 CH CH317133D patent/CH317133A/de unknown
- 1953-06-01 GB GB15256/53A patent/GB725751A/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR923712A (fr) * | 1945-02-09 | 1947-07-16 | Du Pont | Polymérisation de composés monoéthyléniques |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1191965B (de) * | 1958-11-24 | 1965-04-29 | Artur Stoy Dipl Ing | Verfahren zur Herstellung von spinnfaehigen Loesungen von Polymeren bzw. Copolymeren des Acrylnitrils in konzentrierten waessrigen Salzloesungen |
| DE1211162B (de) * | 1959-10-31 | 1966-02-24 | Hans J Zimmer Verfahrenstechni | Verfahren zur Entfernung der in reinem, wasserfreiem Acrylsaeurenitril vorhandenen Spuren Kupfer |
| DE1183686B (de) * | 1960-07-09 | 1964-12-17 | Toho Rayon Kabushiki Kaisha | Verfahren zur Herstellung von verspinnbaren Polyacrylnitrilloesungen |
| DE1570959B1 (de) * | 1964-03-23 | 1970-06-25 | Ministerul Ind Petrolului | Verfahren zur Herstellung von Polyacrylnitril |
Also Published As
| Publication number | Publication date |
|---|---|
| BE520071A (enExample) | |
| GB725751A (en) | 1955-03-09 |
| NL80986C (enExample) | |
| CH317133A (de) | 1956-11-15 |
| US2763636A (en) | 1956-09-18 |
| FR1082731A (fr) | 1954-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1010276B (de) | Verfahren zur Polymerisation von Acrylnitril | |
| DE1300244B (de) | Verfahren zur Herstellung gekoernter wasserloeslicher Polymerisate und Mischpolymerisate | |
| DE2063476B2 (de) | Verfahren zum vernetzen von polymerisaten von acrylamid | |
| DE903033C (de) | Verfahren zum Polymerisieren ungesaettigter Verbindungen in waesserigem Medium | |
| DE3524969C2 (de) | Verfahren zur Herstellung von inversen Mikrolatices und deren Verwendungen | |
| DE907349C (de) | Verfahren zur Suspensions-Polymerisation ungesaettigter organischer Verbindungen, welche eine CH: C <-Gruppe im Molekuel enthalten | |
| DE2029316A1 (de) | Herstellung von Acrylnitrilpolymerlösungen | |
| DE1620839B2 (de) | Verfahren zur Konzentrierung eines wäßrigen Latex l | |
| DE1076372B (de) | Verfahren zur Polymerisation ungesaettigter monomerer organischer Verbindungen in waessriger Emulsion | |
| DE2050723C3 (de) | Verfahren zur Herstellung von Vinylchloridpolymerisaten | |
| DE2703592B2 (de) | Wäßrige Hypochloritlösung | |
| DE2265612C2 (de) | Verfahren zur Herstellung von wäßrigen Dispersionen von Polytetrafluoräthylen | |
| DE1113819B (de) | Verfahren zur Herstellung von Acrylnitrilmischpolymerisaten, die wenigstens 30% eines polymerisierbaren Vinylmonomeren mit einer basischen Aminogruppe enthalten, durch Emulsionspolymerisation | |
| DE1645335A1 (de) | Verfahren zur Herstellung von Polytetrafluoraethylen-Emulsionen | |
| DE1264782B (de) | Verfahren zur Herstellung von perlfoermigen, wasserloeslichen, hochmolekularen Polymerisaten | |
| DE1795705C3 (de) | Verfahren zur Herstellung von hochmolekularen wasserlöslichen PoIyacrylainiden | |
| DE1239679B (de) | Stabilisierung von Acrylsaeureamiden oder alpha-Alkylacrylsaeureamiden gegen Polymerisation | |
| DE1179374B (de) | Verfahren zur Herstellung von Acrylnitril-Polymerisaten | |
| DE1215932B (de) | Verfahren zur Polymerisation von Acrylnitril | |
| DE855161C (de) | Verfahren zur Herstellung von Mischpolymerisaten aus Acrylsaeurenitril und Vinylpyridinen | |
| US3702880A (en) | Method of using a zinc chloride aqueous solution through circulation and of purifying thereof | |
| DE948642C (de) | Verfahren zur Herstellung von Mischpolymerisaten auf Grundlage von Vinylidencyanid | |
| AT271878B (de) | Verfahren zur Herstellung von Vinylchlorid-Polymerisaten | |
| DE2256115A1 (de) | Verfahren zur stabilisierung von acrylamidpolymeren gegen abbau in waesserigen loesungen | |
| DE1420637A1 (de) | Additionspolymere des Formaldehyds mit vorbestimmtem Zahlendurchschnitt-Molekulargewicht und Verfahren zu deren Herstellung |