DD237172A1 - Verfahren zur herstellung von dienpolymeren mit funktionellen endgruppen - Google Patents
Verfahren zur herstellung von dienpolymeren mit funktionellen endgruppen Download PDFInfo
- Publication number
- DD237172A1 DD237172A1 DD24286082A DD24286082A DD237172A1 DD 237172 A1 DD237172 A1 DD 237172A1 DD 24286082 A DD24286082 A DD 24286082A DD 24286082 A DD24286082 A DD 24286082A DD 237172 A1 DD237172 A1 DD 237172A1
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- polymers
- divinylbenzene
- weight
- trilithium
- polymerization
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 2
- 229920000642 polymer Polymers 0.000 claims abstract description 32
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 claims abstract description 28
- 239000003999 initiator Substances 0.000 claims abstract description 19
- 150000001993 dienes Chemical class 0.000 claims abstract description 12
- 239000000203 mixture Substances 0.000 claims abstract description 12
- 238000000034 method Methods 0.000 claims abstract description 10
- 239000000178 monomer Substances 0.000 claims abstract description 9
- 238000002360 preparation method Methods 0.000 claims abstract description 6
- 238000010539 anionic addition polymerization reaction Methods 0.000 claims abstract description 5
- 239000002904 solvent Substances 0.000 claims abstract description 5
- 239000003153 chemical reaction reagent Substances 0.000 claims abstract description 4
- 239000007795 chemical reaction product Substances 0.000 claims abstract description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 15
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 12
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 11
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 8
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 claims description 8
- 238000006116 polymerization reaction Methods 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 6
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical compound CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 claims description 5
- PRJNEUBECVAVAG-UHFFFAOYSA-N 1,3-bis(ethenyl)benzene Chemical compound C=CC1=CC=CC(C=C)=C1 PRJNEUBECVAVAG-UHFFFAOYSA-N 0.000 claims description 4
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 claims description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 4
- -1 of butadiene (1 Chemical class 0.000 claims description 4
- 229920002554 vinyl polymer Polymers 0.000 claims description 4
- WEERVPDNCOGWJF-UHFFFAOYSA-N 1,4-bis(ethenyl)benzene Chemical compound C=CC1=CC=C(C=C)C=C1 WEERVPDNCOGWJF-UHFFFAOYSA-N 0.000 claims description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 3
- MPMBRWOOISTHJV-UHFFFAOYSA-N but-1-enylbenzene Chemical compound CCC=CC1=CC=CC=C1 MPMBRWOOISTHJV-UHFFFAOYSA-N 0.000 claims description 3
- 229910052744 lithium Inorganic materials 0.000 claims description 3
- 239000000725 suspension Substances 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 2
- 239000001569 carbon dioxide Substances 0.000 claims description 2
- 238000007306 functionalization reaction Methods 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims 1
- 238000007334 copolymerization reaction Methods 0.000 claims 1
- 239000004215 Carbon black (E152) Substances 0.000 abstract description 2
- 229920001002 functional polymer Polymers 0.000 abstract description 2
- 229930195733 hydrocarbon Natural products 0.000 abstract description 2
- 150000002430 hydrocarbons Chemical class 0.000 abstract description 2
- 150000002894 organic compounds Chemical class 0.000 abstract 1
- 229920001577 copolymer Polymers 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- HIACAHMKXQESOV-UHFFFAOYSA-N 1,2-bis(prop-1-en-2-yl)benzene Chemical compound CC(=C)C1=CC=CC=C1C(C)=C HIACAHMKXQESOV-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 239000005062 Polybutadiene Substances 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229920002857 polybutadiene Polymers 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 229920006250 telechelic polymer Polymers 0.000 description 2
