DD210254A5 - Verfahren zur herstellung m-chlorsubstituierter aniline - Google Patents
Verfahren zur herstellung m-chlorsubstituierter aniline Download PDFInfo
- Publication number
- DD210254A5 DD210254A5 DD83254164A DD25416483A DD210254A5 DD 210254 A5 DD210254 A5 DD 210254A5 DD 83254164 A DD83254164 A DD 83254164A DD 25416483 A DD25416483 A DD 25416483A DD 210254 A5 DD210254 A5 DD 210254A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- reaction
- items
- item
- chlorine
- aniline
- Prior art date
Links
- 229910052801 chlorine Inorganic materials 0.000 title claims abstract description 11
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 6
- 239000000460 chlorine Substances 0.000 title claims description 10
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 title description 4
- 238000000034 method Methods 0.000 claims abstract description 30
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims abstract description 19
- 229910000043 hydrogen iodide Inorganic materials 0.000 claims abstract description 17
- -1 m-chloro-substituted anilines Chemical class 0.000 claims abstract description 11
- 150000001448 anilines Chemical class 0.000 claims abstract description 10
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 10
- 238000006243 chemical reaction Methods 0.000 claims description 37
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 12
- 125000001424 substituent group Chemical group 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims description 6
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 239000012736 aqueous medium Substances 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 3
- 239000007858 starting material Substances 0.000 claims 2
- 239000000543 intermediate Substances 0.000 abstract description 8
- 238000002360 preparation method Methods 0.000 abstract description 4
- 239000003905 agrochemical Substances 0.000 abstract 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 description 8
- 239000002609 medium Substances 0.000 description 8
- SDYWXFYBZPNOFX-UHFFFAOYSA-N 3,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1 SDYWXFYBZPNOFX-UHFFFAOYSA-N 0.000 description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 6
- 229910052740 iodine Inorganic materials 0.000 description 6
- 239000011630 iodine Substances 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- BRPSAOUFIJSKOT-UHFFFAOYSA-N 2,3-dichloroaniline Chemical compound NC1=CC=CC(Cl)=C1Cl BRPSAOUFIJSKOT-UHFFFAOYSA-N 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- XOGYQVITULCUGU-UHFFFAOYSA-N 3,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C(Cl)=C1 XOGYQVITULCUGU-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000003849 aromatic solvent Substances 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- DADSZOFTIIETSV-UHFFFAOYSA-N n,n-dichloroaniline Chemical compound ClN(Cl)C1=CC=CC=C1 DADSZOFTIIETSV-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- KHCZSJXTDDHLGJ-UHFFFAOYSA-N 2,3,4,5,6-pentachloroaniline Chemical compound NC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl KHCZSJXTDDHLGJ-UHFFFAOYSA-N 0.000 description 1
- GBKZRUCVLTWAML-UHFFFAOYSA-N 2,3,4,5-tetrachloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C(Cl)=C1Cl GBKZRUCVLTWAML-UHFFFAOYSA-N 0.000 description 1
- MOTBXEPLFOLWHZ-UHFFFAOYSA-N 2,3,5-trichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1Cl MOTBXEPLFOLWHZ-UHFFFAOYSA-N 0.000 description 1
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000006298 dechlorination reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- DQNOIKMHTBFYTD-UHFFFAOYSA-N n,n,2,3-tetrachloroaniline Chemical class ClN(Cl)C1=CC=CC(Cl)=C1Cl DQNOIKMHTBFYTD-UHFFFAOYSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C211/44—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring
