DD200795A5 - Verfahren zur herstellung von diphenylaether-derivaten - Google Patents
Verfahren zur herstellung von diphenylaether-derivaten Download PDFInfo
- Publication number
- DD200795A5 DD200795A5 DD81231661A DD23166181A DD200795A5 DD 200795 A5 DD200795 A5 DD 200795A5 DD 81231661 A DD81231661 A DD 81231661A DD 23166181 A DD23166181 A DD 23166181A DD 200795 A5 DD200795 A5 DD 200795A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- formula
- advantageously
- phenoxy
- copper
- benzyl
- Prior art date
Links
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 title claims abstract description 7
- 238000004519 manufacturing process Methods 0.000 title description 2
- 238000000034 method Methods 0.000 claims abstract description 21
- -1 alkali metal phenolate Chemical class 0.000 claims abstract description 9
- 230000007062 hydrolysis Effects 0.000 claims abstract description 7
- 238000006460 hydrolysis reaction Methods 0.000 claims abstract description 7
- 150000002148 esters Chemical class 0.000 claims abstract description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 5
- 238000002360 preparation method Methods 0.000 claims abstract description 5
- 125000004185 ester group Chemical group 0.000 claims abstract description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 30
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 239000008096 xylene Substances 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 6
- 230000015572 biosynthetic process Effects 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 229910021591 Copper(I) chloride Inorganic materials 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 4
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 claims description 4
- 239000000155 melt Substances 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 238000006266 etherification reaction Methods 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- ZGJADVGJIVEEGF-UHFFFAOYSA-M potassium;phenoxide Chemical compound [K+].[O-]C1=CC=CC=C1 ZGJADVGJIVEEGF-UHFFFAOYSA-M 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 claims description 2
- 101100440696 Caenorhabditis elegans cor-1 gene Proteins 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 150000001298 alcohols Chemical class 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 238000006555 catalytic reaction Methods 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000000547 substituted alkyl group Chemical group 0.000 claims 1
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 abstract description 6
- 229940031826 phenolate Drugs 0.000 abstract description 4
- 239000011541 reaction mixture Substances 0.000 description 24
- 239000000243 solution Substances 0.000 description 24
- 238000009835 boiling Methods 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 239000012074 organic phase Substances 0.000 description 9
- 238000001816 cooling Methods 0.000 description 8
- 229940022663 acetate Drugs 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- FSWNRRSWFBXQCL-UHFFFAOYSA-N (3-bromophenyl)methanol Chemical compound OCC1=CC=CC(Br)=C1 FSWNRRSWFBXQCL-UHFFFAOYSA-N 0.000 description 5
- LKRBJGQCGJSSSX-UHFFFAOYSA-N (3-bromophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=CC(Br)=C1 LKRBJGQCGJSSSX-UHFFFAOYSA-N 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- QUKGYYKBILRGFE-UHFFFAOYSA-N benzyl acetate Chemical compound CC(=O)OCC1=CC=CC=C1 QUKGYYKBILRGFE-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- XPHQNMNGUGOWGU-UHFFFAOYSA-N (3-phenoxyphenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 XPHQNMNGUGOWGU-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Substances OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 229960004217 benzyl alcohol Drugs 0.000 description 3
- 150000001879 copper Chemical class 0.000 description 3
- 230000026030 halogenation Effects 0.000 description 3
- 238000005658 halogenation reaction Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- ZSRDNPVYGSFUMD-UHFFFAOYSA-N (3-chlorophenyl)methanol Chemical compound OCC1=CC=CC(Cl)=C1 ZSRDNPVYGSFUMD-UHFFFAOYSA-N 0.000 description 2
- XLMVMSDHBQJNTL-UHFFFAOYSA-N (3-chlorophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=CC(Cl)=C1 XLMVMSDHBQJNTL-UHFFFAOYSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- UDONPJKEOAWFGI-UHFFFAOYSA-N 1-methyl-3-phenoxybenzene Chemical compound CC1=CC=CC(OC=2C=CC=CC=2)=C1 UDONPJKEOAWFGI-UHFFFAOYSA-N 0.000 description 2