- LLVWLCAZSOLOTF-UHFFFAOYSA-N 1-methyl-4-[1,4,4-tris(4-methylphenyl)buta-1,3-dienyl]benzene Chemical compound C1=CC(C)=CC=C1C(C=1C=CC(C)=CC=1)=CC=C(C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 LLVWLCAZSOLOTF-UHFFFAOYSA-N 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 150000002900 organolithium compounds Chemical class 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerization Catalysts (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DD24286082A DD237172A1 (de) | 1982-08-30 | 1982-08-30 | Verfahren zur herstellung von dienpolymeren mit funktionellen endgruppen |
| DE19833309748 DE3309748A1 (de) | 1982-07-23 | 1983-03-18 | Verfahren zur herstellung mehrfunktioneller polymerisationsinitiatoren |
| FR8305709A FR2530642B1 (fr) | 1982-07-23 | 1983-04-07 | Procede pour la preparation d'initiateurs de polymerisation multifonctionnels |
| GB08319201A GB2124228B (en) | 1982-07-23 | 1983-07-15 | Organo-lithium polymerization initiator |
| CS836149A CS237289B1 (en) | 1982-08-30 | 1983-08-24 | Processing of polymere diene with ending functional groups |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DD24286082A DD237172A1 (de) | 1982-08-30 | 1982-08-30 | Verfahren zur herstellung von dienpolymeren mit funktionellen endgruppen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD237172A1 true DD237172A1 (de) | 1986-07-02 |
Family
ID=5540905
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD24286082A DD237172A1 (de) | 1982-07-23 | 1982-08-30 | Verfahren zur herstellung von dienpolymeren mit funktionellen endgruppen |
Country Status (2)
| Country | Link |
|---|---|
| CS (1) | CS237289B1 (cs) |
| DD (1) | DD237172A1 (cs) |
-
1982
- 1982-08-30 DD DD24286082A patent/DD237172A1/de unknown
-
1983
- 1983-08-24 CS CS836149A patent/CS237289B1/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CS237289B1 (en) | 1985-07-16 |
| CS614983A1 (en) | 1984-06-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69205931T2 (de) | Copolymere Dispersion in aliphatischen Lösungsmitteln. | |
| DE69410730T2 (de) | Kontinuierliches Verfahren zur in situ anionischen Dispersionspolymerisation | |
| DE2550226C2 (de) | Verzweigte Blockcopolymerisate und Verfahren zu ihrer Herstellung | |
| DE2541511C2 (de) | Verfahren zur Herstellung eines Blockcopolymerengemisches | |
| DE69321086T2 (de) | Verfahren zur Herstellung von in situ Dispersion von Copolymeren | |
| DE60107187T2 (de) | Verfahren zur Herstellung eines Dienelastomers durch anionische Polymerisation | |
| DE3735403A1 (de) | Verzweigte copolymerisate und verfahren zu ihrer herstellung | |
| DE2004282B2 (de) | Verfahren zur Homopolymerisation von Dienen oder zu deren Mischpolymerisation mit monovinylaromatischen Kohlenwasserstoffen | |
| DE69625612T2 (de) | Multifunktioneller organischer alkalimetallinitiator und seine synthese, anionisch polymerisierte sternförmige polymere und ihre herstellung | |
| DE3779953T2 (de) | Initiatorsystem zur polymerisation von 1,3-dienen oder 1,3-diene enthaltenden copolymeren. | |
| DE3309748A1 (de) | Verfahren zur herstellung mehrfunktioneller polymerisationsinitiatoren | |
| DE2239401A1 (de) | Block- bzw. pfropfcopolymere aus polyalkylenoxiden und vinylaromat- oder dienpolymerisaten | |
| EP0904307B1 (de) | Verfahren zur herstellung von hydrophob-hydrophilen ab-blockcopolymeren | |
| DD237172A1 (de) | Verfahren zur herstellung von dienpolymeren mit funktionellen endgruppen | |
| DD236321A1 (de) | Verfahren zur selektiven butadienpolymerisation aus c tief 4 fraktion | |
| DE2406092B2 (de) | Verfahren zur Herstellung von Dienpolymeren mit kettenendständigen funktionellen Gruppen | |
| DD237173A1 (de) | Verfahren zur herstellung von dienpolymeren mit funktionellen endgruppen | |
| DD237171A1 (de) | Verfahren zur herstellung von dienpolymeren mit funktionellen endgruppen | |
| DD237513A1 (de) | Verfahren zur herstellung multifunktioneller 1,3-dienhomo- und copolymerisate | |
| DD237665A1 (de) | Verfahren zur herstellung von dienpolymeren mit funktionellen endgruppen | |
| DE1945025A1 (de) | Polymerisat eines aromatischen Multivinylkohlenwasserstoffs | |
| DD237174A1 (de) | Verfahren zur selektiven butadienpolymerisation aus c tief 4 fraktionen | |
| DE2026433A1 (de) | Verfahren zur Herstellung von Polymeren auf Basis konjugierter Diolefine | |
| DD236320A1 (de) | Verfahren zur herstellung endstaendig funktioneller 1,3-dienhomo- und copolymerisate | |
| DD237668A1 (de) | Verfahren zur selektivpolymerisation von butadien aus c tief 4 fraktionen |