- C07C211/45—Monoamines
- C07C211/46—Aniline
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/68—Preparation of compounds containing amino groups bound to a carbon skeleton from amines, by reactions not involving amino groups, e.g. reduction of unsaturated amines, aromatisation, or substitution of the carbon skeleton
- C07C209/74—Preparation of compounds containing amino groups bound to a carbon skeleton from amines, by reactions not involving amino groups, e.g. reduction of unsaturated amines, aromatisation, or substitution of the carbon skeleton by halogenation, hydrohalogenation, dehalogenation, or dehydrohalogenation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8214682A FR2532305A1 (fr) | 1982-08-24 | 1982-08-24 | Procede de preparation d'anilines metachlorees |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD210254A5 true DD210254A5 (de) | 1984-06-06 |
Family
ID=9277076
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD83254164A DD210254A5 (de) | 1982-08-24 | 1983-08-23 | Verfahren zur herstellung m-chlorsubstituierter aniline |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4647700A (OSRAM) |
| EP (1) | EP0102305B1 (OSRAM) |
| JP (1) | JPS5959650A (OSRAM) |
| KR (1) | KR890004781B1 (OSRAM) |
| AT (1) | ATE14113T1 (OSRAM) |
| BR (1) | BR8304556A (OSRAM) |
| CA (1) | CA1209588A (OSRAM) |
| DD (1) | DD210254A5 (OSRAM) |
| DE (1) | DE3360353D1 (OSRAM) |
| DK (1) | DK385683A (OSRAM) |
| ES (1) | ES8404973A1 (OSRAM) |
| FR (1) | FR2532305A1 (OSRAM) |
| HU (1) | HU194156B (OSRAM) |
| IL (1) | IL69370A (OSRAM) |
| ZA (1) | ZA836150B (OSRAM) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5051030A (en) * | 1990-06-05 | 1991-09-24 | Roy F. Weston, Inc. | Chemical detoxification process for treatment of soils contaminated with halogenated organic compounds |
| US9994448B2 (en) * | 2009-11-12 | 2018-06-12 | Iofina Chemical, Inc. | Iodine extraction processes |
| CN103068789B (zh) * | 2010-08-20 | 2015-11-25 | 隆萨有限公司 | 选择性间位氯化烷基苯胺的方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2554733C3 (de) * | 1974-12-17 | 1983-12-15 | Quadrupol AG, Glarus | Kolben-Zylinderanordnung mit Dichtungsschlauch |
| DE2503187C3 (de) * | 1975-01-27 | 1979-05-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung durch Chlor meta-substituierte Aniline |
| FR2403990A1 (fr) * | 1977-09-22 | 1979-04-20 | Philagro Sa | Procede de deshalogenation d'amines aromatiques halogenees |
| FR2403991A1 (fr) * | 1977-09-22 | 1979-04-20 | Philagro Sa | Procede de deshalogenation d'amines aromatiques halogenees |
| FR2449076A2 (fr) * | 1979-02-15 | 1980-09-12 | Rhone Poulenc Agrochimie | Procede de preparation d'anilines metachlorees |
| FR2449075A1 (fr) * | 1979-02-15 | 1980-09-12 | Rhone Poulenc Agrochimie | Procede de preparation d'anilines metachlorees |
| IL63297A (en) * | 1980-08-01 | 1984-05-31 | Rhone Poulenc Agrochimie | Selective preparation of meta-chloroanilines |
| DE3042242A1 (de) * | 1980-11-08 | 1982-06-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von m-halogensubstituierten anilinen |
-
1982
- 1982-08-24 FR FR8214682A patent/FR2532305A1/fr active Granted
-
1983
- 1983-07-29 IL IL69370A patent/IL69370A/xx unknown
- 1983-08-11 EP EP83420139A patent/EP0102305B1/fr not_active Expired
- 1983-08-11 DE DE8383420139T patent/DE3360353D1/de not_active Expired
- 1983-08-11 AT AT83420139T patent/ATE14113T1/de not_active IP Right Cessation
- 1983-08-19 ZA ZA836150A patent/ZA836150B/xx unknown
- 1983-08-19 CA CA000434961A patent/CA1209588A/en not_active Expired