- OKVJCVWFVRATSG-UHFFFAOYSA-N 3-hydroxybenzyl alcohol Chemical compound OCC1=CC=CC(O)=C1 OKVJCVWFVRATSG-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229940007550 benzyl acetate Drugs 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- SUISZCALMBHJQX-UHFFFAOYSA-N 3-bromobenzaldehyde Chemical compound BrC1=CC=CC(C=O)=C1 SUISZCALMBHJQX-UHFFFAOYSA-N 0.000 description 1
- 125000006279 3-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Br)=C1[H])C([H])([H])* 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- OUIXENXOUKVZBO-UHFFFAOYSA-N 3-hydroxybenzyl acetate Chemical compound CC(=O)OCC1=CC=CC(O)=C1 OUIXENXOUKVZBO-UHFFFAOYSA-N 0.000 description 1
- WRFWTYGMKIUAKL-UHFFFAOYSA-N 3-methylphenol Chemical compound CC1=CC=CC(O)=C1.CC1=CC=CC(O)=C1 WRFWTYGMKIUAKL-UHFFFAOYSA-N 0.000 description 1
- 229920000557 Nafion® Polymers 0.000 description 1
- USWIQSJKSYQJHX-UHFFFAOYSA-N [phenoxy(phenyl)methyl] acetate Chemical compound C=1C=CC=CC=1C(OC(=O)C)OC1=CC=CC=C1 USWIQSJKSYQJHX-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000005553 drilling Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000005171 halobenzenes Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- ARJOQCYCJMAIFR-UHFFFAOYSA-N prop-2-enoyl prop-2-enoate Chemical compound C=CC(=O)OC(=O)C=C ARJOQCYCJMAIFR-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/257—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings
- C07C43/263—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings the aromatic rings being non-condensed
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/14—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of a —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/257—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings
- C07C43/295—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings containing hydroxy or O-metal groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU801719A HU181737B (en) | 1980-07-10 | 1980-07-10 | Process for preparing diphenyl-ether derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD200795A5 true DD200795A5 (de) | 1983-06-15 |
Family
ID=10955841
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD81231661A DD200795A5 (de) | 1980-07-10 | 1981-07-10 | Verfahren zur herstellung von diphenylaether-derivaten |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4709081A (enExample) |
| JP (1) | JPS5740431A (enExample) |
| AU (1) | AU542642B2 (enExample) |
| BR (1) | BR8104406A (enExample) |
| CA (1) | CA1202319A (enExample) |
| CH (1) | CH650488A5 (enExample) |
| CS (1) | CS221849B2 (enExample) |
| DD (1) | DD200795A5 (enExample) |
| DE (1) | DE3126429A1 (enExample) |
| ES (1) | ES8204711A1 (enExample) |
| FR (1) | FR2486526B1 (enExample) |
| GB (1) | GB2080799B (enExample) |
| HU (1) | HU181737B (enExample) |
| IE (1) | IE51362B1 (enExample) |
| IT (1) | IT1144742B (enExample) |
| NL (1) | NL8103280A (enExample) |
| PL (1) | PL132134B1 (enExample) |
| SU (1) | SU1209025A3 (enExample) |
| YU (1) | YU42413B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HUT39077A (en) * | 1985-01-08 | 1986-08-28 | Chinoin Gyogyszer Es Vegyeszet | Process for production of piretroids |
| GB8728064D0 (en) * | 1987-12-01 | 1988-01-06 | Shell Int Research | Process for preparation of substituted phenoxy propanoic acids |
| WO1999018057A1 (en) * | 1997-10-06 | 1999-04-15 | Massachusetts Institute Of Technology | Preparation of diaryl ether by condensation reactions |
| KR20230044470A (ko) * | 2020-08-28 | 2023-04-04 | 닛뽕 케미파 가부시키가이샤 | 신규한 구리 촉매를 사용하여 디아릴 에테르 골격을 갖는 모르피난 유도체를 제조하는 방법 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4861443A (enExample) * | 1971-12-03 | 1973-08-28 | ||
| SE419538B (sv) * | 1973-10-29 | 1981-08-10 | Eisai Co Ltd | Analogiforfaranden for framstellning av 2-(n-fenoxfenyl)-propionsyraderivat |
| DE2707232A1 (de) * | 1977-02-19 | 1978-08-24 | Bayer Ag | Verfahren zur herstellung halogenmethylierter diphenylaether |
| GB1579151A (en) * | 1977-06-04 | 1980-11-12 | Croda Synthetic Chem Ltd | Preparation of diphenyl ether compounds |
| GB2010837B (en) * | 1977-12-22 | 1982-07-28 | Croda Synthetic Chem Ltd | Process for preparing aralkyl halides |
-
1980
- 1980-07-10 HU HU801719A patent/HU181737B/hu unknown
-
1981
- 1981-06-30 IE IE1469/81A patent/IE51362B1/en not_active IP Right Cessation
- 1981-07-04 DE DE3126429A patent/DE3126429A1/de not_active Withdrawn
- 1981-07-08 YU YU1677/81A patent/YU42413B/xx unknown
- 1981-07-08 FR FR8113435A patent/FR2486526B1/fr not_active Expired
- 1981-07-08 IT IT67944/81A patent/IT1144742B/it active
- 1981-07-08 PL PL1981232106A patent/PL132134B1/pl unknown
- 1981-07-09 CH CH4518/81A patent/CH650488A5/de not_active IP Right Cessation
- 1981-07-09 BR BR8104406A patent/BR8104406A/pt unknown
- 1981-07-09 GB GB8121207A patent/GB2080799B/en not_active Expired
- 1981-07-09 AU AU72715/81A patent/AU542642B2/en not_active Ceased
- 1981-07-09 CS CS815296A patent/CS221849B2/cs unknown
- 1981-07-09 JP JP56106322A patent/JPS5740431A/ja active Granted
- 1981-07-09 SU SU813306783A patent/SU1209025A3/ru active
- 1981-07-09 NL NL8103280A patent/NL8103280A/nl not_active Application Discontinuation
- 1981-07-10 ES ES504338A patent/ES8204711A1/es not_active Expired
- 1981-07-10 DD DD81231661A patent/DD200795A5/de not_active IP Right Cessation
- 1981-07-13 CA CA000381574A patent/CA1202319A/en not_active Expired
-
1985
- 1985-09-26 US US06/781,303 patent/US4709081A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| IE811469L (en) | 1982-01-10 |
| CA1202319A (en) | 1986-03-25 |
| HU181737B (en) | 1983-11-28 |
| IT8167944A0 (it) | 1981-07-08 |
| YU42413B (en) | 1988-08-31 |
| PL132134B1 (en) | 1985-02-28 |
| BR8104406A (pt) | 1982-03-30 |
| ES504338A0 (es) | 1982-06-01 |
| IE51362B1 (en) | 1986-12-10 |
| PL232106A1 (enExample) | 1982-03-29 |
| YU167781A (en) | 1983-10-31 |
| FR2486526A1 (fr) | 1982-01-15 |
| SU1209025A3 (ru) | 1986-01-30 |
| JPH0131495B2 (enExample) | 1989-06-26 |
| GB2080799A (en) | 1982-02-10 |
| AU542642B2 (en) | 1985-02-28 |
| CS221849B2 (en) | 1983-04-29 |
| US4709081A (en) | 1987-11-24 |
| AU7271581A (en) | 1982-01-14 |
| FR2486526B1 (fr) | 1986-04-04 |
| ES8204711A1 (es) | 1982-06-01 |
| DE3126429A1 (de) | 1982-06-03 |
| IT1144742B (it) | 1986-10-29 |
| NL8103280A (nl) | 1982-02-01 |
| CH650488A5 (de) | 1985-07-31 |
| GB2080799B (en) | 1984-05-31 |
| JPS5740431A (en) | 1982-03-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3322459C2 (enExample) | ||
| DE3038636C2 (enExample) | ||
| EP0176026B1 (de) | Verfahren zur Herstellung von 2,4-Dichlor-5-fluor-benzoesäure | |
| EP0002460B1 (de) | Verfahren zur Herstellung von 3,4-Methylendioxymandelsäure | |
| DE1947264C3 (de) | Phosphorsäurepolycarboxytriphenylester und Verfahren zu deren Herstellung | |
| DD200795A5 (de) | Verfahren zur herstellung von diphenylaether-derivaten | |
| DD215529A5 (de) | Verfahren zur herstellung von cyclohexandionderivaten | |
| EP1301494A1 (de) | Verfahren zur herstellung von 2-alkyl-3-aryl- und -heteroaryloxaziridinen und neue 2-alkyl-3-aryloxaziridine | |
| DE2950608C2 (enExample) | ||
| DE19704885C1 (de) | Verfahren zur Herstellung von 3-Hydroxy-2-methylbenzoesäure und 3-Acetoxy-2-methylbenzoesäure | |
| EP0741123B1 (de) | Verfahren zur Herstellung von Salzen substituierter oder unsubstituierter Phthalsäure-Derivate | |
| CH627727A5 (en) | Process for the preparation of phenylalkylcarboxylic acids | |
| DE3003457C2 (enExample) | ||
| DE1768114A1 (de) | Verfahren zur Herstellung von alpha-Ketoglutarsaeure | |
| DE3437634A1 (de) | Verfahren zur herstellung von gegebenenfalls substituierter zimtsaeure in gegenwart eines katalysators | |
| WO2001096277A1 (de) | Verfahren zur herstellung von 2,3,4,6-tetramethylmandelsäure und 2,3,4,6-tetramethylmandelsäureacetat | |
| DE3636818A1 (de) | Verfahren zur herstellung von valpronsaeure | |
| DE2912052A1 (de) | Verfahren zur herstellung von 2eckige klammer auf 4-(thienylcarbonyl)phenyl eckige klammer zu -propionsaeure | |
| DE2524836C2 (de) | Verfahren zur Herstellung von 3-Chlor-4-hydroxyphenylessigsäure | |
| DE2407187B2 (de) | Verfahren zur Herstellung von aromatischen Hydroxycarbonsäurealkylestern | |
| DE2165219C3 (de) | Verfahren zur Herstellung von Sorbinsäure | |
| DE960722C (de) | Verfahren zur Herstellung von Serinen aus Glykokoll und Aldehyden | |
| DE2261616A1 (de) | Verfahren zur herstellung von organischen aldehyden | |
| DE2166727A1 (de) | Cyclopropanderivate | |
| CH646430A5 (de) | Verfahren zur herstellung von naphtholactonen. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ENJ | Ceased due to non-payment of renewal fee |