- 1983-08-23 DK DK385683A patent/DK385683A/da not_active Application Discontinuation
- 1983-08-23 KR KR1019830003939A patent/KR890004781B1/ko not_active Expired
- 1983-08-23 BR BR8304556A patent/BR8304556A/pt not_active IP Right Cessation
- 1983-08-23 DD DD83254164A patent/DD210254A5/de unknown
- 1983-08-23 ES ES525114A patent/ES8404973A1/es not_active Expired
- 1983-08-23 JP JP58154021A patent/JPS5959650A/ja active Pending
- 1983-08-24 HU HU832976A patent/HU194156B/hu unknown
-
1985
- 1985-09-26 US US06/780,212 patent/US4647700A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ES525114A0 (es) | 1984-05-16 |
| ZA836150B (en) | 1984-04-25 |
| KR840006193A (ko) | 1984-11-22 |
| IL69370A0 (en) | 1983-11-30 |
| KR890004781B1 (ko) | 1989-11-27 |
| ATE14113T1 (de) | 1985-07-15 |
| JPS5959650A (ja) | 1984-04-05 |
| US4647700A (en) | 1987-03-03 |
| BR8304556A (pt) | 1984-04-03 |
| FR2532305B1 (OSRAM) | 1984-12-07 |
| DK385683D0 (da) | 1983-08-23 |
| CA1209588A (en) | 1986-08-12 |
| EP0102305A1 (fr) | 1984-03-07 |
| FR2532305A1 (fr) | 1984-03-02 |
| EP0102305B1 (fr) | 1985-07-03 |
| DK385683A (da) | 1984-02-25 |
| DE3360353D1 (en) | 1985-08-08 |
| HU194156B (en) | 1988-01-28 |
| ES8404973A1 (es) | 1984-05-16 |
| IL69370A (en) | 1988-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69813312T2 (de) | Verfahren zur herstellung von cyclopropylethyn sowie zwischenprodukte zur herstellung von cyclopropylethyn | |
| DE2503187C3 (de) | Verfahren zur Herstellung durch Chlor meta-substituierte Aniline | |
| DE2549900A1 (de) | Chlorierte aromatische amine | |
| DE1193510B (de) | Verfahren zur Herstellung von Brom-derivaten des Diphenyls, Diphenylaethers, Diphenylphenylaethers oder Di-, Tri- bzw. Tetraphenylmethans mit 4 und mehr Bromatomen je Molkuel | |
| DE2546532C2 (de) | Verfahren zur Herstellung von Trichlormethyl-trifluormethylbenzolen | |
| DE2437882C3 (de) | Verfahren zur Herstellung von Estern des 3-Phenoxybenzylalkohols | |
| EP0302326B1 (de) | Verfahren zur Herstellung von mit Fluor und gegebenenfalls zusätzlich Chlor substituierten Benzotrifluoriden und neue Benzotrifluoride | |
| DD210254A5 (de) | Verfahren zur herstellung m-chlorsubstituierter aniline | |
| EP0057861B1 (de) | Verfahren zur Herstellung von Nitroanilinen | |
| EP0037548B1 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethylpiperidon-4 | |
| DE3836175A1 (de) | Fluor enthaltende phenole | |
| DE2548970C3 (de) | Verfahren zur Herstellung von Trichlormethyl-trifluormethyl-benzolen | |
| EP0136566B1 (de) | Verfahren zur Herstellung von 3,4-Dichlorbenzotrihalogeniden | |
| EP0551632B1 (de) | Verfahren zur Herstellung von Halogenanthranilsäuren | |
| DE2604276C2 (de) | Verfahren zur α-Monochlorierung kernchlorierter Toluole | |
| DE1123663B (de) | Verfahren zur Herstellung von hochchlorierten Arylsulfiden | |
| EP0173201B1 (de) | Verfahren zur Herstellung aromatischer Bromverbindungen | |
| EP0051782B1 (de) | Verfahren zur Herstellung von m-halogensubstituierten Anilinen | |
| EP1223158A1 (de) | Verfahren zur Herstellung trifluormethyl-substituierter Biphenylcarbonsäuren und neue trichlormethyl- und trifluormethyl-substituierte Biphenylcarbonitrile | |
| DD201673A5 (de) | Verfahren zur selektiven herstellung m-chlorierter aniline | |
| EP0069907B1 (de) | Verfahren zur Herstellung von m-chlorsubstituierten Anilinen | |
| DE2804263A1 (de) | Verfahren zur herstellung von indolin-derivaten | |
| DE2648644B2 (de) | Verfahren zur Herstellung von 4-Phenoxy-phenolen | |
| DE1101410B (de) | Verfahren zur Herstellung von Polyhalogenadamantanen | |
| DD236520A5 (de) | Verfahren zur herstellung von chlor-o-nitroanilinen |